index.editor.js

var Godot = (() => {
  var _scriptDir = typeof document !== 'undefined' && document.currentScript ? document.currentScript.src : undefined;
  
  return (
function(moduleArg = {}) {

// include: shell.js
// The Module object: Our interface to the outside world. We import
// and export values on it. There are various ways Module can be used:
// 1. Not defined. We create it here
// 2. A function parameter, function(Module) { ..generated code.. }
// 3. pre-run appended it, var Module = {}; ..generated code..
// 4. External script tag defines var Module.
// We need to check if Module already exists (e.g. case 3 above).
// Substitution will be replaced with actual code on later stage of the build,
// this way Closure Compiler will not mangle it (e.g. case 4. above).
// Note that if you want to run closure, and also to use Module
// after the generated code, you will need to define   var Module = {};
// before the code. Then that object will be used in the code, and you
// can continue to use Module afterwards as well.
var Module = moduleArg;

// Set up the promise that indicates the Module is initialized
var readyPromiseResolve, readyPromiseReject;
Module['ready'] = new Promise((resolve, reject) => {
  readyPromiseResolve = resolve;
  readyPromiseReject = reject;
});
["_main","_memory","___indirect_function_table","__Z14godot_web_mainiPPc","_fflush","__emwebxr_on_input_event","__emwebxr_on_simple_event","onRuntimeInitialized"].forEach((prop) => {
  if (!Object.getOwnPropertyDescriptor(Module['ready'], prop)) {
    Object.defineProperty(Module['ready'], prop, {
      get: () => abort('You are getting ' + prop + ' on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js'),
      set: () => abort('You are setting ' + prop + ' on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js'),
    });
  }
});

// --pre-jses are emitted after the Module integration code, so that they can
// refer to Module (if they choose; they can also define Module)


// Sometimes an existing Module object exists with properties
// meant to overwrite the default module functionality. Here
// we collect those properties and reapply _after_ we configure
// the current environment's defaults to avoid having to be so
// defensive during initialization.
var moduleOverrides = Object.assign({}, Module);

var arguments_ = [];
var thisProgram = './this.program';
var quit_ = (status, toThrow) => {
  throw toThrow;
};

// Determine the runtime environment we are in. You can customize this by
// setting the ENVIRONMENT setting at compile time (see settings.js).

// Attempt to auto-detect the environment
var ENVIRONMENT_IS_WEB = typeof window == 'object';
var ENVIRONMENT_IS_WORKER = typeof importScripts == 'function';
// N.b. Electron.js environment is simultaneously a NODE-environment, but
// also a web environment.
var ENVIRONMENT_IS_NODE = typeof process == 'object' && typeof process.versions == 'object' && typeof process.versions.node == 'string';
var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;

if (Module['ENVIRONMENT']) {
  throw new Error('Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -sENVIRONMENT=web or -sENVIRONMENT=node)');
}

// `/` should be present at the end if `scriptDirectory` is not empty
var scriptDirectory = '';
function locateFile(path) {
  if (Module['locateFile']) {
    return Module['locateFile'](path, scriptDirectory);
  }
  return scriptDirectory + path;
}

// Hooks that are implemented differently in different runtime environments.
var read_,
    readAsync,
    readBinary,
    setWindowTitle;

if (ENVIRONMENT_IS_SHELL) {

  if ((typeof process == 'object' && typeof require === 'function') || typeof window == 'object' || typeof importScripts == 'function') throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)');

  if (typeof read != 'undefined') {
    read_ = read;
  }

  readBinary = (f) => {
    if (typeof readbuffer == 'function') {
      return new Uint8Array(readbuffer(f));
    }
    let data = read(f, 'binary');
    assert(typeof data == 'object');
    return data;
  };

  readAsync = (f, onload, onerror) => {
    setTimeout(() => onload(readBinary(f)));
  };

  if (typeof clearTimeout == 'undefined') {
    globalThis.clearTimeout = (id) => {};
  }

  if (typeof setTimeout == 'undefined') {
    // spidermonkey lacks setTimeout but we use it above in readAsync.
    globalThis.setTimeout = (f) => (typeof f == 'function') ? f() : abort();
  }

  if (typeof scriptArgs != 'undefined') {
    arguments_ = scriptArgs;
  } else if (typeof arguments != 'undefined') {
    arguments_ = arguments;
  }

  if (typeof quit == 'function') {
    quit_ = (status, toThrow) => {
      // Unlike node which has process.exitCode, d8 has no such mechanism. So we
      // have no way to set the exit code and then let the program exit with
      // that code when it naturally stops running (say, when all setTimeouts
      // have completed). For that reason, we must call `quit` - the only way to
      // set the exit code - but quit also halts immediately.  To increase
      // consistency with node (and the web) we schedule the actual quit call
      // using a setTimeout to give the current stack and any exception handlers
      // a chance to run.  This enables features such as addOnPostRun (which
      // expected to be able to run code after main returns).
      setTimeout(() => {
        if (!(toThrow instanceof ExitStatus)) {
          let toLog = toThrow;
          if (toThrow && typeof toThrow == 'object' && toThrow.stack) {
            toLog = [toThrow, toThrow.stack];
          }
          err(`exiting due to exception: ${toLog}`);
        }
        quit(status);
      });
      throw toThrow;
    };
  }

  if (typeof print != 'undefined') {
    // Prefer to use print/printErr where they exist, as they usually work better.
    if (typeof console == 'undefined') console = /** @type{!Console} */({});
    console.log = /** @type{!function(this:Console, ...*): undefined} */ (print);
    console.warn = console.error = /** @type{!function(this:Console, ...*): undefined} */ (typeof printErr != 'undefined' ? printErr : print);
  }

} else

// Note that this includes Node.js workers when relevant (pthreads is enabled).
// Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and
// ENVIRONMENT_IS_NODE.
if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
  if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled
    scriptDirectory = self.location.href;
  } else if (typeof document != 'undefined' && document.currentScript) { // web
    scriptDirectory = document.currentScript.src;
  }
  // When MODULARIZE, this JS may be executed later, after document.currentScript
  // is gone, so we saved it, and we use it here instead of any other info.
  if (_scriptDir) {
    scriptDirectory = _scriptDir;
  }
  // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them.
  // otherwise, slice off the final part of the url to find the script directory.
  // if scriptDirectory does not contain a slash, lastIndexOf will return -1,
  // and scriptDirectory will correctly be replaced with an empty string.
  // If scriptDirectory contains a query (starting with ?) or a fragment (starting with #),
  // they are removed because they could contain a slash.
  if (scriptDirectory.indexOf('blob:') !== 0) {
    scriptDirectory = scriptDirectory.substr(0, scriptDirectory.replace(/[?#].*/, "").lastIndexOf('/')+1);
  } else {
    scriptDirectory = '';
  }

  if (!(typeof window == 'object' || typeof importScripts == 'function')) throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)');

  // Differentiate the Web Worker from the Node Worker case, as reading must
  // be done differently.
  {
// include: web_or_worker_shell_read.js
read_ = (url) => {
    var xhr = new XMLHttpRequest();
    xhr.open('GET', url, false);
    xhr.send(null);
    return xhr.responseText;
  }

  if (ENVIRONMENT_IS_WORKER) {
    readBinary = (url) => {
      var xhr = new XMLHttpRequest();
      xhr.open('GET', url, false);
      xhr.responseType = 'arraybuffer';
      xhr.send(null);
      return new Uint8Array(/** @type{!ArrayBuffer} */(xhr.response));
    };
  }

  readAsync = (url, onload, onerror) => {
    var xhr = new XMLHttpRequest();
    xhr.open('GET', url, true);
    xhr.responseType = 'arraybuffer';
    xhr.onload = () => {
      if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
        onload(xhr.response);
        return;
      }
      onerror();
    };
    xhr.onerror = onerror;
    xhr.send(null);
  }

// end include: web_or_worker_shell_read.js
  }

  setWindowTitle = (title) => document.title = title;
} else
{
  throw new Error('environment detection error');
}

var out = Module['print'] || console.log.bind(console);
var err = Module['printErr'] || console.error.bind(console);

// Merge back in the overrides
Object.assign(Module, moduleOverrides);
// Free the object hierarchy contained in the overrides, this lets the GC
// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
moduleOverrides = null;
checkIncomingModuleAPI();

// Emit code to handle expected values on the Module object. This applies Module.x
// to the proper local x. This has two benefits: first, we only emit it if it is
// expected to arrive, and second, by using a local everywhere else that can be
// minified.

if (Module['arguments']) arguments_ = Module['arguments'];legacyModuleProp('arguments', 'arguments_');

if (Module['thisProgram']) thisProgram = Module['thisProgram'];legacyModuleProp('thisProgram', 'thisProgram');

if (Module['quit']) quit_ = Module['quit'];legacyModuleProp('quit', 'quit_');

// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message
// Assertions on removed incoming Module JS APIs.
assert(typeof Module['memoryInitializerPrefixURL'] == 'undefined', 'Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead');
assert(typeof Module['pthreadMainPrefixURL'] == 'undefined', 'Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead');
assert(typeof Module['cdInitializerPrefixURL'] == 'undefined', 'Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead');
assert(typeof Module['filePackagePrefixURL'] == 'undefined', 'Module.filePackagePrefixURL option was removed, use Module.locateFile instead');
assert(typeof Module['read'] == 'undefined', 'Module.read option was removed (modify read_ in JS)');
assert(typeof Module['readAsync'] == 'undefined', 'Module.readAsync option was removed (modify readAsync in JS)');
assert(typeof Module['readBinary'] == 'undefined', 'Module.readBinary option was removed (modify readBinary in JS)');
assert(typeof Module['setWindowTitle'] == 'undefined', 'Module.setWindowTitle option was removed (modify setWindowTitle in JS)');
assert(typeof Module['TOTAL_MEMORY'] == 'undefined', 'Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY');
legacyModuleProp('asm', 'wasmExports');
legacyModuleProp('read', 'read_');
legacyModuleProp('readAsync', 'readAsync');
legacyModuleProp('readBinary', 'readBinary');
legacyModuleProp('setWindowTitle', 'setWindowTitle');

var PROXYFS = 'PROXYFS is no longer included by default; build with -lproxyfs.js';
var WORKERFS = 'WORKERFS is no longer included by default; build with -lworkerfs.js';
var NODEFS = 'NODEFS is no longer included by default; build with -lnodefs.js';

assert(!ENVIRONMENT_IS_NODE, "node environment detected but not enabled at build time.  Add 'node' to `-sENVIRONMENT` to enable.");

assert(!ENVIRONMENT_IS_SHELL, "shell environment detected but not enabled at build time.  Add 'shell' to `-sENVIRONMENT` to enable.");


// end include: shell.js
// include: preamble.js
// === Preamble library stuff ===

// Documentation for the public APIs defined in this file must be updated in:
//    site/source/docs/api_reference/preamble.js.rst
// A prebuilt local version of the documentation is available at:
//    site/build/text/docs/api_reference/preamble.js.txt
// You can also build docs locally as HTML or other formats in site/
// An online HTML version (which may be of a different version of Emscripten)
//    is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html

var wasmBinary;
if (Module['wasmBinary']) wasmBinary = Module['wasmBinary'];legacyModuleProp('wasmBinary', 'wasmBinary');
var noExitRuntime = Module['noExitRuntime'] || false;legacyModuleProp('noExitRuntime', 'noExitRuntime');

if (typeof WebAssembly != 'object') {
  abort('no native wasm support detected');
}

// Wasm globals

var wasmMemory;
var wasmExports;

//========================================
// Runtime essentials
//========================================

// whether we are quitting the application. no code should run after this.
// set in exit() and abort()
var ABORT = false;

// set by exit() and abort().  Passed to 'onExit' handler.
// NOTE: This is also used as the process return code code in shell environments
// but only when noExitRuntime is false.
var EXITSTATUS;

/** @type {function(*, string=)} */
function assert(condition, text) {
  if (!condition) {
    abort('Assertion failed' + (text ? ': ' + text : ''));
  }
}

// We used to include malloc/free by default in the past. Show a helpful error in
// builds with assertions.

// Memory management

var HEAP,
/** @type {!Int8Array} */
  HEAP8,
/** @type {!Uint8Array} */
  HEAPU8,
/** @type {!Int16Array} */
  HEAP16,
/** @type {!Uint16Array} */
  HEAPU16,
/** @type {!Int32Array} */
  HEAP32,
/** @type {!Uint32Array} */
  HEAPU32,
/** @type {!Float32Array} */
  HEAPF32,
/** @type {!Float64Array} */
  HEAPF64;

function updateMemoryViews() {
  var b = wasmMemory.buffer;
  Module['HEAP8'] = HEAP8 = new Int8Array(b);
  Module['HEAP16'] = HEAP16 = new Int16Array(b);
  Module['HEAP32'] = HEAP32 = new Int32Array(b);
  Module['HEAPU8'] = HEAPU8 = new Uint8Array(b);
  Module['HEAPU16'] = HEAPU16 = new Uint16Array(b);
  Module['HEAPU32'] = HEAPU32 = new Uint32Array(b);
  Module['HEAPF32'] = HEAPF32 = new Float32Array(b);
  Module['HEAPF64'] = HEAPF64 = new Float64Array(b);
}

assert(!Module['STACK_SIZE'], 'STACK_SIZE can no longer be set at runtime.  Use -sSTACK_SIZE at link time')

assert(typeof Int32Array != 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray != undefined && Int32Array.prototype.set != undefined,
       'JS engine does not provide full typed array support');

// If memory is defined in wasm, the user can't provide it, or set INITIAL_MEMORY
assert(!Module['wasmMemory'], 'Use of `wasmMemory` detected.  Use -sIMPORTED_MEMORY to define wasmMemory externally');
assert(!Module['INITIAL_MEMORY'], 'Detected runtime INITIAL_MEMORY setting.  Use -sIMPORTED_MEMORY to define wasmMemory dynamically');

// include: runtime_init_table.js
// In regular non-RELOCATABLE mode the table is exported
// from the wasm module and this will be assigned once
// the exports are available.
var wasmTable;
// end include: runtime_init_table.js
// include: runtime_stack_check.js
// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
function writeStackCookie() {
  var max = _emscripten_stack_get_end();
  assert((max & 3) == 0);
  // If the stack ends at address zero we write our cookies 4 bytes into the
  // stack.  This prevents interference with SAFE_HEAP and ASAN which also
  // monitor writes to address zero.
  if (max == 0) {
    max += 4;
  }
  // The stack grow downwards towards _emscripten_stack_get_end.
  // We write cookies to the final two words in the stack and detect if they are
  // ever overwritten.
  HEAPU32[((max)>>2)] = 0x02135467;
  HEAPU32[(((max)+(4))>>2)] = 0x89BACDFE;
  // Also test the global address 0 for integrity.
  HEAPU32[((0)>>2)] = 1668509029;
}

function checkStackCookie() {
  if (ABORT) return;
  var max = _emscripten_stack_get_end();
  // See writeStackCookie().
  if (max == 0) {
    max += 4;
  }
  var cookie1 = HEAPU32[((max)>>2)];
  var cookie2 = HEAPU32[(((max)+(4))>>2)];
  if (cookie1 != 0x02135467 || cookie2 != 0x89BACDFE) {
    abort(`Stack overflow! Stack cookie has been overwritten at ${ptrToString(max)}, expected hex dwords 0x89BACDFE and 0x2135467, but received ${ptrToString(cookie2)} ${ptrToString(cookie1)}`);
  }
  // Also test the global address 0 for integrity.
  if (HEAPU32[((0)>>2)] != 0x63736d65 /* 'emsc' */) {
    abort('Runtime error: The application has corrupted its heap memory area (address zero)!');
  }
}
// end include: runtime_stack_check.js
// include: runtime_assertions.js
// Endianness check
(function() {
  var h16 = new Int16Array(1);
  var h8 = new Int8Array(h16.buffer);
  h16[0] = 0x6373;
  if (h8[0] !== 0x73 || h8[1] !== 0x63) throw 'Runtime error: expected the system to be little-endian! (Run with -sSUPPORT_BIG_ENDIAN to bypass)';
})();

// end include: runtime_assertions.js
var __ATPRERUN__  = []; // functions called before the runtime is initialized
var __ATINIT__    = []; // functions called during startup
var __ATMAIN__    = []; // functions called when main() is to be run
var __ATEXIT__    = []; // functions called during shutdown
var __ATPOSTRUN__ = []; // functions called after the main() is called

var runtimeInitialized = false;

var runtimeExited = false;

var runtimeKeepaliveCounter = 0;

function keepRuntimeAlive() {
  return noExitRuntime || runtimeKeepaliveCounter > 0;
}

function preRun() {
  if (Module['preRun']) {
    if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
    while (Module['preRun'].length) {
      addOnPreRun(Module['preRun'].shift());
    }
  }
  callRuntimeCallbacks(__ATPRERUN__);
}

function initRuntime() {
  assert(!runtimeInitialized);
  runtimeInitialized = true;

  checkStackCookie();

  
if (!Module["noFSInit"] && !FS.init.initialized)
  FS.init();
FS.ignorePermissions = false;

TTY.init();
SOCKFS.root = FS.mount(SOCKFS, {}, null);
  callRuntimeCallbacks(__ATINIT__);
}

function preMain() {
  checkStackCookie();
  
  callRuntimeCallbacks(__ATMAIN__);
}

function exitRuntime() {
  assert(!runtimeExited);
  checkStackCookie();
  ___funcs_on_exit(); // Native atexit() functions
  callRuntimeCallbacks(__ATEXIT__);
  FS.quit();
TTY.shutdown();
IDBFS.quit();
  runtimeExited = true;
}

function postRun() {
  checkStackCookie();

  if (Module['postRun']) {
    if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
    while (Module['postRun'].length) {
      addOnPostRun(Module['postRun'].shift());
    }
  }

  callRuntimeCallbacks(__ATPOSTRUN__);
}

function addOnPreRun(cb) {
  __ATPRERUN__.unshift(cb);
}

function addOnInit(cb) {
  __ATINIT__.unshift(cb);
}

function addOnPreMain(cb) {
  __ATMAIN__.unshift(cb);
}

function addOnExit(cb) {
  __ATEXIT__.unshift(cb);
}

function addOnPostRun(cb) {
  __ATPOSTRUN__.unshift(cb);
}

// include: runtime_math.js
// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul

// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround

// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32

// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc

assert(Math.imul, 'This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
assert(Math.fround, 'This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
assert(Math.clz32, 'This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
assert(Math.trunc, 'This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
// end include: runtime_math.js
// A counter of dependencies for calling run(). If we need to
// do asynchronous work before running, increment this and
// decrement it. Incrementing must happen in a place like
// Module.preRun (used by emcc to add file preloading).
// Note that you can add dependencies in preRun, even though
// it happens right before run - run will be postponed until
// the dependencies are met.
var runDependencies = 0;
var runDependencyWatcher = null;
var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
var runDependencyTracking = {};

function getUniqueRunDependency(id) {
  var orig = id;
  while (1) {
    if (!runDependencyTracking[id]) return id;
    id = orig + Math.random();
  }
}

function addRunDependency(id) {
  runDependencies++;

  if (Module['monitorRunDependencies']) {
    Module['monitorRunDependencies'](runDependencies);
  }

  if (id) {
    assert(!runDependencyTracking[id]);
    runDependencyTracking[id] = 1;
    if (runDependencyWatcher === null && typeof setInterval != 'undefined') {
      // Check for missing dependencies every few seconds
      runDependencyWatcher = setInterval(() => {
        if (ABORT) {
          clearInterval(runDependencyWatcher);
          runDependencyWatcher = null;
          return;
        }
        var shown = false;
        for (var dep in runDependencyTracking) {
          if (!shown) {
            shown = true;
            err('still waiting on run dependencies:');
          }
          err('dependency: ' + dep);
        }
        if (shown) {
          err('(end of list)');
        }
      }, 10000);
    }
  } else {
    err('warning: run dependency added without ID');
  }
}

function removeRunDependency(id) {
  runDependencies--;

  if (Module['monitorRunDependencies']) {
    Module['monitorRunDependencies'](runDependencies);
  }

  if (id) {
    assert(runDependencyTracking[id]);
    delete runDependencyTracking[id];
  } else {
    err('warning: run dependency removed without ID');
  }
  if (runDependencies == 0) {
    if (runDependencyWatcher !== null) {
      clearInterval(runDependencyWatcher);
      runDependencyWatcher = null;
    }
    if (dependenciesFulfilled) {
      var callback = dependenciesFulfilled;
      dependenciesFulfilled = null;
      callback(); // can add another dependenciesFulfilled
    }
  }
}

/** @param {string|number=} what */
function abort(what) {
  if (Module['onAbort']) {
    Module['onAbort'](what);
  }

  what = 'Aborted(' + what + ')';
  // TODO(sbc): Should we remove printing and leave it up to whoever
  // catches the exception?
  err(what);

  ABORT = true;
  EXITSTATUS = 1;

  // Use a wasm runtime error, because a JS error might be seen as a foreign
  // exception, which means we'd run destructors on it. We need the error to
  // simply make the program stop.
  // FIXME This approach does not work in Wasm EH because it currently does not assume
  // all RuntimeErrors are from traps; it decides whether a RuntimeError is from
  // a trap or not based on a hidden field within the object. So at the moment
  // we don't have a way of throwing a wasm trap from JS. TODO Make a JS API that
  // allows this in the wasm spec.

  // Suppress closure compiler warning here. Closure compiler's builtin extern
  // defintion for WebAssembly.RuntimeError claims it takes no arguments even
  // though it can.
  // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed.
  /** @suppress {checkTypes} */
  var e = new WebAssembly.RuntimeError(what);

  readyPromiseReject(e);
  // Throw the error whether or not MODULARIZE is set because abort is used
  // in code paths apart from instantiation where an exception is expected
  // to be thrown when abort is called.
  throw e;
}

// include: memoryprofiler.js
// end include: memoryprofiler.js
// include: URIUtils.js
// Prefix of data URIs emitted by SINGLE_FILE and related options.
var dataURIPrefix = 'data:application/octet-stream;base64,';

// Indicates whether filename is a base64 data URI.
function isDataURI(filename) {
  // Prefix of data URIs emitted by SINGLE_FILE and related options.
  return filename.startsWith(dataURIPrefix);
}

// Indicates whether filename is delivered via file protocol (as opposed to http/https)
function isFileURI(filename) {
  return filename.startsWith('file://');
}
// end include: URIUtils.js
function createExportWrapper(name) {
  return function() {
    assert(runtimeInitialized, `native function \`${name}\` called before runtime initialization`);
    assert(!runtimeExited, `native function \`${name}\` called after runtime exit (use NO_EXIT_RUNTIME to keep it alive after main() exits)`);
    var f = wasmExports[name];
    assert(f, `exported native function \`${name}\` not found`);
    return f.apply(null, arguments);
  };
}

// include: runtime_exceptions.js
// end include: runtime_exceptions.js
var wasmBinaryFile;
  wasmBinaryFile = 'godot.web.template_debug.dev.wasm32.wasm';
  if (!isDataURI(wasmBinaryFile)) {
    wasmBinaryFile = locateFile(wasmBinaryFile);
  }

function getBinarySync(file) {
  if (file == wasmBinaryFile && wasmBinary) {
    return new Uint8Array(wasmBinary);
  }
  if (readBinary) {
    return readBinary(file);
  }
  throw "both async and sync fetching of the wasm failed";
}

function getBinaryPromise(binaryFile) {
  // If we don't have the binary yet, try to load it asynchronously.
  // Fetch has some additional restrictions over XHR, like it can't be used on a file:// url.
  // See https://github.com/github/fetch/pull/92#issuecomment-140665932
  // Cordova or Electron apps are typically loaded from a file:// url.
  // So use fetch if it is available and the url is not a file, otherwise fall back to XHR.
  if (!wasmBinary
      && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) {
    if (typeof fetch == 'function'
    ) {
      return fetch(binaryFile, { credentials: 'same-origin' }).then((response) => {
        if (!response['ok']) {
          throw "failed to load wasm binary file at '" + binaryFile + "'";
        }
        return response['arrayBuffer']();
      }).catch(() => getBinarySync(binaryFile));
    }
  }

  // Otherwise, getBinarySync should be able to get it synchronously
  return Promise.resolve().then(() => getBinarySync(binaryFile));
}

function instantiateArrayBuffer(binaryFile, imports, receiver) {
  return getBinaryPromise(binaryFile).then((binary) => {
    return WebAssembly.instantiate(binary, imports);
  }).then((instance) => {
    return instance;
  }).then(receiver, (reason) => {
    err('failed to asynchronously prepare wasm: ' + reason);

    // Warn on some common problems.
    if (isFileURI(wasmBinaryFile)) {
      err('warning: Loading from a file URI (' + wasmBinaryFile + ') is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing');
    }
    abort(reason);
  });
}

function instantiateAsync(binary, binaryFile, imports, callback) {
  if (!binary &&
      typeof WebAssembly.instantiateStreaming == 'function' &&
      !isDataURI(binaryFile) &&
      typeof fetch == 'function') {
    return fetch(binaryFile, { credentials: 'same-origin' }).then((response) => {
      // Suppress closure warning here since the upstream definition for
      // instantiateStreaming only allows Promise<Repsponse> rather than
      // an actual Response.
      // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure is fixed.
      /** @suppress {checkTypes} */
      var result = WebAssembly.instantiateStreaming(response, imports);

      return result.then(
        callback,
        function(reason) {
          // We expect the most common failure cause to be a bad MIME type for the binary,
          // in which case falling back to ArrayBuffer instantiation should work.
          err('wasm streaming compile failed: ' + reason);
          err('falling back to ArrayBuffer instantiation');
          return instantiateArrayBuffer(binaryFile, imports, callback);
        });
    });
  }
  return instantiateArrayBuffer(binaryFile, imports, callback);
}

// Create the wasm instance.
// Receives the wasm imports, returns the exports.
function createWasm() {
  // prepare imports
  var info = {
    'env': wasmImports,
    'wasi_snapshot_preview1': wasmImports,
  };
  // Load the wasm module and create an instance of using native support in the JS engine.
  // handle a generated wasm instance, receiving its exports and
  // performing other necessary setup
  /** @param {WebAssembly.Module=} module*/
  function receiveInstance(instance, module) {
    var exports = instance.exports;

    wasmExports = exports;
    

    wasmMemory = wasmExports['memory'];
    
    assert(wasmMemory, "memory not found in wasm exports");
    // This assertion doesn't hold when emscripten is run in --post-link
    // mode.
    // TODO(sbc): Read INITIAL_MEMORY out of the wasm file in post-link mode.
    //assert(wasmMemory.buffer.byteLength === 67108864);
    updateMemoryViews();

    wasmTable = wasmExports['__indirect_function_table'];
    
    assert(wasmTable, "table not found in wasm exports");

    addOnInit(wasmExports['__wasm_call_ctors']);

    removeRunDependency('wasm-instantiate');
    return exports;
  }
  // wait for the pthread pool (if any)
  addRunDependency('wasm-instantiate');

  // Prefer streaming instantiation if available.
  // Async compilation can be confusing when an error on the page overwrites Module
  // (for example, if the order of elements is wrong, and the one defining Module is
  // later), so we save Module and check it later.
  var trueModule = Module;
  function receiveInstantiationResult(result) {
    // 'result' is a ResultObject object which has both the module and instance.
    // receiveInstance() will swap in the exports (to Module.asm) so they can be called
    assert(Module === trueModule, 'the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?');
    trueModule = null;
    // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line.
    // When the regression is fixed, can restore the above PTHREADS-enabled path.
    receiveInstance(result['instance']);
  }

  // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
  // to manually instantiate the Wasm module themselves. This allows pages to
  // run the instantiation parallel to any other async startup actions they are
  // performing.
  // Also pthreads and wasm workers initialize the wasm instance through this
  // path.
  if (Module['instantiateWasm']) {

    try {
      return Module['instantiateWasm'](info, receiveInstance);
    } catch(e) {
      err('Module.instantiateWasm callback failed with error: ' + e);
        // If instantiation fails, reject the module ready promise.
        readyPromiseReject(e);
    }
  }

  // If instantiation fails, reject the module ready promise.
  instantiateAsync(wasmBinary, wasmBinaryFile, info, receiveInstantiationResult).catch(readyPromiseReject);
  return {}; // no exports yet; we'll fill them in later
}

// Globals used by JS i64 conversions (see makeSetValue)
var tempDouble;
var tempI64;

// include: runtime_debug.js
function legacyModuleProp(prop, newName, incomming=true) {
  if (!Object.getOwnPropertyDescriptor(Module, prop)) {
    Object.defineProperty(Module, prop, {
      configurable: true,
      get() {
        let extra = incomming ? ' (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)' : '';
        abort(`\`Module.${prop}\` has been replaced by \`${newName}\`` + extra);

      }
    });
  }
}

function ignoredModuleProp(prop) {
  if (Object.getOwnPropertyDescriptor(Module, prop)) {
    abort(`\`Module.${prop}\` was supplied but \`${prop}\` not included in INCOMING_MODULE_JS_API`);
  }
}

// forcing the filesystem exports a few things by default
function isExportedByForceFilesystem(name) {
  return name === 'FS_createPath' ||
         name === 'FS_createDataFile' ||
         name === 'FS_createPreloadedFile' ||
         name === 'FS_unlink' ||
         name === 'addRunDependency' ||
         // The old FS has some functionality that WasmFS lacks.
         name === 'FS_createLazyFile' ||
         name === 'FS_createDevice' ||
         name === 'removeRunDependency';
}

function missingGlobal(sym, msg) {
  if (typeof globalThis !== 'undefined') {
    Object.defineProperty(globalThis, sym, {
      configurable: true,
      get() {
        warnOnce('`' + sym + '` is not longer defined by emscripten. ' + msg);
        return undefined;
      }
    });
  }
}

missingGlobal('buffer', 'Please use HEAP8.buffer or wasmMemory.buffer');

function missingLibrarySymbol(sym) {
  if (typeof globalThis !== 'undefined' && !Object.getOwnPropertyDescriptor(globalThis, sym)) {
    Object.defineProperty(globalThis, sym, {
      configurable: true,
      get() {
        // Can't `abort()` here because it would break code that does runtime
        // checks.  e.g. `if (typeof SDL === 'undefined')`.
        var msg = '`' + sym + '` is a library symbol and not included by default; add it to your library.js __deps or to DEFAULT_LIBRARY_FUNCS_TO_INCLUDE on the command line';
        // DEFAULT_LIBRARY_FUNCS_TO_INCLUDE requires the name as it appears in
        // library.js, which means $name for a JS name with no prefix, or name
        // for a JS name like _name.
        var librarySymbol = sym;
        if (!librarySymbol.startsWith('_')) {
          librarySymbol = '$' + sym;
        }
        msg += " (e.g. -sDEFAULT_LIBRARY_FUNCS_TO_INCLUDE='" + librarySymbol + "')";
        if (isExportedByForceFilesystem(sym)) {
          msg += '. Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you';
        }
        warnOnce(msg);
        return undefined;
      }
    });
  }
  // Any symbol that is not included from the JS libary is also (by definition)
  // not exported on the Module object.
  unexportedRuntimeSymbol(sym);
}

function unexportedRuntimeSymbol(sym) {
  if (!Object.getOwnPropertyDescriptor(Module, sym)) {
    Object.defineProperty(Module, sym, {
      configurable: true,
      get() {
        var msg = "'" + sym + "' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the Emscripten FAQ)";
        if (isExportedByForceFilesystem(sym)) {
          msg += '. Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you';
        }
        abort(msg);
      }
    });
  }
}

// Used by XXXXX_DEBUG settings to output debug messages.
function dbg(text) {
  // TODO(sbc): Make this configurable somehow.  Its not always convenient for
  // logging to show up as warnings.
  console.warn.apply(console, arguments);
}
// end include: runtime_debug.js
// === Body ===

// end include: preamble.js

  /** @constructor */
  function ExitStatus(status) {
      this.name = 'ExitStatus';
      this.message = `Program terminated with exit(${status})`;
      this.status = status;
    }

  var callRuntimeCallbacks = (callbacks) => {
      while (callbacks.length > 0) {
        // Pass the module as the first argument.
        callbacks.shift()(Module);
      }
    };

  
    /**
     * @param {number} ptr
     * @param {string} type
     */
  function getValue(ptr, type = 'i8') {
    if (type.endsWith('*')) type = '*';
    switch (type) {
      case 'i1': return HEAP8[((ptr)>>0)];
      case 'i8': return HEAP8[((ptr)>>0)];
      case 'i16': return HEAP16[((ptr)>>1)];
      case 'i32': return HEAP32[((ptr)>>2)];
      case 'i64': abort('to do getValue(i64) use WASM_BIGINT');
      case 'float': return HEAPF32[((ptr)>>2)];
      case 'double': return HEAPF64[((ptr)>>3)];
      case '*': return HEAPU32[((ptr)>>2)];
      default: abort(`invalid type for getValue: ${type}`);
    }
  }

  var ptrToString = (ptr) => {
      assert(typeof ptr === 'number');
      // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned.
      ptr >>>= 0;
      return '0x' + ptr.toString(16).padStart(8, '0');
    };

  
    /**
     * @param {number} ptr
     * @param {number} value
     * @param {string} type
     */
  function setValue(ptr, value, type = 'i8') {
    if (type.endsWith('*')) type = '*';
    switch (type) {
      case 'i1': HEAP8[((ptr)>>0)] = value; break;
      case 'i8': HEAP8[((ptr)>>0)] = value; break;
      case 'i16': HEAP16[((ptr)>>1)] = value; break;
      case 'i32': HEAP32[((ptr)>>2)] = value; break;
      case 'i64': abort('to do setValue(i64) use WASM_BIGINT');
      case 'float': HEAPF32[((ptr)>>2)] = value; break;
      case 'double': HEAPF64[((ptr)>>3)] = value; break;
      case '*': HEAPU32[((ptr)>>2)] = value; break;
      default: abort(`invalid type for setValue: ${type}`);
    }
  }

  var warnOnce = (text) => {
      if (!warnOnce.shown) warnOnce.shown = {};
      if (!warnOnce.shown[text]) {
        warnOnce.shown[text] = 1;
        err(text);
      }
    };

  var UTF8Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf8') : undefined;
  
    /**
     * Given a pointer 'idx' to a null-terminated UTF8-encoded string in the given
     * array that contains uint8 values, returns a copy of that string as a
     * Javascript String object.
     * heapOrArray is either a regular array, or a JavaScript typed array view.
     * @param {number} idx
     * @param {number=} maxBytesToRead
     * @return {string}
     */
  var UTF8ArrayToString = (heapOrArray, idx, maxBytesToRead) => {
      var endIdx = idx + maxBytesToRead;
      var endPtr = idx;
      // TextDecoder needs to know the byte length in advance, it doesn't stop on
      // null terminator by itself.  Also, use the length info to avoid running tiny
      // strings through TextDecoder, since .subarray() allocates garbage.
      // (As a tiny code save trick, compare endPtr against endIdx using a negation,
      // so that undefined means Infinity)
      while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr;
  
      if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) {
        return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr));
      }
      var str = '';
      // If building with TextDecoder, we have already computed the string length
      // above, so test loop end condition against that
      while (idx < endPtr) {
        // For UTF8 byte structure, see:
        // http://en.wikipedia.org/wiki/UTF-8#Description
        // https://www.ietf.org/rfc/rfc2279.txt
        // https://tools.ietf.org/html/rfc3629
        var u0 = heapOrArray[idx++];
        if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
        var u1 = heapOrArray[idx++] & 63;
        if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
        var u2 = heapOrArray[idx++] & 63;
        if ((u0 & 0xF0) == 0xE0) {
          u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
        } else {
          if ((u0 & 0xF8) != 0xF0) warnOnce('Invalid UTF-8 leading byte ' + ptrToString(u0) + ' encountered when deserializing a UTF-8 string in wasm memory to a JS string!');
          u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (heapOrArray[idx++] & 63);
        }
  
        if (u0 < 0x10000) {
          str += String.fromCharCode(u0);
        } else {
          var ch = u0 - 0x10000;
          str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
        }
      }
      return str;
    };
  
    /**
     * Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the
     * emscripten HEAP, returns a copy of that string as a Javascript String object.
     *
     * @param {number} ptr
     * @param {number=} maxBytesToRead - An optional length that specifies the
     *   maximum number of bytes to read. You can omit this parameter to scan the
     *   string until the first 0 byte. If maxBytesToRead is passed, and the string
     *   at [ptr, ptr+maxBytesToReadr[ contains a null byte in the middle, then the
     *   string will cut short at that byte index (i.e. maxBytesToRead will not
     *   produce a string of exact length [ptr, ptr+maxBytesToRead[) N.B. mixing
     *   frequent uses of UTF8ToString() with and without maxBytesToRead may throw
     *   JS JIT optimizations off, so it is worth to consider consistently using one
     * @return {string}
     */
  var UTF8ToString = (ptr, maxBytesToRead) => {
      assert(typeof ptr == 'number');
      return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : '';
    };
  var ___assert_fail = (condition, filename, line, func) => {
      abort(`Assertion failed: ${UTF8ToString(condition)}, at: ` + [filename ? UTF8ToString(filename) : 'unknown filename', line, func ? UTF8ToString(func) : 'unknown function']);
    };

  var wasmTableMirror = [];
  var getWasmTableEntry = (funcPtr) => {
      var func = wasmTableMirror[funcPtr];
      if (!func) {
        if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1;
        wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr);
      }
      assert(wasmTable.get(funcPtr) == func, "JavaScript-side Wasm function table mirror is out of date!");
      return func;
    };
  var ___call_sighandler = (fp, sig) => getWasmTableEntry(fp)(sig);

  var PATH = {
  isAbs:(path) => path.charAt(0) === '/',
  splitPath:(filename) => {
        var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
        return splitPathRe.exec(filename).slice(1);
      },
  normalizeArray:(parts, allowAboveRoot) => {
        // if the path tries to go above the root, `up` ends up > 0
        var up = 0;
        for (var i = parts.length - 1; i >= 0; i--) {
          var last = parts[i];
          if (last === '.') {
            parts.splice(i, 1);
          } else if (last === '..') {
            parts.splice(i, 1);
            up++;
          } else if (up) {
            parts.splice(i, 1);
            up--;
          }
        }
        // if the path is allowed to go above the root, restore leading ..s
        if (allowAboveRoot) {
          for (; up; up--) {
            parts.unshift('..');
          }
        }
        return parts;
      },
  normalize:(path) => {
        var isAbsolute = PATH.isAbs(path),
            trailingSlash = path.substr(-1) === '/';
        // Normalize the path
        path = PATH.normalizeArray(path.split('/').filter((p) => !!p), !isAbsolute).join('/');
        if (!path && !isAbsolute) {
          path = '.';
        }
        if (path && trailingSlash) {
          path += '/';
        }
        return (isAbsolute ? '/' : '') + path;
      },
  dirname:(path) => {
        var result = PATH.splitPath(path),
            root = result[0],
            dir = result[1];
        if (!root && !dir) {
          // No dirname whatsoever
          return '.';
        }
        if (dir) {
          // It has a dirname, strip trailing slash
          dir = dir.substr(0, dir.length - 1);
        }
        return root + dir;
      },
  basename:(path) => {
        // EMSCRIPTEN return '/'' for '/', not an empty string
        if (path === '/') return '/';
        path = PATH.normalize(path);
        path = path.replace(/\/$/, "");
        var lastSlash = path.lastIndexOf('/');
        if (lastSlash === -1) return path;
        return path.substr(lastSlash+1);
      },
  join:function() {
        var paths = Array.prototype.slice.call(arguments);
        return PATH.normalize(paths.join('/'));
      },
  join2:(l, r) => {
        return PATH.normalize(l + '/' + r);
      },
  };
  
  var initRandomFill = () => {
      if (typeof crypto == 'object' && typeof crypto['getRandomValues'] == 'function') {
        // for modern web browsers
        return (view) => crypto.getRandomValues(view);
      } else
      // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096
      abort("no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: (array) => { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };");
    };
  var randomFill = (view) => {
      // Lazily init on the first invocation.
      return (randomFill = initRandomFill())(view);
    };
  
  
  
  var PATH_FS = {
  resolve:function() {
        var resolvedPath = '',
          resolvedAbsolute = false;
        for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
          var path = (i >= 0) ? arguments[i] : FS.cwd();
          // Skip empty and invalid entries
          if (typeof path != 'string') {
            throw new TypeError('Arguments to path.resolve must be strings');
          } else if (!path) {
            return ''; // an invalid portion invalidates the whole thing
          }
          resolvedPath = path + '/' + resolvedPath;
          resolvedAbsolute = PATH.isAbs(path);
        }
        // At this point the path should be resolved to a full absolute path, but
        // handle relative paths to be safe (might happen when process.cwd() fails)
        resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter((p) => !!p), !resolvedAbsolute).join('/');
        return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
      },
  relative:(from, to) => {
        from = PATH_FS.resolve(from).substr(1);
        to = PATH_FS.resolve(to).substr(1);
        function trim(arr) {
          var start = 0;
          for (; start < arr.length; start++) {
            if (arr[start] !== '') break;
          }
          var end = arr.length - 1;
          for (; end >= 0; end--) {
            if (arr[end] !== '') break;
          }
          if (start > end) return [];
          return arr.slice(start, end - start + 1);
        }
        var fromParts = trim(from.split('/'));
        var toParts = trim(to.split('/'));
        var length = Math.min(fromParts.length, toParts.length);
        var samePartsLength = length;
        for (var i = 0; i < length; i++) {
          if (fromParts[i] !== toParts[i]) {
            samePartsLength = i;
            break;
          }
        }
        var outputParts = [];
        for (var i = samePartsLength; i < fromParts.length; i++) {
          outputParts.push('..');
        }
        outputParts = outputParts.concat(toParts.slice(samePartsLength));
        return outputParts.join('/');
      },
  };
  
  
  
  var FS_stdin_getChar_buffer = [];
  
  var lengthBytesUTF8 = (str) => {
      var len = 0;
      for (var i = 0; i < str.length; ++i) {
        // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
        // unit, not a Unicode code point of the character! So decode
        // UTF16->UTF32->UTF8.
        // See http://unicode.org/faq/utf_bom.html#utf16-3
        var c = str.charCodeAt(i); // possibly a lead surrogate
        if (c <= 0x7F) {
          len++;
        } else if (c <= 0x7FF) {
          len += 2;
        } else if (c >= 0xD800 && c <= 0xDFFF) {
          len += 4; ++i;
        } else {
          len += 3;
        }
      }
      return len;
    };
  
  var stringToUTF8Array = (str, heap, outIdx, maxBytesToWrite) => {
      assert(typeof str === 'string');
      // Parameter maxBytesToWrite is not optional. Negative values, 0, null,
      // undefined and false each don't write out any bytes.
      if (!(maxBytesToWrite > 0))
        return 0;
  
      var startIdx = outIdx;
      var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
      for (var i = 0; i < str.length; ++i) {
        // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
        // unit, not a Unicode code point of the character! So decode
        // UTF16->UTF32->UTF8.
        // See http://unicode.org/faq/utf_bom.html#utf16-3
        // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description
        // and https://www.ietf.org/rfc/rfc2279.txt
        // and https://tools.ietf.org/html/rfc3629
        var u = str.charCodeAt(i); // possibly a lead surrogate
        if (u >= 0xD800 && u <= 0xDFFF) {
          var u1 = str.charCodeAt(++i);
          u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF);
        }
        if (u <= 0x7F) {
          if (outIdx >= endIdx) break;
          heap[outIdx++] = u;
        } else if (u <= 0x7FF) {
          if (outIdx + 1 >= endIdx) break;
          heap[outIdx++] = 0xC0 | (u >> 6);
          heap[outIdx++] = 0x80 | (u & 63);
        } else if (u <= 0xFFFF) {
          if (outIdx + 2 >= endIdx) break;
          heap[outIdx++] = 0xE0 | (u >> 12);
          heap[outIdx++] = 0x80 | ((u >> 6) & 63);
          heap[outIdx++] = 0x80 | (u & 63);
        } else {
          if (outIdx + 3 >= endIdx) break;
          if (u > 0x10FFFF) warnOnce('Invalid Unicode code point ' + ptrToString(u) + ' encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF).');
          heap[outIdx++] = 0xF0 | (u >> 18);
          heap[outIdx++] = 0x80 | ((u >> 12) & 63);
          heap[outIdx++] = 0x80 | ((u >> 6) & 63);
          heap[outIdx++] = 0x80 | (u & 63);
        }
      }
      // Null-terminate the pointer to the buffer.
      heap[outIdx] = 0;
      return outIdx - startIdx;
    };
  /** @type {function(string, boolean=, number=)} */
  function intArrayFromString(stringy, dontAddNull, length) {
    var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
    var u8array = new Array(len);
    var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
    if (dontAddNull) u8array.length = numBytesWritten;
    return u8array;
  }
  var FS_stdin_getChar = () => {
      if (!FS_stdin_getChar_buffer.length) {
        var result = null;
        if (typeof window != 'undefined' &&
          typeof window.prompt == 'function') {
          // Browser.
          result = window.prompt('Input: ');  // returns null on cancel
          if (result !== null) {
            result += '\n';
          }
        } else if (typeof readline == 'function') {
          // Command line.
          result = readline();
          if (result !== null) {
            result += '\n';
          }
        }
        if (!result) {
          return null;
        }
        FS_stdin_getChar_buffer = intArrayFromString(result, true);
      }
      return FS_stdin_getChar_buffer.shift();
    };
  var TTY = {
  ttys:[],
  init:function () {
        // https://github.com/emscripten-core/emscripten/pull/1555
        // if (ENVIRONMENT_IS_NODE) {
        //   // currently, FS.init does not distinguish if process.stdin is a file or TTY
        //   // device, it always assumes it's a TTY device. because of this, we're forcing
        //   // process.stdin to UTF8 encoding to at least make stdin reading compatible
        //   // with text files until FS.init can be refactored.
        //   process.stdin.setEncoding('utf8');
        // }
      },
  shutdown:function() {
        // https://github.com/emscripten-core/emscripten/pull/1555
        // if (ENVIRONMENT_IS_NODE) {
        //   // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
        //   // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
        //   // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
        //   // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
        //   // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
        //   process.stdin.pause();
        // }
      },
  register:function(dev, ops) {
        TTY.ttys[dev] = { input: [], output: [], ops: ops };
        FS.registerDevice(dev, TTY.stream_ops);
      },
  stream_ops:{
  open:function(stream) {
          var tty = TTY.ttys[stream.node.rdev];
          if (!tty) {
            throw new FS.ErrnoError(43);
          }
          stream.tty = tty;
          stream.seekable = false;
        },
  close:function(stream) {
          // flush any pending line data
          stream.tty.ops.fsync(stream.tty);
        },
  fsync:function(stream) {
          stream.tty.ops.fsync(stream.tty);
        },
  read:function(stream, buffer, offset, length, pos /* ignored */) {
          if (!stream.tty || !stream.tty.ops.get_char) {
            throw new FS.ErrnoError(60);
          }
          var bytesRead = 0;
          for (var i = 0; i < length; i++) {
            var result;
            try {
              result = stream.tty.ops.get_char(stream.tty);
            } catch (e) {
              throw new FS.ErrnoError(29);
            }
            if (result === undefined && bytesRead === 0) {
              throw new FS.ErrnoError(6);
            }
            if (result === null || result === undefined) break;
            bytesRead++;
            buffer[offset+i] = result;
          }
          if (bytesRead) {
            stream.node.timestamp = Date.now();
          }
          return bytesRead;
        },
  write:function(stream, buffer, offset, length, pos) {
          if (!stream.tty || !stream.tty.ops.put_char) {
            throw new FS.ErrnoError(60);
          }
          try {
            for (var i = 0; i < length; i++) {
              stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
            }
          } catch (e) {
            throw new FS.ErrnoError(29);
          }
          if (length) {
            stream.node.timestamp = Date.now();
          }
          return i;
        },
  },
  default_tty_ops:{
  get_char:function(tty) {
          return FS_stdin_getChar();
        },
  put_char:function(tty, val) {
          if (val === null || val === 10) {
            out(UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          } else {
            if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
          }
        },
  fsync:function(tty) {
          if (tty.output && tty.output.length > 0) {
            out(UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          }
        },
  ioctl_tcgets:function(tty) {
          // typical setting
          return {
            c_iflag: 25856,
            c_oflag: 5,
            c_cflag: 191,
            c_lflag: 35387,
            c_cc: [
              0x03, 0x1c, 0x7f, 0x15, 0x04, 0x00, 0x01, 0x00, 0x11, 0x13, 0x1a, 0x00,
              0x12, 0x0f, 0x17, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
              0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
            ]
          };
        },
  ioctl_tcsets:function(tty, optional_actions, data) {
          // currently just ignore
          return 0;
        },
  ioctl_tiocgwinsz:function(tty) {
          return [24, 80];
        },
  },
  default_tty1_ops:{
  put_char:function(tty, val) {
          if (val === null || val === 10) {
            err(UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          } else {
            if (val != 0) tty.output.push(val);
          }
        },
  fsync:function(tty) {
          if (tty.output && tty.output.length > 0) {
            err(UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          }
        },
  },
  };
  
  
  var zeroMemory = (address, size) => {
      HEAPU8.fill(0, address, address + size);
      return address;
    };
  
  var alignMemory = (size, alignment) => {
      assert(alignment, "alignment argument is required");
      return Math.ceil(size / alignment) * alignment;
    };
  var mmapAlloc = (size) => {
      size = alignMemory(size, 65536);
      var ptr = _emscripten_builtin_memalign(65536, size);
      if (!ptr) return 0;
      return zeroMemory(ptr, size);
    };
  var MEMFS = {
  ops_table:null,
  mount(mount) {
        return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
      },
  createNode(parent, name, mode, dev) {
        if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
          // no supported
          throw new FS.ErrnoError(63);
        }
        if (!MEMFS.ops_table) {
          MEMFS.ops_table = {
            dir: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr,
                lookup: MEMFS.node_ops.lookup,
                mknod: MEMFS.node_ops.mknod,
                rename: MEMFS.node_ops.rename,
                unlink: MEMFS.node_ops.unlink,
                rmdir: MEMFS.node_ops.rmdir,
                readdir: MEMFS.node_ops.readdir,
                symlink: MEMFS.node_ops.symlink
              },
              stream: {
                llseek: MEMFS.stream_ops.llseek
              }
            },
            file: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr
              },
              stream: {
                llseek: MEMFS.stream_ops.llseek,
                read: MEMFS.stream_ops.read,
                write: MEMFS.stream_ops.write,
                allocate: MEMFS.stream_ops.allocate,
                mmap: MEMFS.stream_ops.mmap,
                msync: MEMFS.stream_ops.msync
              }
            },
            link: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr,
                readlink: MEMFS.node_ops.readlink
              },
              stream: {}
            },
            chrdev: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr
              },
              stream: FS.chrdev_stream_ops
            }
          };
        }
        var node = FS.createNode(parent, name, mode, dev);
        if (FS.isDir(node.mode)) {
          node.node_ops = MEMFS.ops_table.dir.node;
          node.stream_ops = MEMFS.ops_table.dir.stream;
          node.contents = {};
        } else if (FS.isFile(node.mode)) {
          node.node_ops = MEMFS.ops_table.file.node;
          node.stream_ops = MEMFS.ops_table.file.stream;
          node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
          // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
          // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
          // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
          node.contents = null; 
        } else if (FS.isLink(node.mode)) {
          node.node_ops = MEMFS.ops_table.link.node;
          node.stream_ops = MEMFS.ops_table.link.stream;
        } else if (FS.isChrdev(node.mode)) {
          node.node_ops = MEMFS.ops_table.chrdev.node;
          node.stream_ops = MEMFS.ops_table.chrdev.stream;
        }
        node.timestamp = Date.now();
        // add the new node to the parent
        if (parent) {
          parent.contents[name] = node;
          parent.timestamp = node.timestamp;
        }
        return node;
      },
  getFileDataAsTypedArray(node) {
        if (!node.contents) return new Uint8Array(0);
        if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
        return new Uint8Array(node.contents);
      },
  expandFileStorage(node, newCapacity) {
        var prevCapacity = node.contents ? node.contents.length : 0;
        if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
        // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
        // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
        // avoid overshooting the allocation cap by a very large margin.
        var CAPACITY_DOUBLING_MAX = 1024 * 1024;
        newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>> 0);
        if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
        var oldContents = node.contents;
        node.contents = new Uint8Array(newCapacity); // Allocate new storage.
        if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
      },
  resizeFileStorage(node, newSize) {
        if (node.usedBytes == newSize) return;
        if (newSize == 0) {
          node.contents = null; // Fully decommit when requesting a resize to zero.
          node.usedBytes = 0;
        } else {
          var oldContents = node.contents;
          node.contents = new Uint8Array(newSize); // Allocate new storage.
          if (oldContents) {
            node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
          }
          node.usedBytes = newSize;
        }
      },
  node_ops:{
  getattr(node) {
          var attr = {};
          // device numbers reuse inode numbers.
          attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
          attr.ino = node.id;
          attr.mode = node.mode;
          attr.nlink = 1;
          attr.uid = 0;
          attr.gid = 0;
          attr.rdev = node.rdev;
          if (FS.isDir(node.mode)) {
            attr.size = 4096;
          } else if (FS.isFile(node.mode)) {
            attr.size = node.usedBytes;
          } else if (FS.isLink(node.mode)) {
            attr.size = node.link.length;
          } else {
            attr.size = 0;
          }
          attr.atime = new Date(node.timestamp);
          attr.mtime = new Date(node.timestamp);
          attr.ctime = new Date(node.timestamp);
          // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
          //       but this is not required by the standard.
          attr.blksize = 4096;
          attr.blocks = Math.ceil(attr.size / attr.blksize);
          return attr;
        },
  setattr(node, attr) {
          if (attr.mode !== undefined) {
            node.mode = attr.mode;
          }
          if (attr.timestamp !== undefined) {
            node.timestamp = attr.timestamp;
          }
          if (attr.size !== undefined) {
            MEMFS.resizeFileStorage(node, attr.size);
          }
        },
  lookup(parent, name) {
          throw FS.genericErrors[44];
        },
  mknod(parent, name, mode, dev) {
          return MEMFS.createNode(parent, name, mode, dev);
        },
  rename(old_node, new_dir, new_name) {
          // if we're overwriting a directory at new_name, make sure it's empty.
          if (FS.isDir(old_node.mode)) {
            var new_node;
            try {
              new_node = FS.lookupNode(new_dir, new_name);
            } catch (e) {
            }
            if (new_node) {
              for (var i in new_node.contents) {
                throw new FS.ErrnoError(55);
              }
            }
          }
          // do the internal rewiring
          delete old_node.parent.contents[old_node.name];
          old_node.parent.timestamp = Date.now()
          old_node.name = new_name;
          new_dir.contents[new_name] = old_node;
          new_dir.timestamp = old_node.parent.timestamp;
          old_node.parent = new_dir;
        },
  unlink(parent, name) {
          delete parent.contents[name];
          parent.timestamp = Date.now();
        },
  rmdir(parent, name) {
          var node = FS.lookupNode(parent, name);
          for (var i in node.contents) {
            throw new FS.ErrnoError(55);
          }
          delete parent.contents[name];
          parent.timestamp = Date.now();
        },
  readdir(node) {
          var entries = ['.', '..'];
          for (var key in node.contents) {
            if (!node.contents.hasOwnProperty(key)) {
              continue;
            }
            entries.push(key);
          }
          return entries;
        },
  symlink(parent, newname, oldpath) {
          var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
          node.link = oldpath;
          return node;
        },
  readlink(node) {
          if (!FS.isLink(node.mode)) {
            throw new FS.ErrnoError(28);
          }
          return node.link;
        },
  },
  stream_ops:{
  read(stream, buffer, offset, length, position) {
          var contents = stream.node.contents;
          if (position >= stream.node.usedBytes) return 0;
          var size = Math.min(stream.node.usedBytes - position, length);
          assert(size >= 0);
          if (size > 8 && contents.subarray) { // non-trivial, and typed array
            buffer.set(contents.subarray(position, position + size), offset);
          } else {
            for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
          }
          return size;
        },
  write(stream, buffer, offset, length, position, canOwn) {
          // The data buffer should be a typed array view
          assert(!(buffer instanceof ArrayBuffer));
          // If the buffer is located in main memory (HEAP), and if
          // memory can grow, we can't hold on to references of the
          // memory buffer, as they may get invalidated. That means we
          // need to do copy its contents.
          if (buffer.buffer === HEAP8.buffer) {
            canOwn = false;
          }
  
          if (!length) return 0;
          var node = stream.node;
          node.timestamp = Date.now();
  
          if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
            if (canOwn) {
              assert(position === 0, 'canOwn must imply no weird position inside the file');
              node.contents = buffer.subarray(offset, offset + length);
              node.usedBytes = length;
              return length;
            } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
              node.contents = buffer.slice(offset, offset + length);
              node.usedBytes = length;
              return length;
            } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
              node.contents.set(buffer.subarray(offset, offset + length), position);
              return length;
            }
          }
  
          // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
          MEMFS.expandFileStorage(node, position+length);
          if (node.contents.subarray && buffer.subarray) {
            // Use typed array write which is available.
            node.contents.set(buffer.subarray(offset, offset + length), position);
          } else {
            for (var i = 0; i < length; i++) {
             node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
            }
          }
          node.usedBytes = Math.max(node.usedBytes, position + length);
          return length;
        },
  llseek(stream, offset, whence) {
          var position = offset;
          if (whence === 1) {
            position += stream.position;
          } else if (whence === 2) {
            if (FS.isFile(stream.node.mode)) {
              position += stream.node.usedBytes;
            }
          }
          if (position < 0) {
            throw new FS.ErrnoError(28);
          }
          return position;
        },
  allocate(stream, offset, length) {
          MEMFS.expandFileStorage(stream.node, offset + length);
          stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
        },
  mmap(stream, length, position, prot, flags) {
          if (!FS.isFile(stream.node.mode)) {
            throw new FS.ErrnoError(43);
          }
          var ptr;
          var allocated;
          var contents = stream.node.contents;
          // Only make a new copy when MAP_PRIVATE is specified.
          if (!(flags & 2) && contents.buffer === HEAP8.buffer) {
            // We can't emulate MAP_SHARED when the file is not backed by the
            // buffer we're mapping to (e.g. the HEAP buffer).
            allocated = false;
            ptr = contents.byteOffset;
          } else {
            // Try to avoid unnecessary slices.
            if (position > 0 || position + length < contents.length) {
              if (contents.subarray) {
                contents = contents.subarray(position, position + length);
              } else {
                contents = Array.prototype.slice.call(contents, position, position + length);
              }
            }
            allocated = true;
            ptr = mmapAlloc(length);
            if (!ptr) {
              throw new FS.ErrnoError(48);
            }
            HEAP8.set(contents, ptr);
          }
          return { ptr, allocated };
        },
  msync(stream, buffer, offset, length, mmapFlags) {
          MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
          // should we check if bytesWritten and length are the same?
          return 0;
        },
  },
  };
  
  /** @param {boolean=} noRunDep */
  var asyncLoad = (url, onload, onerror, noRunDep) => {
      var dep = !noRunDep ? getUniqueRunDependency(`al ${url}`) : '';
      readAsync(url, (arrayBuffer) => {
        assert(arrayBuffer, `Loading data file "${url}" failed (no arrayBuffer).`);
        onload(new Uint8Array(arrayBuffer));
        if (dep) removeRunDependency(dep);
      }, (event) => {
        if (onerror) {
          onerror();
        } else {
          throw `Loading data file "${url}" failed.`;
        }
      });
      if (dep) addRunDependency(dep);
    };
  
  
  var preloadPlugins = Module['preloadPlugins'] || [];
  function FS_handledByPreloadPlugin(byteArray, fullname, finish, onerror) {
      // Ensure plugins are ready.
      if (typeof Browser != 'undefined') Browser.init();
  
      var handled = false;
      preloadPlugins.forEach(function(plugin) {
        if (handled) return;
        if (plugin['canHandle'](fullname)) {
          plugin['handle'](byteArray, fullname, finish, onerror);
          handled = true;
        }
      });
      return handled;
    }
  function FS_createPreloadedFile(parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
      // TODO we should allow people to just pass in a complete filename instead
      // of parent and name being that we just join them anyways
      var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent;
      var dep = getUniqueRunDependency(`cp ${fullname}`); // might have several active requests for the same fullname
      function processData(byteArray) {
        function finish(byteArray) {
          if (preFinish) preFinish();
          if (!dontCreateFile) {
            FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
          }
          if (onload) onload();
          removeRunDependency(dep);
        }
        if (FS_handledByPreloadPlugin(byteArray, fullname, finish, () => {
          if (onerror) onerror();
          removeRunDependency(dep);
        })) {
          return;
        }
        finish(byteArray);
      }
      addRunDependency(dep);
      if (typeof url == 'string') {
        asyncLoad(url, (byteArray) => processData(byteArray), onerror);
      } else {
        processData(url);
      }
    }
  
  function FS_modeStringToFlags(str) {
      var flagModes = {
        'r': 0,
        'r+': 2,
        'w': 512 | 64 | 1,
        'w+': 512 | 64 | 2,
        'a': 1024 | 64 | 1,
        'a+': 1024 | 64 | 2,
      };
      var flags = flagModes[str];
      if (typeof flags == 'undefined') {
        throw new Error(`Unknown file open mode: ${str}`);
      }
      return flags;
    }
  
  function FS_getMode(canRead, canWrite) {
      var mode = 0;
      if (canRead) mode |= 292 | 73;
      if (canWrite) mode |= 146;
      return mode;
    }
  
  
  
  
  
  
  var IDBFS = {
  dbs:{
  },
  indexedDB:() => {
        if (typeof indexedDB != 'undefined') return indexedDB;
        var ret = null;
        if (typeof window == 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
        assert(ret, 'IDBFS used, but indexedDB not supported');
        return ret;
      },
  DB_VERSION:21,
  DB_STORE_NAME:"FILE_DATA",
  mount:function(mount) {
        // reuse all of the core MEMFS functionality
        return MEMFS.mount.apply(null, arguments);
      },
  syncfs:(mount, populate, callback) => {
        IDBFS.getLocalSet(mount, (err, local) => {
          if (err) return callback(err);
  
          IDBFS.getRemoteSet(mount, (err, remote) => {
            if (err) return callback(err);
  
            var src = populate ? remote : local;
            var dst = populate ? local : remote;
  
            IDBFS.reconcile(src, dst, callback);
          });
        });
      },
  quit:() => {
        Object.values(IDBFS.dbs).forEach((value) => value.close());
        IDBFS.dbs = {};
      },
  getDB:(name, callback) => {
        // check the cache first
        var db = IDBFS.dbs[name];
        if (db) {
          return callback(null, db);
        }
  
        var req;
        try {
          req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
        } catch (e) {
          return callback(e);
        }
        if (!req) {
          return callback("Unable to connect to IndexedDB");
        }
        req.onupgradeneeded = (e) => {
          var db = /** @type {IDBDatabase} */ (e.target.result);
          var transaction = e.target.transaction;
  
          var fileStore;
  
          if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
            fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
          } else {
            fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
          }
  
          if (!fileStore.indexNames.contains('timestamp')) {
            fileStore.createIndex('timestamp', 'timestamp', { unique: false });
          }
        };
        req.onsuccess = () => {
          db = /** @type {IDBDatabase} */ (req.result);
  
          // add to the cache
          IDBFS.dbs[name] = db;
          callback(null, db);
        };
        req.onerror = (e) => {
          callback(e.target.error);
          e.preventDefault();
        };
      },
  getLocalSet:(mount, callback) => {
        var entries = {};
  
        function isRealDir(p) {
          return p !== '.' && p !== '..';
        };
        function toAbsolute(root) {
          return (p) => {
            return PATH.join2(root, p);
          }
        };
  
        var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
  
        while (check.length) {
          var path = check.pop();
          var stat;
  
          try {
            stat = FS.stat(path);
          } catch (e) {
            return callback(e);
          }
  
          if (FS.isDir(stat.mode)) {
            check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
          }
  
          entries[path] = { 'timestamp': stat.mtime };
        }
  
        return callback(null, { type: 'local', entries: entries });
      },
  getRemoteSet:(mount, callback) => {
        var entries = {};
  
        IDBFS.getDB(mount.mountpoint, (err, db) => {
          if (err) return callback(err);
  
          try {
            var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
            transaction.onerror = (e) => {
              callback(e.target.error);
              e.preventDefault();
            };
  
            var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
            var index = store.index('timestamp');
  
            index.openKeyCursor().onsuccess = (event) => {
              var cursor = event.target.result;
  
              if (!cursor) {
                return callback(null, { type: 'remote', db, entries });
              }
  
              entries[cursor.primaryKey] = { 'timestamp': cursor.key };
  
              cursor.continue();
            };
          } catch (e) {
            return callback(e);
          }
        });
      },
  loadLocalEntry:(path, callback) => {
        var stat, node;
  
        try {
          var lookup = FS.lookupPath(path);
          node = lookup.node;
          stat = FS.stat(path);
        } catch (e) {
          return callback(e);
        }
  
        if (FS.isDir(stat.mode)) {
          return callback(null, { 'timestamp': stat.mtime, 'mode': stat.mode });
        } else if (FS.isFile(stat.mode)) {
          // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
          // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
          node.contents = MEMFS.getFileDataAsTypedArray(node);
          return callback(null, { 'timestamp': stat.mtime, 'mode': stat.mode, 'contents': node.contents });
        } else {
          return callback(new Error('node type not supported'));
        }
      },
  storeLocalEntry:(path, entry, callback) => {
        try {
          if (FS.isDir(entry['mode'])) {
            FS.mkdirTree(path, entry['mode']);
          } else if (FS.isFile(entry['mode'])) {
            FS.writeFile(path, entry['contents'], { canOwn: true });
          } else {
            return callback(new Error('node type not supported'));
          }
  
          FS.chmod(path, entry['mode']);
          FS.utime(path, entry['timestamp'], entry['timestamp']);
        } catch (e) {
          return callback(e);
        }
  
        callback(null);
      },
  removeLocalEntry:(path, callback) => {
        try {
          var stat = FS.stat(path);
  
          if (FS.isDir(stat.mode)) {
            FS.rmdir(path);
          } else if (FS.isFile(stat.mode)) {
            FS.unlink(path);
          }
        } catch (e) {
          return callback(e);
        }
  
        callback(null);
      },
  loadRemoteEntry:(store, path, callback) => {
        var req = store.get(path);
        req.onsuccess = (event) => { callback(null, event.target.result); };
        req.onerror = (e) => {
          callback(e.target.error);
          e.preventDefault();
        };
      },
  storeRemoteEntry:(store, path, entry, callback) => {
        try {
          var req = store.put(entry, path);
        } catch (e) {
          callback(e);
          return;
        }
        req.onsuccess = () => { callback(null); };
        req.onerror = (e) => {
          callback(e.target.error);
          e.preventDefault();
        };
      },
  removeRemoteEntry:(store, path, callback) => {
        var req = store.delete(path);
        req.onsuccess = () => { callback(null); };
        req.onerror = (e) => {
          callback(e.target.error);
          e.preventDefault();
        };
      },
  reconcile:(src, dst, callback) => {
        var total = 0;
  
        var create = [];
        Object.keys(src.entries).forEach(function (key) {
          var e = src.entries[key];
          var e2 = dst.entries[key];
          if (!e2 || e['timestamp'].getTime() != e2['timestamp'].getTime()) {
            create.push(key);
            total++;
          }
        });
  
        var remove = [];
        Object.keys(dst.entries).forEach(function (key) {
          if (!src.entries[key]) {
            remove.push(key);
            total++;
          }
        });
  
        if (!total) {
          return callback(null);
        }
  
        var errored = false;
        var db = src.type === 'remote' ? src.db : dst.db;
        var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
        var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
  
        function done(err) {
          if (err && !errored) {
            errored = true;
            return callback(err);
          }
        };
  
        transaction.onerror = (e) => {
          done(this.error);
          e.preventDefault();
        };
  
        transaction.oncomplete = (e) => {
          if (!errored) {
            callback(null);
          }
        };
  
        // sort paths in ascending order so directory entries are created
        // before the files inside them
        create.sort().forEach((path) => {
          if (dst.type === 'local') {
            IDBFS.loadRemoteEntry(store, path, (err, entry) => {
              if (err) return done(err);
              IDBFS.storeLocalEntry(path, entry, done);
            });
          } else {
            IDBFS.loadLocalEntry(path, (err, entry) => {
              if (err) return done(err);
              IDBFS.storeRemoteEntry(store, path, entry, done);
            });
          }
        });
  
        // sort paths in descending order so files are deleted before their
        // parent directories
        remove.sort().reverse().forEach((path) => {
          if (dst.type === 'local') {
            IDBFS.removeLocalEntry(path, done);
          } else {
            IDBFS.removeRemoteEntry(store, path, done);
          }
        });
      },
  };
  
  var ERRNO_MESSAGES = {
  0:"Success",
  1:"Arg list too long",
  2:"Permission denied",
  3:"Address already in use",
  4:"Address not available",
  5:"Address family not supported by protocol family",
  6:"No more processes",
  7:"Socket already connected",
  8:"Bad file number",
  9:"Trying to read unreadable message",
  10:"Mount device busy",
  11:"Operation canceled",
  12:"No children",
  13:"Connection aborted",
  14:"Connection refused",
  15:"Connection reset by peer",
  16:"File locking deadlock error",
  17:"Destination address required",
  18:"Math arg out of domain of func",
  19:"Quota exceeded",
  20:"File exists",
  21:"Bad address",
  22:"File too large",
  23:"Host is unreachable",
  24:"Identifier removed",
  25:"Illegal byte sequence",
  26:"Connection already in progress",
  27:"Interrupted system call",
  28:"Invalid argument",
  29:"I/O error",
  30:"Socket is already connected",
  31:"Is a directory",
  32:"Too many symbolic links",
  33:"Too many open files",
  34:"Too many links",
  35:"Message too long",
  36:"Multihop attempted",
  37:"File or path name too long",
  38:"Network interface is not configured",
  39:"Connection reset by network",
  40:"Network is unreachable",
  41:"Too many open files in system",
  42:"No buffer space available",
  43:"No such device",
  44:"No such file or directory",
  45:"Exec format error",
  46:"No record locks available",
  47:"The link has been severed",
  48:"Not enough core",
  49:"No message of desired type",
  50:"Protocol not available",
  51:"No space left on device",
  52:"Function not implemented",
  53:"Socket is not connected",
  54:"Not a directory",
  55:"Directory not empty",
  56:"State not recoverable",
  57:"Socket operation on non-socket",
  59:"Not a typewriter",
  60:"No such device or address",
  61:"Value too large for defined data type",
  62:"Previous owner died",
  63:"Not super-user",
  64:"Broken pipe",
  65:"Protocol error",
  66:"Unknown protocol",
  67:"Protocol wrong type for socket",
  68:"Math result not representable",
  69:"Read only file system",
  70:"Illegal seek",
  71:"No such process",
  72:"Stale file handle",
  73:"Connection timed out",
  74:"Text file busy",
  75:"Cross-device link",
  100:"Device not a stream",
  101:"Bad font file fmt",
  102:"Invalid slot",
  103:"Invalid request code",
  104:"No anode",
  105:"Block device required",
  106:"Channel number out of range",
  107:"Level 3 halted",
  108:"Level 3 reset",
  109:"Link number out of range",
  110:"Protocol driver not attached",
  111:"No CSI structure available",
  112:"Level 2 halted",
  113:"Invalid exchange",
  114:"Invalid request descriptor",
  115:"Exchange full",
  116:"No data (for no delay io)",
  117:"Timer expired",
  118:"Out of streams resources",
  119:"Machine is not on the network",
  120:"Package not installed",
  121:"The object is remote",
  122:"Advertise error",
  123:"Srmount error",
  124:"Communication error on send",
  125:"Cross mount point (not really error)",
  126:"Given log. name not unique",
  127:"f.d. invalid for this operation",
  128:"Remote address changed",
  129:"Can   access a needed shared lib",
  130:"Accessing a corrupted shared lib",
  131:".lib section in a.out corrupted",
  132:"Attempting to link in too many libs",
  133:"Attempting to exec a shared library",
  135:"Streams pipe error",
  136:"Too many users",
  137:"Socket type not supported",
  138:"Not supported",
  139:"Protocol family not supported",
  140:"Can't send after socket shutdown",
  141:"Too many references",
  142:"Host is down",
  148:"No medium (in tape drive)",
  156:"Level 2 not synchronized",
  };
  
  var ERRNO_CODES = {
  };
  
  function demangle(func) {
      warnOnce('warning: build with -sDEMANGLE_SUPPORT to link in libcxxabi demangling');
      return func;
    }
  function demangleAll(text) {
      var regex =
        /\b_Z[\w\d_]+/g;
      return text.replace(regex,
        function(x) {
          var y = demangle(x);
          return x === y ? x : (y + ' [' + x + ']');
        });
    }
  var FS = {
  root:null,
  mounts:[],
  devices:{
  },
  streams:[],
  nextInode:1,
  nameTable:null,
  currentPath:"/",
  initialized:false,
  ignorePermissions:true,
  ErrnoError:null,
  genericErrors:{
  },
  filesystems:null,
  syncFSRequests:0,
  lookupPath:(path, opts = {}) => {
        path = PATH_FS.resolve(path);
  
        if (!path) return { path: '', node: null };
  
        var defaults = {
          follow_mount: true,
          recurse_count: 0
        };
        opts = Object.assign(defaults, opts)
  
        if (opts.recurse_count > 8) {  // max recursive lookup of 8
          throw new FS.ErrnoError(32);
        }
  
        // split the absolute path
        var parts = path.split('/').filter((p) => !!p);
  
        // start at the root
        var current = FS.root;
        var current_path = '/';
  
        for (var i = 0; i < parts.length; i++) {
          var islast = (i === parts.length-1);
          if (islast && opts.parent) {
            // stop resolving
            break;
          }
  
          current = FS.lookupNode(current, parts[i]);
          current_path = PATH.join2(current_path, parts[i]);
  
          // jump to the mount's root node if this is a mountpoint
          if (FS.isMountpoint(current)) {
            if (!islast || (islast && opts.follow_mount)) {
              current = current.mounted.root;
            }
          }
  
          // by default, lookupPath will not follow a symlink if it is the final path component.
          // setting opts.follow = true will override this behavior.
          if (!islast || opts.follow) {
            var count = 0;
            while (FS.isLink(current.mode)) {
              var link = FS.readlink(current_path);
              current_path = PATH_FS.resolve(PATH.dirname(current_path), link);
  
              var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count + 1 });
              current = lookup.node;
  
              if (count++ > 40) {  // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
                throw new FS.ErrnoError(32);
              }
            }
          }
        }
  
        return { path: current_path, node: current };
      },
  getPath:(node) => {
        var path;
        while (true) {
          if (FS.isRoot(node)) {
            var mount = node.mount.mountpoint;
            if (!path) return mount;
            return mount[mount.length-1] !== '/' ? `${mount}/${path}` : mount + path;
          }
          path = path ? `${node.name}/${path}` : node.name;
          node = node.parent;
        }
      },
  hashName:(parentid, name) => {
        var hash = 0;
  
        for (var i = 0; i < name.length; i++) {
          hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
        }
        return ((parentid + hash) >>> 0) % FS.nameTable.length;
      },
  hashAddNode:(node) => {
        var hash = FS.hashName(node.parent.id, node.name);
        node.name_next = FS.nameTable[hash];
        FS.nameTable[hash] = node;
      },
  hashRemoveNode:(node) => {
        var hash = FS.hashName(node.parent.id, node.name);
        if (FS.nameTable[hash] === node) {
          FS.nameTable[hash] = node.name_next;
        } else {
          var current = FS.nameTable[hash];
          while (current) {
            if (current.name_next === node) {
              current.name_next = node.name_next;
              break;
            }
            current = current.name_next;
          }
        }
      },
  lookupNode:(parent, name) => {
        var errCode = FS.mayLookup(parent);
        if (errCode) {
          throw new FS.ErrnoError(errCode, parent);
        }
        var hash = FS.hashName(parent.id, name);
        for (var node = FS.nameTable[hash]; node; node = node.name_next) {
          var nodeName = node.name;
          if (node.parent.id === parent.id && nodeName === name) {
            return node;
          }
        }
        // if we failed to find it in the cache, call into the VFS
        return FS.lookup(parent, name);
      },
  createNode:(parent, name, mode, rdev) => {
        assert(typeof parent == 'object')
        var node = new FS.FSNode(parent, name, mode, rdev);
  
        FS.hashAddNode(node);
  
        return node;
      },
  destroyNode:(node) => {
        FS.hashRemoveNode(node);
      },
  isRoot:(node) => {
        return node === node.parent;
      },
  isMountpoint:(node) => {
        return !!node.mounted;
      },
  isFile:(mode) => {
        return (mode & 61440) === 32768;
      },
  isDir:(mode) => {
        return (mode & 61440) === 16384;
      },
  isLink:(mode) => {
        return (mode & 61440) === 40960;
      },
  isChrdev:(mode) => {
        return (mode & 61440) === 8192;
      },
  isBlkdev:(mode) => {
        return (mode & 61440) === 24576;
      },
  isFIFO:(mode) => {
        return (mode & 61440) === 4096;
      },
  isSocket:(mode) => {
        return (mode & 49152) === 49152;
      },
  flagsToPermissionString:(flag) => {
        var perms = ['r', 'w', 'rw'][flag & 3];
        if ((flag & 512)) {
          perms += 'w';
        }
        return perms;
      },
  nodePermissions:(node, perms) => {
        if (FS.ignorePermissions) {
          return 0;
        }
        // return 0 if any user, group or owner bits are set.
        if (perms.includes('r') && !(node.mode & 292)) {
          return 2;
        } else if (perms.includes('w') && !(node.mode & 146)) {
          return 2;
        } else if (perms.includes('x') && !(node.mode & 73)) {
          return 2;
        }
        return 0;
      },
  mayLookup:(dir) => {
        var errCode = FS.nodePermissions(dir, 'x');
        if (errCode) return errCode;
        if (!dir.node_ops.lookup) return 2;
        return 0;
      },
  mayCreate:(dir, name) => {
        try {
          var node = FS.lookupNode(dir, name);
          return 20;
        } catch (e) {
        }
        return FS.nodePermissions(dir, 'wx');
      },
  mayDelete:(dir, name, isdir) => {
        var node;
        try {
          node = FS.lookupNode(dir, name);
        } catch (e) {
          return e.errno;
        }
        var errCode = FS.nodePermissions(dir, 'wx');
        if (errCode) {
          return errCode;
        }
        if (isdir) {
          if (!FS.isDir(node.mode)) {
            return 54;
          }
          if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
            return 10;
          }
        } else {
          if (FS.isDir(node.mode)) {
            return 31;
          }
        }
        return 0;
      },
  mayOpen:(node, flags) => {
        if (!node) {
          return 44;
        }
        if (FS.isLink(node.mode)) {
          return 32;
        } else if (FS.isDir(node.mode)) {
          if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
              (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
            return 31;
          }
        }
        return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
      },
  MAX_OPEN_FDS:4096,
  nextfd:() => {
        for (var fd = 0; fd <= FS.MAX_OPEN_FDS; fd++) {
          if (!FS.streams[fd]) {
            return fd;
          }
        }
        throw new FS.ErrnoError(33);
      },
  getStreamChecked:(fd) => {
        var stream = FS.getStream(fd);
        if (!stream) {
          throw new FS.ErrnoError(8);
        }
        return stream;
      },
  getStream:(fd) => FS.streams[fd],
  createStream:(stream, fd = -1) => {
        if (!FS.FSStream) {
          FS.FSStream = /** @constructor */ function() {
            this.shared = { };
          };
          FS.FSStream.prototype = {};
          Object.defineProperties(FS.FSStream.prototype, {
            object: {
              /** @this {FS.FSStream} */
              get() { return this.node; },
              /** @this {FS.FSStream} */
              set(val) { this.node = val; }
            },
            isRead: {
              /** @this {FS.FSStream} */
              get() { return (this.flags & 2097155) !== 1; }
            },
            isWrite: {
              /** @this {FS.FSStream} */
              get() { return (this.flags & 2097155) !== 0; }
            },
            isAppend: {
              /** @this {FS.FSStream} */
              get() { return (this.flags & 1024); }
            },
            flags: {
              /** @this {FS.FSStream} */
              get() { return this.shared.flags; },
              /** @this {FS.FSStream} */
              set(val) { this.shared.flags = val; },
            },
            position : {
              /** @this {FS.FSStream} */
              get() { return this.shared.position; },
              /** @this {FS.FSStream} */
              set(val) { this.shared.position = val; },
            },
          });
        }
        // clone it, so we can return an instance of FSStream
        stream = Object.assign(new FS.FSStream(), stream);
        if (fd == -1) {
          fd = FS.nextfd();
        }
        stream.fd = fd;
        FS.streams[fd] = stream;
        return stream;
      },
  closeStream:(fd) => {
        FS.streams[fd] = null;
      },
  chrdev_stream_ops:{
  open:(stream) => {
          var device = FS.getDevice(stream.node.rdev);
          // override node's stream ops with the device's
          stream.stream_ops = device.stream_ops;
          // forward the open call
          if (stream.stream_ops.open) {
            stream.stream_ops.open(stream);
          }
        },
  llseek:() => {
          throw new FS.ErrnoError(70);
        },
  },
  major:(dev) => ((dev) >> 8),
  minor:(dev) => ((dev) & 0xff),
  makedev:(ma, mi) => ((ma) << 8 | (mi)),
  registerDevice:(dev, ops) => {
        FS.devices[dev] = { stream_ops: ops };
      },
  getDevice:(dev) => FS.devices[dev],
  getMounts:(mount) => {
        var mounts = [];
        var check = [mount];
  
        while (check.length) {
          var m = check.pop();
  
          mounts.push(m);
  
          check.push.apply(check, m.mounts);
        }
  
        return mounts;
      },
  syncfs:(populate, callback) => {
        if (typeof populate == 'function') {
          callback = populate;
          populate = false;
        }
  
        FS.syncFSRequests++;
  
        if (FS.syncFSRequests > 1) {
          err(`warning: ${FS.syncFSRequests} FS.syncfs operations in flight at once, probably just doing extra work`);
        }
  
        var mounts = FS.getMounts(FS.root.mount);
        var completed = 0;
  
        function doCallback(errCode) {
          assert(FS.syncFSRequests > 0);
          FS.syncFSRequests--;
          return callback(errCode);
        }
  
        function done(errCode) {
          if (errCode) {
            if (!done.errored) {
              done.errored = true;
              return doCallback(errCode);
            }
            return;
          }
          if (++completed >= mounts.length) {
            doCallback(null);
          }
        };
  
        // sync all mounts
        mounts.forEach((mount) => {
          if (!mount.type.syncfs) {
            return done(null);
          }
          mount.type.syncfs(mount, populate, done);
        });
      },
  mount:(type, opts, mountpoint) => {
        if (typeof type == 'string') {
          // The filesystem was not included, and instead we have an error
          // message stored in the variable.
          throw type;
        }
        var root = mountpoint === '/';
        var pseudo = !mountpoint;
        var node;
  
        if (root && FS.root) {
          throw new FS.ErrnoError(10);
        } else if (!root && !pseudo) {
          var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
  
          mountpoint = lookup.path;  // use the absolute path
          node = lookup.node;
  
          if (FS.isMountpoint(node)) {
            throw new FS.ErrnoError(10);
          }
  
          if (!FS.isDir(node.mode)) {
            throw new FS.ErrnoError(54);
          }
        }
  
        var mount = {
          type,
          opts,
          mountpoint,
          mounts: []
        };
  
        // create a root node for the fs
        var mountRoot = type.mount(mount);
        mountRoot.mount = mount;
        mount.root = mountRoot;
  
        if (root) {
          FS.root = mountRoot;
        } else if (node) {
          // set as a mountpoint
          node.mounted = mount;
  
          // add the new mount to the current mount's children
          if (node.mount) {
            node.mount.mounts.push(mount);
          }
        }
  
        return mountRoot;
      },
  unmount:(mountpoint) => {
        var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
  
        if (!FS.isMountpoint(lookup.node)) {
          throw new FS.ErrnoError(28);
        }
  
        // destroy the nodes for this mount, and all its child mounts
        var node = lookup.node;
        var mount = node.mounted;
        var mounts = FS.getMounts(mount);
  
        Object.keys(FS.nameTable).forEach((hash) => {
          var current = FS.nameTable[hash];
  
          while (current) {
            var next = current.name_next;
  
            if (mounts.includes(current.mount)) {
              FS.destroyNode(current);
            }
  
            current = next;
          }
        });
  
        // no longer a mountpoint
        node.mounted = null;
  
        // remove this mount from the child mounts
        var idx = node.mount.mounts.indexOf(mount);
        assert(idx !== -1);
        node.mount.mounts.splice(idx, 1);
      },
  lookup:(parent, name) => {
        return parent.node_ops.lookup(parent, name);
      },
  mknod:(path, mode, dev) => {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        if (!name || name === '.' || name === '..') {
          throw new FS.ErrnoError(28);
        }
        var errCode = FS.mayCreate(parent, name);
        if (errCode) {
          throw new FS.ErrnoError(errCode);
        }
        if (!parent.node_ops.mknod) {
          throw new FS.ErrnoError(63);
        }
        return parent.node_ops.mknod(parent, name, mode, dev);
      },
  create:(path, mode) => {
        mode = mode !== undefined ? mode : 438 /* 0666 */;
        mode &= 4095;
        mode |= 32768;
        return FS.mknod(path, mode, 0);
      },
  mkdir:(path, mode) => {
        mode = mode !== undefined ? mode : 511 /* 0777 */;
        mode &= 511 | 512;
        mode |= 16384;
        return FS.mknod(path, mode, 0);
      },
  mkdirTree:(path, mode) => {
        var dirs = path.split('/');
        var d = '';
        for (var i = 0; i < dirs.length; ++i) {
          if (!dirs[i]) continue;
          d += '/' + dirs[i];
          try {
            FS.mkdir(d, mode);
          } catch(e) {
            if (e.errno != 20) throw e;
          }
        }
      },
  mkdev:(path, mode, dev) => {
        if (typeof dev == 'undefined') {
          dev = mode;
          mode = 438 /* 0666 */;
        }
        mode |= 8192;
        return FS.mknod(path, mode, dev);
      },
  symlink:(oldpath, newpath) => {
        if (!PATH_FS.resolve(oldpath)) {
          throw new FS.ErrnoError(44);
        }
        var lookup = FS.lookupPath(newpath, { parent: true });
        var parent = lookup.node;
        if (!parent) {
          throw new FS.ErrnoError(44);
        }
        var newname = PATH.basename(newpath);
        var errCode = FS.mayCreate(parent, newname);
        if (errCode) {
          throw new FS.ErrnoError(errCode);
        }
        if (!parent.node_ops.symlink) {
          throw new FS.ErrnoError(63);
        }
        return parent.node_ops.symlink(parent, newname, oldpath);
      },
  rename:(old_path, new_path) => {
        var old_dirname = PATH.dirname(old_path);
        var new_dirname = PATH.dirname(new_path);
        var old_name = PATH.basename(old_path);
        var new_name = PATH.basename(new_path);
        // parents must exist
        var lookup, old_dir, new_dir;
  
        // let the errors from non existant directories percolate up
        lookup = FS.lookupPath(old_path, { parent: true });
        old_dir = lookup.node;
        lookup = FS.lookupPath(new_path, { parent: true });
        new_dir = lookup.node;
  
        if (!old_dir || !new_dir) throw new FS.ErrnoError(44);
        // need to be part of the same mount
        if (old_dir.mount !== new_dir.mount) {
          throw new FS.ErrnoError(75);
        }
        // source must exist
        var old_node = FS.lookupNode(old_dir, old_name);
        // old path should not be an ancestor of the new path
        var relative = PATH_FS.relative(old_path, new_dirname);
        if (relative.charAt(0) !== '.') {
          throw new FS.ErrnoError(28);
        }
        // new path should not be an ancestor of the old path
        relative = PATH_FS.relative(new_path, old_dirname);
        if (relative.charAt(0) !== '.') {
          throw new FS.ErrnoError(55);
        }
        // see if the new path already exists
        var new_node;
        try {
          new_node = FS.lookupNode(new_dir, new_name);
        } catch (e) {
          // not fatal
        }
        // early out if nothing needs to change
        if (old_node === new_node) {
          return;
        }
        // we'll need to delete the old entry
        var isdir = FS.isDir(old_node.mode);
        var errCode = FS.mayDelete(old_dir, old_name, isdir);
        if (errCode) {
          throw new FS.ErrnoError(errCode);
        }
        // need delete permissions if we'll be overwriting.
        // need create permissions if new doesn't already exist.
        errCode = new_node ?
          FS.mayDelete(new_dir, new_name, isdir) :
          FS.mayCreate(new_dir, new_name);
        if (errCode) {
          throw new FS.ErrnoError(errCode);
        }
        if (!old_dir.node_ops.rename) {
          throw new FS.ErrnoError(63);
        }
        if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
          throw new FS.ErrnoError(10);
        }
        // if we are going to change the parent, check write permissions
        if (new_dir !== old_dir) {
          errCode = FS.nodePermissions(old_dir, 'w');
          if (errCode) {
            throw new FS.ErrnoError(errCode);
          }
        }
        // remove the node from the lookup hash
        FS.hashRemoveNode(old_node);
        // do the underlying fs rename
        try {
          old_dir.node_ops.rename(old_node, new_dir, new_name);
        } catch (e) {
          throw e;
        } finally {
          // add the node back to the hash (in case node_ops.rename
          // changed its name)
          FS.hashAddNode(old_node);
        }
      },
  rmdir:(path) => {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        var node = FS.lookupNode(parent, name);
        var errCode = FS.mayDelete(parent, name, true);
        if (errCode) {
          throw new FS.ErrnoError(errCode);
        }
        if (!parent.node_ops.rmdir) {
          throw new FS.ErrnoError(63);
        }
        if (FS.isMountpoint(node)) {
          throw new FS.ErrnoError(10);
        }
        parent.node_ops.rmdir(parent, name);
        FS.destroyNode(node);
      },
  readdir:(path) => {
        var lookup = FS.lookupPath(path, { follow: true });
        var node = lookup.node;
        if (!node.node_ops.readdir) {
          throw new FS.ErrnoError(54);
        }
        return node.node_ops.readdir(node);
      },
  unlink:(path) => {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        if (!parent) {
          throw new FS.ErrnoError(44);
        }
        var name = PATH.basename(path);
        var node = FS.lookupNode(parent, name);
        var errCode = FS.mayDelete(parent, name, false);
        if (errCode) {
          // According to POSIX, we should map EISDIR to EPERM, but
          // we instead do what Linux does (and we must, as we use
          // the musl linux libc).
          throw new FS.ErrnoError(errCode);
        }
        if (!parent.node_ops.unlink) {
          throw new FS.ErrnoError(63);
        }
        if (FS.isMountpoint(node)) {
          throw new FS.ErrnoError(10);
        }
        parent.node_ops.unlink(parent, name);
        FS.destroyNode(node);
      },
  readlink:(path) => {
        var lookup = FS.lookupPath(path);
        var link = lookup.node;
        if (!link) {
          throw new FS.ErrnoError(44);
        }
        if (!link.node_ops.readlink) {
          throw new FS.ErrnoError(28);
        }
        return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
      },
  stat:(path, dontFollow) => {
        var lookup = FS.lookupPath(path, { follow: !dontFollow });
        var node = lookup.node;
        if (!node) {
          throw new FS.ErrnoError(44);
        }
        if (!node.node_ops.getattr) {
          throw new FS.ErrnoError(63);
        }
        return node.node_ops.getattr(node);
      },
  lstat:(path) => {
        return FS.stat(path, true);
      },
  chmod:(path, mode, dontFollow) => {
        var node;
        if (typeof path == 'string') {
          var lookup = FS.lookupPath(path, { follow: !dontFollow });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(63);
        }
        node.node_ops.setattr(node, {
          mode: (mode & 4095) | (node.mode & ~4095),
          timestamp: Date.now()
        });
      },
  lchmod:(path, mode) => {
        FS.chmod(path, mode, true);
      },
  fchmod:(fd, mode) => {
        var stream = FS.getStreamChecked(fd);
        FS.chmod(stream.node, mode);
      },
  chown:(path, uid, gid, dontFollow) => {
        var node;
        if (typeof path == 'string') {
          var lookup = FS.lookupPath(path, { follow: !dontFollow });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(63);
        }
        node.node_ops.setattr(node, {
          timestamp: Date.now()
          // we ignore the uid / gid for now
        });
      },
  lchown:(path, uid, gid) => {
        FS.chown(path, uid, gid, true);
      },
  fchown:(fd, uid, gid) => {
        var stream = FS.getStreamChecked(fd);
        FS.chown(stream.node, uid, gid);
      },
  truncate:(path, len) => {
        if (len < 0) {
          throw new FS.ErrnoError(28);
        }
        var node;
        if (typeof path == 'string') {
          var lookup = FS.lookupPath(path, { follow: true });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(63);
        }
        if (FS.isDir(node.mode)) {
          throw new FS.ErrnoError(31);
        }
        if (!FS.isFile(node.mode)) {
          throw new FS.ErrnoError(28);
        }
        var errCode = FS.nodePermissions(node, 'w');
        if (errCode) {
          throw new FS.ErrnoError(errCode);
        }
        node.node_ops.setattr(node, {
          size: len,
          timestamp: Date.now()
        });
      },
  ftruncate:(fd, len) => {
        var stream = FS.getStreamChecked(fd);
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(28);
        }
        FS.truncate(stream.node, len);
      },
  utime:(path, atime, mtime) => {
        var lookup = FS.lookupPath(path, { follow: true });
        var node = lookup.node;
        node.node_ops.setattr(node, {
          timestamp: Math.max(atime, mtime)
        });
      },
  open:(path, flags, mode) => {
        if (path === "") {
          throw new FS.ErrnoError(44);
        }
        flags = typeof flags == 'string' ? FS_modeStringToFlags(flags) : flags;
        mode = typeof mode == 'undefined' ? 438 /* 0666 */ : mode;
        if ((flags & 64)) {
          mode = (mode & 4095) | 32768;
        } else {
          mode = 0;
        }
        var node;
        if (typeof path == 'object') {
          node = path;
        } else {
          path = PATH.normalize(path);
          try {
            var lookup = FS.lookupPath(path, {
              follow: !(flags & 131072)
            });
            node = lookup.node;
          } catch (e) {
            // ignore
          }
        }
        // perhaps we need to create the node
        var created = false;
        if ((flags & 64)) {
          if (node) {
            // if O_CREAT and O_EXCL are set, error out if the node already exists
            if ((flags & 128)) {
              throw new FS.ErrnoError(20);
            }
          } else {
            // node doesn't exist, try to create it
            node = FS.mknod(path, mode, 0);
            created = true;
          }
        }
        if (!node) {
          throw new FS.ErrnoError(44);
        }
        // can't truncate a device
        if (FS.isChrdev(node.mode)) {
          flags &= ~512;
        }
        // if asked only for a directory, then this must be one
        if ((flags & 65536) && !FS.isDir(node.mode)) {
          throw new FS.ErrnoError(54);
        }
        // check permissions, if this is not a file we just created now (it is ok to
        // create and write to a file with read-only permissions; it is read-only
        // for later use)
        if (!created) {
          var errCode = FS.mayOpen(node, flags);
          if (errCode) {
            throw new FS.ErrnoError(errCode);
          }
        }
        // do truncation if necessary
        if ((flags & 512) && !created) {
          FS.truncate(node, 0);
        }
        // we've already handled these, don't pass down to the underlying vfs
        flags &= ~(128 | 512 | 131072);
  
        // register the stream with the filesystem
        var stream = FS.createStream({
          node,
          path: FS.getPath(node),  // we want the absolute path to the node
          flags,
          seekable: true,
          position: 0,
          stream_ops: node.stream_ops,
          // used by the file family libc calls (fopen, fwrite, ferror, etc.)
          ungotten: [],
          error: false
        });
        // call the new stream's open function
        if (stream.stream_ops.open) {
          stream.stream_ops.open(stream);
        }
        if (Module['logReadFiles'] && !(flags & 1)) {
          if (!FS.readFiles) FS.readFiles = {};
          if (!(path in FS.readFiles)) {
            FS.readFiles[path] = 1;
          }
        }
        return stream;
      },
  close:(stream) => {
        if (FS.isClosed(stream)) {
          throw new FS.ErrnoError(8);
        }
        if (stream.getdents) stream.getdents = null; // free readdir state
        try {
          if (stream.stream_ops.close) {
            stream.stream_ops.close(stream);
          }
        } catch (e) {
          throw e;
        } finally {
          FS.closeStream(stream.fd);
        }
        stream.fd = null;
      },
  isClosed:(stream) => {
        return stream.fd === null;
      },
  llseek:(stream, offset, whence) => {
        if (FS.isClosed(stream)) {
          throw new FS.ErrnoError(8);
        }
        if (!stream.seekable || !stream.stream_ops.llseek) {
          throw new FS.ErrnoError(70);
        }
        if (whence != 0 && whence != 1 && whence != 2) {
          throw new FS.ErrnoError(28);
        }
        stream.position = stream.stream_ops.llseek(stream, offset, whence);
        stream.ungotten = [];
        return stream.position;
      },
  read:(stream, buffer, offset, length, position) => {
        assert(offset >= 0);
        if (length < 0 || position < 0) {
          throw new FS.ErrnoError(28);
        }
        if (FS.isClosed(stream)) {
          throw new FS.ErrnoError(8);
        }
        if ((stream.flags & 2097155) === 1) {
          throw new FS.ErrnoError(8);
        }
        if (FS.isDir(stream.node.mode)) {
          throw new FS.ErrnoError(31);
        }
        if (!stream.stream_ops.read) {
          throw new FS.ErrnoError(28);
        }
        var seeking = typeof position != 'undefined';
        if (!seeking) {
          position = stream.position;
        } else if (!stream.seekable) {
          throw new FS.ErrnoError(70);
        }
        var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
        if (!seeking) stream.position += bytesRead;
        return bytesRead;
      },
  write:(stream, buffer, offset, length, position, canOwn) => {
        assert(offset >= 0);
        if (length < 0 || position < 0) {
          throw new FS.ErrnoError(28);
        }
        if (FS.isClosed(stream)) {
          throw new FS.ErrnoError(8);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(8);
        }
        if (FS.isDir(stream.node.mode)) {
          throw new FS.ErrnoError(31);
        }
        if (!stream.stream_ops.write) {
          throw new FS.ErrnoError(28);
        }
        if (stream.seekable && stream.flags & 1024) {
          // seek to the end before writing in append mode
          FS.llseek(stream, 0, 2);
        }
        var seeking = typeof position != 'undefined';
        if (!seeking) {
          position = stream.position;
        } else if (!stream.seekable) {
          throw new FS.ErrnoError(70);
        }
        var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
        if (!seeking) stream.position += bytesWritten;
        return bytesWritten;
      },
  allocate:(stream, offset, length) => {
        if (FS.isClosed(stream)) {
          throw new FS.ErrnoError(8);
        }
        if (offset < 0 || length <= 0) {
          throw new FS.ErrnoError(28);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(8);
        }
        if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
          throw new FS.ErrnoError(43);
        }
        if (!stream.stream_ops.allocate) {
          throw new FS.ErrnoError(138);
        }
        stream.stream_ops.allocate(stream, offset, length);
      },
  mmap:(stream, length, position, prot, flags) => {
        // User requests writing to file (prot & PROT_WRITE != 0).
        // Checking if we have permissions to write to the file unless
        // MAP_PRIVATE flag is set. According to POSIX spec it is possible
        // to write to file opened in read-only mode with MAP_PRIVATE flag,
        // as all modifications will be visible only in the memory of
        // the current process.
        if ((prot & 2) !== 0
            && (flags & 2) === 0
            && (stream.flags & 2097155) !== 2) {
          throw new FS.ErrnoError(2);
        }
        if ((stream.flags & 2097155) === 1) {
          throw new FS.ErrnoError(2);
        }
        if (!stream.stream_ops.mmap) {
          throw new FS.ErrnoError(43);
        }
        return stream.stream_ops.mmap(stream, length, position, prot, flags);
      },
  msync:(stream, buffer, offset, length, mmapFlags) => {
        assert(offset >= 0);
        if (!stream.stream_ops.msync) {
          return 0;
        }
        return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
      },
  munmap:(stream) => 0,
  ioctl:(stream, cmd, arg) => {
        if (!stream.stream_ops.ioctl) {
          throw new FS.ErrnoError(59);
        }
        return stream.stream_ops.ioctl(stream, cmd, arg);
      },
  readFile:(path, opts = {}) => {
        opts.flags = opts.flags || 0;
        opts.encoding = opts.encoding || 'binary';
        if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
          throw new Error(`Invalid encoding type "${opts.encoding}"`);
        }
        var ret;
        var stream = FS.open(path, opts.flags);
        var stat = FS.stat(path);
        var length = stat.size;
        var buf = new Uint8Array(length);
        FS.read(stream, buf, 0, length, 0);
        if (opts.encoding === 'utf8') {
          ret = UTF8ArrayToString(buf, 0);
        } else if (opts.encoding === 'binary') {
          ret = buf;
        }
        FS.close(stream);
        return ret;
      },
  writeFile:(path, data, opts = {}) => {
        opts.flags = opts.flags || 577;
        var stream = FS.open(path, opts.flags, opts.mode);
        if (typeof data == 'string') {
          var buf = new Uint8Array(lengthBytesUTF8(data)+1);
          var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
          FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
        } else if (ArrayBuffer.isView(data)) {
          FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
        } else {
          throw new Error('Unsupported data type');
        }
        FS.close(stream);
      },
  cwd:() => FS.currentPath,
  chdir:(path) => {
        var lookup = FS.lookupPath(path, { follow: true });
        if (lookup.node === null) {
          throw new FS.ErrnoError(44);
        }
        if (!FS.isDir(lookup.node.mode)) {
          throw new FS.ErrnoError(54);
        }
        var errCode = FS.nodePermissions(lookup.node, 'x');
        if (errCode) {
          throw new FS.ErrnoError(errCode);
        }
        FS.currentPath = lookup.path;
      },
  createDefaultDirectories:() => {
        FS.mkdir('/tmp');
        FS.mkdir('/home');
        FS.mkdir('/home/web_user');
      },
  createDefaultDevices:() => {
        // create /dev
        FS.mkdir('/dev');
        // setup /dev/null
        FS.registerDevice(FS.makedev(1, 3), {
          read: () => 0,
          write: (stream, buffer, offset, length, pos) => length,
        });
        FS.mkdev('/dev/null', FS.makedev(1, 3));
        // setup /dev/tty and /dev/tty1
        // stderr needs to print output using err() rather than out()
        // so we register a second tty just for it.
        TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
        TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
        FS.mkdev('/dev/tty', FS.makedev(5, 0));
        FS.mkdev('/dev/tty1', FS.makedev(6, 0));
        // setup /dev/[u]random
        // use a buffer to avoid overhead of individual crypto calls per byte
        var randomBuffer = new Uint8Array(1024), randomLeft = 0;
        var randomByte = () => {
          if (randomLeft === 0) {
            randomLeft = randomFill(randomBuffer).byteLength;
          }
          return randomBuffer[--randomLeft];
        };
        FS.createDevice('/dev', 'random', randomByte);
        FS.createDevice('/dev', 'urandom', randomByte);
        // we're not going to emulate the actual shm device,
        // just create the tmp dirs that reside in it commonly
        FS.mkdir('/dev/shm');
        FS.mkdir('/dev/shm/tmp');
      },
  createSpecialDirectories:() => {
        // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the
        // name of the stream for fd 6 (see test_unistd_ttyname)
        FS.mkdir('/proc');
        var proc_self = FS.mkdir('/proc/self');
        FS.mkdir('/proc/self/fd');
        FS.mount({
          mount: () => {
            var node = FS.createNode(proc_self, 'fd', 16384 | 511 /* 0777 */, 73);
            node.node_ops = {
              lookup: (parent, name) => {
                var fd = +name;
                var stream = FS.getStreamChecked(fd);
                var ret = {
                  parent: null,
                  mount: { mountpoint: 'fake' },
                  node_ops: { readlink: () => stream.path },
                };
                ret.parent = ret; // make it look like a simple root node
                return ret;
              }
            };
            return node;
          }
        }, {}, '/proc/self/fd');
      },
  createStandardStreams:() => {
        // TODO deprecate the old functionality of a single
        // input / output callback and that utilizes FS.createDevice
        // and instead require a unique set of stream ops
  
        // by default, we symlink the standard streams to the
        // default tty devices. however, if the standard streams
        // have been overwritten we create a unique device for
        // them instead.
        if (Module['stdin']) {
          FS.createDevice('/dev', 'stdin', Module['stdin']);
        } else {
          FS.symlink('/dev/tty', '/dev/stdin');
        }
        if (Module['stdout']) {
          FS.createDevice('/dev', 'stdout', null, Module['stdout']);
        } else {
          FS.symlink('/dev/tty', '/dev/stdout');
        }
        if (Module['stderr']) {
          FS.createDevice('/dev', 'stderr', null, Module['stderr']);
        } else {
          FS.symlink('/dev/tty1', '/dev/stderr');
        }
  
        // open default streams for the stdin, stdout and stderr devices
        var stdin = FS.open('/dev/stdin', 0);
        var stdout = FS.open('/dev/stdout', 1);
        var stderr = FS.open('/dev/stderr', 1);
        assert(stdin.fd === 0, `invalid handle for stdin (${stdin.fd})`);
        assert(stdout.fd === 1, `invalid handle for stdout (${stdout.fd})`);
        assert(stderr.fd === 2, `invalid handle for stderr (${stderr.fd})`);
      },
  ensureErrnoError:() => {
        if (FS.ErrnoError) return;
        FS.ErrnoError = /** @this{Object} */ function ErrnoError(errno, node) {
          // We set the `name` property to be able to identify `FS.ErrnoError`
          // - the `name` is a standard ECMA-262 property of error objects. Kind of good to have it anyway.
          // - when using PROXYFS, an error can come from an underlying FS
          // as different FS objects have their own FS.ErrnoError each,
          // the test `err instanceof FS.ErrnoError` won't detect an error coming from another filesystem, causing bugs.
          // we'll use the reliable test `err.name == "ErrnoError"` instead
          this.name = 'ErrnoError';
          this.node = node;
          this.setErrno = /** @this{Object} */ function(errno) {
            this.errno = errno;
            for (var key in ERRNO_CODES) {
              if (ERRNO_CODES[key] === errno) {
                this.code = key;
                break;
              }
            }
          };
          this.setErrno(errno);
          this.message = ERRNO_MESSAGES[errno];
  
          // Try to get a maximally helpful stack trace. On Node.js, getting Error.stack
          // now ensures it shows what we want.
          if (this.stack) {
            // Define the stack property for Node.js 4, which otherwise errors on the next line.
            Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true });
            this.stack = demangleAll(this.stack);
          }
        };
        FS.ErrnoError.prototype = new Error();
        FS.ErrnoError.prototype.constructor = FS.ErrnoError;
        // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
        [44].forEach((code) => {
          FS.genericErrors[code] = new FS.ErrnoError(code);
          FS.genericErrors[code].stack = '<generic error, no stack>';
        });
      },
  staticInit:() => {
        FS.ensureErrnoError();
  
        FS.nameTable = new Array(4096);
  
        FS.mount(MEMFS, {}, '/');
  
        FS.createDefaultDirectories();
        FS.createDefaultDevices();
        FS.createSpecialDirectories();
  
        FS.filesystems = {
          'MEMFS': MEMFS,
          'IDBFS': IDBFS,
        };
      },
  init:(input, output, error) => {
        assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
        FS.init.initialized = true;
  
        FS.ensureErrnoError();
  
        // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
        Module['stdin'] = input || Module['stdin'];
        Module['stdout'] = output || Module['stdout'];
        Module['stderr'] = error || Module['stderr'];
  
        FS.createStandardStreams();
      },
  quit:() => {
        FS.init.initialized = false;
        // force-flush all streams, so we get musl std streams printed out
        _fflush(0);
        // close all of our streams
        for (var i = 0; i < FS.streams.length; i++) {
          var stream = FS.streams[i];
          if (!stream) {
            continue;
          }
          FS.close(stream);
        }
      },
  findObject:(path, dontResolveLastLink) => {
        var ret = FS.analyzePath(path, dontResolveLastLink);
        if (!ret.exists) {
          return null;
        }
        return ret.object;
      },
  analyzePath:(path, dontResolveLastLink) => {
        // operate from within the context of the symlink's target
        try {
          var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
          path = lookup.path;
        } catch (e) {
        }
        var ret = {
          isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
          parentExists: false, parentPath: null, parentObject: null
        };
        try {
          var lookup = FS.lookupPath(path, { parent: true });
          ret.parentExists = true;
          ret.parentPath = lookup.path;
          ret.parentObject = lookup.node;
          ret.name = PATH.basename(path);
          lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
          ret.exists = true;
          ret.path = lookup.path;
          ret.object = lookup.node;
          ret.name = lookup.node.name;
          ret.isRoot = lookup.path === '/';
        } catch (e) {
          ret.error = e.errno;
        };
        return ret;
      },
  createPath:(parent, path, canRead, canWrite) => {
        parent = typeof parent == 'string' ? parent : FS.getPath(parent);
        var parts = path.split('/').reverse();
        while (parts.length) {
          var part = parts.pop();
          if (!part) continue;
          var current = PATH.join2(parent, part);
          try {
            FS.mkdir(current);
          } catch (e) {
            // ignore EEXIST
          }
          parent = current;
        }
        return current;
      },
  createFile:(parent, name, properties, canRead, canWrite) => {
        var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name);
        var mode = FS_getMode(canRead, canWrite);
        return FS.create(path, mode);
      },
  createDataFile:(parent, name, data, canRead, canWrite, canOwn) => {
        var path = name;
        if (parent) {
          parent = typeof parent == 'string' ? parent : FS.getPath(parent);
          path = name ? PATH.join2(parent, name) : parent;
        }
        var mode = FS_getMode(canRead, canWrite);
        var node = FS.create(path, mode);
        if (data) {
          if (typeof data == 'string') {
            var arr = new Array(data.length);
            for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
            data = arr;
          }
          // make sure we can write to the file
          FS.chmod(node, mode | 146);
          var stream = FS.open(node, 577);
          FS.write(stream, data, 0, data.length, 0, canOwn);
          FS.close(stream);
          FS.chmod(node, mode);
        }
        return node;
      },
  createDevice:(parent, name, input, output) => {
        var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name);
        var mode = FS_getMode(!!input, !!output);
        if (!FS.createDevice.major) FS.createDevice.major = 64;
        var dev = FS.makedev(FS.createDevice.major++, 0);
        // Create a fake device that a set of stream ops to emulate
        // the old behavior.
        FS.registerDevice(dev, {
          open: (stream) => {
            stream.seekable = false;
          },
          close: (stream) => {
            // flush any pending line data
            if (output && output.buffer && output.buffer.length) {
              output(10);
            }
          },
          read: (stream, buffer, offset, length, pos /* ignored */) => {
            var bytesRead = 0;
            for (var i = 0; i < length; i++) {
              var result;
              try {
                result = input();
              } catch (e) {
                throw new FS.ErrnoError(29);
              }
              if (result === undefined && bytesRead === 0) {
                throw new FS.ErrnoError(6);
              }
              if (result === null || result === undefined) break;
              bytesRead++;
              buffer[offset+i] = result;
            }
            if (bytesRead) {
              stream.node.timestamp = Date.now();
            }
            return bytesRead;
          },
          write: (stream, buffer, offset, length, pos) => {
            for (var i = 0; i < length; i++) {
              try {
                output(buffer[offset+i]);
              } catch (e) {
                throw new FS.ErrnoError(29);
              }
            }
            if (length) {
              stream.node.timestamp = Date.now();
            }
            return i;
          }
        });
        return FS.mkdev(path, mode, dev);
      },
  forceLoadFile:(obj) => {
        if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
        if (typeof XMLHttpRequest != 'undefined') {
          throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
        } else if (read_) {
          // Command-line.
          try {
            // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
            //          read() will try to parse UTF8.
            obj.contents = intArrayFromString(read_(obj.url), true);
            obj.usedBytes = obj.contents.length;
          } catch (e) {
            throw new FS.ErrnoError(29);
          }
        } else {
          throw new Error('Cannot load without read() or XMLHttpRequest.');
        }
      },
  createLazyFile:(parent, name, url, canRead, canWrite) => {
        // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
        /** @constructor */
        function LazyUint8Array() {
          this.lengthKnown = false;
          this.chunks = []; // Loaded chunks. Index is the chunk number
        }
        LazyUint8Array.prototype.get = /** @this{Object} */ function LazyUint8Array_get(idx) {
          if (idx > this.length-1 || idx < 0) {
            return undefined;
          }
          var chunkOffset = idx % this.chunkSize;
          var chunkNum = (idx / this.chunkSize)|0;
          return this.getter(chunkNum)[chunkOffset];
        };
        LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
          this.getter = getter;
        };
        LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
          // Find length
          var xhr = new XMLHttpRequest();
          xhr.open('HEAD', url, false);
          xhr.send(null);
          if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
          var datalength = Number(xhr.getResponseHeader("Content-length"));
          var header;
          var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
          var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
  
          var chunkSize = 1024*1024; // Chunk size in bytes
  
          if (!hasByteServing) chunkSize = datalength;
  
          // Function to get a range from the remote URL.
          var doXHR = (from, to) => {
            if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
            if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
  
            // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
            var xhr = new XMLHttpRequest();
            xhr.open('GET', url, false);
            if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
  
            // Some hints to the browser that we want binary data.
            xhr.responseType = 'arraybuffer';
            if (xhr.overrideMimeType) {
              xhr.overrideMimeType('text/plain; charset=x-user-defined');
            }
  
            xhr.send(null);
            if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
            if (xhr.response !== undefined) {
              return new Uint8Array(/** @type{Array<number>} */(xhr.response || []));
            }
            return intArrayFromString(xhr.responseText || '', true);
          };
          var lazyArray = this;
          lazyArray.setDataGetter((chunkNum) => {
            var start = chunkNum * chunkSize;
            var end = (chunkNum+1) * chunkSize - 1; // including this byte
            end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
            if (typeof lazyArray.chunks[chunkNum] == 'undefined') {
              lazyArray.chunks[chunkNum] = doXHR(start, end);
            }
            if (typeof lazyArray.chunks[chunkNum] == 'undefined') throw new Error('doXHR failed!');
            return lazyArray.chunks[chunkNum];
          });
  
          if (usesGzip || !datalength) {
            // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
            chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
            datalength = this.getter(0).length;
            chunkSize = datalength;
            out("LazyFiles on gzip forces download of the whole file when length is accessed");
          }
  
          this._length = datalength;
          this._chunkSize = chunkSize;
          this.lengthKnown = true;
        };
        if (typeof XMLHttpRequest != 'undefined') {
          if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
          var lazyArray = new LazyUint8Array();
          Object.defineProperties(lazyArray, {
            length: {
              get: /** @this{Object} */ function() {
                if (!this.lengthKnown) {
                  this.cacheLength();
                }
                return this._length;
              }
            },
            chunkSize: {
              get: /** @this{Object} */ function() {
                if (!this.lengthKnown) {
                  this.cacheLength();
                }
                return this._chunkSize;
              }
            }
          });
  
          var properties = { isDevice: false, contents: lazyArray };
        } else {
          var properties = { isDevice: false, url: url };
        }
  
        var node = FS.createFile(parent, name, properties, canRead, canWrite);
        // This is a total hack, but I want to get this lazy file code out of the
        // core of MEMFS. If we want to keep this lazy file concept I feel it should
        // be its own thin LAZYFS proxying calls to MEMFS.
        if (properties.contents) {
          node.contents = properties.contents;
        } else if (properties.url) {
          node.contents = null;
          node.url = properties.url;
        }
        // Add a function that defers querying the file size until it is asked the first time.
        Object.defineProperties(node, {
          usedBytes: {
            get: /** @this {FSNode} */ function() { return this.contents.length; }
          }
        });
        // override each stream op with one that tries to force load the lazy file first
        var stream_ops = {};
        var keys = Object.keys(node.stream_ops);
        keys.forEach((key) => {
          var fn = node.stream_ops[key];
          stream_ops[key] = function forceLoadLazyFile() {
            FS.forceLoadFile(node);
            return fn.apply(null, arguments);
          };
        });
        function writeChunks(stream, buffer, offset, length, position) {
          var contents = stream.node.contents;
          if (position >= contents.length)
            return 0;
          var size = Math.min(contents.length - position, length);
          assert(size >= 0);
          if (contents.slice) { // normal array
            for (var i = 0; i < size; i++) {
              buffer[offset + i] = contents[position + i];
            }
          } else {
            for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
              buffer[offset + i] = contents.get(position + i);
            }
          }
          return size;
        }
        // use a custom read function
        stream_ops.read = (stream, buffer, offset, length, position) => {
          FS.forceLoadFile(node);
          return writeChunks(stream, buffer, offset, length, position)
        };
        // use a custom mmap function
        stream_ops.mmap = (stream, length, position, prot, flags) => {
          FS.forceLoadFile(node);
          var ptr = mmapAlloc(length);
          if (!ptr) {
            throw new FS.ErrnoError(48);
          }
          writeChunks(stream, HEAP8, ptr, length, position);
          return { ptr, allocated: true };
        };
        node.stream_ops = stream_ops;
        return node;
      },
  absolutePath:() => {
        abort('FS.absolutePath has been removed; use PATH_FS.resolve instead');
      },
  createFolder:() => {
        abort('FS.createFolder has been removed; use FS.mkdir instead');
      },
  createLink:() => {
        abort('FS.createLink has been removed; use FS.symlink instead');
      },
  joinPath:() => {
        abort('FS.joinPath has been removed; use PATH.join instead');
      },
  mmapAlloc:() => {
        abort('FS.mmapAlloc has been replaced by the top level function mmapAlloc');
      },
  standardizePath:() => {
        abort('FS.standardizePath has been removed; use PATH.normalize instead');
      },
  };
  
  var SYSCALLS = {
  DEFAULT_POLLMASK:5,
  calculateAt:function(dirfd, path, allowEmpty) {
        if (PATH.isAbs(path)) {
          return path;
        }
        // relative path
        var dir;
        if (dirfd === -100) {
          dir = FS.cwd();
        } else {
          var dirstream = SYSCALLS.getStreamFromFD(dirfd);
          dir = dirstream.path;
        }
        if (path.length == 0) {
          if (!allowEmpty) {
            throw new FS.ErrnoError(44);;
          }
          return dir;
        }
        return PATH.join2(dir, path);
      },
  doStat:function(func, path, buf) {
        try {
          var stat = func(path);
        } catch (e) {
          if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
            // an error occurred while trying to look up the path; we should just report ENOTDIR
            return -54;
          }
          throw e;
        }
        HEAP32[((buf)>>2)] = stat.dev;
        HEAP32[(((buf)+(4))>>2)] = stat.mode;
        HEAPU32[(((buf)+(8))>>2)] = stat.nlink;
        HEAP32[(((buf)+(12))>>2)] = stat.uid;
        HEAP32[(((buf)+(16))>>2)] = stat.gid;
        HEAP32[(((buf)+(20))>>2)] = stat.rdev;
        (tempI64 = [stat.size>>>0,(tempDouble=stat.size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(24))>>2)] = tempI64[0],HEAP32[(((buf)+(28))>>2)] = tempI64[1]);
        HEAP32[(((buf)+(32))>>2)] = 4096;
        HEAP32[(((buf)+(36))>>2)] = stat.blocks;
        var atime = stat.atime.getTime();
        var mtime = stat.mtime.getTime();
        var ctime = stat.ctime.getTime();
        (tempI64 = [Math.floor(atime / 1000)>>>0,(tempDouble=Math.floor(atime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(40))>>2)] = tempI64[0],HEAP32[(((buf)+(44))>>2)] = tempI64[1]);
        HEAPU32[(((buf)+(48))>>2)] = (atime % 1000) * 1000;
        (tempI64 = [Math.floor(mtime / 1000)>>>0,(tempDouble=Math.floor(mtime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(56))>>2)] = tempI64[0],HEAP32[(((buf)+(60))>>2)] = tempI64[1]);
        HEAPU32[(((buf)+(64))>>2)] = (mtime % 1000) * 1000;
        (tempI64 = [Math.floor(ctime / 1000)>>>0,(tempDouble=Math.floor(ctime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(72))>>2)] = tempI64[0],HEAP32[(((buf)+(76))>>2)] = tempI64[1]);
        HEAPU32[(((buf)+(80))>>2)] = (ctime % 1000) * 1000;
        (tempI64 = [stat.ino>>>0,(tempDouble=stat.ino,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(88))>>2)] = tempI64[0],HEAP32[(((buf)+(92))>>2)] = tempI64[1]);
        return 0;
      },
  doMsync:function(addr, stream, len, flags, offset) {
        if (!FS.isFile(stream.node.mode)) {
          throw new FS.ErrnoError(43);
        }
        if (flags & 2) {
          // MAP_PRIVATE calls need not to be synced back to underlying fs
          return 0;
        }
        var buffer = HEAPU8.slice(addr, addr + len);
        FS.msync(stream, buffer, offset, len, flags);
      },
  varargs:undefined,
  get() {
        assert(SYSCALLS.varargs != undefined);
        SYSCALLS.varargs += 4;
        var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
        return ret;
      },
  getStr(ptr) {
        var ret = UTF8ToString(ptr);
        return ret;
      },
  getStreamFromFD:function(fd) {
        var stream = FS.getStreamChecked(fd);
        return stream;
      },
  };
  function ___syscall__newselect(nfds, readfds, writefds, exceptfds, timeout) {
  try {
  
      // readfds are supported,
      // writefds checks socket open status
      // exceptfds not supported
      // timeout is always 0 - fully async
      assert(nfds <= 64, 'nfds must be less than or equal to 64');  // fd sets have 64 bits // TODO: this could be 1024 based on current musl headers
      assert(!exceptfds, 'exceptfds not supported');
  
      var total = 0;
  
      var srcReadLow = (readfds ? HEAP32[((readfds)>>2)] : 0),
          srcReadHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0);
      var srcWriteLow = (writefds ? HEAP32[((writefds)>>2)] : 0),
          srcWriteHigh = (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0);
      var srcExceptLow = (exceptfds ? HEAP32[((exceptfds)>>2)] : 0),
          srcExceptHigh = (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0);
  
      var dstReadLow = 0,
          dstReadHigh = 0;
      var dstWriteLow = 0,
          dstWriteHigh = 0;
      var dstExceptLow = 0,
          dstExceptHigh = 0;
  
      var allLow = (readfds ? HEAP32[((readfds)>>2)] : 0) |
                   (writefds ? HEAP32[((writefds)>>2)] : 0) |
                   (exceptfds ? HEAP32[((exceptfds)>>2)] : 0);
      var allHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0) |
                    (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0) |
                    (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0);
  
      var check = function(fd, low, high, val) {
        return (fd < 32 ? (low & val) : (high & val));
      };
  
      for (var fd = 0; fd < nfds; fd++) {
        var mask = 1 << (fd % 32);
        if (!(check(fd, allLow, allHigh, mask))) {
          continue;  // index isn't in the set
        }
  
        var stream = SYSCALLS.getStreamFromFD(fd);
  
        var flags = SYSCALLS.DEFAULT_POLLMASK;
  
        if (stream.stream_ops.poll) {
          var timeoutInMillis = -1;
          if (timeout) {
            var tv_sec = (readfds ? HEAP32[((timeout)>>2)] : 0),
                tv_usec = (readfds ? HEAP32[(((timeout)+(8))>>2)] : 0);
            timeoutInMillis = (tv_sec + tv_usec / 1000000) * 1000;
          }
          flags = stream.stream_ops.poll(stream, timeoutInMillis);
        }
  
        if ((flags & 1) && check(fd, srcReadLow, srcReadHigh, mask)) {
          fd < 32 ? (dstReadLow = dstReadLow | mask) : (dstReadHigh = dstReadHigh | mask);
          total++;
        }
        if ((flags & 4) && check(fd, srcWriteLow, srcWriteHigh, mask)) {
          fd < 32 ? (dstWriteLow = dstWriteLow | mask) : (dstWriteHigh = dstWriteHigh | mask);
          total++;
        }
        if ((flags & 2) && check(fd, srcExceptLow, srcExceptHigh, mask)) {
          fd < 32 ? (dstExceptLow = dstExceptLow | mask) : (dstExceptHigh = dstExceptHigh | mask);
          total++;
        }
      }
  
      if (readfds) {
        HEAP32[((readfds)>>2)] = dstReadLow;
        HEAP32[(((readfds)+(4))>>2)] = dstReadHigh;
      }
      if (writefds) {
        HEAP32[((writefds)>>2)] = dstWriteLow;
        HEAP32[(((writefds)+(4))>>2)] = dstWriteHigh;
      }
      if (exceptfds) {
        HEAP32[((exceptfds)>>2)] = dstExceptLow;
        HEAP32[(((exceptfds)+(4))>>2)] = dstExceptHigh;
      }
  
      return total;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  var SOCKFS = {
  mount(mount) {
        // If Module['websocket'] has already been defined (e.g. for configuring
        // the subprotocol/url) use that, if not initialise it to a new object.
        Module['websocket'] = (Module['websocket'] &&
                               ('object' === typeof Module['websocket'])) ? Module['websocket'] : {};
  
        // Add the Event registration mechanism to the exported websocket configuration
        // object so we can register network callbacks from native JavaScript too.
        // For more documentation see system/include/emscripten/emscripten.h
        Module['websocket']._callbacks = {};
        Module['websocket']['on'] = /** @this{Object} */ function(event, callback) {
          if ('function' === typeof callback) {
            this._callbacks[event] = callback;
          }
          return this;
        };
  
        Module['websocket'].emit = /** @this{Object} */ function(event, param) {
          if ('function' === typeof this._callbacks[event]) {
            this._callbacks[event].call(this, param);
          }
        };
  
        // If debug is enabled register simple default logging callbacks for each Event.
  
        return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
      },
  createSocket(family, type, protocol) {
        type &= ~526336; // Some applications may pass it; it makes no sense for a single process.
        var streaming = type == 1;
        if (streaming && protocol && protocol != 6) {
          throw new FS.ErrnoError(66); // if SOCK_STREAM, must be tcp or 0.
        }
  
        // create our internal socket structure
        var sock = {
          family,
          type,
          protocol,
          server: null,
          error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test
          peers: {},
          pending: [],
          recv_queue: [],
          sock_ops: SOCKFS.websocket_sock_ops
        };
  
        // create the filesystem node to store the socket structure
        var name = SOCKFS.nextname();
        var node = FS.createNode(SOCKFS.root, name, 49152, 0);
        node.sock = sock;
  
        // and the wrapping stream that enables library functions such
        // as read and write to indirectly interact with the socket
        var stream = FS.createStream({
          path: name,
          node,
          flags: 2,
          seekable: false,
          stream_ops: SOCKFS.stream_ops
        });
  
        // map the new stream to the socket structure (sockets have a 1:1
        // relationship with a stream)
        sock.stream = stream;
  
        return sock;
      },
  getSocket(fd) {
        var stream = FS.getStream(fd);
        if (!stream || !FS.isSocket(stream.node.mode)) {
          return null;
        }
        return stream.node.sock;
      },
  stream_ops:{
  poll(stream) {
          var sock = stream.node.sock;
          return sock.sock_ops.poll(sock);
        },
  ioctl(stream, request, varargs) {
          var sock = stream.node.sock;
          return sock.sock_ops.ioctl(sock, request, varargs);
        },
  read(stream, buffer, offset, length, position /* ignored */) {
          var sock = stream.node.sock;
          var msg = sock.sock_ops.recvmsg(sock, length);
          if (!msg) {
            // socket is closed
            return 0;
          }
          buffer.set(msg.buffer, offset);
          return msg.buffer.length;
        },
  write(stream, buffer, offset, length, position /* ignored */) {
          var sock = stream.node.sock;
          return sock.sock_ops.sendmsg(sock, buffer, offset, length);
        },
  close(stream) {
          var sock = stream.node.sock;
          sock.sock_ops.close(sock);
        },
  },
  nextname() {
        if (!SOCKFS.nextname.current) {
          SOCKFS.nextname.current = 0;
        }
        return 'socket[' + (SOCKFS.nextname.current++) + ']';
      },
  websocket_sock_ops:{
  createPeer(sock, addr, port) {
          var ws;
  
          if (typeof addr == 'object') {
            ws = addr;
            addr = null;
            port = null;
          }
  
          if (ws) {
            // for sockets that've already connected (e.g. we're the server)
            // we can inspect the _socket property for the address
            if (ws._socket) {
              addr = ws._socket.remoteAddress;
              port = ws._socket.remotePort;
            }
            // if we're just now initializing a connection to the remote,
            // inspect the url property
            else {
              var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
              if (!result) {
                throw new Error('WebSocket URL must be in the format ws(s)://address:port');
              }
              addr = result[1];
              port = parseInt(result[2], 10);
            }
          } else {
            // create the actual websocket object and connect
            try {
              // runtimeConfig gets set to true if WebSocket runtime configuration is available.
              var runtimeConfig = (Module['websocket'] && ('object' === typeof Module['websocket']));
  
              // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#'
              // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again.
              var url = 'ws:#'.replace('#', '//');
  
              if (runtimeConfig) {
                if ('string' === typeof Module['websocket']['url']) {
                  url = Module['websocket']['url']; // Fetch runtime WebSocket URL config.
                }
              }
  
              if (url === 'ws://' || url === 'wss://') { // Is the supplied URL config just a prefix, if so complete it.
                var parts = addr.split('/');
                url = url + parts[0] + ":" + port + "/" + parts.slice(1).join('/');
              }
  
              // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set.
              var subProtocols = 'binary'; // The default value is 'binary'
  
              if (runtimeConfig) {
                if ('string' === typeof Module['websocket']['subprotocol']) {
                  subProtocols = Module['websocket']['subprotocol']; // Fetch runtime WebSocket subprotocol config.
                }
              }
  
              // The default WebSocket options
              var opts = undefined;
  
              if (subProtocols !== 'null') {
                // The regex trims the string (removes spaces at the beginning and end, then splits the string by
                // <any space>,<any space> into an Array. Whitespace removal is important for Websockify and ws.
                subProtocols = subProtocols.replace(/^ +| +$/g,"").split(/ *, */);
  
                opts = subProtocols;
              }
  
              // some webservers (azure) does not support subprotocol header
              if (runtimeConfig && null === Module['websocket']['subprotocol']) {
                subProtocols = 'null';
                opts = undefined;
              }
  
              // If node we use the ws library.
              var WebSocketConstructor;
              {
                WebSocketConstructor = WebSocket;
              }
              ws = new WebSocketConstructor(url, opts);
              ws.binaryType = 'arraybuffer';
            } catch (e) {
              throw new FS.ErrnoError(23);
            }
          }
  
          var peer = {
            addr,
            port,
            socket: ws,
            dgram_send_queue: []
          };
  
          SOCKFS.websocket_sock_ops.addPeer(sock, peer);
          SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
  
          // if this is a bound dgram socket, send the port number first to allow
          // us to override the ephemeral port reported to us by remotePort on the
          // remote end.
          if (sock.type === 2 && typeof sock.sport != 'undefined') {
            peer.dgram_send_queue.push(new Uint8Array([
                255, 255, 255, 255,
                'p'.charCodeAt(0), 'o'.charCodeAt(0), 'r'.charCodeAt(0), 't'.charCodeAt(0),
                ((sock.sport & 0xff00) >> 8) , (sock.sport & 0xff)
            ]));
          }
  
          return peer;
        },
  getPeer(sock, addr, port) {
          return sock.peers[addr + ':' + port];
        },
  addPeer(sock, peer) {
          sock.peers[peer.addr + ':' + peer.port] = peer;
        },
  removePeer(sock, peer) {
          delete sock.peers[peer.addr + ':' + peer.port];
        },
  handlePeerEvents(sock, peer) {
          var first = true;
  
          var handleOpen = function () {
  
            Module['websocket'].emit('open', sock.stream.fd);
  
            try {
              var queued = peer.dgram_send_queue.shift();
              while (queued) {
                peer.socket.send(queued);
                queued = peer.dgram_send_queue.shift();
              }
            } catch (e) {
              // not much we can do here in the way of proper error handling as we've already
              // lied and said this data was sent. shut it down.
              peer.socket.close();
            }
          };
  
          function handleMessage(data) {
            if (typeof data == 'string') {
              var encoder = new TextEncoder(); // should be utf-8
              data = encoder.encode(data); // make a typed array from the string
            } else {
              assert(data.byteLength !== undefined); // must receive an ArrayBuffer
              if (data.byteLength == 0) {
                // An empty ArrayBuffer will emit a pseudo disconnect event
                // as recv/recvmsg will return zero which indicates that a socket
                // has performed a shutdown although the connection has not been disconnected yet.
                return;
              }
              data = new Uint8Array(data); // make a typed array view on the array buffer
            }
  
            // if this is the port message, override the peer's port with it
            var wasfirst = first;
            first = false;
            if (wasfirst &&
                data.length === 10 &&
                data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 &&
                data[4] === 'p'.charCodeAt(0) && data[5] === 'o'.charCodeAt(0) && data[6] === 'r'.charCodeAt(0) && data[7] === 't'.charCodeAt(0)) {
              // update the peer's port and it's key in the peer map
              var newport = ((data[8] << 8) | data[9]);
              SOCKFS.websocket_sock_ops.removePeer(sock, peer);
              peer.port = newport;
              SOCKFS.websocket_sock_ops.addPeer(sock, peer);
              return;
            }
  
            sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data });
            Module['websocket'].emit('message', sock.stream.fd);
          };
  
          if (ENVIRONMENT_IS_NODE) {
            peer.socket.on('open', handleOpen);
            peer.socket.on('message', function(data, isBinary) {
              if (!isBinary) {
                return;
              }
              handleMessage((new Uint8Array(data)).buffer); // copy from node Buffer -> ArrayBuffer
            });
            peer.socket.on('close', function() {
              Module['websocket'].emit('close', sock.stream.fd);
            });
            peer.socket.on('error', function(error) {
              // Although the ws library may pass errors that may be more descriptive than
              // ECONNREFUSED they are not necessarily the expected error code e.g.
              // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED
              // is still probably the most useful thing to do.
              sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
              Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
              // don't throw
            });
          } else {
            peer.socket.onopen = handleOpen;
            peer.socket.onclose = function() {
              Module['websocket'].emit('close', sock.stream.fd);
            };
            peer.socket.onmessage = function peer_socket_onmessage(event) {
              handleMessage(event.data);
            };
            peer.socket.onerror = function(error) {
              // The WebSocket spec only allows a 'simple event' to be thrown on error,
              // so we only really know as much as ECONNREFUSED.
              sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
              Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
            };
          }
        },
  poll(sock) {
          if (sock.type === 1 && sock.server) {
            // listen sockets should only say they're available for reading
            // if there are pending clients.
            return sock.pending.length ? (64 | 1) : 0;
          }
  
          var mask = 0;
          var dest = sock.type === 1 ?  // we only care about the socket state for connection-based sockets
            SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) :
            null;
  
          if (sock.recv_queue.length ||
              !dest ||  // connection-less sockets are always ready to read
              (dest && dest.socket.readyState === dest.socket.CLOSING) ||
              (dest && dest.socket.readyState === dest.socket.CLOSED)) {  // let recv return 0 once closed
            mask |= (64 | 1);
          }
  
          if (!dest ||  // connection-less sockets are always ready to write
              (dest && dest.socket.readyState === dest.socket.OPEN)) {
            mask |= 4;
          }
  
          if ((dest && dest.socket.readyState === dest.socket.CLOSING) ||
              (dest && dest.socket.readyState === dest.socket.CLOSED)) {
            mask |= 16;
          }
  
          return mask;
        },
  ioctl(sock, request, arg) {
          switch (request) {
            case 21531:
              var bytes = 0;
              if (sock.recv_queue.length) {
                bytes = sock.recv_queue[0].data.length;
              }
              HEAP32[((arg)>>2)] = bytes;
              return 0;
            default:
              return 28;
          }
        },
  close(sock) {
          // if we've spawned a listen server, close it
          if (sock.server) {
            try {
              sock.server.close();
            } catch (e) {
            }
            sock.server = null;
          }
          // close any peer connections
          var peers = Object.keys(sock.peers);
          for (var i = 0; i < peers.length; i++) {
            var peer = sock.peers[peers[i]];
            try {
              peer.socket.close();
            } catch (e) {
            }
            SOCKFS.websocket_sock_ops.removePeer(sock, peer);
          }
          return 0;
        },
  bind(sock, addr, port) {
          if (typeof sock.saddr != 'undefined' || typeof sock.sport != 'undefined') {
            throw new FS.ErrnoError(28);  // already bound
          }
          sock.saddr = addr;
          sock.sport = port;
          // in order to emulate dgram sockets, we need to launch a listen server when
          // binding on a connection-less socket
          // note: this is only required on the server side
          if (sock.type === 2) {
            // close the existing server if it exists
            if (sock.server) {
              sock.server.close();
              sock.server = null;
            }
            // swallow error operation not supported error that occurs when binding in the
            // browser where this isn't supported
            try {
              sock.sock_ops.listen(sock, 0);
            } catch (e) {
              if (!(e.name === 'ErrnoError')) throw e;
              if (e.errno !== 138) throw e;
            }
          }
        },
  connect(sock, addr, port) {
          if (sock.server) {
            throw new FS.ErrnoError(138);
          }
  
          // TODO autobind
          // if (!sock.addr && sock.type == 2) {
          // }
  
          // early out if we're already connected / in the middle of connecting
          if (typeof sock.daddr != 'undefined' && typeof sock.dport != 'undefined') {
            var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
            if (dest) {
              if (dest.socket.readyState === dest.socket.CONNECTING) {
                throw new FS.ErrnoError(7);
              } else {
                throw new FS.ErrnoError(30);
              }
            }
          }
  
          // add the socket to our peer list and set our
          // destination address / port to match
          var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
          sock.daddr = peer.addr;
          sock.dport = peer.port;
  
          // always "fail" in non-blocking mode
          throw new FS.ErrnoError(26);
        },
  listen(sock, backlog) {
          if (!ENVIRONMENT_IS_NODE) {
            throw new FS.ErrnoError(138);
          }
        },
  accept(listensock) {
          if (!listensock.server || !listensock.pending.length) {
            throw new FS.ErrnoError(28);
          }
          var newsock = listensock.pending.shift();
          newsock.stream.flags = listensock.stream.flags;
          return newsock;
        },
  getname(sock, peer) {
          var addr, port;
          if (peer) {
            if (sock.daddr === undefined || sock.dport === undefined) {
              throw new FS.ErrnoError(53);
            }
            addr = sock.daddr;
            port = sock.dport;
          } else {
            // TODO saddr and sport will be set for bind()'d UDP sockets, but what
            // should we be returning for TCP sockets that've been connect()'d?
            addr = sock.saddr || 0;
            port = sock.sport || 0;
          }
          return { addr, port };
        },
  sendmsg(sock, buffer, offset, length, addr, port) {
          if (sock.type === 2) {
            // connection-less sockets will honor the message address,
            // and otherwise fall back to the bound destination address
            if (addr === undefined || port === undefined) {
              addr = sock.daddr;
              port = sock.dport;
            }
            // if there was no address to fall back to, error out
            if (addr === undefined || port === undefined) {
              throw new FS.ErrnoError(17);
            }
          } else {
            // connection-based sockets will only use the bound
            addr = sock.daddr;
            port = sock.dport;
          }
  
          // find the peer for the destination address
          var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
  
          // early out if not connected with a connection-based socket
          if (sock.type === 1) {
            if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
              throw new FS.ErrnoError(53);
            } else if (dest.socket.readyState === dest.socket.CONNECTING) {
              throw new FS.ErrnoError(6);
            }
          }
  
          // create a copy of the incoming data to send, as the WebSocket API
          // doesn't work entirely with an ArrayBufferView, it'll just send
          // the entire underlying buffer
          if (ArrayBuffer.isView(buffer)) {
            offset += buffer.byteOffset;
            buffer = buffer.buffer;
          }
  
          var data;
            data = buffer.slice(offset, offset + length);
  
          // if we're emulating a connection-less dgram socket and don't have
          // a cached connection, queue the buffer to send upon connect and
          // lie, saying the data was sent now.
          if (sock.type === 2) {
            if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
              // if we're not connected, open a new connection
              if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
                dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
              }
              dest.dgram_send_queue.push(data);
              return length;
            }
          }
  
          try {
            // send the actual data
            dest.socket.send(data);
            return length;
          } catch (e) {
            throw new FS.ErrnoError(28);
          }
        },
  recvmsg(sock, length) {
          // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html
          if (sock.type === 1 && sock.server) {
            // tcp servers should not be recv()'ing on the listen socket
            throw new FS.ErrnoError(53);
          }
  
          var queued = sock.recv_queue.shift();
          if (!queued) {
            if (sock.type === 1) {
              var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
  
              if (!dest) {
                // if we have a destination address but are not connected, error out
                throw new FS.ErrnoError(53);
              }
              if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
                // return null if the socket has closed
                return null;
              }
              // else, our socket is in a valid state but truly has nothing available
              throw new FS.ErrnoError(6);
            }
            throw new FS.ErrnoError(6);
          }
  
          // queued.data will be an ArrayBuffer if it's unadulterated, but if it's
          // requeued TCP data it'll be an ArrayBufferView
          var queuedLength = queued.data.byteLength || queued.data.length;
          var queuedOffset = queued.data.byteOffset || 0;
          var queuedBuffer = queued.data.buffer || queued.data;
          var bytesRead = Math.min(length, queuedLength);
          var res = {
            buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
            addr: queued.addr,
            port: queued.port
          };
  
          // push back any unread data for TCP connections
          if (sock.type === 1 && bytesRead < queuedLength) {
            var bytesRemaining = queuedLength - bytesRead;
            queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
            sock.recv_queue.unshift(queued);
          }
  
          return res;
        },
  },
  };
  
  function getSocketFromFD(fd) {
      var socket = SOCKFS.getSocket(fd);
      if (!socket) throw new FS.ErrnoError(8);
      return socket;
    }
  
  var setErrNo = (value) => {
      HEAP32[((___errno_location())>>2)] = value;
      return value;
    };
  var Sockets = {
  BUFFER_SIZE:10240,
  MAX_BUFFER_SIZE:10485760,
  nextFd:1,
  fds:{
  },
  nextport:1,
  maxport:65535,
  peer:null,
  connections:{
  },
  portmap:{
  },
  localAddr:4261412874,
  addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034],
  };
  
  var inetPton4 = (str) => {
      var b = str.split('.');
      for (var i = 0; i < 4; i++) {
        var tmp = Number(b[i]);
        if (isNaN(tmp)) return null;
        b[i] = tmp;
      }
      return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0;
    };
  
  
  /** @suppress {checkTypes} */
  var jstoi_q = (str) => parseInt(str);
  var inetPton6 = (str) => {
      var words;
      var w, offset, z, i;
      /* http://home.deds.nl/~aeron/regex/ */
      var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i
      var parts = [];
      if (!valid6regx.test(str)) {
        return null;
      }
      if (str === "::") {
        return [0, 0, 0, 0, 0, 0, 0, 0];
      }
      // Z placeholder to keep track of zeros when splitting the string on ":"
      if (str.startsWith("::")) {
        str = str.replace("::", "Z:"); // leading zeros case
      } else {
        str = str.replace("::", ":Z:");
      }
  
      if (str.indexOf(".") > 0) {
        // parse IPv4 embedded stress
        str = str.replace(new RegExp('[.]', 'g'), ":");
        words = str.split(":");
        words[words.length-4] = jstoi_q(words[words.length-4]) + jstoi_q(words[words.length-3])*256;
        words[words.length-3] = jstoi_q(words[words.length-2]) + jstoi_q(words[words.length-1])*256;
        words = words.slice(0, words.length-2);
      } else {
        words = str.split(":");
      }
  
      offset = 0; z = 0;
      for (w=0; w < words.length; w++) {
        if (typeof words[w] == 'string') {
          if (words[w] === 'Z') {
            // compressed zeros - write appropriate number of zero words
            for (z = 0; z < (8 - words.length+1); z++) {
              parts[w+z] = 0;
            }
            offset = z-1;
          } else {
            // parse hex to field to 16-bit value and write it in network byte-order
            parts[w+offset] = _htons(parseInt(words[w],16));
          }
        } else {
          // parsed IPv4 words
          parts[w+offset] = words[w];
        }
      }
      return [
        (parts[1] << 16) | parts[0],
        (parts[3] << 16) | parts[2],
        (parts[5] << 16) | parts[4],
        (parts[7] << 16) | parts[6]
      ];
    };
  
  
  /** @param {number=} addrlen */
  var writeSockaddr = (sa, family, addr, port, addrlen) => {
      switch (family) {
        case 2:
          addr = inetPton4(addr);
          zeroMemory(sa, 16);
          if (addrlen) {
            HEAP32[((addrlen)>>2)] = 16;
          }
          HEAP16[((sa)>>1)] = family;
          HEAP32[(((sa)+(4))>>2)] = addr;
          HEAP16[(((sa)+(2))>>1)] = _htons(port);
          break;
        case 10:
          addr = inetPton6(addr);
          zeroMemory(sa, 28);
          if (addrlen) {
            HEAP32[((addrlen)>>2)] = 28;
          }
          HEAP32[((sa)>>2)] = family;
          HEAP32[(((sa)+(8))>>2)] = addr[0];
          HEAP32[(((sa)+(12))>>2)] = addr[1];
          HEAP32[(((sa)+(16))>>2)] = addr[2];
          HEAP32[(((sa)+(20))>>2)] = addr[3];
          HEAP16[(((sa)+(2))>>1)] = _htons(port);
          break;
        default:
          return 5;
      }
      return 0;
    };
  
  
  var DNS = {
  address_map:{
  id:1,
  addrs:{
  },
  names:{
  },
  },
  lookup_name:(name) => {
        // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one.
        var res = inetPton4(name);
        if (res !== null) {
          return name;
        }
        res = inetPton6(name);
        if (res !== null) {
          return name;
        }
  
        // See if this name is already mapped.
        var addr;
  
        if (DNS.address_map.addrs[name]) {
          addr = DNS.address_map.addrs[name];
        } else {
          var id = DNS.address_map.id++;
          assert(id < 65535, 'exceeded max address mappings of 65535');
  
          addr = '172.29.' + (id & 0xff) + '.' + (id & 0xff00);
  
          DNS.address_map.names[addr] = name;
          DNS.address_map.addrs[name] = addr;
        }
  
        return addr;
      },
  lookup_addr:(addr) => {
        if (DNS.address_map.names[addr]) {
          return DNS.address_map.names[addr];
        }
  
        return null;
      },
  };
  
  function ___syscall_accept4(fd, addr, addrlen, flags, d1, d2) {
  try {
  
      var sock = getSocketFromFD(fd);
      var newsock = sock.sock_ops.accept(sock);
      if (addr) {
        var errno = writeSockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport, addrlen);
        assert(!errno);
      }
      return newsock.stream.fd;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  
  var inetNtop4 = (addr) => {
      return (addr & 0xff) + '.' + ((addr >> 8) & 0xff) + '.' + ((addr >> 16) & 0xff) + '.' + ((addr >> 24) & 0xff)
    };
  
  
  var inetNtop6 = (ints) => {
      //  ref:  http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4
      //  Format for IPv4 compatible and mapped  128-bit IPv6 Addresses
      //  128-bits are split into eight 16-bit words
      //  stored in network byte order (big-endian)
      //  |                80 bits               | 16 |      32 bits        |
      //  +-----------------------------------------------------------------+
      //  |               10 bytes               |  2 |      4 bytes        |
      //  +--------------------------------------+--------------------------+
      //  +               5 words                |  1 |      2 words        |
      //  +--------------------------------------+--------------------------+
      //  |0000..............................0000|0000|    IPv4 ADDRESS     | (compatible)
      //  +--------------------------------------+----+---------------------+
      //  |0000..............................0000|FFFF|    IPv4 ADDRESS     | (mapped)
      //  +--------------------------------------+----+---------------------+
      var str = "";
      var word = 0;
      var longest = 0;
      var lastzero = 0;
      var zstart = 0;
      var len = 0;
      var i = 0;
      var parts = [
        ints[0] & 0xffff,
        (ints[0] >> 16),
        ints[1] & 0xffff,
        (ints[1] >> 16),
        ints[2] & 0xffff,
        (ints[2] >> 16),
        ints[3] & 0xffff,
        (ints[3] >> 16)
      ];
  
      // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses
  
      var hasipv4 = true;
      var v4part = "";
      // check if the 10 high-order bytes are all zeros (first 5 words)
      for (i = 0; i < 5; i++) {
        if (parts[i] !== 0) { hasipv4 = false; break; }
      }
  
      if (hasipv4) {
        // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words)
        v4part = inetNtop4(parts[6] | (parts[7] << 16));
        // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word)
        if (parts[5] === -1) {
          str = "::ffff:";
          str += v4part;
          return str;
        }
        // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word)
        if (parts[5] === 0) {
          str = "::";
          //special case IPv6 addresses
          if (v4part === "0.0.0.0") v4part = ""; // any/unspecified address
          if (v4part === "0.0.0.1") v4part = "1";// loopback address
          str += v4part;
          return str;
        }
      }
  
      // Handle all other IPv6 addresses
  
      // first run to find the longest contiguous zero words
      for (word = 0; word < 8; word++) {
        if (parts[word] === 0) {
          if (word - lastzero > 1) {
            len = 0;
          }
          lastzero = word;
          len++;
        }
        if (len > longest) {
          longest = len;
          zstart = word - longest + 1;
        }
      }
  
      for (word = 0; word < 8; word++) {
        if (longest > 1) {
          // compress contiguous zeros - to produce "::"
          if (parts[word] === 0 && word >= zstart && word < (zstart + longest) ) {
            if (word === zstart) {
              str += ":";
              if (zstart === 0) str += ":"; //leading zeros case
            }
            continue;
          }
        }
        // converts 16-bit words from big-endian to little-endian before converting to hex string
        str += Number(_ntohs(parts[word] & 0xffff)).toString(16);
        str += word < 7 ? ":" : "";
      }
      return str;
    };
  
  var readSockaddr = (sa, salen) => {
      // family / port offsets are common to both sockaddr_in and sockaddr_in6
      var family = HEAP16[((sa)>>1)];
      var port = _ntohs(HEAPU16[(((sa)+(2))>>1)]);
      var addr;
  
      switch (family) {
        case 2:
          if (salen !== 16) {
            return { errno: 28 };
          }
          addr = HEAP32[(((sa)+(4))>>2)];
          addr = inetNtop4(addr);
          break;
        case 10:
          if (salen !== 28) {
            return { errno: 28 };
          }
          addr = [
            HEAP32[(((sa)+(8))>>2)],
            HEAP32[(((sa)+(12))>>2)],
            HEAP32[(((sa)+(16))>>2)],
            HEAP32[(((sa)+(20))>>2)]
          ];
          addr = inetNtop6(addr);
          break;
        default:
          return { errno: 5 };
      }
  
      return { family: family, addr: addr, port: port };
    };
  
  
  /** @param {boolean=} allowNull */
  function getSocketAddress(addrp, addrlen, allowNull) {
      if (allowNull && addrp === 0) return null;
      var info = readSockaddr(addrp, addrlen);
      if (info.errno) throw new FS.ErrnoError(info.errno);
      info.addr = DNS.lookup_addr(info.addr) || info.addr;
      return info;
    }
  
  function ___syscall_bind(fd, addr, addrlen, d1, d2, d3) {
  try {
  
      var sock = getSocketFromFD(fd);
      var info = getSocketAddress(addr, addrlen);
      sock.sock_ops.bind(sock, info.addr, info.port);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_chdir(path) {
  try {
  
      path = SYSCALLS.getStr(path);
      FS.chdir(path);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_chmod(path, mode) {
  try {
  
      path = SYSCALLS.getStr(path);
      FS.chmod(path, mode);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  
  function ___syscall_connect(fd, addr, addrlen, d1, d2, d3) {
  try {
  
      var sock = getSocketFromFD(fd);
      var info = getSocketAddress(addr, addrlen);
      sock.sock_ops.connect(sock, info.addr, info.port);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_faccessat(dirfd, path, amode, flags) {
  try {
  
      path = SYSCALLS.getStr(path);
      assert(flags === 0);
      path = SYSCALLS.calculateAt(dirfd, path);
      if (amode & ~7) {
        // need a valid mode
        return -28;
      }
      var lookup = FS.lookupPath(path, { follow: true });
      var node = lookup.node;
      if (!node) {
        return -44;
      }
      var perms = '';
      if (amode & 4) perms += 'r';
      if (amode & 2) perms += 'w';
      if (amode & 1) perms += 'x';
      if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
        return -2;
      }
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_fchmod(fd, mode) {
  try {
  
      FS.fchmod(fd, mode);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  function ___syscall_fcntl64(fd, cmd, varargs) {
  SYSCALLS.varargs = varargs;
  try {
  
      var stream = SYSCALLS.getStreamFromFD(fd);
      switch (cmd) {
        case 0: {
          var arg = SYSCALLS.get();
          if (arg < 0) {
            return -28;
          }
          var newStream;
          newStream = FS.createStream(stream, arg);
          return newStream.fd;
        }
        case 1:
        case 2:
          return 0;  // FD_CLOEXEC makes no sense for a single process.
        case 3:
          return stream.flags;
        case 4: {
          var arg = SYSCALLS.get();
          stream.flags |= arg;
          return 0;
        }
        case 5: {
          var arg = SYSCALLS.get();
          var offset = 0;
          // We're always unlocked.
          HEAP16[(((arg)+(offset))>>1)] = 2;
          return 0;
        }
        case 6:
        case 7:
          return 0; // Pretend that the locking is successful.
        case 16:
        case 8:
          return -28; // These are for sockets. We don't have them fully implemented yet.
        case 9:
          // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fcntl() returns that, and we set errno ourselves.
          setErrNo(28);
          return -1;
        default: {
          return -28;
        }
      }
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_fstat64(fd, buf) {
  try {
  
      var stream = SYSCALLS.getStreamFromFD(fd);
      return SYSCALLS.doStat(FS.stat, stream.path, buf);
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  var stringToUTF8 = (str, outPtr, maxBytesToWrite) => {
      assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
      return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
    };
  
  function ___syscall_getcwd(buf, size) {
  try {
  
      if (size === 0) return -28;
      var cwd = FS.cwd();
      var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1;
      if (size < cwdLengthInBytes) return -68;
      stringToUTF8(cwd, buf, size);
      return cwdLengthInBytes;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  function ___syscall_getdents64(fd, dirp, count) {
  try {
  
      var stream = SYSCALLS.getStreamFromFD(fd)
      if (!stream.getdents) {
        stream.getdents = FS.readdir(stream.path);
      }
  
      var struct_size = 280;
      var pos = 0;
      var off = FS.llseek(stream, 0, 1);
  
      var idx = Math.floor(off / struct_size);
  
      while (idx < stream.getdents.length && pos + struct_size <= count) {
        var id;
        var type;
        var name = stream.getdents[idx];
        if (name === '.') {
          id = stream.node.id;
          type = 4; // DT_DIR
        }
        else if (name === '..') {
          var lookup = FS.lookupPath(stream.path, { parent: true });
          id = lookup.node.id;
          type = 4; // DT_DIR
        }
        else {
          var child = FS.lookupNode(stream.node, name);
          id = child.id;
          type = FS.isChrdev(child.mode) ? 2 :  // DT_CHR, character device.
                 FS.isDir(child.mode) ? 4 :     // DT_DIR, directory.
                 FS.isLink(child.mode) ? 10 :   // DT_LNK, symbolic link.
                 8;                             // DT_REG, regular file.
        }
        assert(id);
        (tempI64 = [id>>>0,(tempDouble=id,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[((dirp + pos)>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(4))>>2)] = tempI64[1]);
        (tempI64 = [(idx + 1) * struct_size>>>0,(tempDouble=(idx + 1) * struct_size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((dirp + pos)+(8))>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(12))>>2)] = tempI64[1]);
        HEAP16[(((dirp + pos)+(16))>>1)] = 280;
        HEAP8[(((dirp + pos)+(18))>>0)] = type;
        stringToUTF8(name, dirp + pos + 19, 256);
        pos += struct_size;
        idx += 1;
      }
      FS.llseek(stream, idx * struct_size, 0);
      return pos;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  
  
  function ___syscall_getsockname(fd, addr, addrlen, d1, d2, d3) {
  try {
  
      var sock = getSocketFromFD(fd);
      // TODO: sock.saddr should never be undefined, see TODO in websocket_sock_ops.getname
      var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || '0.0.0.0'), sock.sport, addrlen);
      assert(!errno);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  function ___syscall_getsockopt(fd, level, optname, optval, optlen, d1) {
  try {
  
      var sock = getSocketFromFD(fd);
      // Minimal getsockopt aimed at resolving https://github.com/emscripten-core/emscripten/issues/2211
      // so only supports SOL_SOCKET with SO_ERROR.
      if (level === 1) {
        if (optname === 4) {
          HEAP32[((optval)>>2)] = sock.error;
          HEAP32[((optlen)>>2)] = 4;
          sock.error = null; // Clear the error (The SO_ERROR option obtains and then clears this field).
          return 0;
        }
      }
      return -50; // The option is unknown at the level indicated.
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_ioctl(fd, op, varargs) {
  SYSCALLS.varargs = varargs;
  try {
  
      var stream = SYSCALLS.getStreamFromFD(fd);
      switch (op) {
        case 21509: {
          if (!stream.tty) return -59;
          return 0;
        }
        case 21505: {
          if (!stream.tty) return -59;
          if (stream.tty.ops.ioctl_tcgets) {
            var termios = stream.tty.ops.ioctl_tcgets(stream);
            var argp = SYSCALLS.get();
            HEAP32[((argp)>>2)] = termios.c_iflag || 0;
            HEAP32[(((argp)+(4))>>2)] = termios.c_oflag || 0;
            HEAP32[(((argp)+(8))>>2)] = termios.c_cflag || 0;
            HEAP32[(((argp)+(12))>>2)] = termios.c_lflag || 0;
            for (var i = 0; i < 32; i++) {
              HEAP8[(((argp + i)+(17))>>0)] = termios.c_cc[i] || 0;
            }
            return 0;
          }
          return 0;
        }
        case 21510:
        case 21511:
        case 21512: {
          if (!stream.tty) return -59;
          return 0; // no-op, not actually adjusting terminal settings
        }
        case 21506:
        case 21507:
        case 21508: {
          if (!stream.tty) return -59;
          if (stream.tty.ops.ioctl_tcsets) {
            var argp = SYSCALLS.get();
            var c_iflag = HEAP32[((argp)>>2)];
            var c_oflag = HEAP32[(((argp)+(4))>>2)];
            var c_cflag = HEAP32[(((argp)+(8))>>2)];
            var c_lflag = HEAP32[(((argp)+(12))>>2)];
            var c_cc = []
            for (var i = 0; i < 32; i++) {
              c_cc.push(HEAP8[(((argp + i)+(17))>>0)]);
            }
            return stream.tty.ops.ioctl_tcsets(stream.tty, op, { c_iflag, c_oflag, c_cflag, c_lflag, c_cc });
          }
          return 0; // no-op, not actually adjusting terminal settings
        }
        case 21519: {
          if (!stream.tty) return -59;
          var argp = SYSCALLS.get();
          HEAP32[((argp)>>2)] = 0;
          return 0;
        }
        case 21520: {
          if (!stream.tty) return -59;
          return -28; // not supported
        }
        case 21531: {
          var argp = SYSCALLS.get();
          return FS.ioctl(stream, op, argp);
        }
        case 21523: {
          // TODO: in theory we should write to the winsize struct that gets
          // passed in, but for now musl doesn't read anything on it
          if (!stream.tty) return -59;
          if (stream.tty.ops.ioctl_tiocgwinsz) {
            var winsize = stream.tty.ops.ioctl_tiocgwinsz(stream.tty);
            var argp = SYSCALLS.get();
            HEAP16[((argp)>>1)] = winsize[0];
            HEAP16[(((argp)+(2))>>1)] = winsize[1];
          }
          return 0;
        }
        case 21524: {
          // TODO: technically, this ioctl call should change the window size.
          // but, since emscripten doesn't have any concept of a terminal window
          // yet, we'll just silently throw it away as we do TIOCGWINSZ
          if (!stream.tty) return -59;
          return 0;
        }
        case 21515: {
          if (!stream.tty) return -59;
          return 0;
        }
        default: return -28; // not supported
      }
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  function ___syscall_listen(fd, backlog) {
  try {
  
      var sock = getSocketFromFD(fd);
      sock.sock_ops.listen(sock, backlog);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_lstat64(path, buf) {
  try {
  
      path = SYSCALLS.getStr(path);
      return SYSCALLS.doStat(FS.lstat, path, buf);
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_mkdirat(dirfd, path, mode) {
  try {
  
      path = SYSCALLS.getStr(path);
      path = SYSCALLS.calculateAt(dirfd, path);
      // remove a trailing slash, if one - /a/b/ has basename of '', but
      // we want to create b in the context of this function
      path = PATH.normalize(path);
      if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
      FS.mkdir(path, mode, 0);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_newfstatat(dirfd, path, buf, flags) {
  try {
  
      path = SYSCALLS.getStr(path);
      var nofollow = flags & 256;
      var allowEmpty = flags & 4096;
      flags = flags & (~6400);
      assert(!flags, `unknown flags in __syscall_newfstatat: ${flags}`);
      path = SYSCALLS.calculateAt(dirfd, path, allowEmpty);
      return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf);
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_openat(dirfd, path, flags, varargs) {
  SYSCALLS.varargs = varargs;
  try {
  
      path = SYSCALLS.getStr(path);
      path = SYSCALLS.calculateAt(dirfd, path);
      var mode = varargs ? SYSCALLS.get() : 0;
      return FS.open(path, flags, mode).fd;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_poll(fds, nfds, timeout) {
  try {
  
      var nonzero = 0;
      for (var i = 0; i < nfds; i++) {
        var pollfd = fds + 8 * i;
        var fd = HEAP32[((pollfd)>>2)];
        var events = HEAP16[(((pollfd)+(4))>>1)];
        var mask = 32;
        var stream = FS.getStream(fd);
        if (stream) {
          mask = SYSCALLS.DEFAULT_POLLMASK;
          if (stream.stream_ops.poll) {
            mask = stream.stream_ops.poll(stream, -1);
          }
        }
        mask &= events | 8 | 16;
        if (mask) nonzero++;
        HEAP16[(((pollfd)+(6))>>1)] = mask;
      }
      return nonzero;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  
  function ___syscall_readlinkat(dirfd, path, buf, bufsize) {
  try {
  
      path = SYSCALLS.getStr(path);
      path = SYSCALLS.calculateAt(dirfd, path);
      if (bufsize <= 0) return -28;
      var ret = FS.readlink(path);
  
      var len = Math.min(bufsize, lengthBytesUTF8(ret));
      var endChar = HEAP8[buf+len];
      stringToUTF8(ret, buf, bufsize+1);
      // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
      // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
      HEAP8[buf+len] = endChar;
      return len;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  
  
  function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) {
  try {
  
      var sock = getSocketFromFD(fd);
      var msg = sock.sock_ops.recvmsg(sock, len);
      if (!msg) return 0; // socket is closed
      if (addr) {
        var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen);
        assert(!errno);
      }
      HEAPU8.set(msg.buffer, buf);
      return msg.buffer.byteLength;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) {
  try {
  
      oldpath = SYSCALLS.getStr(oldpath);
      newpath = SYSCALLS.getStr(newpath);
      oldpath = SYSCALLS.calculateAt(olddirfd, oldpath);
      newpath = SYSCALLS.calculateAt(newdirfd, newpath);
      FS.rename(oldpath, newpath);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_rmdir(path) {
  try {
  
      path = SYSCALLS.getStr(path);
      FS.rmdir(path);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  
  function ___syscall_sendto(fd, message, length, flags, addr, addr_len) {
  try {
  
      var sock = getSocketFromFD(fd);
      var dest = getSocketAddress(addr, addr_len, true);
      if (!dest) {
        // send, no address provided
        return FS.write(sock.stream, HEAP8,message, length);
      }
      // sendto an address
      return sock.sock_ops.sendmsg(sock, HEAP8,message, length, dest.addr, dest.port);
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  
  function ___syscall_socket(domain, type, protocol) {
  try {
  
      var sock = SOCKFS.createSocket(domain, type, protocol);
      assert(sock.stream.fd < 64); // XXX ? select() assumes socket fd values are in 0..63
      return sock.stream.fd;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_stat64(path, buf) {
  try {
  
      path = SYSCALLS.getStr(path);
      return SYSCALLS.doStat(FS.stat, path, buf);
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_statfs64(path, size, buf) {
  try {
  
      path = SYSCALLS.getStr(path);
      assert(size === 64);
      // NOTE: None of the constants here are true. We're just returning safe and
      //       sane values.
      HEAP32[(((buf)+(4))>>2)] = 4096;
      HEAP32[(((buf)+(40))>>2)] = 4096;
      HEAP32[(((buf)+(8))>>2)] = 1000000;
      HEAP32[(((buf)+(12))>>2)] = 500000;
      HEAP32[(((buf)+(16))>>2)] = 500000;
      HEAP32[(((buf)+(20))>>2)] = FS.nextInode;
      HEAP32[(((buf)+(24))>>2)] = 1000000;
      HEAP32[(((buf)+(28))>>2)] = 42;
      HEAP32[(((buf)+(44))>>2)] = 2;  // ST_NOSUID
      HEAP32[(((buf)+(36))>>2)] = 255;
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_symlink(target, linkpath) {
  try {
  
      target = SYSCALLS.getStr(target);
      linkpath = SYSCALLS.getStr(linkpath);
      FS.symlink(target, linkpath);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  function ___syscall_unlinkat(dirfd, path, flags) {
  try {
  
      path = SYSCALLS.getStr(path);
      path = SYSCALLS.calculateAt(dirfd, path);
      if (flags === 0) {
        FS.unlink(path);
      } else if (flags === 512) {
        FS.rmdir(path);
      } else {
        abort('Invalid flags passed to unlinkat');
      }
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return -e.errno;
  }
  }

  var nowIsMonotonic = true;;
  var __emscripten_get_now_is_monotonic = () => nowIsMonotonic;

  var __emscripten_throw_longjmp = () => {
      throw Infinity;
    };

  function convertI32PairToI53Checked(lo, hi) {
      assert(lo == (lo >>> 0) || lo == (lo|0)); // lo should either be a i32 or a u32
      assert(hi === (hi|0));                    // hi should be a i32
      return ((hi + 0x200000) >>> 0 < 0x400001 - !!lo) ? (lo >>> 0) + hi * 4294967296 : NaN;
    }
  function __gmtime_js(time_low, time_high,tmPtr) {
    var time = convertI32PairToI53Checked(time_low, time_high);;
  
    
      var date = new Date(time * 1000);
      HEAP32[((tmPtr)>>2)] = date.getUTCSeconds();
      HEAP32[(((tmPtr)+(4))>>2)] = date.getUTCMinutes();
      HEAP32[(((tmPtr)+(8))>>2)] = date.getUTCHours();
      HEAP32[(((tmPtr)+(12))>>2)] = date.getUTCDate();
      HEAP32[(((tmPtr)+(16))>>2)] = date.getUTCMonth();
      HEAP32[(((tmPtr)+(20))>>2)] = date.getUTCFullYear()-1900;
      HEAP32[(((tmPtr)+(24))>>2)] = date.getUTCDay();
      var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0);
      var yday = ((date.getTime() - start) / (1000 * 60 * 60 * 24))|0;
      HEAP32[(((tmPtr)+(28))>>2)] = yday;
    ;
  }

  var isLeapYear = (year) => {
        return year%4 === 0 && (year%100 !== 0 || year%400 === 0);
    };
  
  var MONTH_DAYS_LEAP_CUMULATIVE = [0,31,60,91,121,152,182,213,244,274,305,335];
  
  var MONTH_DAYS_REGULAR_CUMULATIVE = [0,31,59,90,120,151,181,212,243,273,304,334];
  var ydayFromDate = (date) => {
      var leap = isLeapYear(date.getFullYear());
      var monthDaysCumulative = (leap ? MONTH_DAYS_LEAP_CUMULATIVE : MONTH_DAYS_REGULAR_CUMULATIVE);
      var yday = monthDaysCumulative[date.getMonth()] + date.getDate() - 1; // -1 since it's days since Jan 1
  
      return yday;
    };
  
  function __localtime_js(time_low, time_high,tmPtr) {
    var time = convertI32PairToI53Checked(time_low, time_high);;
  
    
      var date = new Date(time*1000);
      HEAP32[((tmPtr)>>2)] = date.getSeconds();
      HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes();
      HEAP32[(((tmPtr)+(8))>>2)] = date.getHours();
      HEAP32[(((tmPtr)+(12))>>2)] = date.getDate();
      HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth();
      HEAP32[(((tmPtr)+(20))>>2)] = date.getFullYear()-1900;
      HEAP32[(((tmPtr)+(24))>>2)] = date.getDay();
  
      var yday = ydayFromDate(date)|0;
      HEAP32[(((tmPtr)+(28))>>2)] = yday;
      HEAP32[(((tmPtr)+(36))>>2)] = -(date.getTimezoneOffset() * 60);
  
      // Attention: DST is in December in South, and some regions don't have DST at all.
      var start = new Date(date.getFullYear(), 0, 1);
      var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
      var winterOffset = start.getTimezoneOffset();
      var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset))|0;
      HEAP32[(((tmPtr)+(32))>>2)] = dst;
    ;
  }

  var timers = {
  };
  
  var handleException = (e) => {
      // Certain exception types we do not treat as errors since they are used for
      // internal control flow.
      // 1. ExitStatus, which is thrown by exit()
      // 2. "unwind", which is thrown by emscripten_unwind_to_js_event_loop() and others
      //    that wish to return to JS event loop.
      if (e instanceof ExitStatus || e == 'unwind') {
        return EXITSTATUS;
      }
      checkStackCookie();
      if (e instanceof WebAssembly.RuntimeError) {
        if (_emscripten_stack_get_current() <= 0) {
          err('Stack overflow detected.  You can try increasing -sSTACK_SIZE (currently set to 65536)');
        }
      }
      quit_(1, e);
    };
  
  
  var _proc_exit = (code) => {
      EXITSTATUS = code;
      if (!keepRuntimeAlive()) {
        if (Module['onExit']) Module['onExit'](code);
        ABORT = true;
      }
      quit_(code, new ExitStatus(code));
    };
  /** @suppress {duplicate } */
  /** @param {boolean|number=} implicit */
  var exitJS = (status, implicit) => {
      EXITSTATUS = status;
  
      if (!keepRuntimeAlive()) {
        exitRuntime();
      }
  
      // if exit() was called explicitly, warn the user if the runtime isn't actually being shut down
      if (keepRuntimeAlive() && !implicit) {
        var msg = `program exited (with status: ${status}), but keepRuntimeAlive() is set (counter=${runtimeKeepaliveCounter}) due to an async operation, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)`;
        readyPromiseReject(msg);
        err(msg);
      }
  
      _proc_exit(status);
    };
  var _exit = exitJS;
  
  var maybeExit = () => {
      if (runtimeExited) {
        return;
      }
      if (!keepRuntimeAlive()) {
        try {
          _exit(EXITSTATUS);
        } catch (e) {
          handleException(e);
        }
      }
    };
  var callUserCallback = (func) => {
      if (runtimeExited || ABORT) {
        err('user callback triggered after runtime exited or application aborted.  Ignoring.');
        return;
      }
      try {
        func();
        maybeExit();
      } catch (e) {
        handleException(e);
      }
    };
  
  
  var _emscripten_get_now;
      // Modern environment where performance.now() is supported:
      // N.B. a shorter form "_emscripten_get_now = performance.now;" is
      // unfortunately not allowed even in current browsers (e.g. FF Nightly 75).
      _emscripten_get_now = () => performance.now();
  ;
  var __setitimer_js = (which, timeout_ms) => {
      // First, clear any existing timer.
      if (timers[which]) {
        clearTimeout(timers[which].id);
        delete timers[which];
      }
  
      // A timeout of zero simply cancels the current timeout so we have nothing
      // more to do.
      if (!timeout_ms) return 0;
  
      var id = setTimeout(() => {
        assert(which in timers);
        delete timers[which];
        callUserCallback(() => __emscripten_timeout(which, _emscripten_get_now()));
      }, timeout_ms);
      timers[which] = { id, timeout_ms };
      return 0;
    };

  
  
  var stringToNewUTF8 = (str) => {
      var size = lengthBytesUTF8(str) + 1;
      var ret = _malloc(size);
      if (ret) stringToUTF8(str, ret, size);
      return ret;
    };
  var __tzset_js = (timezone, daylight, tzname) => {
      // TODO: Use (malleable) environment variables instead of system settings.
      var currentYear = new Date().getFullYear();
      var winter = new Date(currentYear, 0, 1);
      var summer = new Date(currentYear, 6, 1);
      var winterOffset = winter.getTimezoneOffset();
      var summerOffset = summer.getTimezoneOffset();
  
      // Local standard timezone offset. Local standard time is not adjusted for daylight savings.
      // This code uses the fact that getTimezoneOffset returns a greater value during Standard Time versus Daylight Saving Time (DST).
      // Thus it determines the expected output during Standard Time, and it compares whether the output of the given date the same (Standard) or less (DST).
      var stdTimezoneOffset = Math.max(winterOffset, summerOffset);
  
      // timezone is specified as seconds west of UTC ("The external variable
      // `timezone` shall be set to the difference, in seconds, between
      // Coordinated Universal Time (UTC) and local standard time."), the same
      // as returned by stdTimezoneOffset.
      // See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html
      HEAPU32[((timezone)>>2)] = stdTimezoneOffset * 60;
  
      HEAP32[((daylight)>>2)] = Number(winterOffset != summerOffset);
  
      function extractZone(date) {
        var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/);
        return match ? match[1] : "GMT";
      };
      var winterName = extractZone(winter);
      var summerName = extractZone(summer);
      var winterNamePtr = stringToNewUTF8(winterName);
      var summerNamePtr = stringToNewUTF8(summerName);
      if (summerOffset < winterOffset) {
        // Northern hemisphere
        HEAPU32[((tzname)>>2)] = winterNamePtr;
        HEAPU32[(((tzname)+(4))>>2)] = summerNamePtr;
      } else {
        HEAPU32[((tzname)>>2)] = summerNamePtr;
        HEAPU32[(((tzname)+(4))>>2)] = winterNamePtr;
      }
    };

  var _abort = () => {
      abort('native code called abort()');
    };

  
  var runtimeKeepalivePush = () => {
      runtimeKeepaliveCounter += 1;
    };
  function _emscripten_set_main_loop_timing(mode, value) {
      Browser.mainLoop.timingMode = mode;
      Browser.mainLoop.timingValue = value;
  
      if (!Browser.mainLoop.func) {
        err('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.');
        return 1; // Return non-zero on failure, can't set timing mode when there is no main loop.
      }
  
      if (!Browser.mainLoop.running) {
        runtimeKeepalivePush();
        Browser.mainLoop.running = true;
      }
      if (mode == 0) {
        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
          var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0;
          setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop
        };
        Browser.mainLoop.method = 'timeout';
      } else if (mode == 1) {
        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
          Browser.requestAnimationFrame(Browser.mainLoop.runner);
        };
        Browser.mainLoop.method = 'rAF';
      } else if (mode == 2) {
        if (typeof setImmediate == 'undefined') {
          // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed)
          var setImmediates = [];
          var emscriptenMainLoopMessageId = 'setimmediate';
          /** @param {Event} event */
          var Browser_setImmediate_messageHandler = (event) => {
            // When called in current thread or Worker, the main loop ID is structured slightly different to accommodate for --proxy-to-worker runtime listening to Worker events,
            // so check for both cases.
            if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) {
              event.stopPropagation();
              setImmediates.shift()();
            }
          };
          addEventListener("message", Browser_setImmediate_messageHandler, true);
          setImmediate = /** @type{function(function(): ?, ...?): number} */(function Browser_emulated_setImmediate(func) {
            setImmediates.push(func);
            if (ENVIRONMENT_IS_WORKER) {
              if (Module['setImmediates'] === undefined) Module['setImmediates'] = [];
              Module['setImmediates'].push(func);
              postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js
            } else postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself.
          })
        }
        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
          setImmediate(Browser.mainLoop.runner);
        };
        Browser.mainLoop.method = 'immediate';
      }
      return 0;
    }
  
  
  function webgl_enable_ANGLE_instanced_arrays(ctx) {
      // Extension available in WebGL 1 from Firefox 26 and Google Chrome 30 onwards. Core feature in WebGL 2.
      var ext = ctx.getExtension('ANGLE_instanced_arrays');
      if (ext) {
        ctx['vertexAttribDivisor'] = function(index, divisor) { ext['vertexAttribDivisorANGLE'](index, divisor); };
        ctx['drawArraysInstanced'] = function(mode, first, count, primcount) { ext['drawArraysInstancedANGLE'](mode, first, count, primcount); };
        ctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { ext['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
        return 1;
      }
    }
  
  function webgl_enable_OES_vertex_array_object(ctx) {
      // Extension available in WebGL 1 from Firefox 25 and WebKit 536.28/desktop Safari 6.0.3 onwards. Core feature in WebGL 2.
      var ext = ctx.getExtension('OES_vertex_array_object');
      if (ext) {
        ctx['createVertexArray'] = function() { return ext['createVertexArrayOES'](); };
        ctx['deleteVertexArray'] = function(vao) { ext['deleteVertexArrayOES'](vao); };
        ctx['bindVertexArray'] = function(vao) { ext['bindVertexArrayOES'](vao); };
        ctx['isVertexArray'] = function(vao) { return ext['isVertexArrayOES'](vao); };
        return 1;
      }
    }
  
  function webgl_enable_WEBGL_draw_buffers(ctx) {
      // Extension available in WebGL 1 from Firefox 28 onwards. Core feature in WebGL 2.
      var ext = ctx.getExtension('WEBGL_draw_buffers');
      if (ext) {
        ctx['drawBuffers'] = function(n, bufs) { ext['drawBuffersWEBGL'](n, bufs); };
        return 1;
      }
    }
  
  function webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(ctx) {
      // Closure is expected to be allowed to minify the '.dibvbi' property, so not accessing it quoted.
      return !!(ctx.dibvbi = ctx.getExtension('WEBGL_draw_instanced_base_vertex_base_instance'));
    }
  
  function webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(ctx) {
      // Closure is expected to be allowed to minify the '.mdibvbi' property, so not accessing it quoted.
      return !!(ctx.mdibvbi = ctx.getExtension('WEBGL_multi_draw_instanced_base_vertex_base_instance'));
    }
  
  function webgl_enable_WEBGL_multi_draw(ctx) {
      // Closure is expected to be allowed to minify the '.multiDrawWebgl' property, so not accessing it quoted.
      return !!(ctx.multiDrawWebgl = ctx.getExtension('WEBGL_multi_draw'));
    }
  
  
  var GL = {
  counter:1,
  buffers:[],
  programs:[],
  framebuffers:[],
  renderbuffers:[],
  textures:[],
  shaders:[],
  vaos:[],
  contexts:[],
  offscreenCanvases:{
  },
  queries:[],
  samplers:[],
  transformFeedbacks:[],
  syncs:[],
  stringCache:{
  },
  stringiCache:{
  },
  unpackAlignment:4,
  recordError:function recordError(errorCode) {
        if (!GL.lastError) {
          GL.lastError = errorCode;
        }
      },
  getNewId:function(table) {
        var ret = GL.counter++;
        for (var i = table.length; i < ret; i++) {
          table[i] = null;
        }
        return ret;
      },
  getSource:function(shader, count, string, length) {
        var source = '';
        for (var i = 0; i < count; ++i) {
          var len = length ? HEAP32[(((length)+(i*4))>>2)] : -1;
          source += UTF8ToString(HEAP32[(((string)+(i*4))>>2)], len < 0 ? undefined : len);
        }
        return source;
      },
  createContext:function(/** @type {HTMLCanvasElement} */ canvas, webGLContextAttributes) {
        // In proxied operation mode, rAF()/setTimeout() functions do not delimit frame boundaries, so can't have WebGL implementation
        // try to detect when it's ok to discard contents of the rendered backbuffer.
        if (webGLContextAttributes.renderViaOffscreenBackBuffer) webGLContextAttributes['preserveDrawingBuffer'] = true;
  
        var ctx =
          (webGLContextAttributes.majorVersion > 1)
          ?
            canvas.getContext("webgl2", webGLContextAttributes)
          :
          (canvas.getContext("webgl", webGLContextAttributes)
            // https://caniuse.com/#feat=webgl
            );
  
        if (!ctx) return 0;
  
        var handle = GL.registerContext(ctx, webGLContextAttributes);
  
        return handle;
      },
  enableOffscreenFramebufferAttributes:function(webGLContextAttributes) {
        webGLContextAttributes.renderViaOffscreenBackBuffer = true;
        webGLContextAttributes.preserveDrawingBuffer = true;
      },
  createOffscreenFramebuffer:function(context) {
        var gl = context.GLctx;
  
        // Create FBO
        var fbo = gl.createFramebuffer();
        gl.bindFramebuffer(0x8D40 /*GL_FRAMEBUFFER*/, fbo);
        context.defaultFbo = fbo;
  
        context.defaultFboForbidBlitFramebuffer = false;
        if (gl.getContextAttributes().antialias) {
          context.defaultFboForbidBlitFramebuffer = true;
        }
  
        // Create render targets to the FBO
        context.defaultColorTarget = gl.createTexture();
        context.defaultDepthTarget = gl.createRenderbuffer();
        GL.resizeOffscreenFramebuffer(context); // Size them up correctly (use the same mechanism when resizing on demand)
  
        gl.bindTexture(0xDE1 /*GL_TEXTURE_2D*/, context.defaultColorTarget);
        gl.texParameteri(0xDE1 /*GL_TEXTURE_2D*/, 0x2801 /*GL_TEXTURE_MIN_FILTER*/, 0x2600 /*GL_NEAREST*/);
        gl.texParameteri(0xDE1 /*GL_TEXTURE_2D*/, 0x2800 /*GL_TEXTURE_MAG_FILTER*/, 0x2600 /*GL_NEAREST*/);
        gl.texParameteri(0xDE1 /*GL_TEXTURE_2D*/, 0x2802 /*GL_TEXTURE_WRAP_S*/, 0x812F /*GL_CLAMP_TO_EDGE*/);
        gl.texParameteri(0xDE1 /*GL_TEXTURE_2D*/, 0x2803 /*GL_TEXTURE_WRAP_T*/, 0x812F /*GL_CLAMP_TO_EDGE*/);
        gl.texImage2D(0xDE1 /*GL_TEXTURE_2D*/, 0, 0x1908 /*GL_RGBA*/, gl.canvas.width, gl.canvas.height, 0, 0x1908 /*GL_RGBA*/, 0x1401 /*GL_UNSIGNED_BYTE*/, null);
        gl.framebufferTexture2D(0x8D40 /*GL_FRAMEBUFFER*/, 0x8CE0 /*GL_COLOR_ATTACHMENT0*/, 0xDE1 /*GL_TEXTURE_2D*/, context.defaultColorTarget, 0);
        gl.bindTexture(0xDE1 /*GL_TEXTURE_2D*/, null);
  
        // Create depth render target to the FBO
        var depthTarget = gl.createRenderbuffer();
        gl.bindRenderbuffer(0x8D41 /*GL_RENDERBUFFER*/, context.defaultDepthTarget);
        gl.renderbufferStorage(0x8D41 /*GL_RENDERBUFFER*/, 0x81A5 /*GL_DEPTH_COMPONENT16*/, gl.canvas.width, gl.canvas.height);
        gl.framebufferRenderbuffer(0x8D40 /*GL_FRAMEBUFFER*/, 0x8D00 /*GL_DEPTH_ATTACHMENT*/, 0x8D41 /*GL_RENDERBUFFER*/, context.defaultDepthTarget);
        gl.bindRenderbuffer(0x8D41 /*GL_RENDERBUFFER*/, null);
  
        // Create blitter
        var vertices = [
          -1, -1,
          -1,  1,
           1, -1,
           1,  1
        ];
        var vb = gl.createBuffer();
        gl.bindBuffer(0x8892 /*GL_ARRAY_BUFFER*/, vb);
        gl.bufferData(0x8892 /*GL_ARRAY_BUFFER*/, new Float32Array(vertices), 0x88E4 /*GL_STATIC_DRAW*/);
        gl.bindBuffer(0x8892 /*GL_ARRAY_BUFFER*/, null);
        context.blitVB = vb;
  
        var vsCode =
          'attribute vec2 pos;' +
          'varying lowp vec2 tex;' +
          'void main() { tex = pos * 0.5 + vec2(0.5,0.5); gl_Position = vec4(pos, 0.0, 1.0); }';
        var vs = gl.createShader(0x8B31 /*GL_VERTEX_SHADER*/);
        gl.shaderSource(vs, vsCode);
        gl.compileShader(vs);
  
        var fsCode =
          'varying lowp vec2 tex;' +
          'uniform sampler2D sampler;' +
          'void main() { gl_FragColor = texture2D(sampler, tex); }';
        var fs = gl.createShader(0x8B30 /*GL_FRAGMENT_SHADER*/);
        gl.shaderSource(fs, fsCode);
        gl.compileShader(fs);
  
        var blitProgram = gl.createProgram();
        gl.attachShader(blitProgram, vs);
        gl.attachShader(blitProgram, fs);
        gl.linkProgram(blitProgram);
        context.blitProgram = blitProgram;
        context.blitPosLoc = gl.getAttribLocation(blitProgram, "pos");
        gl.useProgram(blitProgram);
        gl.uniform1i(gl.getUniformLocation(blitProgram, "sampler"), 0);
        gl.useProgram(null);
  
        context.defaultVao = undefined;
        if (gl.createVertexArray) {
          context.defaultVao = gl.createVertexArray();
          gl.bindVertexArray(context.defaultVao);
          gl.enableVertexAttribArray(context.blitPosLoc);
          gl.bindVertexArray(null);
        }
      },
  resizeOffscreenFramebuffer:function(context) {
        var gl = context.GLctx;
  
        // Resize color buffer
        if (context.defaultColorTarget) {
          var prevTextureBinding = gl.getParameter(0x8069 /*GL_TEXTURE_BINDING_2D*/);
          gl.bindTexture(0xDE1 /*GL_TEXTURE_2D*/, context.defaultColorTarget);
          gl.texImage2D(0xDE1 /*GL_TEXTURE_2D*/, 0, 0x1908 /*GL_RGBA*/, gl.drawingBufferWidth, gl.drawingBufferHeight, 0, 0x1908 /*GL_RGBA*/, 0x1401 /*GL_UNSIGNED_BYTE*/, null);
          gl.bindTexture(0xDE1 /*GL_TEXTURE_2D*/, prevTextureBinding);
        }
  
        // Resize depth buffer
        if (context.defaultDepthTarget) {
          var prevRenderBufferBinding = gl.getParameter(0x8CA7 /*GL_RENDERBUFFER_BINDING*/);
          gl.bindRenderbuffer(0x8D41 /*GL_RENDERBUFFER*/, context.defaultDepthTarget);
          gl.renderbufferStorage(0x8D41 /*GL_RENDERBUFFER*/, 0x81A5 /*GL_DEPTH_COMPONENT16*/, gl.drawingBufferWidth, gl.drawingBufferHeight); // TODO: Read context creation parameters for what type of depth and stencil to use
          gl.bindRenderbuffer(0x8D41 /*GL_RENDERBUFFER*/, prevRenderBufferBinding);
        }
      },
  blitOffscreenFramebuffer:function(context) {
        var gl = context.GLctx;
  
        var prevScissorTest = gl.getParameter(0xC11 /*GL_SCISSOR_TEST*/);
        if (prevScissorTest) gl.disable(0xC11 /*GL_SCISSOR_TEST*/);
  
        var prevFbo = gl.getParameter(0x8CA6 /*GL_FRAMEBUFFER_BINDING*/);
  
        if (gl.blitFramebuffer && !context.defaultFboForbidBlitFramebuffer) {
          gl.bindFramebuffer(0x8CA8 /*GL_READ_FRAMEBUFFER*/, context.defaultFbo);
          gl.bindFramebuffer(0x8CA9 /*GL_DRAW_FRAMEBUFFER*/, null);
          gl.blitFramebuffer(0, 0, gl.canvas.width, gl.canvas.height,
                             0, 0, gl.canvas.width, gl.canvas.height,
                             0x4000 /*GL_COLOR_BUFFER_BIT*/, 0x2600/*GL_NEAREST*/);
        }
        else
        {
          gl.bindFramebuffer(0x8D40 /*GL_FRAMEBUFFER*/, null);
  
          var prevProgram = gl.getParameter(0x8B8D /*GL_CURRENT_PROGRAM*/);
          gl.useProgram(context.blitProgram);
  
          var prevVB = gl.getParameter(0x8894 /*GL_ARRAY_BUFFER_BINDING*/);
          gl.bindBuffer(0x8892 /*GL_ARRAY_BUFFER*/, context.blitVB);
  
          var prevActiveTexture = gl.getParameter(0x84E0 /*GL_ACTIVE_TEXTURE*/);
          gl.activeTexture(0x84C0 /*GL_TEXTURE0*/);
  
          var prevTextureBinding = gl.getParameter(0x8069 /*GL_TEXTURE_BINDING_2D*/);
          gl.bindTexture(0xDE1 /*GL_TEXTURE_2D*/, context.defaultColorTarget);
  
          var prevBlend = gl.getParameter(0xBE2 /*GL_BLEND*/);
          if (prevBlend) gl.disable(0xBE2 /*GL_BLEND*/);
  
          var prevCullFace = gl.getParameter(0xB44 /*GL_CULL_FACE*/);
          if (prevCullFace) gl.disable(0xB44 /*GL_CULL_FACE*/);
  
          var prevDepthTest = gl.getParameter(0xB71 /*GL_DEPTH_TEST*/);
          if (prevDepthTest) gl.disable(0xB71 /*GL_DEPTH_TEST*/);
  
          var prevStencilTest = gl.getParameter(0xB90 /*GL_STENCIL_TEST*/);
          if (prevStencilTest) gl.disable(0xB90 /*GL_STENCIL_TEST*/);
  
          function draw() {
            gl.vertexAttribPointer(context.blitPosLoc, 2, 0x1406 /*GL_FLOAT*/, false, 0, 0);
            gl.drawArrays(5/*GL_TRIANGLE_STRIP*/, 0, 4);
          }
  
          if (context.defaultVao) {
            // WebGL 2 or OES_vertex_array_object
            var prevVAO = gl.getParameter(0x85B5 /*GL_VERTEX_ARRAY_BINDING*/);
            gl.bindVertexArray(context.defaultVao);
            draw();
            gl.bindVertexArray(prevVAO);
          }
          else
          {
            var prevVertexAttribPointer = {
              buffer: gl.getVertexAttrib(context.blitPosLoc, 0x889F /*GL_VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/),
              size: gl.getVertexAttrib(context.blitPosLoc, 0x8623 /*GL_VERTEX_ATTRIB_ARRAY_SIZE*/),
              stride: gl.getVertexAttrib(context.blitPosLoc, 0x8624 /*GL_VERTEX_ATTRIB_ARRAY_STRIDE*/),
              type: gl.getVertexAttrib(context.blitPosLoc, 0x8625 /*GL_VERTEX_ATTRIB_ARRAY_TYPE*/),
              normalized: gl.getVertexAttrib(context.blitPosLoc, 0x886A /*GL_VERTEX_ATTRIB_ARRAY_NORMALIZED*/),
              pointer: gl.getVertexAttribOffset(context.blitPosLoc, 0x8645 /*GL_VERTEX_ATTRIB_ARRAY_POINTER*/),
            };
            var maxVertexAttribs = gl.getParameter(0x8869 /*GL_MAX_VERTEX_ATTRIBS*/);
            var prevVertexAttribEnables = [];
            for (var i = 0; i < maxVertexAttribs; ++i) {
              var prevEnabled = gl.getVertexAttrib(i, 0x8622 /*GL_VERTEX_ATTRIB_ARRAY_ENABLED*/);
              var wantEnabled = i == context.blitPosLoc;
              if (prevEnabled && !wantEnabled) {
                gl.disableVertexAttribArray(i);
              }
              if (!prevEnabled && wantEnabled) {
                gl.enableVertexAttribArray(i);
              }
              prevVertexAttribEnables[i] = prevEnabled;
            }
  
            draw();
  
            for (var i = 0; i < maxVertexAttribs; ++i) {
              var prevEnabled = prevVertexAttribEnables[i];
              var nowEnabled = i == context.blitPosLoc;
              if (prevEnabled && !nowEnabled) {
                gl.enableVertexAttribArray(i);
              }
              if (!prevEnabled && nowEnabled) {
                gl.disableVertexAttribArray(i);
              }
            }
            gl.bindBuffer(0x8892 /*GL_ARRAY_BUFFER*/, prevVertexAttribPointer.buffer);
            gl.vertexAttribPointer(context.blitPosLoc,
                                   prevVertexAttribPointer.size,
                                   prevVertexAttribPointer.type,
                                   prevVertexAttribPointer.normalized,
                                   prevVertexAttribPointer.stride,
                                   prevVertexAttribPointer.offset);
          }
  
          if (prevStencilTest) gl.enable(0xB90 /*GL_STENCIL_TEST*/);
          if (prevDepthTest) gl.enable(0xB71 /*GL_DEPTH_TEST*/);
          if (prevCullFace) gl.enable(0xB44 /*GL_CULL_FACE*/);
          if (prevBlend) gl.enable(0xBE2 /*GL_BLEND*/);
  
          gl.bindTexture(0xDE1 /*GL_TEXTURE_2D*/, prevTextureBinding);
          gl.activeTexture(prevActiveTexture);
          gl.bindBuffer(0x8892 /*GL_ARRAY_BUFFER*/, prevVB);
          gl.useProgram(prevProgram);
        }
        gl.bindFramebuffer(0x8D40 /*GL_FRAMEBUFFER*/, prevFbo);
        if (prevScissorTest) gl.enable(0xC11 /*GL_SCISSOR_TEST*/);
      },
  registerContext:function(ctx, webGLContextAttributes) {
        // without pthreads a context is just an integer ID
        var handle = GL.getNewId(GL.contexts);
  
        var context = {
          handle,
          attributes: webGLContextAttributes,
          version: webGLContextAttributes.majorVersion,
          GLctx: ctx
        };
  
        // Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
        if (ctx.canvas) ctx.canvas.GLctxObject = context;
        GL.contexts[handle] = context;
        if (typeof webGLContextAttributes.enableExtensionsByDefault == 'undefined' || webGLContextAttributes.enableExtensionsByDefault) {
          GL.initExtensions(context);
        }
  
        if (webGLContextAttributes.renderViaOffscreenBackBuffer) GL.createOffscreenFramebuffer(context);
        return handle;
      },
  makeContextCurrent:function(contextHandle) {
  
        GL.currentContext = GL.contexts[contextHandle]; // Active Emscripten GL layer context object.
        Module.ctx = GLctx = GL.currentContext && GL.currentContext.GLctx; // Active WebGL context object.
        return !(contextHandle && !GLctx);
      },
  getContext:function(contextHandle) {
        return GL.contexts[contextHandle];
      },
  deleteContext:function(contextHandle) {
        if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
        if (typeof JSEvents == 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
        if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
        GL.contexts[contextHandle] = null;
      },
  initExtensions:function(context) {
        // If this function is called without a specific context object, init the extensions of the currently active context.
        if (!context) context = GL.currentContext;
  
        if (context.initExtensionsDone) return;
        context.initExtensionsDone = true;
  
        var GLctx = context.GLctx;
  
        // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist.
  
        // Extensions that are only available in WebGL 1 (the calls will be no-ops if called on a WebGL 2 context active)
        webgl_enable_ANGLE_instanced_arrays(GLctx);
        webgl_enable_OES_vertex_array_object(GLctx);
        webgl_enable_WEBGL_draw_buffers(GLctx);
        // Extensions that are available from WebGL >= 2 (no-op if called on a WebGL 1 context active)
        webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx);
        webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx);
  
        // On WebGL 2, EXT_disjoint_timer_query is replaced with an alternative
        // that's based on core APIs, and exposes only the queryCounterEXT()
        // entrypoint.
        if (context.version >= 2) {
          GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query_webgl2");
        }
  
        // However, Firefox exposes the WebGL 1 version on WebGL 2 as well and
        // thus we look for the WebGL 1 version again if the WebGL 2 version
        // isn't present. https://bugzilla.mozilla.org/show_bug.cgi?id=1328882
        if (context.version < 2 || !GLctx.disjointTimerQueryExt)
        {
          GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
        }
  
        webgl_enable_WEBGL_multi_draw(GLctx);
  
        // .getSupportedExtensions() can return null if context is lost, so coerce to empty array.
        var exts = GLctx.getSupportedExtensions() || [];
        exts.forEach(function(ext) {
          // WEBGL_lose_context, WEBGL_debug_renderer_info and WEBGL_debug_shaders are not enabled by default.
          if (!ext.includes('lose_context') && !ext.includes('debug')) {
            // Call .getExtension() to enable that extension permanently.
            GLctx.getExtension(ext);
          }
        });
      },
  };
  
  /** @suppress {duplicate } */
  function _emscripten_webgl_do_commit_frame() {
      if (!GL.currentContext || !GL.currentContext.GLctx) {
        return -3;
      }
  
      if (GL.currentContext.defaultFbo) {
        GL.blitOffscreenFramebuffer(GL.currentContext);
        return 0;
      }
      if (!GL.currentContext.attributes.explicitSwapControl) {
        return -3;
      }
      // We would do GL.currentContext.GLctx.commit(); here, but the current implementation
      // in browsers has removed it - swap is implicit, so this function is a no-op for now
      // (until/unless the spec changes).
      return 0;
    }
  var _emscripten_webgl_commit_frame = _emscripten_webgl_do_commit_frame;
  
  
  
  var runtimeKeepalivePop = () => {
      assert(runtimeKeepaliveCounter > 0);
      runtimeKeepaliveCounter -= 1;
    };
  
    /**
     * @param {number=} arg
     * @param {boolean=} noSetTiming
     */
  function setMainLoop(browserIterationFunc, fps, simulateInfiniteLoop, arg, noSetTiming) {
      assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.');
  
      Browser.mainLoop.func = browserIterationFunc;
      Browser.mainLoop.arg = arg;
  
      var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
      function checkIsRunning() {
        if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) {
          runtimeKeepalivePop();
          maybeExit();
          return false;
        }
        return true;
      }
  
      // We create the loop runner here but it is not actually running until
      // _emscripten_set_main_loop_timing is called (which might happen a
      // later time).  This member signifies that the current runner has not
      // yet been started so that we can call runtimeKeepalivePush when it
      // gets it timing set for the first time.
      Browser.mainLoop.running = false;
      Browser.mainLoop.runner = function Browser_mainLoop_runner() {
        if (ABORT) return;
        if (Browser.mainLoop.queue.length > 0) {
          var start = Date.now();
          var blocker = Browser.mainLoop.queue.shift();
          blocker.func(blocker.arg);
          if (Browser.mainLoop.remainingBlockers) {
            var remaining = Browser.mainLoop.remainingBlockers;
            var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining);
            if (blocker.counted) {
              Browser.mainLoop.remainingBlockers = next;
            } else {
              // not counted, but move the progress along a tiny bit
              next = next + 0.5; // do not steal all the next one's progress
              Browser.mainLoop.remainingBlockers = (8*remaining + next)/9;
            }
          }
          out('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers);
          Browser.mainLoop.updateStatus();
  
          // catches pause/resume main loop from blocker execution
          if (!checkIsRunning()) return;
  
          setTimeout(Browser.mainLoop.runner, 0);
          return;
        }
  
        // catch pauses from non-main loop sources
        if (!checkIsRunning()) return;
  
        // Implement very basic swap interval control
        Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
        if (Browser.mainLoop.timingMode == 1 && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
          // Not the scheduled time to render this frame - skip.
          Browser.mainLoop.scheduler();
          return;
        } else if (Browser.mainLoop.timingMode == 0) {
          Browser.mainLoop.tickStartTime = _emscripten_get_now();
        }
  
        // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize
        // VBO double-buffering and reduce GPU stalls.
  
        if (Browser.mainLoop.method === 'timeout' && Module.ctx) {
          warnOnce('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!');
          Browser.mainLoop.method = ''; // just warn once per call to set main loop
        }
  
        Browser.mainLoop.runIter(browserIterationFunc);
  
        checkStackCookie();
  
        // catch pauses from the main loop itself
        if (!checkIsRunning()) return;
  
        // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able
        // to queue the newest produced audio samples.
        // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData()
        //       do not need to be hardcoded into this function, but can be more generic.
        if (typeof SDL == 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
  
        Browser.mainLoop.scheduler();
      }
  
      if (!noSetTiming) {
        if (fps && fps > 0) {
          _emscripten_set_main_loop_timing(0, 1000.0 / fps);
        } else {
          // Do rAF by rendering each frame (no decimating)
          _emscripten_set_main_loop_timing(1, 1);
        }
  
        Browser.mainLoop.scheduler();
      }
  
      if (simulateInfiniteLoop) {
        throw 'unwind';
      }
    }
  
  
  
  
  /** @param {number=} timeout */
  var safeSetTimeout = (func, timeout) => {
      runtimeKeepalivePush();
      return setTimeout(() => {
        runtimeKeepalivePop();
        callUserCallback(func);
      }, timeout);
    };
  
  
  
  
  
  
  var Browser = {
  mainLoop:{
  running:false,
  scheduler:null,
  method:"",
  currentlyRunningMainloop:0,
  func:null,
  arg:0,
  timingMode:0,
  timingValue:0,
  currentFrameNumber:0,
  queue:[],
  pause:function() {
          Browser.mainLoop.scheduler = null;
          // Incrementing this signals the previous main loop that it's now become old, and it must return.
          Browser.mainLoop.currentlyRunningMainloop++;
        },
  resume:function() {
          Browser.mainLoop.currentlyRunningMainloop++;
          var timingMode = Browser.mainLoop.timingMode;
          var timingValue = Browser.mainLoop.timingValue;
          var func = Browser.mainLoop.func;
          Browser.mainLoop.func = null;
          // do not set timing and call scheduler, we will do it on the next lines
          setMainLoop(func, 0, false, Browser.mainLoop.arg, true);
          _emscripten_set_main_loop_timing(timingMode, timingValue);
          Browser.mainLoop.scheduler();
        },
  updateStatus:function() {
          if (Module['setStatus']) {
            var message = Module['statusMessage'] || 'Please wait...';
            var remaining = Browser.mainLoop.remainingBlockers;
            var expected = Browser.mainLoop.expectedBlockers;
            if (remaining) {
              if (remaining < expected) {
                Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')');
              } else {
                Module['setStatus'](message);
              }
            } else {
              Module['setStatus']('');
            }
          }
        },
  runIter:function(func) {
          if (ABORT) return;
          if (Module['preMainLoop']) {
            var preRet = Module['preMainLoop']();
            if (preRet === false) {
              return; // |return false| skips a frame
            }
          }
          callUserCallback(func);
          if (Module['postMainLoop']) Module['postMainLoop']();
        },
  },
  isFullscreen:false,
  pointerLock:false,
  moduleContextCreatedCallbacks:[],
  workers:[],
  init:function() {
        if (Browser.initted) return;
        Browser.initted = true;
  
        // Support for plugins that can process preloaded files. You can add more of these to
        // your app by creating and appending to preloadPlugins.
        //
        // Each plugin is asked if it can handle a file based on the file's name. If it can,
        // it is given the file's raw data. When it is done, it calls a callback with the file's
        // (possibly modified) data. For example, a plugin might decompress a file, or it
        // might create some side data structure for use later (like an Image element, etc.).
  
        var imagePlugin = {};
        imagePlugin['canHandle'] = function imagePlugin_canHandle(name) {
          return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
        };
        imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) {
          var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
          if (b.size !== byteArray.length) { // Safari bug #118630
            // Safari's Blob can only take an ArrayBuffer
            b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) });
          }
          var url = URL.createObjectURL(b);
          assert(typeof url == 'string', 'createObjectURL must return a url as a string');
          var img = new Image();
          img.onload = () => {
            assert(img.complete, 'Image ' + name + ' could not be decoded');
            var canvas = /** @type {!HTMLCanvasElement} */ (document.createElement('canvas'));
            canvas.width = img.width;
            canvas.height = img.height;
            var ctx = canvas.getContext('2d');
            ctx.drawImage(img, 0, 0);
            preloadedImages[name] = canvas;
            URL.revokeObjectURL(url);
            if (onload) onload(byteArray);
          };
          img.onerror = (event) => {
            out('Image ' + url + ' could not be decoded');
            if (onerror) onerror();
          };
          img.src = url;
        };
        preloadPlugins.push(imagePlugin);
  
        var audioPlugin = {};
        audioPlugin['canHandle'] = function audioPlugin_canHandle(name) {
          return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 };
        };
        audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) {
          var done = false;
          function finish(audio) {
            if (done) return;
            done = true;
            preloadedAudios[name] = audio;
            if (onload) onload(byteArray);
          }
          function fail() {
            if (done) return;
            done = true;
            preloadedAudios[name] = new Audio(); // empty shim
            if (onerror) onerror();
          }
          var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
          var url = URL.createObjectURL(b); // XXX we never revoke this!
          assert(typeof url == 'string', 'createObjectURL must return a url as a string');
          var audio = new Audio();
          audio.addEventListener('canplaythrough', () => finish(audio), false); // use addEventListener due to chromium bug 124926
          audio.onerror = function audio_onerror(event) {
            if (done) return;
            err('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach');
            function encode64(data) {
              var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
              var PAD = '=';
              var ret = '';
              var leftchar = 0;
              var leftbits = 0;
              for (var i = 0; i < data.length; i++) {
                leftchar = (leftchar << 8) | data[i];
                leftbits += 8;
                while (leftbits >= 6) {
                  var curr = (leftchar >> (leftbits-6)) & 0x3f;
                  leftbits -= 6;
                  ret += BASE[curr];
                }
              }
              if (leftbits == 2) {
                ret += BASE[(leftchar&3) << 4];
                ret += PAD + PAD;
              } else if (leftbits == 4) {
                ret += BASE[(leftchar&0xf) << 2];
                ret += PAD;
              }
              return ret;
            }
            audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray);
            finish(audio); // we don't wait for confirmation this worked - but it's worth trying
          };
          audio.src = url;
          // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror
          safeSetTimeout(() => {
            finish(audio); // try to use it even though it is not necessarily ready to play
          }, 10000);
        };
        preloadPlugins.push(audioPlugin);
  
        // Canvas event setup
  
        function pointerLockChange() {
          Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] ||
                                document['mozPointerLockElement'] === Module['canvas'] ||
                                document['webkitPointerLockElement'] === Module['canvas'] ||
                                document['msPointerLockElement'] === Module['canvas'];
        }
        var canvas = Module['canvas'];
        if (canvas) {
          // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module
          // Module['forcedAspectRatio'] = 4 / 3;
  
          canvas.requestPointerLock = canvas['requestPointerLock'] ||
                                      canvas['mozRequestPointerLock'] ||
                                      canvas['webkitRequestPointerLock'] ||
                                      canvas['msRequestPointerLock'] ||
                                      (() => {});
          canvas.exitPointerLock = document['exitPointerLock'] ||
                                   document['mozExitPointerLock'] ||
                                   document['webkitExitPointerLock'] ||
                                   document['msExitPointerLock'] ||
                                   (() => {}); // no-op if function does not exist
          canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
  
          document.addEventListener('pointerlockchange', pointerLockChange, false);
          document.addEventListener('mozpointerlockchange', pointerLockChange, false);
          document.addEventListener('webkitpointerlockchange', pointerLockChange, false);
          document.addEventListener('mspointerlockchange', pointerLockChange, false);
  
          if (Module['elementPointerLock']) {
            canvas.addEventListener("click", (ev) => {
              if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
                Module['canvas'].requestPointerLock();
                ev.preventDefault();
              }
            }, false);
          }
        }
      },
  createContext:function(/** @type {HTMLCanvasElement} */ canvas, useWebGL, setInModule, webGLContextAttributes) {
        if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas.
  
        var ctx;
        var contextHandle;
        if (useWebGL) {
          // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults.
          var contextAttributes = {
            antialias: false,
            alpha: false,
            majorVersion: (typeof WebGL2RenderingContext != 'undefined') ? 2 : 1,
          };
  
          if (webGLContextAttributes) {
            for (var attribute in webGLContextAttributes) {
              contextAttributes[attribute] = webGLContextAttributes[attribute];
            }
          }
  
          // This check of existence of GL is here to satisfy Closure compiler, which yells if variable GL is referenced below but GL object is not
          // actually compiled in because application is not doing any GL operations. TODO: Ideally if GL is not being used, this function
          // Browser.createContext() should not even be emitted.
          if (typeof GL != 'undefined') {
            contextHandle = GL.createContext(canvas, contextAttributes);
            if (contextHandle) {
              ctx = GL.getContext(contextHandle).GLctx;
            }
          }
        } else {
          ctx = canvas.getContext('2d');
        }
  
        if (!ctx) return null;
  
        if (setInModule) {
          if (!useWebGL) assert(typeof GLctx == 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it');
  
          Module.ctx = ctx;
          if (useWebGL) GL.makeContextCurrent(contextHandle);
          Module.useWebGL = useWebGL;
          Browser.moduleContextCreatedCallbacks.forEach((callback) => callback());
          Browser.init();
        }
        return ctx;
      },
  destroyContext:function(canvas, useWebGL, setInModule) {},
  fullscreenHandlersInstalled:false,
  lockPointer:undefined,
  resizeCanvas:undefined,
  requestFullscreen:function(lockPointer, resizeCanvas) {
        Browser.lockPointer = lockPointer;
        Browser.resizeCanvas = resizeCanvas;
        if (typeof Browser.lockPointer == 'undefined') Browser.lockPointer = true;
        if (typeof Browser.resizeCanvas == 'undefined') Browser.resizeCanvas = false;
  
        var canvas = Module['canvas'];
        function fullscreenChange() {
          Browser.isFullscreen = false;
          var canvasContainer = canvas.parentNode;
          if ((document['fullscreenElement'] || document['mozFullScreenElement'] ||
               document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
               document['webkitCurrentFullScreenElement']) === canvasContainer) {
            canvas.exitFullscreen = Browser.exitFullscreen;
            if (Browser.lockPointer) canvas.requestPointerLock();
            Browser.isFullscreen = true;
            if (Browser.resizeCanvas) {
              Browser.setFullscreenCanvasSize();
            } else {
              Browser.updateCanvasDimensions(canvas);
            }
          } else {
            // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
            canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
            canvasContainer.parentNode.removeChild(canvasContainer);
  
            if (Browser.resizeCanvas) {
              Browser.setWindowedCanvasSize();
            } else {
              Browser.updateCanvasDimensions(canvas);
            }
          }
          if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen);
          if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen);
        }
  
        if (!Browser.fullscreenHandlersInstalled) {
          Browser.fullscreenHandlersInstalled = true;
          document.addEventListener('fullscreenchange', fullscreenChange, false);
          document.addEventListener('mozfullscreenchange', fullscreenChange, false);
          document.addEventListener('webkitfullscreenchange', fullscreenChange, false);
          document.addEventListener('MSFullscreenChange', fullscreenChange, false);
        }
  
        // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
        var canvasContainer = document.createElement("div");
        canvas.parentNode.insertBefore(canvasContainer, canvas);
        canvasContainer.appendChild(canvas);
  
        // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
        canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] ||
                                            canvasContainer['mozRequestFullScreen'] ||
                                            canvasContainer['msRequestFullscreen'] ||
                                           (canvasContainer['webkitRequestFullscreen'] ? () => canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) : null) ||
                                           (canvasContainer['webkitRequestFullScreen'] ? () => canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) : null);
  
        canvasContainer.requestFullscreen();
      },
  requestFullScreen:function() {
        abort('Module.requestFullScreen has been replaced by Module.requestFullscreen (without a capital S)');
      },
  exitFullscreen:function() {
        // This is workaround for chrome. Trying to exit from fullscreen
        // not in fullscreen state will cause "TypeError: Document not active"
        // in chrome. See https://github.com/emscripten-core/emscripten/pull/8236
        if (!Browser.isFullscreen) {
          return false;
        }
  
        var CFS = document['exitFullscreen'] ||
                  document['cancelFullScreen'] ||
                  document['mozCancelFullScreen'] ||
                  document['msExitFullscreen'] ||
                  document['webkitCancelFullScreen'] ||
            (() => {});
        CFS.apply(document, []);
        return true;
      },
  nextRAF:0,
  fakeRequestAnimationFrame:function(func) {
        // try to keep 60fps between calls to here
        var now = Date.now();
        if (Browser.nextRAF === 0) {
          Browser.nextRAF = now + 1000/60;
        } else {
          while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0
            Browser.nextRAF += 1000/60;
          }
        }
        var delay = Math.max(Browser.nextRAF - now, 0);
        setTimeout(func, delay);
      },
  requestAnimationFrame:function(func) {
        if (typeof requestAnimationFrame == 'function') {
          requestAnimationFrame(func);
          return;
        }
        var RAF = Browser.fakeRequestAnimationFrame;
        RAF(func);
      },
  safeSetTimeout:function(func, timeout) {
        // Legacy function, this is used by the SDL2 port so we need to keep it
        // around at least until that is updated.
        // See https://github.com/libsdl-org/SDL/pull/6304
        return safeSetTimeout(func, timeout);
      },
  safeRequestAnimationFrame:function(func) {
        runtimeKeepalivePush();
        return Browser.requestAnimationFrame(() => {
          runtimeKeepalivePop();
          callUserCallback(func);
        });
      },
  getMimetype:function(name) {
        return {
          'jpg': 'image/jpeg',
          'jpeg': 'image/jpeg',
          'png': 'image/png',
          'bmp': 'image/bmp',
          'ogg': 'audio/ogg',
          'wav': 'audio/wav',
          'mp3': 'audio/mpeg'
        }[name.substr(name.lastIndexOf('.')+1)];
      },
  getUserMedia:function(func) {
        if (!window.getUserMedia) {
          window.getUserMedia = navigator['getUserMedia'] ||
                                navigator['mozGetUserMedia'];
        }
        window.getUserMedia(func);
      },
  getMovementX:function(event) {
        return event['movementX'] ||
               event['mozMovementX'] ||
               event['webkitMovementX'] ||
               0;
      },
  getMovementY:function(event) {
        return event['movementY'] ||
               event['mozMovementY'] ||
               event['webkitMovementY'] ||
               0;
      },
  getMouseWheelDelta:function(event) {
        var delta = 0;
        switch (event.type) {
          case 'DOMMouseScroll':
            // 3 lines make up a step
            delta = event.detail / 3;
            break;
          case 'mousewheel':
            // 120 units make up a step
            delta = event.wheelDelta / 120;
            break;
          case 'wheel':
            delta = event.deltaY
            switch (event.deltaMode) {
              case 0:
                // DOM_DELTA_PIXEL: 100 pixels make up a step
                delta /= 100;
                break;
              case 1:
                // DOM_DELTA_LINE: 3 lines make up a step
                delta /= 3;
                break;
              case 2:
                // DOM_DELTA_PAGE: A page makes up 80 steps
                delta *= 80;
                break;
              default:
                throw 'unrecognized mouse wheel delta mode: ' + event.deltaMode;
            }
            break;
          default:
            throw 'unrecognized mouse wheel event: ' + event.type;
        }
        return delta;
      },
  mouseX:0,
  mouseY:0,
  mouseMovementX:0,
  mouseMovementY:0,
  touches:{
  },
  lastTouches:{
  },
  calculateMouseEvent:function(event) { // event should be mousemove, mousedown or mouseup
        if (Browser.pointerLock) {
          // When the pointer is locked, calculate the coordinates
          // based on the movement of the mouse.
          // Workaround for Firefox bug 764498
          if (event.type != 'mousemove' &&
              ('mozMovementX' in event)) {
            Browser.mouseMovementX = Browser.mouseMovementY = 0;
          } else {
            Browser.mouseMovementX = Browser.getMovementX(event);
            Browser.mouseMovementY = Browser.getMovementY(event);
          }
  
          // check if SDL is available
          if (typeof SDL != "undefined") {
            Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
            Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
          } else {
            // just add the mouse delta to the current absolut mouse position
            // FIXME: ideally this should be clamped against the canvas size and zero
            Browser.mouseX += Browser.mouseMovementX;
            Browser.mouseY += Browser.mouseMovementY;
          }
        } else {
          // Otherwise, calculate the movement based on the changes
          // in the coordinates.
          var rect = Module["canvas"].getBoundingClientRect();
          var cw = Module["canvas"].width;
          var ch = Module["canvas"].height;
  
          // Neither .scrollX or .pageXOffset are defined in a spec, but
          // we prefer .scrollX because it is currently in a spec draft.
          // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
          var scrollX = ((typeof window.scrollX != 'undefined') ? window.scrollX : window.pageXOffset);
          var scrollY = ((typeof window.scrollY != 'undefined') ? window.scrollY : window.pageYOffset);
          // If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset
          // and we have no viable fallback.
          assert((typeof scrollX != 'undefined') && (typeof scrollY != 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.');
  
          if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') {
            var touch = event.touch;
            if (touch === undefined) {
              return; // the "touch" property is only defined in SDL
  
            }
            var adjustedX = touch.pageX - (scrollX + rect.left);
            var adjustedY = touch.pageY - (scrollY + rect.top);
  
            adjustedX = adjustedX * (cw / rect.width);
            adjustedY = adjustedY * (ch / rect.height);
  
            var coords = { x: adjustedX, y: adjustedY };
  
            if (event.type === 'touchstart') {
              Browser.lastTouches[touch.identifier] = coords;
              Browser.touches[touch.identifier] = coords;
            } else if (event.type === 'touchend' || event.type === 'touchmove') {
              var last = Browser.touches[touch.identifier];
              if (!last) last = coords;
              Browser.lastTouches[touch.identifier] = last;
              Browser.touches[touch.identifier] = coords;
            }
            return;
          }
  
          var x = event.pageX - (scrollX + rect.left);
          var y = event.pageY - (scrollY + rect.top);
  
          // the canvas might be CSS-scaled compared to its backbuffer;
          // SDL-using content will want mouse coordinates in terms
          // of backbuffer units.
          x = x * (cw / rect.width);
          y = y * (ch / rect.height);
  
          Browser.mouseMovementX = x - Browser.mouseX;
          Browser.mouseMovementY = y - Browser.mouseY;
          Browser.mouseX = x;
          Browser.mouseY = y;
        }
      },
  resizeListeners:[],
  updateResizeListeners:function() {
        var canvas = Module['canvas'];
        Browser.resizeListeners.forEach((listener) => listener(canvas.width, canvas.height));
      },
  setCanvasSize:function(width, height, noUpdates) {
        var canvas = Module['canvas'];
        Browser.updateCanvasDimensions(canvas, width, height);
        if (!noUpdates) Browser.updateResizeListeners();
      },
  windowedWidth:0,
  windowedHeight:0,
  setFullscreenCanvasSize:function() {
        // check if SDL is available
        if (typeof SDL != "undefined") {
          var flags = HEAPU32[((SDL.screen)>>2)];
          flags = flags | 0x00800000; // set SDL_FULLSCREEN flag
          HEAP32[((SDL.screen)>>2)] = flags;
        }
        Browser.updateCanvasDimensions(Module['canvas']);
        Browser.updateResizeListeners();
      },
  setWindowedCanvasSize:function() {
        // check if SDL is available
        if (typeof SDL != "undefined") {
          var flags = HEAPU32[((SDL.screen)>>2)];
          flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag
          HEAP32[((SDL.screen)>>2)] = flags;
        }
        Browser.updateCanvasDimensions(Module['canvas']);
        Browser.updateResizeListeners();
      },
  updateCanvasDimensions:function(canvas, wNative, hNative) {
        if (wNative && hNative) {
          canvas.widthNative = wNative;
          canvas.heightNative = hNative;
        } else {
          wNative = canvas.widthNative;
          hNative = canvas.heightNative;
        }
        var w = wNative;
        var h = hNative;
        if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) {
          if (w/h < Module['forcedAspectRatio']) {
            w = Math.round(h * Module['forcedAspectRatio']);
          } else {
            h = Math.round(w / Module['forcedAspectRatio']);
          }
        }
        if (((document['fullscreenElement'] || document['mozFullScreenElement'] ||
             document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
             document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) {
           var factor = Math.min(screen.width / w, screen.height / h);
           w = Math.round(w * factor);
           h = Math.round(h * factor);
        }
        if (Browser.resizeCanvas) {
          if (canvas.width  != w) canvas.width  = w;
          if (canvas.height != h) canvas.height = h;
          if (typeof canvas.style != 'undefined') {
            canvas.style.removeProperty( "width");
            canvas.style.removeProperty("height");
          }
        } else {
          if (canvas.width  != wNative) canvas.width  = wNative;
          if (canvas.height != hNative) canvas.height = hNative;
          if (typeof canvas.style != 'undefined') {
            if (w != wNative || h != hNative) {
              canvas.style.setProperty( "width", w + "px", "important");
              canvas.style.setProperty("height", h + "px", "important");
            } else {
              canvas.style.removeProperty( "width");
              canvas.style.removeProperty("height");
            }
          }
        }
      },
  };
  function _emscripten_cancel_main_loop() {
      Browser.mainLoop.pause();
      Browser.mainLoop.func = null;
    }

  var _emscripten_console_error = (str) => {
      assert(typeof str == 'number');
      console.error(UTF8ToString(str));
    };

  function _emscripten_date_now() {
      return Date.now();
    }

  var _emscripten_force_exit = (status) => {
      noExitRuntime = false;
      runtimeKeepaliveCounter = 0;
      _exit(status);
    };

  var getHeapMax = () =>
      // Stay one Wasm page short of 4GB: while e.g. Chrome is able to allocate
      // full 4GB Wasm memories, the size will wrap back to 0 bytes in Wasm side
      // for any code that deals with heap sizes, which would require special
      // casing all heap size related code to treat 0 specially.
      2147483648;
  var _emscripten_get_heap_max = () => getHeapMax();


  var _emscripten_memcpy_big = (dest, src, num) => HEAPU8.copyWithin(dest, src, src + num);

  
  var growMemory = (size) => {
      var b = wasmMemory.buffer;
      var pages = (size - b.byteLength + 65535) >>> 16;
      try {
        // round size grow request up to wasm page size (fixed 64KB per spec)
        wasmMemory.grow(pages); // .grow() takes a delta compared to the previous size
        updateMemoryViews();
        return 1 /*success*/;
      } catch(e) {
        err(`growMemory: Attempted to grow heap from ${b.byteLength} bytes to ${size} bytes, but got error: ${e}`);
      }
      // implicit 0 return to save code size (caller will cast "undefined" into 0
      // anyhow)
    };
  var _emscripten_resize_heap = (requestedSize) => {
      var oldSize = HEAPU8.length;
      // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned.
      requestedSize >>>= 0;
      // With multithreaded builds, races can happen (another thread might increase the size
      // in between), so return a failure, and let the caller retry.
      assert(requestedSize > oldSize);
  
      // Memory resize rules:
      // 1.  Always increase heap size to at least the requested size, rounded up
      //     to next page multiple.
      // 2a. If MEMORY_GROWTH_LINEAR_STEP == -1, excessively resize the heap
      //     geometrically: increase the heap size according to
      //     MEMORY_GROWTH_GEOMETRIC_STEP factor (default +20%), At most
      //     overreserve by MEMORY_GROWTH_GEOMETRIC_CAP bytes (default 96MB).
      // 2b. If MEMORY_GROWTH_LINEAR_STEP != -1, excessively resize the heap
      //     linearly: increase the heap size by at least
      //     MEMORY_GROWTH_LINEAR_STEP bytes.
      // 3.  Max size for the heap is capped at 2048MB-WASM_PAGE_SIZE, or by
      //     MAXIMUM_MEMORY, or by ASAN limit, depending on which is smallest
      // 4.  If we were unable to allocate as much memory, it may be due to
      //     over-eager decision to excessively reserve due to (3) above.
      //     Hence if an allocation fails, cut down on the amount of excess
      //     growth, in an attempt to succeed to perform a smaller allocation.
  
      // A limit is set for how much we can grow. We should not exceed that
      // (the wasm binary specifies it, so if we tried, we'd fail anyhow).
      var maxHeapSize = getHeapMax();
      if (requestedSize > maxHeapSize) {
        err(`Cannot enlarge memory, asked to go up to ${requestedSize} bytes, but the limit is ${maxHeapSize} bytes!`);
        return false;
      }
  
      var alignUp = (x, multiple) => x + (multiple - x % multiple) % multiple;
  
      // Loop through potential heap size increases. If we attempt a too eager
      // reservation that fails, cut down on the attempted size and reserve a
      // smaller bump instead. (max 3 times, chosen somewhat arbitrarily)
      for (var cutDown = 1; cutDown <= 4; cutDown *= 2) {
        var overGrownHeapSize = oldSize * (1 + 0.2 / cutDown); // ensure geometric growth
        // but limit overreserving (default to capping at +96MB overgrowth at most)
        overGrownHeapSize = Math.min(overGrownHeapSize, requestedSize + 100663296 );
  
        var newSize = Math.min(maxHeapSize, alignUp(Math.max(requestedSize, overGrownHeapSize), 65536));
  
        var replacement = growMemory(newSize);
        if (replacement) {
  
          return true;
        }
      }
      err(`Failed to grow the heap from ${oldSize} bytes to ${newSize} bytes, not enough memory!`);
      return false;
    };

  var withStackSave = (f) => {
      var stack = stackSave();
      var ret = f();
      stackRestore(stack);
      return ret;
    };
  var JSEvents = {
  inEventHandler:0,
  removeAllEventListeners:function() {
        for (var i = JSEvents.eventHandlers.length-1; i >= 0; --i) {
          JSEvents._removeHandler(i);
        }
        JSEvents.eventHandlers = [];
        JSEvents.deferredCalls = [];
      },
  registerRemoveEventListeners:function() {
        if (!JSEvents.removeEventListenersRegistered) {
          __ATEXIT__.push(JSEvents.removeAllEventListeners);
          JSEvents.removeEventListenersRegistered = true;
        }
      },
  deferredCalls:[],
  deferCall:function(targetFunction, precedence, argsList) {
        function arraysHaveEqualContent(arrA, arrB) {
          if (arrA.length != arrB.length) return false;
  
          for (var i in arrA) {
            if (arrA[i] != arrB[i]) return false;
          }
          return true;
        }
        // Test if the given call was already queued, and if so, don't add it again.
        for (var i in JSEvents.deferredCalls) {
          var call = JSEvents.deferredCalls[i];
          if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
            return;
          }
        }
        JSEvents.deferredCalls.push({
          targetFunction,
          precedence,
          argsList
        });
  
        JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; });
      },
  removeDeferredCalls:function(targetFunction) {
        for (var i = 0; i < JSEvents.deferredCalls.length; ++i) {
          if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
            JSEvents.deferredCalls.splice(i, 1);
            --i;
          }
        }
      },
  canPerformEventHandlerRequests:function() {
        if (navigator.userActivation) {
          // Verify against transient activation status from UserActivation API
          // whether it is possible to perform a request here without needing to defer. See
          // https://developer.mozilla.org/en-US/docs/Web/Security/User_activation#transient_activation
          // and https://caniuse.com/mdn-api_useractivation
          // At the time of writing, Firefox does not support this API: https://bugzilla.mozilla.org/show_bug.cgi?id=1791079
          return navigator.userActivation.isActive;
        }
        return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
      },
  runDeferredCalls:function() {
        if (!JSEvents.canPerformEventHandlerRequests()) {
          return;
        }
        for (var i = 0; i < JSEvents.deferredCalls.length; ++i) {
          var call = JSEvents.deferredCalls[i];
          JSEvents.deferredCalls.splice(i, 1);
          --i;
          call.targetFunction.apply(null, call.argsList);
        }
      },
  eventHandlers:[],
  removeAllHandlersOnTarget:function(target, eventTypeString) {
        for (var i = 0; i < JSEvents.eventHandlers.length; ++i) {
          if (JSEvents.eventHandlers[i].target == target && 
            (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
             JSEvents._removeHandler(i--);
           }
        }
      },
  _removeHandler:function(i) {
        var h = JSEvents.eventHandlers[i];
        h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
        JSEvents.eventHandlers.splice(i, 1);
      },
  registerOrRemoveHandler:function(eventHandler) {
        if (!eventHandler.target) {
          err('registerOrRemoveHandler: the target element for event handler registration does not exist, when processing the following event handler registration:');
          console.dir(eventHandler);
          return -4;
        }
        var jsEventHandler = function jsEventHandler(event) {
          // Increment nesting count for the event handler.
          ++JSEvents.inEventHandler;
          JSEvents.currentEventHandler = eventHandler;
          // Process any old deferred calls the user has placed.
          JSEvents.runDeferredCalls();
          // Process the actual event, calls back to user C code handler.
          eventHandler.handlerFunc(event);
          // Process any new deferred calls that were placed right now from this event handler.
          JSEvents.runDeferredCalls();
          // Out of event handler - restore nesting count.
          --JSEvents.inEventHandler;
        };
        
        if (eventHandler.callbackfunc) {
          eventHandler.eventListenerFunc = jsEventHandler;
          eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
          JSEvents.eventHandlers.push(eventHandler);
          JSEvents.registerRemoveEventListeners();
        } else {
          for (var i = 0; i < JSEvents.eventHandlers.length; ++i) {
            if (JSEvents.eventHandlers[i].target == eventHandler.target
             && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
               JSEvents._removeHandler(i--);
             }
          }
        }
        return 0;
      },
  getNodeNameForTarget:function(target) {
        if (!target) return '';
        if (target == window) return '#window';
        if (target == screen) return '#screen';
        return (target && target.nodeName) ? target.nodeName : '';
      },
  fullscreenEnabled:function() {
        return document.fullscreenEnabled
        // Safari 13.0.3 on macOS Catalina 10.15.1 still ships with prefixed webkitFullscreenEnabled.
        // TODO: If Safari at some point ships with unprefixed version, update the version check above.
        || document.webkitFullscreenEnabled
         ;
      },
  };
  
  function maybeCStringToJsString(cString) {
      // "cString > 2" checks if the input is a number, and isn't of the special
      // values we accept here, EMSCRIPTEN_EVENT_TARGET_* (which map to 0, 1, 2).
      // In other words, if cString > 2 then it's a pointer to a valid place in
      // memory, and points to a C string.
      return cString > 2 ? UTF8ToString(cString) : cString;
    }
  
  var specialHTMLTargets = [0, typeof document != 'undefined' ? document : 0, typeof window != 'undefined' ? window : 0];
  function findEventTarget(target) {
      target = maybeCStringToJsString(target);
      var domElement = specialHTMLTargets[target] || (typeof document != 'undefined' ? document.querySelector(target) : undefined);
      return domElement;
    }
  function findCanvasEventTarget(target) { return findEventTarget(target); }
  function _emscripten_set_canvas_element_size(target, width, height) {
      var canvas = findCanvasEventTarget(target);
      if (!canvas) return -4;
      canvas.width = width;
      canvas.height = height;
      if (canvas.GLctxObject) GL.resizeOffscreenFramebuffer(canvas.GLctxObject);
      return 0;
    }

  
  
  function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop) {
      var browserIterationFunc = getWasmTableEntry(func);
      setMainLoop(browserIterationFunc, fps, simulateInfiniteLoop);
    }


  
  
  var emscripten_webgl_power_preferences = ['default', 'low-power', 'high-performance'];
  
  
  
  /** @suppress {duplicate } */
  function _emscripten_webgl_do_create_context(target, attributes) {
      assert(attributes);
      var a = attributes >> 2;
      var powerPreference = HEAP32[a + (24>>2)];
      var contextAttributes = {
        'alpha': !!HEAP32[a + (0>>2)],
        'depth': !!HEAP32[a + (4>>2)],
        'stencil': !!HEAP32[a + (8>>2)],
        'antialias': !!HEAP32[a + (12>>2)],
        'premultipliedAlpha': !!HEAP32[a + (16>>2)],
        'preserveDrawingBuffer': !!HEAP32[a + (20>>2)],
        'powerPreference': emscripten_webgl_power_preferences[powerPreference],
        'failIfMajorPerformanceCaveat': !!HEAP32[a + (28>>2)],
        // The following are not predefined WebGL context attributes in the WebGL specification, so the property names can be minified by Closure.
        majorVersion: HEAP32[a + (32>>2)],
        minorVersion: HEAP32[a + (36>>2)],
        enableExtensionsByDefault: HEAP32[a + (40>>2)],
        explicitSwapControl: HEAP32[a + (44>>2)],
        proxyContextToMainThread: HEAP32[a + (48>>2)],
        renderViaOffscreenBackBuffer: HEAP32[a + (52>>2)]
      };
  
      var canvas = findCanvasEventTarget(target);
  
      if (!canvas) {
        return 0;
      }
  
      if (contextAttributes.explicitSwapControl && !contextAttributes.renderViaOffscreenBackBuffer) {
        contextAttributes.renderViaOffscreenBackBuffer = true;
      }
  
      var contextHandle = GL.createContext(canvas, contextAttributes);
      return contextHandle;
    }
  var _emscripten_webgl_create_context = _emscripten_webgl_do_create_context;

  
  function _emscripten_webgl_destroy_context(contextHandle) {
      if (GL.currentContext == contextHandle) GL.currentContext = 0;
      GL.deleteContext(contextHandle);
    }

  
  
  
  
  
  
  
  function _emscripten_webgl_enable_extension(contextHandle, extension) {
      var context = GL.getContext(contextHandle);
      var extString = UTF8ToString(extension);
      if (extString.startsWith('GL_')) extString = extString.substr(3); // Allow enabling extensions both with "GL_" prefix and without.
  
      // Switch-board that pulls in code for all GL extensions, even if those are not used :/
      // Build with -sGL_SUPPORT_SIMPLE_ENABLE_EXTENSIONS=0 to avoid this.
  
      // Obtain function entry points to WebGL 1 extension related functions.
      if (extString == 'ANGLE_instanced_arrays') webgl_enable_ANGLE_instanced_arrays(GLctx);
      if (extString == 'OES_vertex_array_object') webgl_enable_OES_vertex_array_object(GLctx);
      if (extString == 'WEBGL_draw_buffers') webgl_enable_WEBGL_draw_buffers(GLctx);
  
      if (extString == 'WEBGL_draw_instanced_base_vertex_base_instance') webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx);
      if (extString == 'WEBGL_multi_draw_instanced_base_vertex_base_instance') webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx);
  
      if (extString == 'WEBGL_multi_draw') webgl_enable_WEBGL_multi_draw(GLctx);
  
      var ext = context.GLctx.getExtension(extString);
      return !!ext;
    }

  function _emscripten_webgl_init_context_attributes(attributes) {
      assert(attributes);
      var a = attributes >> 2;
      for (var i = 0; i < (56>>2); ++i) {
        HEAP32[a+i] = 0;
      }
  
      HEAP32[a + (0>>2)] =
      HEAP32[a + (4>>2)] = 
      HEAP32[a + (12>>2)] = 
      HEAP32[a + (16>>2)] = 
      HEAP32[a + (32>>2)] = 
      HEAP32[a + (40>>2)] = 1;
  
    }

  function _emscripten_webgl_make_context_current(contextHandle) {
      var success = GL.makeContextCurrent(contextHandle);
      return success ? 0 : -5;
    }

  var ENV = {
  };
  
  var getExecutableName = () => {
      return thisProgram || './this.program';
    };
  var getEnvStrings = () => {
      if (!getEnvStrings.strings) {
        // Default values.
        // Browser language detection #8751
        var lang = ((typeof navigator == 'object' && navigator.languages && navigator.languages[0]) || 'C').replace('-', '_') + '.UTF-8';
        var env = {
          'USER': 'web_user',
          'LOGNAME': 'web_user',
          'PATH': '/',
          'PWD': '/',
          'HOME': '/home/web_user',
          'LANG': lang,
          '_': getExecutableName()
        };
        // Apply the user-provided values, if any.
        for (var x in ENV) {
          // x is a key in ENV; if ENV[x] is undefined, that means it was
          // explicitly set to be so. We allow user code to do that to
          // force variables with default values to remain unset.
          if (ENV[x] === undefined) delete env[x];
          else env[x] = ENV[x];
        }
        var strings = [];
        for (var x in env) {
          strings.push(`${x}=${env[x]}`);
        }
        getEnvStrings.strings = strings;
      }
      return getEnvStrings.strings;
    };
  
  var stringToAscii = (str, buffer) => {
      for (var i = 0; i < str.length; ++i) {
        assert(str.charCodeAt(i) === (str.charCodeAt(i) & 0xff));
        HEAP8[((buffer++)>>0)] = str.charCodeAt(i);
      }
      // Null-terminate the string
      HEAP8[((buffer)>>0)] = 0;
    };
  
  var _environ_get = (__environ, environ_buf) => {
      var bufSize = 0;
      getEnvStrings().forEach(function(string, i) {
        var ptr = environ_buf + bufSize;
        HEAPU32[(((__environ)+(i*4))>>2)] = ptr;
        stringToAscii(string, ptr);
        bufSize += string.length + 1;
      });
      return 0;
    };

  
  var _environ_sizes_get = (penviron_count, penviron_buf_size) => {
      var strings = getEnvStrings();
      HEAPU32[((penviron_count)>>2)] = strings.length;
      var bufSize = 0;
      strings.forEach(function(string) {
        bufSize += string.length + 1;
      });
      HEAPU32[((penviron_buf_size)>>2)] = bufSize;
      return 0;
    };


  function _fd_close(fd) {
  try {
  
      var stream = SYSCALLS.getStreamFromFD(fd);
      FS.close(stream);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return e.errno;
  }
  }

  function _fd_fdstat_get(fd, pbuf) {
  try {
  
      var rightsBase = 0;
      var rightsInheriting = 0;
      var flags = 0;
      {
        var stream = SYSCALLS.getStreamFromFD(fd);
        // All character devices are terminals (other things a Linux system would
        // assume is a character device, like the mouse, we have special APIs for).
        var type = stream.tty ? 2 :
                   FS.isDir(stream.mode) ? 3 :
                   FS.isLink(stream.mode) ? 7 :
                   4;
      }
      HEAP8[((pbuf)>>0)] = type;
      HEAP16[(((pbuf)+(2))>>1)] = flags;
      (tempI64 = [rightsBase>>>0,(tempDouble=rightsBase,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((pbuf)+(8))>>2)] = tempI64[0],HEAP32[(((pbuf)+(12))>>2)] = tempI64[1]);
      (tempI64 = [rightsInheriting>>>0,(tempDouble=rightsInheriting,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((pbuf)+(16))>>2)] = tempI64[0],HEAP32[(((pbuf)+(20))>>2)] = tempI64[1]);
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return e.errno;
  }
  }

  /** @param {number=} offset */
  var doReadv = (stream, iov, iovcnt, offset) => {
      var ret = 0;
      for (var i = 0; i < iovcnt; i++) {
        var ptr = HEAPU32[((iov)>>2)];
        var len = HEAPU32[(((iov)+(4))>>2)];
        iov += 8;
        var curr = FS.read(stream, HEAP8,ptr, len, offset);
        if (curr < 0) return -1;
        ret += curr;
        if (curr < len) break; // nothing more to read
        if (typeof offset !== 'undefined') {
          offset += curr;
        }
      }
      return ret;
    };
  
  function _fd_read(fd, iov, iovcnt, pnum) {
  try {
  
      var stream = SYSCALLS.getStreamFromFD(fd);
      var num = doReadv(stream, iov, iovcnt);
      HEAPU32[((pnum)>>2)] = num;
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return e.errno;
  }
  }

  
  function _fd_seek(fd,offset_low, offset_high,whence,newOffset) {
    var offset = convertI32PairToI53Checked(offset_low, offset_high);;
  
    
  try {
  
      if (isNaN(offset)) return 61;
      var stream = SYSCALLS.getStreamFromFD(fd);
      FS.llseek(stream, offset, whence);
      (tempI64 = [stream.position>>>0,(tempDouble=stream.position,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[((newOffset)>>2)] = tempI64[0],HEAP32[(((newOffset)+(4))>>2)] = tempI64[1]);
      if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return e.errno;
  }
  ;
  }

  /** @param {number=} offset */
  var doWritev = (stream, iov, iovcnt, offset) => {
      var ret = 0;
      for (var i = 0; i < iovcnt; i++) {
        var ptr = HEAPU32[((iov)>>2)];
        var len = HEAPU32[(((iov)+(4))>>2)];
        iov += 8;
        var curr = FS.write(stream, HEAP8,ptr, len, offset);
        if (curr < 0) return -1;
        ret += curr;
        if (typeof offset !== 'undefined') {
          offset += curr;
        }
      }
      return ret;
    };
  
  function _fd_write(fd, iov, iovcnt, pnum) {
  try {
  
      var stream = SYSCALLS.getStreamFromFD(fd);
      var num = doWritev(stream, iov, iovcnt);
      HEAPU32[((pnum)>>2)] = num;
      return 0;
    } catch (e) {
    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
    return e.errno;
  }
  }

  
  
  
  
  
  
  
  
  
  var _getaddrinfo = (node, service, hint, out) => {
      // Note getaddrinfo currently only returns a single addrinfo with ai_next defaulting to NULL. When NULL
      // hints are specified or ai_family set to AF_UNSPEC or ai_socktype or ai_protocol set to 0 then we
      // really should provide a linked list of suitable addrinfo values.
      var addrs = [];
      var canon = null;
      var addr = 0;
      var port = 0;
      var flags = 0;
      var family = 0;
      var type = 0;
      var proto = 0;
      var ai, last;
  
      function allocaddrinfo(family, type, proto, canon, addr, port) {
        var sa, salen, ai;
        var errno;
  
        salen = family === 10 ?
          28 :
          16;
        addr = family === 10 ?
          inetNtop6(addr) :
          inetNtop4(addr);
        sa = _malloc(salen);
        errno = writeSockaddr(sa, family, addr, port);
        assert(!errno);
  
        ai = _malloc(32);
        HEAP32[(((ai)+(4))>>2)] = family;
        HEAP32[(((ai)+(8))>>2)] = type;
        HEAP32[(((ai)+(12))>>2)] = proto;
        HEAPU32[(((ai)+(24))>>2)] = canon;
        HEAPU32[(((ai)+(20))>>2)] = sa;
        if (family === 10) {
          HEAP32[(((ai)+(16))>>2)] = 28;
        } else {
          HEAP32[(((ai)+(16))>>2)] = 16;
        }
        HEAP32[(((ai)+(28))>>2)] = 0;
  
        return ai;
      }
  
      if (hint) {
        flags = HEAP32[((hint)>>2)];
        family = HEAP32[(((hint)+(4))>>2)];
        type = HEAP32[(((hint)+(8))>>2)];
        proto = HEAP32[(((hint)+(12))>>2)];
      }
      if (type && !proto) {
        proto = type === 2 ? 17 : 6;
      }
      if (!type && proto) {
        type = proto === 17 ? 2 : 1;
      }
  
      // If type or proto are set to zero in hints we should really be returning multiple addrinfo values, but for
      // now default to a TCP STREAM socket so we can at least return a sensible addrinfo given NULL hints.
      if (proto === 0) {
        proto = 6;
      }
      if (type === 0) {
        type = 1;
      }
  
      if (!node && !service) {
        return -2;
      }
      if (flags & ~(1|2|4|
          1024|8|16|32)) {
        return -1;
      }
      if (hint !== 0 && (HEAP32[((hint)>>2)] & 2) && !node) {
        return -1;
      }
      if (flags & 32) {
        // TODO
        return -2;
      }
      if (type !== 0 && type !== 1 && type !== 2) {
        return -7;
      }
      if (family !== 0 && family !== 2 && family !== 10) {
        return -6;
      }
  
      if (service) {
        service = UTF8ToString(service);
        port = parseInt(service, 10);
  
        if (isNaN(port)) {
          if (flags & 1024) {
            return -2;
          }
          // TODO support resolving well-known service names from:
          // http://www.iana.org/assignments/service-names-port-numbers/service-names-port-numbers.txt
          return -8;
        }
      }
  
      if (!node) {
        if (family === 0) {
          family = 2;
        }
        if ((flags & 1) === 0) {
          if (family === 2) {
            addr = _htonl(2130706433);
          } else {
            addr = [0, 0, 0, 1];
          }
        }
        ai = allocaddrinfo(family, type, proto, null, addr, port);
        HEAPU32[((out)>>2)] = ai;
        return 0;
      }
  
      //
      // try as a numeric address
      //
      node = UTF8ToString(node);
      addr = inetPton4(node);
      if (addr !== null) {
        // incoming node is a valid ipv4 address
        if (family === 0 || family === 2) {
          family = 2;
        }
        else if (family === 10 && (flags & 8)) {
          addr = [0, 0, _htonl(0xffff), addr];
          family = 10;
        } else {
          return -2;
        }
      } else {
        addr = inetPton6(node);
        if (addr !== null) {
          // incoming node is a valid ipv6 address
          if (family === 0 || family === 10) {
            family = 10;
          } else {
            return -2;
          }
        }
      }
      if (addr != null) {
        ai = allocaddrinfo(family, type, proto, node, addr, port);
        HEAPU32[((out)>>2)] = ai;
        return 0;
      }
      if (flags & 4) {
        return -2;
      }
  
      //
      // try as a hostname
      //
      // resolve the hostname to a temporary fake address
      node = DNS.lookup_name(node);
      addr = inetPton4(node);
      if (family === 0) {
        family = 2;
      } else if (family === 10) {
        addr = [0, 0, _htonl(0xffff), addr];
      }
      ai = allocaddrinfo(family, type, proto, null, addr, port);
      HEAPU32[((out)>>2)] = ai;
      return 0;
    };

  
  
  
  var _getnameinfo = (sa, salen, node, nodelen, serv, servlen, flags) => {
      var info = readSockaddr(sa, salen);
      if (info.errno) {
        return -6;
      }
      var port = info.port;
      var addr = info.addr;
  
      var overflowed = false;
  
      if (node && nodelen) {
        var lookup;
        if ((flags & 1) || !(lookup = DNS.lookup_addr(addr))) {
          if (flags & 8) {
            return -2;
          }
        } else {
          addr = lookup;
        }
        var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen);
  
        if (numBytesWrittenExclNull+1 >= nodelen) {
          overflowed = true;
        }
      }
  
      if (serv && servlen) {
        port = '' + port;
        var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen);
  
        if (numBytesWrittenExclNull+1 >= servlen) {
          overflowed = true;
        }
      }
  
      if (overflowed) {
        // Note: even when we overflow, getnameinfo() is specced to write out the truncated results.
        return -12;
      }
  
      return 0;
    };

  function _glActiveTexture(x0) { GLctx.activeTexture(x0) }

  function _glAttachShader(program, shader) {
      GLctx.attachShader(GL.programs[program], GL.shaders[shader]);
    }

  function _glBeginTransformFeedback(x0) { GLctx.beginTransformFeedback(x0) }

  function _glBindBuffer(target, buffer) {
  
      if (target == 0x88EB /*GL_PIXEL_PACK_BUFFER*/) {
        // In WebGL 2 glReadPixels entry point, we need to use a different WebGL 2 API function call when a buffer is bound to
        // GL_PIXEL_PACK_BUFFER_BINDING point, so must keep track whether that binding point is non-null to know what is
        // the proper API function to call.
        GLctx.currentPixelPackBufferBinding = buffer;
      } else if (target == 0x88EC /*GL_PIXEL_UNPACK_BUFFER*/) {
        // In WebGL 2 gl(Compressed)Tex(Sub)Image[23]D entry points, we need to
        // use a different WebGL 2 API function call when a buffer is bound to
        // GL_PIXEL_UNPACK_BUFFER_BINDING point, so must keep track whether that
        // binding point is non-null to know what is the proper API function to
        // call.
        GLctx.currentPixelUnpackBufferBinding = buffer;
      }
      GLctx.bindBuffer(target, GL.buffers[buffer]);
    }

  function _glBindBufferBase(target, index, buffer) {
      GLctx.bindBufferBase(target, index, GL.buffers[buffer]);
    }

  function _glBindBufferRange(target, index, buffer, offset, ptrsize) {
      GLctx.bindBufferRange(target, index, GL.buffers[buffer], offset, ptrsize);
    }

  function _glBindFramebuffer(target, framebuffer) {
  
      // defaultFbo may not be present if 'renderViaOffscreenBackBuffer' was not enabled during context creation time,
      // i.e. setting -sOFFSCREEN_FRAMEBUFFER at compilation time does not yet mandate that offscreen back buffer
      // is being used, but that is ultimately decided at context creation time.
      GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : GL.currentContext.defaultFbo);
  
    }

  function _glBindRenderbuffer(target, renderbuffer) {
      GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]);
    }

  function _glBindTexture(target, texture) {
      GLctx.bindTexture(target, GL.textures[texture]);
    }

  function _glBindVertexArray(vao) {
      GLctx.bindVertexArray(GL.vaos[vao]);
    }

  function _glBlendColor(x0, x1, x2, x3) { GLctx.blendColor(x0, x1, x2, x3) }

  function _glBlendEquation(x0) { GLctx.blendEquation(x0) }

  function _glBlendFunc(x0, x1) { GLctx.blendFunc(x0, x1) }

  function _glBlendFuncSeparate(x0, x1, x2, x3) { GLctx.blendFuncSeparate(x0, x1, x2, x3) }

  function _glBlitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) { GLctx.blitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) }

  function _glBufferData(target, size, data, usage) {
  
      if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        // If size is zero, WebGL would interpret uploading the whole input arraybuffer (starting from given offset), which would
        // not make sense in WebAssembly, so avoid uploading if size is zero. However we must still call bufferData to establish a
        // backing storage of zero bytes.
        if (data && size) {
          GLctx.bufferData(target, HEAPU8, usage, data, size);
        } else {
          GLctx.bufferData(target, size, usage);
        }
      } else {
        // N.b. here first form specifies a heap subarray, second form an integer size, so the ?: code here is polymorphic. It is advised to avoid
        // randomly mixing both uses in calling code, to avoid any potential JS engine JIT issues.
        GLctx.bufferData(target, data ? HEAPU8.subarray(data, data+size) : size, usage);
      }
    }

  function _glBufferSubData(target, offset, size, data) {
      if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        size && GLctx.bufferSubData(target, offset, HEAPU8, data, size);
        return;
      }
      GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
    }

  function _glCheckFramebufferStatus(x0) { return GLctx.checkFramebufferStatus(x0) }

  function _glClear(x0) { GLctx.clear(x0) }

  function _glClearBufferfv(buffer, drawbuffer, value) {
  
      GLctx.clearBufferfv(buffer, drawbuffer, HEAPF32, value>>2);
    }

  function _glClearColor(x0, x1, x2, x3) { GLctx.clearColor(x0, x1, x2, x3) }

  function _glClearDepthf(x0) { GLctx.clearDepth(x0) }

  function _glColorMask(red, green, blue, alpha) {
      GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
    }

  function _glCompileShader(shader) {
      GLctx.compileShader(GL.shaders[shader]);
    }

  function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
      if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        if (GLctx.currentPixelUnpackBufferBinding || !imageSize) {
          GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data);
        } else {
          GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, HEAPU8, data, imageSize);
        }
        return;
      }
      GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data), (data+imageSize)) : null);
    }

  function _glCopyBufferSubData(x0, x1, x2, x3, x4) { GLctx.copyBufferSubData(x0, x1, x2, x3, x4) }

  function _glCreateProgram() {
      var id = GL.getNewId(GL.programs);
      var program = GLctx.createProgram();
      // Store additional information needed for each shader program:
      program.name = id;
      // Lazy cache results of glGetProgramiv(GL_ACTIVE_UNIFORM_MAX_LENGTH/GL_ACTIVE_ATTRIBUTE_MAX_LENGTH/GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH)
      program.maxUniformLength = program.maxAttributeLength = program.maxUniformBlockNameLength = 0;
      program.uniformIdCounter = 1;
      GL.programs[id] = program;
      return id;
    }

  function _glCreateShader(shaderType) {
      var id = GL.getNewId(GL.shaders);
      GL.shaders[id] = GLctx.createShader(shaderType);
  
      return id;
    }

  function _glCullFace(x0) { GLctx.cullFace(x0) }

  function _glDeleteBuffers(n, buffers) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((buffers)+(i*4))>>2)];
        var buffer = GL.buffers[id];
  
        // From spec: "glDeleteBuffers silently ignores 0's and names that do not
        // correspond to existing buffer objects."
        if (!buffer) continue;
  
        GLctx.deleteBuffer(buffer);
        buffer.name = 0;
        GL.buffers[id] = null;
  
        if (id == GLctx.currentPixelPackBufferBinding) GLctx.currentPixelPackBufferBinding = 0;
        if (id == GLctx.currentPixelUnpackBufferBinding) GLctx.currentPixelUnpackBufferBinding = 0;
      }
    }

  function _glDeleteFramebuffers(n, framebuffers) {
      for (var i = 0; i < n; ++i) {
        var id = HEAP32[(((framebuffers)+(i*4))>>2)];
        var framebuffer = GL.framebuffers[id];
        if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
        GLctx.deleteFramebuffer(framebuffer);
        framebuffer.name = 0;
        GL.framebuffers[id] = null;
      }
    }

  function _glDeleteProgram(id) {
      if (!id) return;
      var program = GL.programs[id];
      if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
        GL.recordError(0x501 /* GL_INVALID_VALUE */);
        return;
      }
      GLctx.deleteProgram(program);
      program.name = 0;
      GL.programs[id] = null;
    }

  function _glDeleteQueries(n, ids) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((ids)+(i*4))>>2)];
        var query = GL.queries[id];
        if (!query) continue; // GL spec: "unused names in ids are ignored, as is the name zero."
        GLctx.deleteQuery(query);
        GL.queries[id] = null;
      }
    }

  function _glDeleteRenderbuffers(n, renderbuffers) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
        var renderbuffer = GL.renderbuffers[id];
        if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
        GLctx.deleteRenderbuffer(renderbuffer);
        renderbuffer.name = 0;
        GL.renderbuffers[id] = null;
      }
    }

  function _glDeleteShader(id) {
      if (!id) return;
      var shader = GL.shaders[id];
      if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
        GL.recordError(0x501 /* GL_INVALID_VALUE */);
        return;
      }
      GLctx.deleteShader(shader);
      GL.shaders[id] = null;
    }

  function _glDeleteSync(id) {
      if (!id) return;
      var sync = GL.syncs[id];
      if (!sync) { // glDeleteSync signals an error when deleting a nonexisting object, unlike some other GL delete functions.
        GL.recordError(0x501 /* GL_INVALID_VALUE */);
        return;
      }
      GLctx.deleteSync(sync);
      sync.name = 0;
      GL.syncs[id] = null;
    }

  function _glDeleteTextures(n, textures) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((textures)+(i*4))>>2)];
        var texture = GL.textures[id];
        if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
        GLctx.deleteTexture(texture);
        texture.name = 0;
        GL.textures[id] = null;
      }
    }

  function _glDeleteVertexArrays(n, vaos) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((vaos)+(i*4))>>2)];
        GLctx.deleteVertexArray(GL.vaos[id]);
        GL.vaos[id] = null;
      }
    }

  function _glDepthFunc(x0) { GLctx.depthFunc(x0) }

  function _glDepthMask(flag) {
      GLctx.depthMask(!!flag);
    }

  function _glDisable(x0) { GLctx.disable(x0) }

  function _glDisableVertexAttribArray(index) {
      GLctx.disableVertexAttribArray(index);
    }

  function _glDrawArrays(mode, first, count) {
  
      GLctx.drawArrays(mode, first, count);
  
    }

  function _glDrawArraysInstanced(mode, first, count, primcount) {
      GLctx.drawArraysInstanced(mode, first, count, primcount);
    }

  function _glDrawElements(mode, count, type, indices) {
  
      GLctx.drawElements(mode, count, type, indices);
  
    }

  function _glDrawElementsInstanced(mode, count, type, indices, primcount) {
      GLctx.drawElementsInstanced(mode, count, type, indices, primcount);
    }

  function _glEnable(x0) { GLctx.enable(x0) }

  function _glEnableVertexAttribArray(index) {
      GLctx.enableVertexAttribArray(index);
    }

  function _glEndTransformFeedback() { GLctx.endTransformFeedback() }

  function _glFenceSync(condition, flags) {
      var sync = GLctx.fenceSync(condition, flags);
      if (sync) {
        var id = GL.getNewId(GL.syncs);
        sync.name = id;
        GL.syncs[id] = sync;
        return id;
      }
      return 0; // Failed to create a sync object
    }

  function _glFinish() { GLctx.finish() }

  function _glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
      GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
                                         GL.renderbuffers[renderbuffer]);
    }

  function _glFramebufferTexture2D(target, attachment, textarget, texture, level) {
      GLctx.framebufferTexture2D(target, attachment, textarget,
                                      GL.textures[texture], level);
    }

  function _glFramebufferTextureLayer(target, attachment, texture, level, layer) {
      GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer);
    }

  function _glFrontFace(x0) { GLctx.frontFace(x0) }

  function __glGenObject(n, buffers, createFunction, objectTable
      ) {
      for (var i = 0; i < n; i++) {
        var buffer = GLctx[createFunction]();
        var id = buffer && GL.getNewId(objectTable);
        if (buffer) {
          buffer.name = id;
          objectTable[id] = buffer;
        } else {
          GL.recordError(0x502 /* GL_INVALID_OPERATION */);
        }
        HEAP32[(((buffers)+(i*4))>>2)] = id;
      }
    }
  
  function _glGenBuffers(n, buffers) {
      __glGenObject(n, buffers, 'createBuffer', GL.buffers
        );
    }

  
  function _glGenFramebuffers(n, ids) {
      __glGenObject(n, ids, 'createFramebuffer', GL.framebuffers
        );
    }

  function _glGenQueries(n, ids) {
      __glGenObject(n, ids, 'createQuery', GL.queries
        );
    }

  
  function _glGenRenderbuffers(n, renderbuffers) {
      __glGenObject(n, renderbuffers, 'createRenderbuffer', GL.renderbuffers
        );
    }

  
  function _glGenTextures(n, textures) {
      __glGenObject(n, textures, 'createTexture', GL.textures
        );
    }

  
  function _glGenVertexArrays(n, arrays) {
      __glGenObject(n, arrays, 'createVertexArray', GL.vaos
        );
    }

  function _glGenerateMipmap(x0) { GLctx.generateMipmap(x0) }

  function readI53FromI64(ptr) {
      return HEAPU32[ptr>>2] + HEAP32[ptr+4>>2] * 4294967296;
    }
  
  function readI53FromU64(ptr) {
      return HEAPU32[ptr>>2] + HEAPU32[ptr+4>>2] * 4294967296;
    }
  function writeI53ToI64(ptr, num) {
      HEAPU32[ptr>>2] = num;
      HEAPU32[ptr+4>>2] = (num - HEAPU32[ptr>>2])/4294967296;
      var deserialized = (num >= 0) ? readI53FromU64(ptr) : readI53FromI64(ptr);
      if (deserialized != num) warnOnce('writeI53ToI64() out of range: serialized JS Number ' + num + ' to Wasm heap as bytes lo=' + ptrToString(HEAPU32[ptr>>2]) + ', hi=' + ptrToString(HEAPU32[ptr+4>>2]) + ', which deserializes back to ' + deserialized + ' instead!');
    }
  
  function emscriptenWebGLGet(name_, p, type) {
      // Guard against user passing a null pointer.
      // Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
      // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
      // better to report an error instead of doing anything random.
      if (!p) {
        GL.recordError(0x501 /* GL_INVALID_VALUE */);
        return;
      }
      var ret = undefined;
      switch (name_) { // Handle a few trivial GLES values
        case 0x8DFA: // GL_SHADER_COMPILER
          ret = 1;
          break;
        case 0x8DF8: // GL_SHADER_BINARY_FORMATS
          if (type != 0 && type != 1) {
            GL.recordError(0x500); // GL_INVALID_ENUM
          }
          return; // Do not write anything to the out pointer, since no binary formats are supported.
        case 0x87FE: // GL_NUM_PROGRAM_BINARY_FORMATS
        case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
          ret = 0;
          break;
        case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
          // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
          // so implement it ourselves to allow C++ GLES2 code get the length.
          var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
          ret = formats ? formats.length : 0;
          break;
  
        case 0x821D: // GL_NUM_EXTENSIONS
          if (GL.currentContext.version < 2) {
            GL.recordError(0x502 /* GL_INVALID_OPERATION */); // Calling GLES3/WebGL2 function with a GLES2/WebGL1 context
            return;
          }
          // .getSupportedExtensions() can return null if context is lost, so coerce to empty array.
          var exts = GLctx.getSupportedExtensions() || [];
          ret = 2 * exts.length; // each extension is duplicated, first in unprefixed WebGL form, and then a second time with "GL_" prefix.
          break;
        case 0x821B: // GL_MAJOR_VERSION
        case 0x821C: // GL_MINOR_VERSION
          if (GL.currentContext.version < 2) {
            GL.recordError(0x500); // GL_INVALID_ENUM
            return;
          }
          ret = name_ == 0x821B ? 3 : 0; // return version 3.0
          break;
      }
  
      if (ret === undefined) {
        var result = GLctx.getParameter(name_);
        switch (typeof result) {
          case "number":
            ret = result;
            break;
          case "boolean":
            ret = result ? 1 : 0;
            break;
          case "string":
            GL.recordError(0x500); // GL_INVALID_ENUM
            return;
          case "object":
            if (result === null) {
              // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
              // can mean an invalid name_, which we need to report as an error
              switch (name_) {
                case 0x8894: // ARRAY_BUFFER_BINDING
                case 0x8B8D: // CURRENT_PROGRAM
                case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
                case 0x8CA6: // FRAMEBUFFER_BINDING or DRAW_FRAMEBUFFER_BINDING
                case 0x8CA7: // RENDERBUFFER_BINDING
                case 0x8069: // TEXTURE_BINDING_2D
                case 0x85B5: // WebGL 2 GL_VERTEX_ARRAY_BINDING, or WebGL 1 extension OES_vertex_array_object GL_VERTEX_ARRAY_BINDING_OES
                case 0x8F36: // COPY_READ_BUFFER_BINDING or COPY_READ_BUFFER
                case 0x8F37: // COPY_WRITE_BUFFER_BINDING or COPY_WRITE_BUFFER
                case 0x88ED: // PIXEL_PACK_BUFFER_BINDING
                case 0x88EF: // PIXEL_UNPACK_BUFFER_BINDING
                case 0x8CAA: // READ_FRAMEBUFFER_BINDING
                case 0x8919: // SAMPLER_BINDING
                case 0x8C1D: // TEXTURE_BINDING_2D_ARRAY
                case 0x806A: // TEXTURE_BINDING_3D
                case 0x8E25: // TRANSFORM_FEEDBACK_BINDING
                case 0x8C8F: // TRANSFORM_FEEDBACK_BUFFER_BINDING
                case 0x8A28: // UNIFORM_BUFFER_BINDING
                case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
                  ret = 0;
                  break;
                }
                default: {
                  GL.recordError(0x500); // GL_INVALID_ENUM
                  return;
                }
              }
            } else if (result instanceof Float32Array ||
                       result instanceof Uint32Array ||
                       result instanceof Int32Array ||
                       result instanceof Array) {
              for (var i = 0; i < result.length; ++i) {
                switch (type) {
                  case 0: HEAP32[(((p)+(i*4))>>2)] = result[i]; break;
                  case 2: HEAPF32[(((p)+(i*4))>>2)] = result[i]; break;
                  case 4: HEAP8[(((p)+(i))>>0)] = result[i] ? 1 : 0; break;
                }
              }
              return;
            } else {
              try {
                ret = result.name | 0;
              } catch(e) {
                GL.recordError(0x500); // GL_INVALID_ENUM
                err('GL_INVALID_ENUM in glGet' + type + 'v: Unknown object returned from WebGL getParameter(' + name_ + ')! (error: ' + e + ')');
                return;
              }
            }
            break;
          default:
            GL.recordError(0x500); // GL_INVALID_ENUM
            err('GL_INVALID_ENUM in glGet' + type + 'v: Native code calling glGet' + type + 'v(' + name_ + ') and it returns ' + result + ' of type ' + typeof(result) + '!');
            return;
        }
      }
  
      switch (type) {
        case 1: writeI53ToI64(p, ret); break;
        case 0: HEAP32[((p)>>2)] = ret; break;
        case 2:   HEAPF32[((p)>>2)] = ret; break;
        case 4: HEAP8[((p)>>0)] = ret ? 1 : 0; break;
      }
    }
  
  function _glGetFloatv(name_, p) {
      emscriptenWebGLGet(name_, p, 2);
    }

  function _glGetInteger64v(name_, p) {
      emscriptenWebGLGet(name_, p, 1);
    }

  
  function _glGetIntegerv(name_, p) {
      emscriptenWebGLGet(name_, p, 0);
    }

  function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
      var log = GLctx.getProgramInfoLog(GL.programs[program]);
      if (log === null) log = '(unknown error)';
      var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0;
      if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
    }

  function _glGetProgramiv(program, pname, p) {
      if (!p) {
        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it.
        GL.recordError(0x501 /* GL_INVALID_VALUE */);
        return;
      }
  
      if (program >= GL.counter) {
        GL.recordError(0x501 /* GL_INVALID_VALUE */);
        return;
      }
  
      program = GL.programs[program];
  
      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
        var log = GLctx.getProgramInfoLog(program);
        if (log === null) log = '(unknown error)';
        HEAP32[((p)>>2)] = log.length + 1;
      } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
        if (!program.maxUniformLength) {
          for (var i = 0; i < GLctx.getProgramParameter(program, 0x8B86/*GL_ACTIVE_UNIFORMS*/); ++i) {
            program.maxUniformLength = Math.max(program.maxUniformLength, GLctx.getActiveUniform(program, i).name.length+1);
          }
        }
        HEAP32[((p)>>2)] = program.maxUniformLength;
      } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
        if (!program.maxAttributeLength) {
          for (var i = 0; i < GLctx.getProgramParameter(program, 0x8B89/*GL_ACTIVE_ATTRIBUTES*/); ++i) {
            program.maxAttributeLength = Math.max(program.maxAttributeLength, GLctx.getActiveAttrib(program, i).name.length+1);
          }
        }
        HEAP32[((p)>>2)] = program.maxAttributeLength;
      } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
        if (!program.maxUniformBlockNameLength) {
          for (var i = 0; i < GLctx.getProgramParameter(program, 0x8A36/*GL_ACTIVE_UNIFORM_BLOCKS*/); ++i) {
            program.maxUniformBlockNameLength = Math.max(program.maxUniformBlockNameLength, GLctx.getActiveUniformBlockName(program, i).length+1);
          }
        }
        HEAP32[((p)>>2)] = program.maxUniformBlockNameLength;
      } else {
        HEAP32[((p)>>2)] = GLctx.getProgramParameter(program, pname);
      }
    }

  
  function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
      var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
      if (log === null) log = '(unknown error)';
      var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0;
      if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
    }

  function _glGetShaderiv(shader, pname, p) {
      if (!p) {
        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it.
        GL.recordError(0x501 /* GL_INVALID_VALUE */);
        return;
      }
      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
        var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
        if (log === null) log = '(unknown error)';
        // The GLES2 specification says that if the shader has an empty info log,
        // a value of 0 is returned. Otherwise the log has a null char appended.
        // (An empty string is falsey, so we can just check that instead of
        // looking at log.length.)
        var logLength = log ? log.length + 1 : 0;
        HEAP32[((p)>>2)] = logLength;
      } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH
        var source = GLctx.getShaderSource(GL.shaders[shader]);
        // source may be a null, or the empty string, both of which are falsey
        // values that we report a 0 length for.
        var sourceLength = source ? source.length + 1 : 0;
        HEAP32[((p)>>2)] = sourceLength;
      } else {
        HEAP32[((p)>>2)] = GLctx.getShaderParameter(GL.shaders[shader], pname);
      }
    }

  
  function _glGetString(name_) {
      var ret = GL.stringCache[name_];
      if (!ret) {
        switch (name_) {
          case 0x1F03 /* GL_EXTENSIONS */:
            var exts = GLctx.getSupportedExtensions() || []; // .getSupportedExtensions() can return null if context is lost, so coerce to empty array.
            exts = exts.concat(exts.map(function(e) { return "GL_" + e; }));
            ret = stringToNewUTF8(exts.join(' '));
            break;
          case 0x1F00 /* GL_VENDOR */:
          case 0x1F01 /* GL_RENDERER */:
          case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
          case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
            var s = GLctx.getParameter(name_);
            if (!s) {
              GL.recordError(0x500/*GL_INVALID_ENUM*/);
            }
            ret = s && stringToNewUTF8(s);
            break;
  
          case 0x1F02 /* GL_VERSION */:
            var glVersion = GLctx.getParameter(0x1F02 /*GL_VERSION*/);
            // return GLES version string corresponding to the version of the WebGL context
            if (GL.currentContext.version >= 2) glVersion = 'OpenGL ES 3.0 (' + glVersion + ')';
            else
            {
              glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
            }
            ret = stringToNewUTF8(glVersion);
            break;
          case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
            var glslVersion = GLctx.getParameter(0x8B8C /*GL_SHADING_LANGUAGE_VERSION*/);
            // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
            var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
            var ver_num = glslVersion.match(ver_re);
            if (ver_num !== null) {
              if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
              glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
            }
            ret = stringToNewUTF8(glslVersion);
            break;
          default:
            GL.recordError(0x500/*GL_INVALID_ENUM*/);
            // fall through
        }
        GL.stringCache[name_] = ret;
      }
      return ret;
    }

  function _glGetStringi(name, index) {
      if (GL.currentContext.version < 2) {
        GL.recordError(0x502 /* GL_INVALID_OPERATION */); // Calling GLES3/WebGL2 function with a GLES2/WebGL1 context
        return 0;
      }
      var stringiCache = GL.stringiCache[name];
      if (stringiCache) {
        if (index < 0 || index >= stringiCache.length) {
          GL.recordError(0x501/*GL_INVALID_VALUE*/);
          return 0;
        }
        return stringiCache[index];
      }
      switch (name) {
        case 0x1F03 /* GL_EXTENSIONS */:
          var exts = GLctx.getSupportedExtensions() || []; // .getSupportedExtensions() can return null if context is lost, so coerce to empty array.
          exts = exts.concat(exts.map(function(e) { return "GL_" + e; }));
          exts = exts.map(function(e) { return stringToNewUTF8(e); });
  
          stringiCache = GL.stringiCache[name] = exts;
          if (index < 0 || index >= stringiCache.length) {
            GL.recordError(0x501/*GL_INVALID_VALUE*/);
            return 0;
          }
          return stringiCache[index];
        default:
          GL.recordError(0x500/*GL_INVALID_ENUM*/);
          return 0;
      }
    }

  function _glGetSynciv(sync, pname, bufSize, length, values) {
      if (bufSize < 0) {
        // GLES3 specification does not specify how to behave if bufSize < 0, however in the spec wording for glGetInternalformativ, it does say that GL_INVALID_VALUE should be raised,
        // so raise GL_INVALID_VALUE here as well.
        GL.recordError(0x501 /* GL_INVALID_VALUE */);
        return;
      }
      if (!values) {
        // GLES3 specification does not specify how to behave if values is a null pointer. Since calling this function does not make sense
        // if values == null, issue a GL error to notify user about it.
        GL.recordError(0x501 /* GL_INVALID_VALUE */);
        return;
      }
      var ret = GLctx.getSyncParameter(GL.syncs[sync], pname);
      if (ret !== null) {
        HEAP32[((values)>>2)] = ret;
        if (length) HEAP32[((length)>>2)] = 1; // Report a single value outputted.
      }
    }

  function _glGetUniformBlockIndex(program, uniformBlockName) {
      return GLctx.getUniformBlockIndex(GL.programs[program], UTF8ToString(uniformBlockName));
    }

  
  /** @noinline */
  function webglGetLeftBracePos(name) {
      return name.slice(-1) == ']' && name.lastIndexOf('[');
    }
  
  function webglPrepareUniformLocationsBeforeFirstUse(program) {
      var uniformLocsById = program.uniformLocsById, // Maps GLuint -> WebGLUniformLocation
        uniformSizeAndIdsByName = program.uniformSizeAndIdsByName, // Maps name -> [uniform array length, GLuint]
        i, j;
  
      // On the first time invocation of glGetUniformLocation on this shader program:
      // initialize cache data structures and discover which uniforms are arrays.
      if (!uniformLocsById) {
        // maps GLint integer locations to WebGLUniformLocations
        program.uniformLocsById = uniformLocsById = {};
        // maps integer locations back to uniform name strings, so that we can lazily fetch uniform array locations
        program.uniformArrayNamesById = {};
  
        for (i = 0; i < GLctx.getProgramParameter(program, 0x8B86/*GL_ACTIVE_UNIFORMS*/); ++i) {
          var u = GLctx.getActiveUniform(program, i);
          var nm = u.name;
          var sz = u.size;
          var lb = webglGetLeftBracePos(nm);
          var arrayName = lb > 0 ? nm.slice(0, lb) : nm;
  
          // Assign a new location.
          var id = program.uniformIdCounter;
          program.uniformIdCounter += sz;
          // Eagerly get the location of the uniformArray[0] base element.
          // The remaining indices >0 will be left for lazy evaluation to
          // improve performance. Those may never be needed to fetch, if the
          // application fills arrays always in full starting from the first
          // element of the array.
          uniformSizeAndIdsByName[arrayName] = [sz, id];
  
          // Store placeholder integers in place that highlight that these
          // >0 index locations are array indices pending population.
          for(j = 0; j < sz; ++j) {
            uniformLocsById[id] = j;
            program.uniformArrayNamesById[id++] = arrayName;
          }
        }
      }
    }
  
  
  
  function _glGetUniformLocation(program, name) {
  
      name = UTF8ToString(name);
  
      if (program = GL.programs[program]) {
        webglPrepareUniformLocationsBeforeFirstUse(program);
        var uniformLocsById = program.uniformLocsById; // Maps GLuint -> WebGLUniformLocation
        var arrayIndex = 0;
        var uniformBaseName = name;
  
        // Invariant: when populating integer IDs for uniform locations, we must maintain the precondition that
        // arrays reside in contiguous addresses, i.e. for a 'vec4 colors[10];', colors[4] must be at location colors[0]+4.
        // However, user might call glGetUniformLocation(program, "colors") for an array, so we cannot discover based on the user
        // input arguments whether the uniform we are dealing with is an array. The only way to discover which uniforms are arrays
        // is to enumerate over all the active uniforms in the program.
        var leftBrace = webglGetLeftBracePos(name);
  
        // If user passed an array accessor "[index]", parse the array index off the accessor.
        if (leftBrace > 0) {
          arrayIndex = jstoi_q(name.slice(leftBrace + 1)) >>> 0; // "index]", coerce parseInt(']') with >>>0 to treat "foo[]" as "foo[0]" and foo[-1] as unsigned out-of-bounds.
          uniformBaseName = name.slice(0, leftBrace);
        }
  
        // Have we cached the location of this uniform before?
        var sizeAndId = program.uniformSizeAndIdsByName[uniformBaseName]; // A pair [array length, GLint of the uniform location]
  
        // If an uniform with this name exists, and if its index is within the array limits (if it's even an array),
        // query the WebGLlocation, or return an existing cached location.
        if (sizeAndId && arrayIndex < sizeAndId[0]) {
          arrayIndex += sizeAndId[1]; // Add the base location of the uniform to the array index offset.
          if ((uniformLocsById[arrayIndex] = uniformLocsById[arrayIndex] || GLctx.getUniformLocation(program, name))) {
            return arrayIndex;
          }
        }
      }
      else {
        // N.b. we are currently unable to distinguish between GL program IDs that never existed vs GL program IDs that have been deleted,
        // so report GL_INVALID_VALUE in both cases.
        GL.recordError(0x501 /* GL_INVALID_VALUE */);
      }
      return -1;
    }

  function _glLinkProgram(program) {
      program = GL.programs[program];
      GLctx.linkProgram(program);
      // Invalidate earlier computed uniform->ID mappings, those have now become stale
      program.uniformLocsById = 0; // Mark as null-like so that glGetUniformLocation() knows to populate this again.
      program.uniformSizeAndIdsByName = {};
  
    }

  function _glPixelStorei(pname, param) {
      if (pname == 0xCF5 /* GL_UNPACK_ALIGNMENT */) {
        GL.unpackAlignment = param;
      }
      GLctx.pixelStorei(pname, param);
    }

  function _glReadBuffer(x0) { GLctx.readBuffer(x0) }

  function computeUnpackAlignedImageSize(width, height, sizePerPixel, alignment) {
      function roundedToNextMultipleOf(x, y) {
        return (x + y - 1) & -y;
      }
      var plainRowSize = width * sizePerPixel;
      var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
      return height * alignedRowSize;
    }
  
  function colorChannelsInGlTextureFormat(format) {
      // Micro-optimizations for size: map format to size by subtracting smallest enum value (0x1902) from all values first.
      // Also omit the most common size value (1) from the list, which is assumed by formats not on the list.
      var colorChannels = {
        // 0x1902 /* GL_DEPTH_COMPONENT */ - 0x1902: 1,
        // 0x1906 /* GL_ALPHA */ - 0x1902: 1,
        5: 3,
        6: 4,
        // 0x1909 /* GL_LUMINANCE */ - 0x1902: 1,
        8: 2,
        29502: 3,
        29504: 4,
        // 0x1903 /* GL_RED */ - 0x1902: 1,
        26917: 2,
        26918: 2,
        // 0x8D94 /* GL_RED_INTEGER */ - 0x1902: 1,
        29846: 3,
        29847: 4
      };
      return colorChannels[format - 0x1902]||1;
    }
  
  function heapObjectForWebGLType(type) {
      // Micro-optimization for size: Subtract lowest GL enum number (0x1400/* GL_BYTE */) from type to compare
      // smaller values for the heap, for shorter generated code size.
      // Also the type HEAPU16 is not tested for explicitly, but any unrecognized type will return out HEAPU16.
      // (since most types are HEAPU16)
      type -= 0x1400;
      if (type == 0) return HEAP8;
  
      if (type == 1) return HEAPU8;
  
      if (type == 2) return HEAP16;
  
      if (type == 4) return HEAP32;
  
      if (type == 6) return HEAPF32;
  
      if (type == 5
        || type == 28922
        || type == 28520
        || type == 30779
        || type == 30782
        )
        return HEAPU32;
  
      return HEAPU16;
    }
  
  function heapAccessShiftForWebGLHeap(heap) {
      return 31 - Math.clz32(heap.BYTES_PER_ELEMENT);
    }
  
  function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
      var heap = heapObjectForWebGLType(type);
      var shift = heapAccessShiftForWebGLHeap(heap);
      var byteSize = 1<<shift;
      var sizePerPixel = colorChannelsInGlTextureFormat(format) * byteSize;
      var bytes = computeUnpackAlignedImageSize(width, height, sizePerPixel, GL.unpackAlignment);
      return heap.subarray(pixels >> shift, pixels + bytes >> shift);
    }
  
  
  
  function _glReadPixels(x, y, width, height, format, type, pixels) {
      if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        if (GLctx.currentPixelPackBufferBinding) {
          GLctx.readPixels(x, y, width, height, format, type, pixels);
        } else {
          var heap = heapObjectForWebGLType(type);
          GLctx.readPixels(x, y, width, height, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap));
        }
        return;
      }
      var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
      if (!pixelData) {
        GL.recordError(0x500/*GL_INVALID_ENUM*/);
        return;
      }
      GLctx.readPixels(x, y, width, height, format, type, pixelData);
    }

  function _glRenderbufferStorage(x0, x1, x2, x3) { GLctx.renderbufferStorage(x0, x1, x2, x3) }

  function _glRenderbufferStorageMultisample(x0, x1, x2, x3, x4) { GLctx.renderbufferStorageMultisample(x0, x1, x2, x3, x4) }

  function _glScissor(x0, x1, x2, x3) { GLctx.scissor(x0, x1, x2, x3) }

  function _glShaderSource(shader, count, string, length) {
      var source = GL.getSource(shader, count, string, length);
  
      GLctx.shaderSource(GL.shaders[shader], source);
    }

  
  
  
  function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
      if (GL.currentContext.version >= 2) {
        // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        if (GLctx.currentPixelUnpackBufferBinding) {
          GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels);
        } else if (pixels) {
          var heap = heapObjectForWebGLType(type);
          GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap));
        } else {
          GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, null);
        }
        return;
      }
      GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null);
    }

  
  function _glTexImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels) {
      if (GLctx.currentPixelUnpackBufferBinding) {
        GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels);
      } else if (pixels) {
        var heap = heapObjectForWebGLType(type);
        GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap));
      } else {
        GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, null);
      }
    }

  function _glTexParameterf(x0, x1, x2) { GLctx.texParameterf(x0, x1, x2) }

  function _glTexParameteri(x0, x1, x2) { GLctx.texParameteri(x0, x1, x2) }

  function _glTexStorage2D(x0, x1, x2, x3, x4) { GLctx.texStorage2D(x0, x1, x2, x3, x4) }

  
  function _glTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) {
      if (GLctx.currentPixelUnpackBufferBinding) {
        GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels);
      } else if (pixels) {
        var heap = heapObjectForWebGLType(type);
        GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap));
      } else {
        GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null);
      }
    }

  function _glTransformFeedbackVaryings(program, count, varyings, bufferMode) {
      program = GL.programs[program];
      var vars = [];
      for (var i = 0; i < count; i++)
        vars.push(UTF8ToString(HEAP32[(((varyings)+(i*4))>>2)]));
  
      GLctx.transformFeedbackVaryings(program, vars, bufferMode);
    }

  function webglGetUniformLocation(location) {
      var p = GLctx.currentProgram;
  
      if (p) {
        var webglLoc = p.uniformLocsById[location];
        // p.uniformLocsById[location] stores either an integer, or a WebGLUniformLocation.
  
        // If an integer, we have not yet bound the location, so do it now. The integer value specifies the array index
        // we should bind to.
        if (typeof webglLoc == 'number') {
          p.uniformLocsById[location] = webglLoc = GLctx.getUniformLocation(p, p.uniformArrayNamesById[location] + (webglLoc > 0 ? '[' + webglLoc + ']' : ''));
        }
        // Else an already cached WebGLUniformLocation, return it.
        return webglLoc;
      } else {
        GL.recordError(0x502/*GL_INVALID_OPERATION*/);
      }
    }
  
  function _glUniform1f(location, v0) {
      GLctx.uniform1f(webglGetUniformLocation(location), v0);
    }

  
  function _glUniform1i(location, v0) {
      GLctx.uniform1i(webglGetUniformLocation(location), v0);
    }

  
  var miniTempWebGLIntBuffers = [];
  
  function _glUniform1iv(location, count, value) {
  
      if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        count && GLctx.uniform1iv(webglGetUniformLocation(location), HEAP32, value>>2, count);
        return;
      }
  
      if (count <= 288) {
        // avoid allocation when uploading few enough uniforms
        var view = miniTempWebGLIntBuffers[count-1];
        for (var i = 0; i < count; ++i) {
          view[i] = HEAP32[(((value)+(4*i))>>2)];
        }
      } else
      {
        var view = HEAP32.subarray((value)>>2, (value+count*4)>>2);
      }
      GLctx.uniform1iv(webglGetUniformLocation(location), view);
    }

  function _glUniform1ui(location, v0) {
      GLctx.uniform1ui(webglGetUniformLocation(location), v0);
    }

  function _glUniform1uiv(location, count, value) {
      count && GLctx.uniform1uiv(webglGetUniformLocation(location), HEAPU32, value>>2, count);
    }

  
  function _glUniform2f(location, v0, v1) {
      GLctx.uniform2f(webglGetUniformLocation(location), v0, v1);
    }

  
  var miniTempWebGLFloatBuffers = [];
  
  function _glUniform2fv(location, count, value) {
  
      if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        count && GLctx.uniform2fv(webglGetUniformLocation(location), HEAPF32, value>>2, count*2);
        return;
      }
  
      if (count <= 144) {
        // avoid allocation when uploading few enough uniforms
        var view = miniTempWebGLFloatBuffers[2*count-1];
        for (var i = 0; i < 2*count; i += 2) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
        }
      } else
      {
        var view = HEAPF32.subarray((value)>>2, (value+count*8)>>2);
      }
      GLctx.uniform2fv(webglGetUniformLocation(location), view);
    }

  
  
  function _glUniform2iv(location, count, value) {
  
      if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        count && GLctx.uniform2iv(webglGetUniformLocation(location), HEAP32, value>>2, count*2);
        return;
      }
  
      if (count <= 144) {
        // avoid allocation when uploading few enough uniforms
        var view = miniTempWebGLIntBuffers[2*count-1];
        for (var i = 0; i < 2*count; i += 2) {
          view[i] = HEAP32[(((value)+(4*i))>>2)];
          view[i+1] = HEAP32[(((value)+(4*i+4))>>2)];
        }
      } else
      {
        var view = HEAP32.subarray((value)>>2, (value+count*8)>>2);
      }
      GLctx.uniform2iv(webglGetUniformLocation(location), view);
    }

  
  
  function _glUniform3fv(location, count, value) {
  
      if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        count && GLctx.uniform3fv(webglGetUniformLocation(location), HEAPF32, value>>2, count*3);
        return;
      }
  
      if (count <= 96) {
        // avoid allocation when uploading few enough uniforms
        var view = miniTempWebGLFloatBuffers[3*count-1];
        for (var i = 0; i < 3*count; i += 3) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
        }
      } else
      {
        var view = HEAPF32.subarray((value)>>2, (value+count*12)>>2);
      }
      GLctx.uniform3fv(webglGetUniformLocation(location), view);
    }

  
  function _glUniform4f(location, v0, v1, v2, v3) {
      GLctx.uniform4f(webglGetUniformLocation(location), v0, v1, v2, v3);
    }

  
  
  function _glUniform4fv(location, count, value) {
  
      if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        count && GLctx.uniform4fv(webglGetUniformLocation(location), HEAPF32, value>>2, count*4);
        return;
      }
  
      if (count <= 72) {
        // avoid allocation when uploading few enough uniforms
        var view = miniTempWebGLFloatBuffers[4*count-1];
        // hoist the heap out of the loop for size and for pthreads+growth.
        var heap = HEAPF32;
        value >>= 2;
        for (var i = 0; i < 4 * count; i += 4) {
          var dst = value + i;
          view[i] = heap[dst];
          view[i + 1] = heap[dst + 1];
          view[i + 2] = heap[dst + 2];
          view[i + 3] = heap[dst + 3];
        }
      } else
      {
        var view = HEAPF32.subarray((value)>>2, (value+count*16)>>2);
      }
      GLctx.uniform4fv(webglGetUniformLocation(location), view);
    }

  function _glUniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding) {
      program = GL.programs[program];
  
      GLctx.uniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding);
    }

  
  
  function _glUniformMatrix4fv(location, count, transpose, value) {
  
      if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible.
        count && GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value>>2, count*16);
        return;
      }
  
      if (count <= 18) {
        // avoid allocation when uploading few enough uniforms
        var view = miniTempWebGLFloatBuffers[16*count-1];
        // hoist the heap out of the loop for size and for pthreads+growth.
        var heap = HEAPF32;
        value >>= 2;
        for (var i = 0; i < 16 * count; i += 16) {
          var dst = value + i;
          view[i] = heap[dst];
          view[i + 1] = heap[dst + 1];
          view[i + 2] = heap[dst + 2];
          view[i + 3] = heap[dst + 3];
          view[i + 4] = heap[dst + 4];
          view[i + 5] = heap[dst + 5];
          view[i + 6] = heap[dst + 6];
          view[i + 7] = heap[dst + 7];
          view[i + 8] = heap[dst + 8];
          view[i + 9] = heap[dst + 9];
          view[i + 10] = heap[dst + 10];
          view[i + 11] = heap[dst + 11];
          view[i + 12] = heap[dst + 12];
          view[i + 13] = heap[dst + 13];
          view[i + 14] = heap[dst + 14];
          view[i + 15] = heap[dst + 15];
        }
      } else
      {
        var view = HEAPF32.subarray((value)>>2, (value+count*64)>>2);
      }
      GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, view);
    }

  function _glUseProgram(program) {
      program = GL.programs[program];
      GLctx.useProgram(program);
      // Record the currently active program so that we can access the uniform
      // mapping table of that program.
      GLctx.currentProgram = program;
    }

  function _glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx.vertexAttrib4f(x0, x1, x2, x3, x4) }

  function _glVertexAttribDivisor(index, divisor) {
      GLctx.vertexAttribDivisor(index, divisor);
    }

  function _glVertexAttribI4ui(x0, x1, x2, x3, x4) { GLctx.vertexAttribI4ui(x0, x1, x2, x3, x4) }

  function _glVertexAttribIPointer(index, size, type, stride, ptr) {
      GLctx.vertexAttribIPointer(index, size, type, stride, ptr);
    }

  function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
      GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
    }

  function _glViewport(x0, x1, x2, x3) { GLctx.viewport(x0, x1, x2, x3) }

  
  var GodotRuntime = {
  get_func:function (ptr) {
  			return wasmTable.get(ptr); // eslint-disable-line no-undef
  		},
  error:function () {
  			err.apply(null, Array.from(arguments)); // eslint-disable-line no-undef
  		},
  print:function () {
  			out.apply(null, Array.from(arguments)); // eslint-disable-line no-undef
  		},
  malloc:function (p_size) {
  			return _malloc(p_size); // eslint-disable-line no-undef
  		},
  free:function (p_ptr) {
  			_free(p_ptr); // eslint-disable-line no-undef
  		},
  getHeapValue:function (p_ptr, p_type) {
  			return getValue(p_ptr, p_type); // eslint-disable-line no-undef
  		},
  setHeapValue:function (p_ptr, p_value, p_type) {
  			setValue(p_ptr, p_value, p_type); // eslint-disable-line no-undef
  		},
  heapSub:function (p_heap, p_ptr, p_len) {
  			const bytes = p_heap.BYTES_PER_ELEMENT;
  			return p_heap.subarray(p_ptr / bytes, p_ptr / bytes + p_len);
  		},
  heapSlice:function (p_heap, p_ptr, p_len) {
  			const bytes = p_heap.BYTES_PER_ELEMENT;
  			return p_heap.slice(p_ptr / bytes, p_ptr / bytes + p_len);
  		},
  heapCopy:function (p_dst, p_src, p_ptr) {
  			const bytes = p_src.BYTES_PER_ELEMENT;
  			return p_dst.set(p_src, p_ptr / bytes);
  		},
  parseString:function (p_ptr) {
  			return UTF8ToString(p_ptr); // eslint-disable-line no-undef
  		},
  parseStringArray:function (p_ptr, p_size) {
  			const strings = [];
  			const ptrs = GodotRuntime.heapSub(HEAP32, p_ptr, p_size); // TODO wasm64
  			ptrs.forEach(function (ptr) {
  				strings.push(GodotRuntime.parseString(ptr));
  			});
  			return strings;
  		},
  strlen:function (p_str) {
  			return lengthBytesUTF8(p_str); // eslint-disable-line no-undef
  		},
  allocString:function (p_str) {
  			const length = GodotRuntime.strlen(p_str) + 1;
  			const c_str = GodotRuntime.malloc(length);
  			stringToUTF8(p_str, c_str, length); // eslint-disable-line no-undef
  			return c_str;
  		},
  allocStringArray:function (p_strings) {
  			const size = p_strings.length;
  			const c_ptr = GodotRuntime.malloc(size * 4);
  			for (let i = 0; i < size; i++) {
  				HEAP32[(c_ptr >> 2) + i] = GodotRuntime.allocString(p_strings[i]);
  			}
  			return c_ptr;
  		},
  freeStringArray:function (p_ptr, p_len) {
  			for (let i = 0; i < p_len; i++) {
  				GodotRuntime.free(HEAP32[(p_ptr >> 2) + i]);
  			}
  			GodotRuntime.free(p_ptr);
  		},
  stringToHeap:function (p_str, p_ptr, p_len) {
  			return stringToUTF8Array(p_str, HEAP8, p_ptr, p_len); // eslint-disable-line no-undef
  		},
  };
  
  
  
  var GodotConfig = {
  canvas:null,
  locale:"en",
  canvas_resize_policy:2,
  virtual_keyboard:false,
  persistent_drops:false,
  on_execute:null,
  on_exit:null,
  init_config:function (p_opts) {
  			GodotConfig.canvas_resize_policy = p_opts['canvasResizePolicy'];
  			GodotConfig.canvas = p_opts['canvas'];
  			GodotConfig.locale = p_opts['locale'] || GodotConfig.locale;
  			GodotConfig.virtual_keyboard = p_opts['virtualKeyboard'];
  			GodotConfig.persistent_drops = !!p_opts['persistentDrops'];
  			GodotConfig.on_execute = p_opts['onExecute'];
  			GodotConfig.on_exit = p_opts['onExit'];
  			if (p_opts['focusCanvas']) {
  				GodotConfig.canvas.focus();
  			}
  		},
  locate_file:function (file) {
  			return Module['locateFile'](file); // eslint-disable-line no-undef
  		},
  clear:function () {
  			GodotConfig.canvas = null;
  			GodotConfig.locale = 'en';
  			GodotConfig.canvas_resize_policy = 2;
  			GodotConfig.virtual_keyboard = false;
  			GodotConfig.persistent_drops = false;
  			GodotConfig.on_execute = null;
  			GodotConfig.on_exit = null;
  		},
  };
  
  
  
  var GodotFS = {
  ENOENT:44,
  _idbfs:false,
  _syncing:false,
  _mount_points:[],
  is_persistent:function () {
  			return GodotFS._idbfs ? 1 : 0;
  		},
  init:function (persistentPaths) {
  			GodotFS._idbfs = false;
  			if (!Array.isArray(persistentPaths)) {
  				return Promise.reject(new Error('Persistent paths must be an array'));
  			}
  			if (!persistentPaths.length) {
  				return Promise.resolve();
  			}
  			GodotFS._mount_points = persistentPaths.slice();
  
  			function createRecursive(dir) {
  				try {
  					FS.stat(dir);
  				} catch (e) {
  					if (e.errno !== GodotFS.ENOENT) {
  						// Let mkdirTree throw in case, we cannot trust the above check.
  						GodotRuntime.error(e);
  					}
  					FS.mkdirTree(dir);
  				}
  			}
  
  			GodotFS._mount_points.forEach(function (path) {
  				createRecursive(path);
  				FS.mount(IDBFS, {}, path);
  			});
  			return new Promise(function (resolve, reject) {
  				FS.syncfs(true, function (err) {
  					if (err) {
  						GodotFS._mount_points = [];
  						GodotFS._idbfs = false;
  						GodotRuntime.print(`IndexedDB not available: ${err.message}`);
  					} else {
  						GodotFS._idbfs = true;
  					}
  					resolve(err);
  				});
  			});
  		},
  deinit:function () {
  			GodotFS._mount_points.forEach(function (path) {
  				try {
  					FS.unmount(path);
  				} catch (e) {
  					GodotRuntime.print('Already unmounted', e);
  				}
  				if (GodotFS._idbfs && IDBFS.dbs[path]) {
  					IDBFS.dbs[path].close();
  					delete IDBFS.dbs[path];
  				}
  			});
  			GodotFS._mount_points = [];
  			GodotFS._idbfs = false;
  			GodotFS._syncing = false;
  		},
  sync:function () {
  			if (GodotFS._syncing) {
  				GodotRuntime.error('Already syncing!');
  				return Promise.resolve();
  			}
  			GodotFS._syncing = true;
  			return new Promise(function (resolve, reject) {
  				FS.syncfs(false, function (error) {
  					if (error) {
  						GodotRuntime.error(`Failed to save IDB file system: ${error.message}`);
  					}
  					GodotFS._syncing = false;
  					resolve(error);
  				});
  			});
  		},
  copy_to_fs:function (path, buffer) {
  			const idx = path.lastIndexOf('/');
  			let dir = '/';
  			if (idx > 0) {
  				dir = path.slice(0, idx);
  			}
  			try {
  				FS.stat(dir);
  			} catch (e) {
  				if (e.errno !== GodotFS.ENOENT) {
  					// Let mkdirTree throw in case, we cannot trust the above check.
  					GodotRuntime.error(e);
  				}
  				FS.mkdirTree(dir);
  			}
  			FS.writeFile(path, new Uint8Array(buffer));
  		},
  };
  
  var GodotOS = {
  request_quit:function () {},
  _async_cbs:[],
  _fs_sync_promise:null,
  atexit:function (p_promise_cb) {
  			GodotOS._async_cbs.push(p_promise_cb);
  		},
  cleanup:function (exit_code) {
  			const cb = GodotConfig.on_exit;
  			GodotFS.deinit();
  			GodotConfig.clear();
  			if (cb) {
  				cb(exit_code);
  			}
  		},
  finish_async:function (callback) {
  			GodotOS._fs_sync_promise.then(function (err) {
  				const promises = [];
  				GodotOS._async_cbs.forEach(function (cb) {
  					promises.push(new Promise(cb));
  				});
  				return Promise.all(promises);
  			}).then(function () {
  				return GodotFS.sync(); // Final FS sync.
  			}).then(function (err) {
  				// Always deferred.
  				setTimeout(function () {
  					callback();
  				}, 0);
  			});
  		},
  };
  
  var GodotAudio = {
  ctx:null,
  input:null,
  driver:null,
  interval:0,
  init:function (mix_rate, latency, onstatechange, onlatencyupdate) {
  			const opts = {};
  			// If mix_rate is 0, let the browser choose.
  			if (mix_rate) {
  				opts['sampleRate'] = mix_rate;
  			}
  			// Do not specify, leave 'interactive' for good performance.
  			// opts['latencyHint'] = latency / 1000;
  			const ctx = new (window.AudioContext || window.webkitAudioContext)(opts);
  			GodotAudio.ctx = ctx;
  			ctx.onstatechange = function () {
  				let state = 0;
  				switch (ctx.state) {
  				case 'suspended':
  					state = 0;
  					break;
  				case 'running':
  					state = 1;
  					break;
  				case 'closed':
  					state = 2;
  					break;
  
  					// no default
  				}
  				onstatechange(state);
  			};
  			ctx.onstatechange(); // Immediately notify state.
  			// Update computed latency
  			GodotAudio.interval = setInterval(function () {
  				let computed_latency = 0;
  				if (ctx.baseLatency) {
  					computed_latency += GodotAudio.ctx.baseLatency;
  				}
  				if (ctx.outputLatency) {
  					computed_latency += GodotAudio.ctx.outputLatency;
  				}
  				onlatencyupdate(computed_latency);
  			}, 1000);
  			GodotOS.atexit(GodotAudio.close_async);
  			return ctx.destination.channelCount;
  		},
  create_input:function (callback) {
  			if (GodotAudio.input) {
  				return 0; // Already started.
  			}
  			function gotMediaInput(stream) {
  				try {
  					GodotAudio.input = GodotAudio.ctx.createMediaStreamSource(stream);
  					callback(GodotAudio.input);
  				} catch (e) {
  					GodotRuntime.error('Failed creating input.', e);
  				}
  			}
  			if (navigator.mediaDevices && navigator.mediaDevices.getUserMedia) {
  				navigator.mediaDevices.getUserMedia({
  					'audio': true,
  				}).then(gotMediaInput, function (e) {
  					GodotRuntime.error('Error getting user media.', e);
  				});
  			} else {
  				if (!navigator.getUserMedia) {
  					navigator.getUserMedia = navigator.webkitGetUserMedia || navigator.mozGetUserMedia;
  				}
  				if (!navigator.getUserMedia) {
  					GodotRuntime.error('getUserMedia not available.');
  					return 1;
  				}
  				navigator.getUserMedia({
  					'audio': true,
  				}, gotMediaInput, function (e) {
  					GodotRuntime.print(e);
  				});
  			}
  			return 0;
  		},
  close_async:function (resolve, reject) {
  			const ctx = GodotAudio.ctx;
  			GodotAudio.ctx = null;
  			// Audio was not initialized.
  			if (!ctx) {
  				resolve();
  				return;
  			}
  			// Remove latency callback
  			if (GodotAudio.interval) {
  				clearInterval(GodotAudio.interval);
  				GodotAudio.interval = 0;
  			}
  			// Disconnect input, if it was started.
  			if (GodotAudio.input) {
  				GodotAudio.input.disconnect();
  				GodotAudio.input = null;
  			}
  			// Disconnect output
  			let closed = Promise.resolve();
  			if (GodotAudio.driver) {
  				closed = GodotAudio.driver.close();
  			}
  			closed.then(function () {
  				return ctx.close();
  			}).then(function () {
  				ctx.onstatechange = null;
  				resolve();
  			}).catch(function (e) {
  				ctx.onstatechange = null;
  				GodotRuntime.error('Error closing AudioContext', e);
  				resolve();
  			});
  		},
  };
  function _godot_audio_has_worklet() {
  		return (GodotAudio.ctx && GodotAudio.ctx.audioWorklet) ? 1 : 0;
  	}

  function _godot_audio_init(p_mix_rate, p_latency, p_state_change, p_latency_update) {
  		const statechange = GodotRuntime.get_func(p_state_change);
  		const latencyupdate = GodotRuntime.get_func(p_latency_update);
  		const mix_rate = GodotRuntime.getHeapValue(p_mix_rate, 'i32');
  		const channels = GodotAudio.init(mix_rate, p_latency, statechange, latencyupdate);
  		GodotRuntime.setHeapValue(p_mix_rate, GodotAudio.ctx.sampleRate, 'i32');
  		return channels;
  	}

  function _godot_audio_input_start() {
  		return GodotAudio.create_input(function (input) {
  			input.connect(GodotAudio.driver.get_node());
  		});
  	}

  function _godot_audio_input_stop() {
  		if (GodotAudio.input) {
  			const tracks = GodotAudio.input['mediaStream']['getTracks']();
  			for (let i = 0; i < tracks.length; i++) {
  				tracks[i]['stop']();
  			}
  			GodotAudio.input.disconnect();
  			GodotAudio.input = null;
  		}
  	}

  function _godot_audio_is_available() {
  		if (!(window.AudioContext || window.webkitAudioContext)) {
  			return 0;
  		}
  		return 1;
  	}

  function _godot_audio_resume() {
  		if (GodotAudio.ctx && GodotAudio.ctx.state !== 'running') {
  			GodotAudio.ctx.resume();
  		}
  	}

  
  
  var GodotAudioWorklet = {
  promise:null,
  worklet:null,
  ring_buffer:null,
  create:function (channels) {
  			const path = GodotConfig.locate_file('godot.audio.worklet.js');
  			GodotAudioWorklet.promise = GodotAudio.ctx.audioWorklet.addModule(path).then(function () {
  				GodotAudioWorklet.worklet = new AudioWorkletNode(
  					GodotAudio.ctx,
  					'godot-processor',
  					{
  						'outputChannelCount': [channels],
  					}
  				);
  				return Promise.resolve();
  			});
  			GodotAudio.driver = GodotAudioWorklet;
  		},
  start:function (in_buf, out_buf, state) {
  			GodotAudioWorklet.promise.then(function () {
  				const node = GodotAudioWorklet.worklet;
  				node.connect(GodotAudio.ctx.destination);
  				node.port.postMessage({
  					'cmd': 'start',
  					'data': [state, in_buf, out_buf],
  				});
  				node.port.onmessage = function (event) {
  					GodotRuntime.error(event.data);
  				};
  			});
  		},
  start_no_threads:function (p_out_buf, p_out_size, out_callback, p_in_buf, p_in_size, in_callback) {
  			function RingBuffer() {
  				let wpos = 0;
  				let rpos = 0;
  				let pending_samples = 0;
  				const wbuf = new Float32Array(p_out_size);
  
  				function send(port) {
  					if (pending_samples === 0) {
  						return;
  					}
  					const buffer = GodotRuntime.heapSub(HEAPF32, p_out_buf, p_out_size);
  					const size = buffer.length;
  					const tot_sent = pending_samples;
  					out_callback(wpos, pending_samples);
  					if (wpos + pending_samples >= size) {
  						const high = size - wpos;
  						wbuf.set(buffer.subarray(wpos, size));
  						pending_samples -= high;
  						wpos = 0;
  					}
  					if (pending_samples > 0) {
  						wbuf.set(buffer.subarray(wpos, wpos + pending_samples), tot_sent - pending_samples);
  					}
  					port.postMessage({ 'cmd': 'chunk', 'data': wbuf.subarray(0, tot_sent) });
  					wpos += pending_samples;
  					pending_samples = 0;
  				}
  				this.receive = function (recv_buf) {
  					const buffer = GodotRuntime.heapSub(HEAPF32, p_in_buf, p_in_size);
  					const from = rpos;
  					let to_write = recv_buf.length;
  					let high = 0;
  					if (rpos + to_write >= p_in_size) {
  						high = p_in_size - rpos;
  						buffer.set(recv_buf.subarray(0, high), rpos);
  						to_write -= high;
  						rpos = 0;
  					}
  					if (to_write) {
  						buffer.set(recv_buf.subarray(high, to_write), rpos);
  					}
  					in_callback(from, recv_buf.length);
  					rpos += to_write;
  				};
  				this.consumed = function (size, port) {
  					pending_samples += size;
  					send(port);
  				};
  			}
  			GodotAudioWorklet.ring_buffer = new RingBuffer();
  			GodotAudioWorklet.promise.then(function () {
  				const node = GodotAudioWorklet.worklet;
  				const buffer = GodotRuntime.heapSlice(HEAPF32, p_out_buf, p_out_size);
  				node.connect(GodotAudio.ctx.destination);
  				node.port.postMessage({
  					'cmd': 'start_nothreads',
  					'data': [buffer, p_in_size],
  				});
  				node.port.onmessage = function (event) {
  					if (!GodotAudioWorklet.worklet) {
  						return;
  					}
  					if (event.data['cmd'] === 'read') {
  						const read = event.data['data'];
  						GodotAudioWorklet.ring_buffer.consumed(read, GodotAudioWorklet.worklet.port);
  					} else if (event.data['cmd'] === 'input') {
  						const buf = event.data['data'];
  						if (buf.length > p_in_size) {
  							GodotRuntime.error('Input chunk is too big');
  							return;
  						}
  						GodotAudioWorklet.ring_buffer.receive(buf);
  					} else {
  						GodotRuntime.error(event.data);
  					}
  				};
  			});
  		},
  get_node:function () {
  			return GodotAudioWorklet.worklet;
  		},
  close:function () {
  			return new Promise(function (resolve, reject) {
  				if (GodotAudioWorklet.promise === null) {
  					return;
  				}
  				const p = GodotAudioWorklet.promise;
  				p.then(function () {
  					GodotAudioWorklet.worklet.port.postMessage({
  						'cmd': 'stop',
  						'data': null,
  					});
  					GodotAudioWorklet.worklet.disconnect();
  					GodotAudioWorklet.worklet.port.onmessage = null;
  					GodotAudioWorklet.worklet = null;
  					GodotAudioWorklet.promise = null;
  					resolve();
  				}).catch(function (err) {
  					// Aborted?
  					GodotRuntime.error(err);
  				});
  			});
  		},
  };
  function _godot_audio_worklet_create(channels) {
  		try {
  			GodotAudioWorklet.create(channels);
  		} catch (e) {
  			GodotRuntime.error('Error starting AudioDriverWorklet', e);
  			return 1;
  		}
  		return 0;
  	}

  function _godot_audio_worklet_start_no_threads(p_out_buf, p_out_size, p_out_callback, p_in_buf, p_in_size, p_in_callback) {
  		const out_callback = GodotRuntime.get_func(p_out_callback);
  		const in_callback = GodotRuntime.get_func(p_in_callback);
  		GodotAudioWorklet.start_no_threads(p_out_buf, p_out_size, out_callback, p_in_buf, p_in_size, in_callback);
  	}

  function _godot_js_config_canvas_id_get(p_ptr, p_ptr_max) {
  		GodotRuntime.stringToHeap(`#${GodotConfig.canvas.id}`, p_ptr, p_ptr_max);
  	}

  function _godot_js_config_locale_get(p_ptr, p_ptr_max) {
  		GodotRuntime.stringToHeap(GodotConfig.locale, p_ptr, p_ptr_max);
  	}

  
  
  
  var GodotDisplayCursor = {
  shape:"default",
  visible:true,
  cursors:{
  },
  set_style:function (style) {
  			GodotConfig.canvas.style.cursor = style;
  		},
  set_shape:function (shape) {
  			GodotDisplayCursor.shape = shape;
  			let css = shape;
  			if (shape in GodotDisplayCursor.cursors) {
  				const c = GodotDisplayCursor.cursors[shape];
  				css = `url("${c.url}") ${c.x} ${c.y}, default`;
  			}
  			if (GodotDisplayCursor.visible) {
  				GodotDisplayCursor.set_style(css);
  			}
  		},
  clear:function () {
  			GodotDisplayCursor.set_style('');
  			GodotDisplayCursor.shape = 'default';
  			GodotDisplayCursor.visible = true;
  			Object.keys(GodotDisplayCursor.cursors).forEach(function (key) {
  				URL.revokeObjectURL(GodotDisplayCursor.cursors[key]);
  				delete GodotDisplayCursor.cursors[key];
  			});
  		},
  lockPointer:function () {
  			const canvas = GodotConfig.canvas;
  			if (canvas.requestPointerLock) {
  				canvas.requestPointerLock();
  			}
  		},
  releasePointer:function () {
  			if (document.exitPointerLock) {
  				document.exitPointerLock();
  			}
  		},
  isPointerLocked:function () {
  			return document.pointerLockElement === GodotConfig.canvas;
  		},
  };
  
  var GodotEventListeners = {
  handlers:[],
  has:function (target, event, method, capture) {
  			return GodotEventListeners.handlers.findIndex(function (e) {
  				return e.target === target && e.event === event && e.method === method && e.capture === capture;
  			}) !== -1;
  		},
  add:function (target, event, method, capture) {
  			if (GodotEventListeners.has(target, event, method, capture)) {
  				return;
  			}
  			function Handler(p_target, p_event, p_method, p_capture) {
  				this.target = p_target;
  				this.event = p_event;
  				this.method = p_method;
  				this.capture = p_capture;
  			}
  			GodotEventListeners.handlers.push(new Handler(target, event, method, capture));
  			target.addEventListener(event, method, capture);
  		},
  clear:function () {
  			GodotEventListeners.handlers.forEach(function (h) {
  				h.target.removeEventListener(h.event, h.method, h.capture);
  			});
  			GodotEventListeners.handlers.length = 0;
  		},
  };
  
  
  
  
  
  /** @suppress {duplicate } */
  function _emscripten_webgl_do_get_current_context() {
      return GL.currentContext ? GL.currentContext.handle : 0;
    }
  var _emscripten_webgl_get_current_context = _emscripten_webgl_do_get_current_context;
  var GodotDisplayScreen = {
  desired_size:[0,0],
  hidpi:true,
  getPixelRatio:function () {
  			return GodotDisplayScreen.hidpi ? window.devicePixelRatio || 1 : 1;
  		},
  isFullscreen:function () {
  			const elem = document.fullscreenElement || document.mozFullscreenElement
  				|| document.webkitFullscreenElement || document.msFullscreenElement;
  			if (elem) {
  				return elem === GodotConfig.canvas;
  			}
  			// But maybe knowing the element is not supported.
  			return document.fullscreen || document.mozFullScreen
  				|| document.webkitIsFullscreen;
  		},
  hasFullscreen:function () {
  			return document.fullscreenEnabled || document.mozFullScreenEnabled
  				|| document.webkitFullscreenEnabled;
  		},
  requestFullscreen:function () {
  			if (!GodotDisplayScreen.hasFullscreen()) {
  				return 1;
  			}
  			const canvas = GodotConfig.canvas;
  			try {
  				const promise = (canvas.requestFullscreen || canvas.msRequestFullscreen
  					|| canvas.mozRequestFullScreen || canvas.mozRequestFullscreen
  					|| canvas.webkitRequestFullscreen
  				).call(canvas);
  				// Some browsers (Safari) return undefined.
  				// For the standard ones, we need to catch it.
  				if (promise) {
  					promise.catch(function () {
  						// nothing to do.
  					});
  				}
  			} catch (e) {
  				return 1;
  			}
  			return 0;
  		},
  exitFullscreen:function () {
  			if (!GodotDisplayScreen.isFullscreen()) {
  				return 0;
  			}
  			try {
  				const promise = document.exitFullscreen();
  				if (promise) {
  					promise.catch(function () {
  						// nothing to do.
  					});
  				}
  			} catch (e) {
  				return 1;
  			}
  			return 0;
  		},
  _updateGL:function () {
  			const gl_context_handle = _emscripten_webgl_get_current_context(); // eslint-disable-line no-undef
  			const gl = GL.getContext(gl_context_handle);
  			if (gl) {
  				GL.resizeOffscreenFramebuffer(gl);
  			}
  		},
  updateSize:function () {
  			const isFullscreen = GodotDisplayScreen.isFullscreen();
  			const wantsFullWindow = GodotConfig.canvas_resize_policy === 2;
  			const noResize = GodotConfig.canvas_resize_policy === 0;
  			const dWidth = GodotDisplayScreen.desired_size[0];
  			const dHeight = GodotDisplayScreen.desired_size[1];
  			const canvas = GodotConfig.canvas;
  			let width = dWidth;
  			let height = dHeight;
  			if (noResize) {
  				// Don't resize canvas, just update GL if needed.
  				if (canvas.width !== width || canvas.height !== height) {
  					GodotDisplayScreen.desired_size = [canvas.width, canvas.height];
  					GodotDisplayScreen._updateGL();
  					return 1;
  				}
  				return 0;
  			}
  			const scale = GodotDisplayScreen.getPixelRatio();
  			if (isFullscreen || wantsFullWindow) {
  				// We need to match screen size.
  				width = window.innerWidth * scale;
  				height = window.innerHeight * scale;
  			}
  			const csw = `${width / scale}px`;
  			const csh = `${height / scale}px`;
  			if (canvas.style.width !== csw || canvas.style.height !== csh || canvas.width !== width || canvas.height !== height) {
  				// Size doesn't match.
  				// Resize canvas, set correct CSS pixel size, update GL.
  				canvas.width = width;
  				canvas.height = height;
  				canvas.style.width = csw;
  				canvas.style.height = csh;
  				GodotDisplayScreen._updateGL();
  				return 1;
  			}
  			return 0;
  		},
  };
  
  
  
  var GodotDisplayVK = {
  textinput:null,
  textarea:null,
  available:function () {
  			return GodotConfig.virtual_keyboard && 'ontouchstart' in window;
  		},
  init:function (input_cb) {
  			function create(what) {
  				const elem = document.createElement(what);
  				elem.style.display = 'none';
  				elem.style.position = 'absolute';
  				elem.style.zIndex = '-1';
  				elem.style.background = 'transparent';
  				elem.style.padding = '0px';
  				elem.style.margin = '0px';
  				elem.style.overflow = 'hidden';
  				elem.style.width = '0px';
  				elem.style.height = '0px';
  				elem.style.border = '0px';
  				elem.style.outline = 'none';
  				elem.readonly = true;
  				elem.disabled = true;
  				GodotEventListeners.add(elem, 'input', function (evt) {
  					const c_str = GodotRuntime.allocString(elem.value);
  					input_cb(c_str, elem.selectionEnd);
  					GodotRuntime.free(c_str);
  				}, false);
  				GodotEventListeners.add(elem, 'blur', function (evt) {
  					elem.style.display = 'none';
  					elem.readonly = true;
  					elem.disabled = true;
  				}, false);
  				GodotConfig.canvas.insertAdjacentElement('beforebegin', elem);
  				return elem;
  			}
  			GodotDisplayVK.textinput = create('input');
  			GodotDisplayVK.textarea = create('textarea');
  			GodotDisplayVK.updateSize();
  		},
  show:function (text, type, start, end) {
  			if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) {
  				return;
  			}
  			if (GodotDisplayVK.textinput.style.display !== '' || GodotDisplayVK.textarea.style.display !== '') {
  				GodotDisplayVK.hide();
  			}
  			GodotDisplayVK.updateSize();
  
  			let elem = GodotDisplayVK.textinput;
  			switch (type) {
  			case 0: // KEYBOARD_TYPE_DEFAULT
  				elem.type = 'text';
  				elem.inputmode = '';
  				break;
  			case 1: // KEYBOARD_TYPE_MULTILINE
  				elem = GodotDisplayVK.textarea;
  				break;
  			case 2: // KEYBOARD_TYPE_NUMBER
  				elem.type = 'text';
  				elem.inputmode = 'numeric';
  				break;
  			case 3: // KEYBOARD_TYPE_NUMBER_DECIMAL
  				elem.type = 'text';
  				elem.inputmode = 'decimal';
  				break;
  			case 4: // KEYBOARD_TYPE_PHONE
  				elem.type = 'tel';
  				elem.inputmode = '';
  				break;
  			case 5: // KEYBOARD_TYPE_EMAIL_ADDRESS
  				elem.type = 'email';
  				elem.inputmode = '';
  				break;
  			case 6: // KEYBOARD_TYPE_PASSWORD
  				elem.type = 'password';
  				elem.inputmode = '';
  				break;
  			case 7: // KEYBOARD_TYPE_URL
  				elem.type = 'url';
  				elem.inputmode = '';
  				break;
  			default:
  				elem.type = 'text';
  				elem.inputmode = '';
  				break;
  			}
  
  			elem.readonly = false;
  			elem.disabled = false;
  			elem.value = text;
  			elem.style.display = 'block';
  			elem.focus();
  			elem.setSelectionRange(start, end);
  		},
  hide:function () {
  			if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) {
  				return;
  			}
  			[GodotDisplayVK.textinput, GodotDisplayVK.textarea].forEach(function (elem) {
  				elem.blur();
  				elem.style.display = 'none';
  				elem.value = '';
  			});
  		},
  updateSize:function () {
  			if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) {
  				return;
  			}
  			const rect = GodotConfig.canvas.getBoundingClientRect();
  			function update(elem) {
  				elem.style.left = `${rect.left}px`;
  				elem.style.top = `${rect.top}px`;
  				elem.style.width = `${rect.width}px`;
  				elem.style.height = `${rect.height}px`;
  			}
  			update(GodotDisplayVK.textinput);
  			update(GodotDisplayVK.textarea);
  		},
  clear:function () {
  			if (GodotDisplayVK.textinput) {
  				GodotDisplayVK.textinput.remove();
  				GodotDisplayVK.textinput = null;
  			}
  			if (GodotDisplayVK.textarea) {
  				GodotDisplayVK.textarea.remove();
  				GodotDisplayVK.textarea = null;
  			}
  		},
  };
  
  var GodotDisplay = {
  window_icon:"",
  getDPI:function () {
  			// devicePixelRatio is given in dppx
  			// https://drafts.csswg.org/css-values/#resolution
  			// > due to the 1:96 fixed ratio of CSS *in* to CSS *px*, 1dppx is equivalent to 96dpi.
  			const dpi = Math.round(window.devicePixelRatio * 96);
  			return dpi >= 96 ? dpi : 96;
  		},
  };
  function _godot_js_display_alert(p_text) {
  		window.alert(GodotRuntime.parseString(p_text)); // eslint-disable-line no-alert
  	}

  function _godot_js_display_canvas_focus() {
  		GodotConfig.canvas.focus();
  	}

  function _godot_js_display_canvas_is_focused() {
  		return document.activeElement === GodotConfig.canvas;
  	}

  function _godot_js_display_clipboard_get(callback) {
  		const func = GodotRuntime.get_func(callback);
  		try {
  			navigator.clipboard.readText().then(function (result) {
  				const ptr = GodotRuntime.allocString(result);
  				func(ptr);
  				GodotRuntime.free(ptr);
  			}).catch(function (e) {
  				// Fail graciously.
  			});
  		} catch (e) {
  			// Fail graciously.
  		}
  	}

  function _godot_js_display_clipboard_set(p_text) {
  		const text = GodotRuntime.parseString(p_text);
  		if (!navigator.clipboard || !navigator.clipboard.writeText) {
  			return 1;
  		}
  		navigator.clipboard.writeText(text).catch(function (e) {
  			// Setting OS clipboard is only possible from an input callback.
  			GodotRuntime.error('Setting OS clipboard is only possible from an input callback for the Web platform. Exception:', e);
  		});
  		return 0;
  	}

  function _godot_js_display_cursor_is_hidden() {
  		return !GodotDisplayCursor.visible;
  	}

  function _godot_js_display_cursor_is_locked() {
  		return GodotDisplayCursor.isPointerLocked() ? 1 : 0;
  	}

  function _godot_js_display_cursor_lock_set(p_lock) {
  		if (p_lock) {
  			GodotDisplayCursor.lockPointer();
  		} else {
  			GodotDisplayCursor.releasePointer();
  		}
  	}

  function _godot_js_display_cursor_set_custom_shape(p_shape, p_ptr, p_len, p_hotspot_x, p_hotspot_y) {
  		const shape = GodotRuntime.parseString(p_shape);
  		const old_shape = GodotDisplayCursor.cursors[shape];
  		if (p_len > 0) {
  			const png = new Blob([GodotRuntime.heapSlice(HEAPU8, p_ptr, p_len)], { type: 'image/png' });
  			const url = URL.createObjectURL(png);
  			GodotDisplayCursor.cursors[shape] = {
  				url: url,
  				x: p_hotspot_x,
  				y: p_hotspot_y,
  			};
  		} else {
  			delete GodotDisplayCursor.cursors[shape];
  		}
  		if (shape === GodotDisplayCursor.shape) {
  			GodotDisplayCursor.set_shape(GodotDisplayCursor.shape);
  		}
  		if (old_shape) {
  			URL.revokeObjectURL(old_shape.url);
  		}
  	}

  function _godot_js_display_cursor_set_shape(p_string) {
  		GodotDisplayCursor.set_shape(GodotRuntime.parseString(p_string));
  	}

  function _godot_js_display_cursor_set_visible(p_visible) {
  		const visible = p_visible !== 0;
  		if (visible === GodotDisplayCursor.visible) {
  			return;
  		}
  		GodotDisplayCursor.visible = visible;
  		if (visible) {
  			GodotDisplayCursor.set_shape(GodotDisplayCursor.shape);
  		} else {
  			GodotDisplayCursor.set_style('none');
  		}
  	}

  function _godot_js_display_desired_size_set(width, height) {
  		GodotDisplayScreen.desired_size = [width, height];
  		GodotDisplayScreen.updateSize();
  	}

  function _godot_js_display_fullscreen_cb(callback) {
  		const canvas = GodotConfig.canvas;
  		const func = GodotRuntime.get_func(callback);
  		function change_cb(evt) {
  			if (evt.target === canvas) {
  				func(GodotDisplayScreen.isFullscreen());
  			}
  		}
  		GodotEventListeners.add(document, 'fullscreenchange', change_cb, false);
  		GodotEventListeners.add(document, 'mozfullscreenchange', change_cb, false);
  		GodotEventListeners.add(document, 'webkitfullscreenchange', change_cb, false);
  	}

  function _godot_js_display_fullscreen_exit() {
  		return GodotDisplayScreen.exitFullscreen();
  	}

  function _godot_js_display_fullscreen_request() {
  		return GodotDisplayScreen.requestFullscreen();
  	}

  function _godot_js_display_has_webgl(p_version) {
  		if (p_version !== 1 && p_version !== 2) {
  			return false;
  		}
  		try {
  			return !!document.createElement('canvas').getContext(p_version === 2 ? 'webgl2' : 'webgl');
  		} catch (e) { /* Not available */ }
  		return false;
  	}

  function _godot_js_display_is_swap_ok_cancel() {
  		const win = (['Windows', 'Win64', 'Win32', 'WinCE']);
  		const plat = navigator.platform || '';
  		if (win.indexOf(plat) !== -1) {
  			return 1;
  		}
  		return 0;
  	}

  function _godot_js_display_notification_cb(callback, p_enter, p_exit, p_in, p_out) {
  		const canvas = GodotConfig.canvas;
  		const func = GodotRuntime.get_func(callback);
  		const notif = [p_enter, p_exit, p_in, p_out];
  		['mouseover', 'mouseleave', 'focus', 'blur'].forEach(function (evt_name, idx) {
  			GodotEventListeners.add(canvas, evt_name, function () {
  				func(notif[idx]);
  			}, true);
  		});
  	}

  function _godot_js_display_pixel_ratio_get() {
  		return GodotDisplayScreen.getPixelRatio();
  	}

  function _godot_js_display_screen_dpi_get() {
  		return GodotDisplay.getDPI();
  	}

  function _godot_js_display_screen_size_get(width, height) {
  		const scale = GodotDisplayScreen.getPixelRatio();
  		GodotRuntime.setHeapValue(width, window.screen.width * scale, 'i32');
  		GodotRuntime.setHeapValue(height, window.screen.height * scale, 'i32');
  	}

  function _godot_js_display_setup_canvas(p_width, p_height, p_fullscreen, p_hidpi) {
  		const canvas = GodotConfig.canvas;
  		GodotEventListeners.add(canvas, 'contextmenu', function (ev) {
  			ev.preventDefault();
  		}, false);
  		GodotEventListeners.add(canvas, 'webglcontextlost', function (ev) {
  			alert('WebGL context lost, please reload the page'); // eslint-disable-line no-alert
  			ev.preventDefault();
  		}, false);
  		GodotDisplayScreen.hidpi = !!p_hidpi;
  		switch (GodotConfig.canvas_resize_policy) {
  		case 0: // None
  			GodotDisplayScreen.desired_size = [canvas.width, canvas.height];
  			break;
  		case 1: // Project
  			GodotDisplayScreen.desired_size = [p_width, p_height];
  			break;
  		default: // Full window
  			// Ensure we display in the right place, the size will be handled by updateSize
  			canvas.style.position = 'absolute';
  			canvas.style.top = 0;
  			canvas.style.left = 0;
  			break;
  		}
  		GodotDisplayScreen.updateSize();
  		if (p_fullscreen) {
  			GodotDisplayScreen.requestFullscreen();
  		}
  	}

  function _godot_js_display_size_update() {
  		const updated = GodotDisplayScreen.updateSize();
  		if (updated) {
  			GodotDisplayVK.updateSize();
  		}
  		return updated;
  	}

  function _godot_js_display_touchscreen_is_available() {
  		return 'ontouchstart' in window;
  	}

  function _godot_js_display_tts_available() {
  		return 'speechSynthesis' in window;
  	}

  function _godot_js_display_vk_available() {
  		return GodotDisplayVK.available();
  	}

  function _godot_js_display_vk_cb(p_input_cb) {
  		const input_cb = GodotRuntime.get_func(p_input_cb);
  		if (GodotDisplayVK.available()) {
  			GodotDisplayVK.init(input_cb);
  		}
  	}

  function _godot_js_display_vk_hide() {
  		GodotDisplayVK.hide();
  	}

  function _godot_js_display_vk_show(p_text, p_type, p_start, p_end) {
  		const text = GodotRuntime.parseString(p_text);
  		const start = p_start > 0 ? p_start : 0;
  		const end = p_end > 0 ? p_end : start;
  		GodotDisplayVK.show(text, p_type, start, end);
  	}

  function _godot_js_display_window_blur_cb(callback) {
  		const func = GodotRuntime.get_func(callback);
  		GodotEventListeners.add(window, 'blur', function () {
  			func();
  		}, false);
  	}

  function _godot_js_display_window_icon_set(p_ptr, p_len) {
  		let link = document.getElementById('-gd-engine-icon');
  		const old_icon = GodotDisplay.window_icon;
  		if (p_ptr) {
  			if (link === null) {
  				link = document.createElement('link');
  				link.rel = 'icon';
  				link.id = '-gd-engine-icon';
  				document.head.appendChild(link);
  			}
  			const png = new Blob([GodotRuntime.heapSlice(HEAPU8, p_ptr, p_len)], { type: 'image/png' });
  			GodotDisplay.window_icon = URL.createObjectURL(png);
  			link.href = GodotDisplay.window_icon;
  		} else {
  			if (link) {
  				link.remove();
  			}
  			GodotDisplay.window_icon = null;
  		}
  		if (old_icon) {
  			URL.revokeObjectURL(old_icon);
  		}
  	}

  function _godot_js_display_window_size_get(p_width, p_height) {
  		GodotRuntime.setHeapValue(p_width, GodotConfig.canvas.width, 'i32');
  		GodotRuntime.setHeapValue(p_height, GodotConfig.canvas.height, 'i32');
  	}

  function _godot_js_display_window_title_set(p_data) {
  		document.title = GodotRuntime.parseString(p_data);
  	}

  function _godot_js_eval(p_js, p_use_global_ctx, p_union_ptr, p_byte_arr, p_byte_arr_write, p_callback) {
  		const js_code = GodotRuntime.parseString(p_js);
  		let eval_ret = null;
  		try {
  			if (p_use_global_ctx) {
  				// indirect eval call grants global execution context
  				const global_eval = eval; // eslint-disable-line no-eval
  				eval_ret = global_eval(js_code);
  			} else {
  				eval_ret = eval(js_code); // eslint-disable-line no-eval
  			}
  		} catch (e) {
  			GodotRuntime.error(e);
  		}
  
  		switch (typeof eval_ret) {
  		case 'boolean':
  			GodotRuntime.setHeapValue(p_union_ptr, eval_ret, 'i32');
  			return 1; // BOOL
  
  		case 'number':
  			GodotRuntime.setHeapValue(p_union_ptr, eval_ret, 'double');
  			return 3; // FLOAT
  
  		case 'string':
  			GodotRuntime.setHeapValue(p_union_ptr, GodotRuntime.allocString(eval_ret), '*');
  			return 4; // STRING
  
  		case 'object':
  			if (eval_ret === null) {
  				break;
  			}
  
  			if (ArrayBuffer.isView(eval_ret) && !(eval_ret instanceof Uint8Array)) {
  				eval_ret = new Uint8Array(eval_ret.buffer);
  			} else if (eval_ret instanceof ArrayBuffer) {
  				eval_ret = new Uint8Array(eval_ret);
  			}
  			if (eval_ret instanceof Uint8Array) {
  				const func = GodotRuntime.get_func(p_callback);
  				const bytes_ptr = func(p_byte_arr, p_byte_arr_write, eval_ret.length);
  				HEAPU8.set(eval_ret, bytes_ptr);
  				return 29; // PACKED_BYTE_ARRAY
  			}
  			break;
  
  			// no default
  		}
  		return 0; // NIL
  	}

  var IDHandler = {
  _last_id:0,
  _references:{
  },
  get:function (p_id) {
  			return IDHandler._references[p_id];
  		},
  add:function (p_data) {
  			const id = ++IDHandler._last_id;
  			IDHandler._references[id] = p_data;
  			return id;
  		},
  remove:function (p_id) {
  			delete IDHandler._references[p_id];
  		},
  };
  
  
  var GodotFetch = {
  onread:function (id, result) {
  			const obj = IDHandler.get(id);
  			if (!obj) {
  				return;
  			}
  			if (result.value) {
  				obj.chunks.push(result.value);
  			}
  			obj.reading = false;
  			obj.done = result.done;
  		},
  onresponse:function (id, response) {
  			const obj = IDHandler.get(id);
  			if (!obj) {
  				return;
  			}
  			let chunked = false;
  			response.headers.forEach(function (value, header) {
  				const v = value.toLowerCase().trim();
  				const h = header.toLowerCase().trim();
  				if (h === 'transfer-encoding' && v === 'chunked') {
  					chunked = true;
  				}
  			});
  			obj.status = response.status;
  			obj.response = response;
  			obj.reader = response.body.getReader();
  			obj.chunked = chunked;
  		},
  onerror:function (id, err) {
  			GodotRuntime.error(err);
  			const obj = IDHandler.get(id);
  			if (!obj) {
  				return;
  			}
  			obj.error = err;
  		},
  create:function (method, url, headers, body) {
  			const obj = {
  				request: null,
  				response: null,
  				reader: null,
  				error: null,
  				done: false,
  				reading: false,
  				status: 0,
  				chunks: [],
  			};
  			const id = IDHandler.add(obj);
  			const init = {
  				method: method,
  				headers: headers,
  				body: body,
  			};
  			obj.request = fetch(url, init);
  			obj.request.then(GodotFetch.onresponse.bind(null, id)).catch(GodotFetch.onerror.bind(null, id));
  			return id;
  		},
  free:function (id) {
  			const obj = IDHandler.get(id);
  			if (!obj) {
  				return;
  			}
  			IDHandler.remove(id);
  			if (!obj.request) {
  				return;
  			}
  			// Try to abort
  			obj.request.then(function (response) {
  				response.abort();
  			}).catch(function (e) { /* nothing to do */ });
  		},
  read:function (id) {
  			const obj = IDHandler.get(id);
  			if (!obj) {
  				return;
  			}
  			if (obj.reader && !obj.reading) {
  				if (obj.done) {
  					obj.reader = null;
  					return;
  				}
  				obj.reading = true;
  				obj.reader.read().then(GodotFetch.onread.bind(null, id)).catch(GodotFetch.onerror.bind(null, id));
  			}
  		},
  };
  function _godot_js_fetch_create(p_method, p_url, p_headers, p_headers_size, p_body, p_body_size) {
  		const method = GodotRuntime.parseString(p_method);
  		const url = GodotRuntime.parseString(p_url);
  		const headers = GodotRuntime.parseStringArray(p_headers, p_headers_size);
  		const body = p_body_size ? GodotRuntime.heapSlice(HEAP8, p_body, p_body_size) : null;
  		return GodotFetch.create(method, url, headers.map(function (hv) {
  			const idx = hv.indexOf(':');
  			if (idx <= 0) {
  				return [];
  			}
  			return [
  				hv.slice(0, idx).trim(),
  				hv.slice(idx + 1).trim(),
  			];
  		}).filter(function (v) {
  			return v.length === 2;
  		}), body);
  	}

  function _godot_js_fetch_free(id) {
  		GodotFetch.free(id);
  	}

  function _godot_js_fetch_http_status_get(p_id) {
  		const obj = IDHandler.get(p_id);
  		if (!obj || !obj.response) {
  			return 0;
  		}
  		return obj.status;
  	}

  function _godot_js_fetch_is_chunked(p_id) {
  		const obj = IDHandler.get(p_id);
  		if (!obj || !obj.response) {
  			return -1;
  		}
  		return obj.chunked ? 1 : 0;
  	}

  function _godot_js_fetch_read_chunk(p_id, p_buf, p_buf_size) {
  		const obj = IDHandler.get(p_id);
  		if (!obj || !obj.response) {
  			return 0;
  		}
  		let to_read = p_buf_size;
  		const chunks = obj.chunks;
  		while (to_read && chunks.length) {
  			const chunk = obj.chunks[0];
  			if (chunk.length > to_read) {
  				GodotRuntime.heapCopy(HEAP8, chunk.slice(0, to_read), p_buf);
  				chunks[0] = chunk.slice(to_read);
  				to_read = 0;
  			} else {
  				GodotRuntime.heapCopy(HEAP8, chunk, p_buf);
  				to_read -= chunk.length;
  				chunks.pop();
  			}
  		}
  		if (!chunks.length) {
  			GodotFetch.read(p_id);
  		}
  		return p_buf_size - to_read;
  	}

  function _godot_js_fetch_read_headers(p_id, p_parse_cb, p_ref) {
  		const obj = IDHandler.get(p_id);
  		if (!obj || !obj.response) {
  			return 1;
  		}
  		const cb = GodotRuntime.get_func(p_parse_cb);
  		const arr = [];
  		obj.response.headers.forEach(function (v, h) {
  			arr.push(`${h}:${v}`);
  		});
  		const c_ptr = GodotRuntime.allocStringArray(arr);
  		cb(arr.length, c_ptr, p_ref);
  		GodotRuntime.freeStringArray(c_ptr, arr.length);
  		return 0;
  	}

  function _godot_js_fetch_state_get(p_id) {
  		const obj = IDHandler.get(p_id);
  		if (!obj) {
  			return -1;
  		}
  		if (obj.error) {
  			return -1;
  		}
  		if (!obj.response) {
  			return 0;
  		}
  		if (obj.reader) {
  			return 1;
  		}
  		if (obj.done) {
  			return 2;
  		}
  		return -1;
  	}

  
  
  
  
  var GodotInputGamepads = {
  samples:[],
  get_pads:function () {
  			try {
  				// Will throw in iframe when permission is denied.
  				// Will throw/warn in the future for insecure contexts.
  				// See https://github.com/w3c/gamepad/pull/120
  				const pads = navigator.getGamepads();
  				if (pads) {
  					return pads;
  				}
  				return [];
  			} catch (e) {
  				return [];
  			}
  		},
  get_samples:function () {
  			return GodotInputGamepads.samples;
  		},
  get_sample:function (index) {
  			const samples = GodotInputGamepads.samples;
  			return index < samples.length ? samples[index] : null;
  		},
  sample:function () {
  			const pads = GodotInputGamepads.get_pads();
  			const samples = [];
  			for (let i = 0; i < pads.length; i++) {
  				const pad = pads[i];
  				if (!pad) {
  					samples.push(null);
  					continue;
  				}
  				const s = {
  					standard: pad.mapping === 'standard',
  					buttons: [],
  					axes: [],
  					connected: pad.connected,
  				};
  				for (let b = 0; b < pad.buttons.length; b++) {
  					s.buttons.push(pad.buttons[b].value);
  				}
  				for (let a = 0; a < pad.axes.length; a++) {
  					s.axes.push(pad.axes[a]);
  				}
  				samples.push(s);
  			}
  			GodotInputGamepads.samples = samples;
  		},
  init:function (onchange) {
  			GodotInputGamepads.samples = [];
  			function add(pad) {
  				const guid = GodotInputGamepads.get_guid(pad);
  				const c_id = GodotRuntime.allocString(pad.id);
  				const c_guid = GodotRuntime.allocString(guid);
  				onchange(pad.index, 1, c_id, c_guid);
  				GodotRuntime.free(c_id);
  				GodotRuntime.free(c_guid);
  			}
  			const pads = GodotInputGamepads.get_pads();
  			for (let i = 0; i < pads.length; i++) {
  				// Might be reserved space.
  				if (pads[i]) {
  					add(pads[i]);
  				}
  			}
  			GodotEventListeners.add(window, 'gamepadconnected', function (evt) {
  				if (evt.gamepad) {
  					add(evt.gamepad);
  				}
  			}, false);
  			GodotEventListeners.add(window, 'gamepaddisconnected', function (evt) {
  				if (evt.gamepad) {
  					onchange(evt.gamepad.index, 0);
  				}
  			}, false);
  		},
  get_guid:function (pad) {
  			if (pad.mapping) {
  				return pad.mapping;
  			}
  			const ua = navigator.userAgent;
  			let os = 'Unknown';
  			if (ua.indexOf('Android') >= 0) {
  				os = 'Android';
  			} else if (ua.indexOf('Linux') >= 0) {
  				os = 'Linux';
  			} else if (ua.indexOf('iPhone') >= 0) {
  				os = 'iOS';
  			} else if (ua.indexOf('Macintosh') >= 0) {
  				// Updated iPads will fall into this category.
  				os = 'MacOSX';
  			} else if (ua.indexOf('Windows') >= 0) {
  				os = 'Windows';
  			}
  
  			const id = pad.id;
  			// Chrom* style: NAME (Vendor: xxxx Product: xxxx).
  			const exp1 = /vendor: ([0-9a-f]{4}) product: ([0-9a-f]{4})/i;
  			// Firefox/Safari style (Safari may remove leading zeroes).
  			const exp2 = /^([0-9a-f]+)-([0-9a-f]+)-/i;
  			let vendor = '';
  			let product = '';
  			if (exp1.test(id)) {
  				const match = exp1.exec(id);
  				vendor = match[1].padStart(4, '0');
  				product = match[2].padStart(4, '0');
  			} else if (exp2.test(id)) {
  				const match = exp2.exec(id);
  				vendor = match[1].padStart(4, '0');
  				product = match[2].padStart(4, '0');
  			}
  			if (!vendor || !product) {
  				return `${os}Unknown`;
  			}
  			return os + vendor + product;
  		},
  };
  
  
  var GodotInputDragDrop = {
  promises:[],
  pending_files:[],
  add_entry:function (entry) {
  			if (entry.isDirectory) {
  				GodotInputDragDrop.add_dir(entry);
  			} else if (entry.isFile) {
  				GodotInputDragDrop.add_file(entry);
  			} else {
  				GodotRuntime.error('Unrecognized entry...', entry);
  			}
  		},
  add_dir:function (entry) {
  			GodotInputDragDrop.promises.push(new Promise(function (resolve, reject) {
  				const reader = entry.createReader();
  				reader.readEntries(function (entries) {
  					for (let i = 0; i < entries.length; i++) {
  						GodotInputDragDrop.add_entry(entries[i]);
  					}
  					resolve();
  				});
  			}));
  		},
  add_file:function (entry) {
  			GodotInputDragDrop.promises.push(new Promise(function (resolve, reject) {
  				entry.file(function (file) {
  					const reader = new FileReader();
  					reader.onload = function () {
  						const f = {
  							'path': file.relativePath || file.webkitRelativePath,
  							'name': file.name,
  							'type': file.type,
  							'size': file.size,
  							'data': reader.result,
  						};
  						if (!f['path']) {
  							f['path'] = f['name'];
  						}
  						GodotInputDragDrop.pending_files.push(f);
  						resolve();
  					};
  					reader.onerror = function () {
  						GodotRuntime.print('Error reading file');
  						reject();
  					};
  					reader.readAsArrayBuffer(file);
  				}, function (err) {
  					GodotRuntime.print('Error!');
  					reject();
  				});
  			}));
  		},
  process:function (resolve, reject) {
  			if (GodotInputDragDrop.promises.length === 0) {
  				resolve();
  				return;
  			}
  			GodotInputDragDrop.promises.pop().then(function () {
  				setTimeout(function () {
  					GodotInputDragDrop.process(resolve, reject);
  				}, 0);
  			});
  		},
  _process_event:function (ev, callback) {
  			ev.preventDefault();
  			if (ev.dataTransfer.items) {
  				// Use DataTransferItemList interface to access the file(s)
  				for (let i = 0; i < ev.dataTransfer.items.length; i++) {
  					const item = ev.dataTransfer.items[i];
  					let entry = null;
  					if ('getAsEntry' in item) {
  						entry = item.getAsEntry();
  					} else if ('webkitGetAsEntry' in item) {
  						entry = item.webkitGetAsEntry();
  					}
  					if (entry) {
  						GodotInputDragDrop.add_entry(entry);
  					}
  				}
  			} else {
  				GodotRuntime.error('File upload not supported');
  			}
  			new Promise(GodotInputDragDrop.process).then(function () {
  				const DROP = `/tmp/drop-${parseInt(Math.random() * (1 << 30), 10)}/`;
  				const drops = [];
  				const files = [];
  				FS.mkdir(DROP.slice(0, -1)); // Without trailing slash
  				GodotInputDragDrop.pending_files.forEach((elem) => {
  					const path = elem['path'];
  					GodotFS.copy_to_fs(DROP + path, elem['data']);
  					let idx = path.indexOf('/');
  					if (idx === -1) {
  						// Root file
  						drops.push(DROP + path);
  					} else {
  						// Subdir
  						const sub = path.substr(0, idx);
  						idx = sub.indexOf('/');
  						if (idx < 0 && drops.indexOf(DROP + sub) === -1) {
  							drops.push(DROP + sub);
  						}
  					}
  					files.push(DROP + path);
  				});
  				GodotInputDragDrop.promises = [];
  				GodotInputDragDrop.pending_files = [];
  				callback(drops);
  				if (GodotConfig.persistent_drops) {
  					// Delay removal at exit.
  					GodotOS.atexit(function (resolve, reject) {
  						GodotInputDragDrop.remove_drop(files, DROP);
  						resolve();
  					});
  				} else {
  					GodotInputDragDrop.remove_drop(files, DROP);
  				}
  			});
  		},
  remove_drop:function (files, drop_path) {
  			const dirs = [drop_path.substr(0, drop_path.length - 1)];
  			// Remove temporary files
  			files.forEach(function (file) {
  				FS.unlink(file);
  				let dir = file.replace(drop_path, '');
  				let idx = dir.lastIndexOf('/');
  				while (idx > 0) {
  					dir = dir.substr(0, idx);
  					if (dirs.indexOf(drop_path + dir) === -1) {
  						dirs.push(drop_path + dir);
  					}
  					idx = dir.lastIndexOf('/');
  				}
  			});
  			// Remove dirs.
  			dirs.sort(function (a, b) {
  				const al = (a.match(/\//g) || []).length;
  				const bl = (b.match(/\//g) || []).length;
  				if (al > bl) {
  					return -1;
  				} else if (al < bl) {
  					return 1;
  				}
  				return 0;
  			}).forEach(function (dir) {
  				FS.rmdir(dir);
  			});
  		},
  handler:function (callback) {
  			return function (ev) {
  				GodotInputDragDrop._process_event(ev, callback);
  			};
  		},
  };
  
  var GodotInput = {
  getModifiers:function (evt) {
  			return (evt.shiftKey + 0) + ((evt.altKey + 0) << 1) + ((evt.ctrlKey + 0) << 2) + ((evt.metaKey + 0) << 3);
  		},
  computePosition:function (evt, rect) {
  			const canvas = GodotConfig.canvas;
  			const rw = canvas.width / rect.width;
  			const rh = canvas.height / rect.height;
  			const x = (evt.clientX - rect.x) * rw;
  			const y = (evt.clientY - rect.y) * rh;
  			return [x, y];
  		},
  };
  function _godot_js_input_drop_files_cb(callback) {
  		const func = GodotRuntime.get_func(callback);
  		const dropFiles = function (files) {
  			const args = files || [];
  			if (!args.length) {
  				return;
  			}
  			const argc = args.length;
  			const argv = GodotRuntime.allocStringArray(args);
  			func(argv, argc);
  			GodotRuntime.freeStringArray(argv, argc);
  		};
  		const canvas = GodotConfig.canvas;
  		GodotEventListeners.add(canvas, 'dragover', function (ev) {
  			// Prevent default behavior (which would try to open the file(s))
  			ev.preventDefault();
  		}, false);
  		GodotEventListeners.add(canvas, 'drop', GodotInputDragDrop.handler(dropFiles));
  	}

  function _godot_js_input_gamepad_cb(change_cb) {
  		const onchange = GodotRuntime.get_func(change_cb);
  		GodotInputGamepads.init(onchange);
  	}

  function _godot_js_input_gamepad_sample() {
  		GodotInputGamepads.sample();
  		return 0;
  	}

  function _godot_js_input_gamepad_sample_count() {
  		return GodotInputGamepads.get_samples().length;
  	}

  function _godot_js_input_gamepad_sample_get(p_index, r_btns, r_btns_num, r_axes, r_axes_num, r_standard) {
  		const sample = GodotInputGamepads.get_sample(p_index);
  		if (!sample || !sample.connected) {
  			return 1;
  		}
  		const btns = sample.buttons;
  		const btns_len = btns.length < 16 ? btns.length : 16;
  		for (let i = 0; i < btns_len; i++) {
  			GodotRuntime.setHeapValue(r_btns + (i << 2), btns[i], 'float');
  		}
  		GodotRuntime.setHeapValue(r_btns_num, btns_len, 'i32');
  		const axes = sample.axes;
  		const axes_len = axes.length < 10 ? axes.length : 10;
  		for (let i = 0; i < axes_len; i++) {
  			GodotRuntime.setHeapValue(r_axes + (i << 2), axes[i], 'float');
  		}
  		GodotRuntime.setHeapValue(r_axes_num, axes_len, 'i32');
  		const is_standard = sample.standard ? 1 : 0;
  		GodotRuntime.setHeapValue(r_standard, is_standard, 'i32');
  		return 0;
  	}

  function _godot_js_input_key_cb(callback, code, key) {
  		const func = GodotRuntime.get_func(callback);
  		function key_cb(pressed, evt) {
  			const modifiers = GodotInput.getModifiers(evt);
  			GodotRuntime.stringToHeap(evt.code, code, 32);
  			GodotRuntime.stringToHeap(evt.key, key, 32);
  			func(pressed, evt.repeat, modifiers);
  			evt.preventDefault();
  		}
  		GodotEventListeners.add(GodotConfig.canvas, 'keydown', key_cb.bind(null, 1), false);
  		GodotEventListeners.add(GodotConfig.canvas, 'keyup', key_cb.bind(null, 0), false);
  	}

  function _godot_js_input_mouse_button_cb(callback) {
  		const func = GodotRuntime.get_func(callback);
  		const canvas = GodotConfig.canvas;
  		function button_cb(p_pressed, evt) {
  			const rect = canvas.getBoundingClientRect();
  			const pos = GodotInput.computePosition(evt, rect);
  			const modifiers = GodotInput.getModifiers(evt);
  			// Since the event is consumed, focus manually.
  			// NOTE: The iframe container may not have focus yet, so focus even when already active.
  			if (p_pressed) {
  				GodotConfig.canvas.focus();
  			}
  			if (func(p_pressed, evt.button, pos[0], pos[1], modifiers)) {
  				evt.preventDefault();
  			}
  		}
  		GodotEventListeners.add(canvas, 'mousedown', button_cb.bind(null, 1), false);
  		GodotEventListeners.add(window, 'mouseup', button_cb.bind(null, 0), false);
  	}

  function _godot_js_input_mouse_move_cb(callback) {
  		const func = GodotRuntime.get_func(callback);
  		const canvas = GodotConfig.canvas;
  		function move_cb(evt) {
  			const rect = canvas.getBoundingClientRect();
  			const pos = GodotInput.computePosition(evt, rect);
  			// Scale movement
  			const rw = canvas.width / rect.width;
  			const rh = canvas.height / rect.height;
  			const rel_pos_x = evt.movementX * rw;
  			const rel_pos_y = evt.movementY * rh;
  			const modifiers = GodotInput.getModifiers(evt);
  			func(pos[0], pos[1], rel_pos_x, rel_pos_y, modifiers);
  		}
  		GodotEventListeners.add(window, 'mousemove', move_cb, false);
  	}

  function _godot_js_input_mouse_wheel_cb(callback) {
  		const func = GodotRuntime.get_func(callback);
  		function wheel_cb(evt) {
  			if (func(evt['deltaX'] || 0, evt['deltaY'] || 0)) {
  				evt.preventDefault();
  			}
  		}
  		GodotEventListeners.add(GodotConfig.canvas, 'wheel', wheel_cb, false);
  	}

  function _godot_js_input_paste_cb(callback) {
  		const func = GodotRuntime.get_func(callback);
  		GodotEventListeners.add(window, 'paste', function (evt) {
  			const text = evt.clipboardData.getData('text');
  			const ptr = GodotRuntime.allocString(text);
  			func(ptr);
  			GodotRuntime.free(ptr);
  		}, false);
  	}

  function _godot_js_input_touch_cb(callback, ids, coords) {
  		const func = GodotRuntime.get_func(callback);
  		const canvas = GodotConfig.canvas;
  		function touch_cb(type, evt) {
  			// Since the event is consumed, focus manually.
  			// NOTE: The iframe container may not have focus yet, so focus even when already active.
  			if (type === 0) {
  				GodotConfig.canvas.focus();
  			}
  			const rect = canvas.getBoundingClientRect();
  			const touches = evt.changedTouches;
  			for (let i = 0; i < touches.length; i++) {
  				const touch = touches[i];
  				const pos = GodotInput.computePosition(touch, rect);
  				GodotRuntime.setHeapValue(coords + (i * 2) * 8, pos[0], 'double');
  				GodotRuntime.setHeapValue(coords + (i * 2 + 1) * 8, pos[1], 'double');
  				GodotRuntime.setHeapValue(ids + i * 4, touch.identifier, 'i32');
  			}
  			func(type, touches.length);
  			if (evt.cancelable) {
  				evt.preventDefault();
  			}
  		}
  		GodotEventListeners.add(canvas, 'touchstart', touch_cb.bind(null, 0), false);
  		GodotEventListeners.add(canvas, 'touchend', touch_cb.bind(null, 1), false);
  		GodotEventListeners.add(canvas, 'touchcancel', touch_cb.bind(null, 1), false);
  		GodotEventListeners.add(canvas, 'touchmove', touch_cb.bind(null, 2), false);
  	}

  function _godot_js_input_vibrate_handheld(p_duration_ms) {
  		if (typeof navigator.vibrate !== 'function') {
  			GodotRuntime.print('This browser does not support vibration.');
  		} else {
  			navigator.vibrate(p_duration_ms);
  		}
  	}

  function _godot_js_os_download_buffer(p_ptr, p_size, p_name, p_mime) {
  		const buf = GodotRuntime.heapSlice(HEAP8, p_ptr, p_size);
  		const name = GodotRuntime.parseString(p_name);
  		const mime = GodotRuntime.parseString(p_mime);
  		const blob = new Blob([buf], { type: mime });
  		const url = window.URL.createObjectURL(blob);
  		const a = document.createElement('a');
  		a.href = url;
  		a.download = name;
  		a.style.display = 'none';
  		document.body.appendChild(a);
  		a.click();
  		a.remove();
  		window.URL.revokeObjectURL(url);
  	}

  function _godot_js_os_execute(p_json) {
  		const json_args = GodotRuntime.parseString(p_json);
  		const args = JSON.parse(json_args);
  		if (GodotConfig.on_execute) {
  			GodotConfig.on_execute(args);
  			return 0;
  		}
  		return 1;
  	}

  function _godot_js_os_finish_async(p_callback) {
  		const func = GodotRuntime.get_func(p_callback);
  		GodotOS.finish_async(func);
  	}

  function _godot_js_os_fs_is_persistent() {
  		return GodotFS.is_persistent();
  	}

  function _godot_js_os_fs_sync(callback) {
  		const func = GodotRuntime.get_func(callback);
  		GodotOS._fs_sync_promise = GodotFS.sync();
  		GodotOS._fs_sync_promise.then(function (err) {
  			func();
  		});
  	}

  function _godot_js_os_has_feature(p_ftr) {
  		const ftr = GodotRuntime.parseString(p_ftr);
  		const ua = navigator.userAgent;
  		if (ftr === 'web_macos') {
  			return (ua.indexOf('Mac') !== -1) ? 1 : 0;
  		}
  		if (ftr === 'web_windows') {
  			return (ua.indexOf('Windows') !== -1) ? 1 : 0;
  		}
  		if (ftr === 'web_android') {
  			return (ua.indexOf('Android') !== -1) ? 1 : 0;
  		}
  		if (ftr === 'web_ios') {
  			return ((ua.indexOf('iPhone') !== -1) || (ua.indexOf('iPad') !== -1) || (ua.indexOf('iPod') !== -1)) ? 1 : 0;
  		}
  		if (ftr === 'web_linuxbsd') {
  			return ((ua.indexOf('CrOS') !== -1) || (ua.indexOf('BSD') !== -1) || (ua.indexOf('Linux') !== -1) || (ua.indexOf('X11') !== -1)) ? 1 : 0;
  		}
  		return 0;
  	}

  function _godot_js_os_hw_concurrency_get() {
  		// TODO Godot core needs fixing to avoid spawning too many threads (> 24).
  		const concurrency = navigator.hardwareConcurrency || 1;
  		return concurrency < 2 ? concurrency : 2;
  	}

  function _godot_js_os_request_quit_cb(p_callback) {
  		GodotOS.request_quit = GodotRuntime.get_func(p_callback);
  	}

  function _godot_js_os_shell_open(p_uri) {
  		window.open(GodotRuntime.parseString(p_uri), '_blank');
  	}

  
  
  var GodotPWA = {
  hasUpdate:false,
  updateState:function (cb, reg) {
  			if (!reg) {
  				return;
  			}
  			if (!reg.active) {
  				return;
  			}
  			if (reg.waiting) {
  				GodotPWA.hasUpdate = true;
  				cb();
  			}
  			GodotEventListeners.add(reg, 'updatefound', function () {
  				const installing = reg.installing;
  				GodotEventListeners.add(installing, 'statechange', function () {
  					if (installing.state === 'installed') {
  						GodotPWA.hasUpdate = true;
  						cb();
  					}
  				});
  			});
  		},
  };
  function _godot_js_pwa_cb(p_update_cb) {
  		if ('serviceWorker' in navigator) {
  			const cb = GodotRuntime.get_func(p_update_cb);
  			navigator.serviceWorker.getRegistration().then(GodotPWA.updateState.bind(null, cb));
  		}
  	}

  function _godot_js_pwa_update() {
  		if ('serviceWorker' in navigator && GodotPWA.hasUpdate) {
  			navigator.serviceWorker.getRegistration().then(function (reg) {
  				if (!reg || !reg.waiting) {
  					return;
  				}
  				reg.waiting.postMessage('update');
  			});
  			return 0;
  		}
  		return 1;
  	}

  
  
  var GodotRTCDataChannel = {
  connect:function (p_id, p_on_open, p_on_message, p_on_error, p_on_close) {
  			const ref = IDHandler.get(p_id);
  			if (!ref) {
  				return;
  			}
  
  			ref.binaryType = 'arraybuffer';
  			ref.onopen = function (event) {
  				p_on_open();
  			};
  			ref.onclose = function (event) {
  				p_on_close();
  			};
  			ref.onerror = function (event) {
  				p_on_error();
  			};
  			ref.onmessage = function (event) {
  				let buffer;
  				let is_string = 0;
  				if (event.data instanceof ArrayBuffer) {
  					buffer = new Uint8Array(event.data);
  				} else if (event.data instanceof Blob) {
  					GodotRuntime.error('Blob type not supported');
  					return;
  				} else if (typeof event.data === 'string') {
  					is_string = 1;
  					const enc = new TextEncoder('utf-8');
  					buffer = new Uint8Array(enc.encode(event.data));
  				} else {
  					GodotRuntime.error('Unknown message type');
  					return;
  				}
  				const len = buffer.length * buffer.BYTES_PER_ELEMENT;
  				const out = GodotRuntime.malloc(len);
  				HEAPU8.set(buffer, out);
  				p_on_message(out, len, is_string);
  				GodotRuntime.free(out);
  			};
  		},
  close:function (p_id) {
  			const ref = IDHandler.get(p_id);
  			if (!ref) {
  				return;
  			}
  			ref.onopen = null;
  			ref.onmessage = null;
  			ref.onerror = null;
  			ref.onclose = null;
  			ref.close();
  		},
  get_prop:function (p_id, p_prop, p_def) {
  			const ref = IDHandler.get(p_id);
  			return (ref && ref[p_prop] !== undefined) ? ref[p_prop] : p_def;
  		},
  };
  function _godot_js_rtc_datachannel_close(p_id) {
  		const ref = IDHandler.get(p_id);
  		if (!ref) {
  			return;
  		}
  		GodotRTCDataChannel.close(p_id);
  	}

  function _godot_js_rtc_datachannel_connect(p_id, p_ref, p_on_open, p_on_message, p_on_error, p_on_close) {
  		const onopen = GodotRuntime.get_func(p_on_open).bind(null, p_ref);
  		const onmessage = GodotRuntime.get_func(p_on_message).bind(null, p_ref);
  		const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_ref);
  		const onclose = GodotRuntime.get_func(p_on_close).bind(null, p_ref);
  		GodotRTCDataChannel.connect(p_id, onopen, onmessage, onerror, onclose);
  	}

  function _godot_js_rtc_datachannel_destroy(p_id) {
  		GodotRTCDataChannel.close(p_id);
  		IDHandler.remove(p_id);
  	}

  function _godot_js_rtc_datachannel_get_buffered_amount(p_id) {
  		return GodotRTCDataChannel.get_prop(p_id, 'bufferedAmount', 0);
  	}

  function _godot_js_rtc_datachannel_id_get(p_id) {
  		return GodotRTCDataChannel.get_prop(p_id, 'id', 65535);
  	}

  function _godot_js_rtc_datachannel_is_negotiated(p_id) {
  		return GodotRTCDataChannel.get_prop(p_id, 'negotiated', 65535);
  	}

  function _godot_js_rtc_datachannel_is_ordered(p_id) {
  		return GodotRTCDataChannel.get_prop(p_id, 'ordered', true);
  	}

  function _godot_js_rtc_datachannel_label_get(p_id) {
  		const ref = IDHandler.get(p_id);
  		if (!ref || !ref.label) {
  			return 0;
  		}
  		return GodotRuntime.allocString(ref.label);
  	}

  function _godot_js_rtc_datachannel_max_packet_lifetime_get(p_id) {
  		const ref = IDHandler.get(p_id);
  		if (!ref) {
  			return 65535;
  		}
  		if (ref['maxPacketLifeTime'] !== undefined) {
  			return ref['maxPacketLifeTime'];
  		} else if (ref['maxRetransmitTime'] !== undefined) {
  			// Guess someone didn't appreciate the standardization process.
  			return ref['maxRetransmitTime'];
  		}
  		return 65535;
  	}

  function _godot_js_rtc_datachannel_max_retransmits_get(p_id) {
  		return GodotRTCDataChannel.get_prop(p_id, 'maxRetransmits', 65535);
  	}

  function _godot_js_rtc_datachannel_protocol_get(p_id) {
  		const ref = IDHandler.get(p_id);
  		if (!ref || !ref.protocol) {
  			return 0;
  		}
  		return GodotRuntime.allocString(ref.protocol);
  	}

  function _godot_js_rtc_datachannel_ready_state_get(p_id) {
  		const ref = IDHandler.get(p_id);
  		if (!ref) {
  			return 3; // CLOSED
  		}
  
  		switch (ref.readyState) {
  		case 'connecting':
  			return 0;
  		case 'open':
  			return 1;
  		case 'closing':
  			return 2;
  		case 'closed':
  		default:
  			return 3;
  		}
  	}

  function _godot_js_rtc_datachannel_send(p_id, p_buffer, p_length, p_raw) {
  		const ref = IDHandler.get(p_id);
  		if (!ref) {
  			return 1;
  		}
  
  		const bytes_array = new Uint8Array(p_length);
  		for (let i = 0; i < p_length; i++) {
  			bytes_array[i] = GodotRuntime.getHeapValue(p_buffer + i, 'i8');
  		}
  
  		if (p_raw) {
  			ref.send(bytes_array.buffer);
  		} else {
  			const string = new TextDecoder('utf-8').decode(bytes_array);
  			ref.send(string);
  		}
  		return 0;
  	}

  
  
  
  var GodotRTCPeerConnection = {
  ConnectionState:{
  new:0,
  connecting:1,
  connected:2,
  disconnected:3,
  failed:4,
  closed:5,
  },
  ConnectionStateCompat:{
  new:0,
  checking:1,
  connected:2,
  completed:2,
  disconnected:3,
  failed:4,
  closed:5,
  },
  IceGatheringState:{
  new:0,
  gathering:1,
  complete:2,
  },
  SignalingState:{
  stable:0,
  'have-local-offer':1,
  'have-remote-offer':2,
  'have-local-pranswer':3,
  'have-remote-pranswer':4,
  closed:5,
  },
  create:function (config, onConnectionChange, onSignalingChange, onIceGatheringChange, onIceCandidate, onDataChannel) {
  			let conn = null;
  			try {
  				conn = new RTCPeerConnection(config);
  			} catch (e) {
  				GodotRuntime.error(e);
  				return 0;
  			}
  
  			const id = IDHandler.add(conn);
  
  			if ('connectionState' in conn && conn['connectionState'] !== undefined) {
  				// Use "connectionState" if supported
  				conn.onconnectionstatechange = function (event) {
  					if (!IDHandler.get(id)) {
  						return;
  					}
  					onConnectionChange(GodotRTCPeerConnection.ConnectionState[conn.connectionState] || 0);
  				};
  			} else {
  				// Fall back to using "iceConnectionState" when "connectionState" is not supported (notably Firefox).
  				conn.oniceconnectionstatechange = function (event) {
  					if (!IDHandler.get(id)) {
  						return;
  					}
  					onConnectionChange(GodotRTCPeerConnection.ConnectionStateCompat[conn.iceConnectionState] || 0);
  				};
  			}
  			conn.onicegatheringstatechange = function (event) {
  				if (!IDHandler.get(id)) {
  					return;
  				}
  				onIceGatheringChange(GodotRTCPeerConnection.IceGatheringState[conn.iceGatheringState] || 0);
  			};
  			conn.onsignalingstatechange = function (event) {
  				if (!IDHandler.get(id)) {
  					return;
  				}
  				onSignalingChange(GodotRTCPeerConnection.SignalingState[conn.signalingState] || 0);
  			};
  			conn.onicecandidate = function (event) {
  				if (!IDHandler.get(id)) {
  					return;
  				}
  				const c = event.candidate;
  				if (!c || !c.candidate) {
  					return;
  				}
  				const candidate_str = GodotRuntime.allocString(c.candidate);
  				const mid_str = GodotRuntime.allocString(c.sdpMid);
  				onIceCandidate(mid_str, c.sdpMLineIndex, candidate_str);
  				GodotRuntime.free(candidate_str);
  				GodotRuntime.free(mid_str);
  			};
  			conn.ondatachannel = function (event) {
  				if (!IDHandler.get(id)) {
  					return;
  				}
  				const cid = IDHandler.add(event.channel);
  				onDataChannel(cid);
  			};
  			return id;
  		},
  destroy:function (p_id) {
  			const conn = IDHandler.get(p_id);
  			if (!conn) {
  				return;
  			}
  			conn.onconnectionstatechange = null;
  			conn.oniceconnectionstatechange = null;
  			conn.onicegatheringstatechange = null;
  			conn.onsignalingstatechange = null;
  			conn.onicecandidate = null;
  			conn.ondatachannel = null;
  			IDHandler.remove(p_id);
  		},
  onsession:function (p_id, callback, session) {
  			if (!IDHandler.get(p_id)) {
  				return;
  			}
  			const type_str = GodotRuntime.allocString(session.type);
  			const sdp_str = GodotRuntime.allocString(session.sdp);
  			callback(type_str, sdp_str);
  			GodotRuntime.free(type_str);
  			GodotRuntime.free(sdp_str);
  		},
  onerror:function (p_id, callback, error) {
  			const ref = IDHandler.get(p_id);
  			if (!ref) {
  				return;
  			}
  			GodotRuntime.error(error);
  			callback();
  		},
  };
  function _godot_js_rtc_pc_close(p_id) {
  		const ref = IDHandler.get(p_id);
  		if (!ref) {
  			return;
  		}
  		ref.close();
  	}

  function _godot_js_rtc_pc_create(p_config, p_ref, p_on_connection_state_change, p_on_ice_gathering_state_change, p_on_signaling_state_change, p_on_ice_candidate, p_on_datachannel) {
  		const wrap = function (p_func) {
  			return GodotRuntime.get_func(p_func).bind(null, p_ref);
  		};
  		return GodotRTCPeerConnection.create(
  			JSON.parse(GodotRuntime.parseString(p_config)),
  			wrap(p_on_connection_state_change),
  			wrap(p_on_signaling_state_change),
  			wrap(p_on_ice_gathering_state_change),
  			wrap(p_on_ice_candidate),
  			wrap(p_on_datachannel)
  		);
  	}

  
  function _godot_js_rtc_pc_datachannel_create(p_id, p_label, p_config) {
  		try {
  			const ref = IDHandler.get(p_id);
  			if (!ref) {
  				return 0;
  			}
  
  			const label = GodotRuntime.parseString(p_label);
  			const config = JSON.parse(GodotRuntime.parseString(p_config));
  
  			const channel = ref.createDataChannel(label, config);
  			return IDHandler.add(channel);
  		} catch (e) {
  			GodotRuntime.error(e);
  			return 0;
  		}
  	}

  function _godot_js_rtc_pc_destroy(p_id) {
  		GodotRTCPeerConnection.destroy(p_id);
  	}

  function _godot_js_rtc_pc_ice_candidate_add(p_id, p_mid_name, p_mline_idx, p_sdp) {
  		const ref = IDHandler.get(p_id);
  		if (!ref) {
  			return;
  		}
  		const sdpMidName = GodotRuntime.parseString(p_mid_name);
  		const sdpName = GodotRuntime.parseString(p_sdp);
  		ref.addIceCandidate(new RTCIceCandidate({
  			'candidate': sdpName,
  			'sdpMid': sdpMidName,
  			'sdpMlineIndex': p_mline_idx,
  		}));
  	}

  function _godot_js_rtc_pc_local_description_set(p_id, p_type, p_sdp, p_obj, p_on_error) {
  		const ref = IDHandler.get(p_id);
  		if (!ref) {
  			return;
  		}
  		const type = GodotRuntime.parseString(p_type);
  		const sdp = GodotRuntime.parseString(p_sdp);
  		const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj);
  		ref.setLocalDescription({
  			'sdp': sdp,
  			'type': type,
  		}).catch(function (error) {
  			GodotRTCPeerConnection.onerror(p_id, onerror, error);
  		});
  	}

  function _godot_js_rtc_pc_offer_create(p_id, p_obj, p_on_session, p_on_error) {
  		const ref = IDHandler.get(p_id);
  		if (!ref) {
  			return;
  		}
  		const onsession = GodotRuntime.get_func(p_on_session).bind(null, p_obj);
  		const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj);
  		ref.createOffer().then(function (session) {
  			GodotRTCPeerConnection.onsession(p_id, onsession, session);
  		}).catch(function (error) {
  			GodotRTCPeerConnection.onerror(p_id, onerror, error);
  		});
  	}

  function _godot_js_rtc_pc_remote_description_set(p_id, p_type, p_sdp, p_obj, p_session_created, p_on_error) {
  		const ref = IDHandler.get(p_id);
  		if (!ref) {
  			return;
  		}
  		const type = GodotRuntime.parseString(p_type);
  		const sdp = GodotRuntime.parseString(p_sdp);
  		const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj);
  		const onsession = GodotRuntime.get_func(p_session_created).bind(null, p_obj);
  		ref.setRemoteDescription({
  			'sdp': sdp,
  			'type': type,
  		}).then(function () {
  			if (type !== 'offer') {
  				return Promise.resolve();
  			}
  			return ref.createAnswer().then(function (session) {
  				GodotRTCPeerConnection.onsession(p_id, onsession, session);
  			});
  		}).catch(function (error) {
  			GodotRTCPeerConnection.onerror(p_id, onerror, error);
  		});
  	}

  function _godot_js_tts_get_voices(p_callback) {
  		const func = GodotRuntime.get_func(p_callback);
  		try {
  			const arr = [];
  			const voices = window.speechSynthesis.getVoices();
  			for (let i = 0; i < voices.length; i++) {
  				arr.push(`${voices[i].lang};${voices[i].name}`);
  			}
  			const c_ptr = GodotRuntime.allocStringArray(arr);
  			func(arr.length, c_ptr);
  			GodotRuntime.freeStringArray(c_ptr, arr.length);
  		} catch (e) {
  			// Fail graciously.
  		}
  	}

  function _godot_js_tts_is_paused() {
  		return window.speechSynthesis.paused;
  	}

  function _godot_js_tts_is_speaking() {
  		return window.speechSynthesis.speaking;
  	}

  function _godot_js_tts_pause() {
  		window.speechSynthesis.pause();
  	}

  function _godot_js_tts_resume() {
  		window.speechSynthesis.resume();
  	}

  function _godot_js_tts_speak(p_text, p_voice, p_volume, p_pitch, p_rate, p_utterance_id, p_callback) {
  		const func = GodotRuntime.get_func(p_callback);
  
  		function listener_end(evt) {
  			evt.currentTarget.cb(1 /*TTS_UTTERANCE_ENDED*/, evt.currentTarget.id, 0);
  		}
  
  		function listener_start(evt) {
  			evt.currentTarget.cb(0 /*TTS_UTTERANCE_STARTED*/, evt.currentTarget.id, 0);
  		}
  
  		function listener_error(evt) {
  			evt.currentTarget.cb(2 /*TTS_UTTERANCE_CANCELED*/, evt.currentTarget.id, 0);
  		}
  
  		function listener_bound(evt) {
  			evt.currentTarget.cb(3 /*TTS_UTTERANCE_BOUNDARY*/, evt.currentTarget.id, evt.charIndex);
  		}
  
  		const utterance = new SpeechSynthesisUtterance(GodotRuntime.parseString(p_text));
  		utterance.rate = p_rate;
  		utterance.pitch = p_pitch;
  		utterance.volume = p_volume / 100.0;
  		utterance.addEventListener('end', listener_end);
  		utterance.addEventListener('start', listener_start);
  		utterance.addEventListener('error', listener_error);
  		utterance.addEventListener('boundary', listener_bound);
  		utterance.id = p_utterance_id;
  		utterance.cb = func;
  		const voice = GodotRuntime.parseString(p_voice);
  		const voices = window.speechSynthesis.getVoices();
  		for (let i = 0; i < voices.length; i++) {
  			if (voices[i].name === voice) {
  				utterance.voice = voices[i];
  				break;
  			}
  		}
  		window.speechSynthesis.resume();
  		window.speechSynthesis.speak(utterance);
  	}

  function _godot_js_tts_stop() {
  		window.speechSynthesis.cancel();
  		window.speechSynthesis.resume();
  	}

  
  
  var GodotWebSocket = {
  _onopen:function (p_id, callback, event) {
  			const ref = IDHandler.get(p_id);
  			if (!ref) {
  				return; // Godot object is gone.
  			}
  			const c_str = GodotRuntime.allocString(ref.protocol);
  			callback(c_str);
  			GodotRuntime.free(c_str);
  		},
  _onmessage:function (p_id, callback, event) {
  			const ref = IDHandler.get(p_id);
  			if (!ref) {
  				return; // Godot object is gone.
  			}
  			let buffer;
  			let is_string = 0;
  			if (event.data instanceof ArrayBuffer) {
  				buffer = new Uint8Array(event.data);
  			} else if (event.data instanceof Blob) {
  				GodotRuntime.error('Blob type not supported');
  				return;
  			} else if (typeof event.data === 'string') {
  				is_string = 1;
  				const enc = new TextEncoder('utf-8');
  				buffer = new Uint8Array(enc.encode(event.data));
  			} else {
  				GodotRuntime.error('Unknown message type');
  				return;
  			}
  			const len = buffer.length * buffer.BYTES_PER_ELEMENT;
  			const out = GodotRuntime.malloc(len);
  			HEAPU8.set(buffer, out);
  			callback(out, len, is_string);
  			GodotRuntime.free(out);
  		},
  _onerror:function (p_id, callback, event) {
  			const ref = IDHandler.get(p_id);
  			if (!ref) {
  				return; // Godot object is gone.
  			}
  			callback();
  		},
  _onclose:function (p_id, callback, event) {
  			const ref = IDHandler.get(p_id);
  			if (!ref) {
  				return; // Godot object is gone.
  			}
  			const c_str = GodotRuntime.allocString(event.reason);
  			callback(event.code, c_str, event.wasClean ? 1 : 0);
  			GodotRuntime.free(c_str);
  		},
  send:function (p_id, p_data) {
  			const ref = IDHandler.get(p_id);
  			if (!ref || ref.readyState !== ref.OPEN) {
  				return 1; // Godot object is gone or socket is not in a ready state.
  			}
  			ref.send(p_data);
  			return 0;
  		},
  bufferedAmount:function (p_id) {
  			const ref = IDHandler.get(p_id);
  			if (!ref) {
  				return 0; // Godot object is gone.
  			}
  			return ref.bufferedAmount;
  		},
  create:function (socket, p_on_open, p_on_message, p_on_error, p_on_close) {
  			const id = IDHandler.add(socket);
  			socket.onopen = GodotWebSocket._onopen.bind(null, id, p_on_open);
  			socket.onmessage = GodotWebSocket._onmessage.bind(null, id, p_on_message);
  			socket.onerror = GodotWebSocket._onerror.bind(null, id, p_on_error);
  			socket.onclose = GodotWebSocket._onclose.bind(null, id, p_on_close);
  			return id;
  		},
  close:function (p_id, p_code, p_reason) {
  			const ref = IDHandler.get(p_id);
  			if (ref && ref.readyState < ref.CLOSING) {
  				const code = p_code;
  				const reason = p_reason;
  				ref.close(code, reason);
  			}
  		},
  destroy:function (p_id) {
  			const ref = IDHandler.get(p_id);
  			if (!ref) {
  				return;
  			}
  			GodotWebSocket.close(p_id, 3001, 'destroyed');
  			IDHandler.remove(p_id);
  			ref.onopen = null;
  			ref.onmessage = null;
  			ref.onerror = null;
  			ref.onclose = null;
  		},
  };
  function _godot_js_websocket_buffered_amount(p_id) {
  		return GodotWebSocket.bufferedAmount(p_id);
  	}

  function _godot_js_websocket_close(p_id, p_code, p_reason) {
  		const code = p_code;
  		const reason = GodotRuntime.parseString(p_reason);
  		GodotWebSocket.close(p_id, code, reason);
  	}

  function _godot_js_websocket_create(p_ref, p_url, p_proto, p_on_open, p_on_message, p_on_error, p_on_close) {
  		const on_open = GodotRuntime.get_func(p_on_open).bind(null, p_ref);
  		const on_message = GodotRuntime.get_func(p_on_message).bind(null, p_ref);
  		const on_error = GodotRuntime.get_func(p_on_error).bind(null, p_ref);
  		const on_close = GodotRuntime.get_func(p_on_close).bind(null, p_ref);
  		const url = GodotRuntime.parseString(p_url);
  		const protos = GodotRuntime.parseString(p_proto);
  		let socket = null;
  		try {
  			if (protos) {
  				socket = new WebSocket(url, protos.split(','));
  			} else {
  				socket = new WebSocket(url);
  			}
  		} catch (e) {
  			return 0;
  		}
  		socket.binaryType = 'arraybuffer';
  		return GodotWebSocket.create(socket, on_open, on_message, on_error, on_close);
  	}

  function _godot_js_websocket_destroy(p_id) {
  		GodotWebSocket.destroy(p_id);
  	}

  function _godot_js_websocket_send(p_id, p_buf, p_buf_len, p_raw) {
  		const bytes_array = new Uint8Array(p_buf_len);
  		let i = 0;
  		for (i = 0; i < p_buf_len; i++) {
  			bytes_array[i] = GodotRuntime.getHeapValue(p_buf + i, 'i8');
  		}
  		let out = bytes_array.buffer;
  		if (!p_raw) {
  			out = new TextDecoder('utf-8').decode(bytes_array);
  		}
  		return GodotWebSocket.send(p_id, out);
  	}

  
  
  var GodotJSWrapper = {
  proxies:null,
  cb_ret:null,
  MyProxy:function (val) {
  			const id = IDHandler.add(this);
  			GodotJSWrapper.proxies.set(val, id);
  			let refs = 1;
  			this.ref = function () {
  				refs++;
  			};
  			this.unref = function () {
  				refs--;
  				if (refs === 0) {
  					IDHandler.remove(id);
  					GodotJSWrapper.proxies.delete(val);
  				}
  			};
  			this.get_val = function () {
  				return val;
  			};
  			this.get_id = function () {
  				return id;
  			};
  		},
  get_proxied:function (val) {
  			const id = GodotJSWrapper.proxies.get(val);
  			if (id === undefined) {
  				const proxy = new GodotJSWrapper.MyProxy(val);
  				return proxy.get_id();
  			}
  			IDHandler.get(id).ref();
  			return id;
  		},
  get_proxied_value:function (id) {
  			const proxy = IDHandler.get(id);
  			if (proxy === undefined) {
  				return undefined;
  			}
  			return proxy.get_val();
  		},
  variant2js:function (type, val) {
  			switch (type) {
  			case 0:
  				return null;
  			case 1:
  				return !!GodotRuntime.getHeapValue(val, 'i64');
  			case 2:
  				return GodotRuntime.getHeapValue(val, 'i64');
  			case 3:
  				return GodotRuntime.getHeapValue(val, 'double');
  			case 4:
  				return GodotRuntime.parseString(GodotRuntime.getHeapValue(val, '*'));
  			case 24: // OBJECT
  				return GodotJSWrapper.get_proxied_value(GodotRuntime.getHeapValue(val, 'i64'));
  			default:
  				return undefined;
  			}
  		},
  js2variant:function (p_val, p_exchange) {
  			if (p_val === undefined || p_val === null) {
  				return 0; // NIL
  			}
  			const type = typeof (p_val);
  			if (type === 'boolean') {
  				GodotRuntime.setHeapValue(p_exchange, p_val, 'i64');
  				return 1; // BOOL
  			} else if (type === 'number') {
  				if (Number.isInteger(p_val)) {
  					GodotRuntime.setHeapValue(p_exchange, p_val, 'i64');
  					return 2; // INT
  				}
  				GodotRuntime.setHeapValue(p_exchange, p_val, 'double');
  				return 3; // FLOAT
  			} else if (type === 'string') {
  				const c_str = GodotRuntime.allocString(p_val);
  				GodotRuntime.setHeapValue(p_exchange, c_str, '*');
  				return 4; // STRING
  			}
  			const id = GodotJSWrapper.get_proxied(p_val);
  			GodotRuntime.setHeapValue(p_exchange, id, 'i64');
  			return 24; // OBJECT
  		},
  };
  function _godot_js_wrapper_create_cb(p_ref, p_func) {
  		const func = GodotRuntime.get_func(p_func);
  		let id = 0;
  		const cb = function () {
  			if (!GodotJSWrapper.get_proxied_value(id)) {
  				return undefined;
  			}
  			// The callback will store the returned value in this variable via
  			// "godot_js_wrapper_object_set_cb_ret" upon calling the user function.
  			// This is safe! JavaScript is single threaded (and using it in threads is not a good idea anyway).
  			GodotJSWrapper.cb_ret = null;
  			const args = Array.from(arguments);
  			const argsProxy = new GodotJSWrapper.MyProxy(args);
  			func(p_ref, argsProxy.get_id(), args.length);
  			argsProxy.unref();
  			const ret = GodotJSWrapper.cb_ret;
  			GodotJSWrapper.cb_ret = null;
  			return ret;
  		};
  		id = GodotJSWrapper.get_proxied(cb);
  		return id;
  	}

  function _godot_js_wrapper_create_object(p_object, p_args, p_argc, p_convert_callback, p_exchange, p_lock, p_free_lock_callback) {
  		const name = GodotRuntime.parseString(p_object);
  		if (typeof (window[name]) === 'undefined') {
  			return -1;
  		}
  		const convert = GodotRuntime.get_func(p_convert_callback);
  		const freeLock = GodotRuntime.get_func(p_free_lock_callback);
  		const args = new Array(p_argc);
  		for (let i = 0; i < p_argc; i++) {
  			const type = convert(p_args, i, p_exchange, p_lock);
  			const lock = GodotRuntime.getHeapValue(p_lock, '*');
  			args[i] = GodotJSWrapper.variant2js(type, p_exchange);
  			if (lock) {
  				freeLock(p_lock, type);
  			}
  		}
  		try {
  			const res = new window[name](...args);
  			return GodotJSWrapper.js2variant(res, p_exchange);
  		} catch (e) {
  			GodotRuntime.error(`Error calling constructor ${name} with args:`, args, 'error:', e);
  			return -1;
  		}
  	}

  function _godot_js_wrapper_interface_get(p_name) {
  		const name = GodotRuntime.parseString(p_name);
  		if (typeof (window[name]) !== 'undefined') {
  			return GodotJSWrapper.get_proxied(window[name]);
  		}
  		return 0;
  	}

  function _godot_js_wrapper_object_call(p_id, p_method, p_args, p_argc, p_convert_callback, p_exchange, p_lock, p_free_lock_callback) {
  		const obj = GodotJSWrapper.get_proxied_value(p_id);
  		if (obj === undefined) {
  			return -1;
  		}
  		const method = GodotRuntime.parseString(p_method);
  		const convert = GodotRuntime.get_func(p_convert_callback);
  		const freeLock = GodotRuntime.get_func(p_free_lock_callback);
  		const args = new Array(p_argc);
  		for (let i = 0; i < p_argc; i++) {
  			const type = convert(p_args, i, p_exchange, p_lock);
  			const lock = GodotRuntime.getHeapValue(p_lock, '*');
  			args[i] = GodotJSWrapper.variant2js(type, p_exchange);
  			if (lock) {
  				freeLock(p_lock, type);
  			}
  		}
  		try {
  			const res = obj[method](...args);
  			return GodotJSWrapper.js2variant(res, p_exchange);
  		} catch (e) {
  			GodotRuntime.error(`Error calling method ${method} on:`, obj, 'error:', e);
  			return -1;
  		}
  	}

  function _godot_js_wrapper_object_get(p_id, p_exchange, p_prop) {
  		const obj = GodotJSWrapper.get_proxied_value(p_id);
  		if (obj === undefined) {
  			return 0;
  		}
  		if (p_prop) {
  			const prop = GodotRuntime.parseString(p_prop);
  			try {
  				return GodotJSWrapper.js2variant(obj[prop], p_exchange);
  			} catch (e) {
  				GodotRuntime.error(`Error getting variable ${prop} on object`, obj);
  				return 0; // NIL
  			}
  		}
  		return GodotJSWrapper.js2variant(obj, p_exchange);
  	}

  function _godot_js_wrapper_object_getvar(p_id, p_type, p_exchange) {
  		const obj = GodotJSWrapper.get_proxied_value(p_id);
  		if (obj === undefined) {
  			return -1;
  		}
  		const prop = GodotJSWrapper.variant2js(p_type, p_exchange);
  		if (prop === undefined || prop === null) {
  			return -1;
  		}
  		try {
  			return GodotJSWrapper.js2variant(obj[prop], p_exchange);
  		} catch (e) {
  			GodotRuntime.error(`Error getting variable ${prop} on object`, obj, e);
  			return -1;
  		}
  	}

  function _godot_js_wrapper_object_set(p_id, p_name, p_type, p_exchange) {
  		const obj = GodotJSWrapper.get_proxied_value(p_id);
  		if (obj === undefined) {
  			return;
  		}
  		const name = GodotRuntime.parseString(p_name);
  		try {
  			obj[name] = GodotJSWrapper.variant2js(p_type, p_exchange);
  		} catch (e) {
  			GodotRuntime.error(`Error setting variable ${name} on object`, obj);
  		}
  	}

  function _godot_js_wrapper_object_set_cb_ret(p_val_type, p_val_ex) {
  		GodotJSWrapper.cb_ret = GodotJSWrapper.variant2js(p_val_type, p_val_ex);
  	}

  function _godot_js_wrapper_object_setvar(p_id, p_key_type, p_key_ex, p_val_type, p_val_ex) {
  		const obj = GodotJSWrapper.get_proxied_value(p_id);
  		if (obj === undefined) {
  			return -1;
  		}
  		const key = GodotJSWrapper.variant2js(p_key_type, p_key_ex);
  		try {
  			obj[key] = GodotJSWrapper.variant2js(p_val_type, p_val_ex);
  			return 0;
  		} catch (e) {
  			GodotRuntime.error(`Error setting variable ${key} on object`, obj);
  			return -1;
  		}
  	}

  function _godot_js_wrapper_object_unref(p_id) {
  		const proxy = IDHandler.get(p_id);
  		if (proxy !== undefined) {
  			proxy.unref();
  		}
  	}

  
  
  
  var GodotWebGL2 = {
  };
  function _godot_webgl2_glFramebufferTextureMultiviewOVR(target, attachment, texture, level, base_view_index, num_views) {
  		const context = GL.currentContext;
  		if (typeof context.multiviewExt === 'undefined') {
  			const /** OVR_multiview2 */ ext = context.GLctx.getExtension('OVR_multiview2');
  			if (!ext) {
  				GodotRuntime.error('Trying to call glFramebufferTextureMultiviewOVR() without the OVR_multiview2 extension');
  				return;
  			}
  			context.multiviewExt = ext;
  		}
  		const /** OVR_multiview2 */ ext = context.multiviewExt;
  		ext.framebufferTextureMultiviewOVR(target, attachment, GL.textures[texture], level, base_view_index, num_views);
  	}

  
  
  function _godot_webgl2_glGetBufferSubData(target, offset, size, data) {
  		const gl_context_handle = _emscripten_webgl_get_current_context(); // eslint-disable-line no-undef
  		const gl = GL.getContext(gl_context_handle);
  		if (gl) {
  			gl.GLctx['getBufferSubData'](target, offset, HEAPU8, data, size);
  		}
  	}

  
  
  
  
  
  
  
  var GodotWebXR = {
  gl:null,
  session:null,
  gl_binding:null,
  layer:null,
  space:null,
  frame:null,
  pose:null,
  view_count:1,
  input_sources:[,,,,,,,,,,,,,,,],
  touches:[,,,,],
  onsimpleevent:null,
  orig_requestAnimationFrame:null,
  requestAnimationFrame:(callback) => {
  			if (GodotWebXR.session && GodotWebXR.space) {
  				const onFrame = function (time, frame) {
  					GodotWebXR.frame = frame;
  					GodotWebXR.pose = frame.getViewerPose(GodotWebXR.space);
  					callback(time);
  					GodotWebXR.frame = null;
  					GodotWebXR.pose = null;
  				};
  				GodotWebXR.session.requestAnimationFrame(onFrame);
  			} else {
  				GodotWebXR.orig_requestAnimationFrame(callback);
  			}
  		},
  monkeyPatchRequestAnimationFrame:(enable) => {
  			if (GodotWebXR.orig_requestAnimationFrame === null) {
  				GodotWebXR.orig_requestAnimationFrame = Browser.requestAnimationFrame;
  			}
  			Browser.requestAnimationFrame = enable
  				? GodotWebXR.requestAnimationFrame : GodotWebXR.orig_requestAnimationFrame;
  		},
  pauseResumeMainLoop:() => {
  			// Once both GodotWebXR.session and GodotWebXR.space are set or
  			// unset, our monkey-patched requestAnimationFrame() should be
  			// enabled or disabled. When using the WebXR API Emulator, this
  			// gets picked up automatically, however, in the Oculus Browser
  			// on the Quest, we need to pause and resume the main loop.
  			Browser.mainLoop.pause();
  			runtimeKeepalivePush(); // eslint-disable-line no-undef
  			window.setTimeout(function () {
  				runtimeKeepalivePop(); // eslint-disable-line no-undef
  				Browser.mainLoop.resume();
  			}, 0);
  		},
  getLayer:() => {
  			const new_view_count = (GodotWebXR.pose) ? GodotWebXR.pose.views.length : 1;
  			let layer = GodotWebXR.layer;
  
  			// If the view count hasn't changed since creating this layer, then
  			// we can simply return it.
  			if (layer && GodotWebXR.view_count === new_view_count) {
  				return layer;
  			}
  
  			if (!GodotWebXR.session || !GodotWebXR.gl_binding) {
  				return null;
  			}
  
  			const gl = GodotWebXR.gl;
  
  			layer = GodotWebXR.gl_binding.createProjectionLayer({
  				textureType: new_view_count > 1 ? 'texture-array' : 'texture',
  				colorFormat: gl.RGBA8,
  				depthFormat: gl.DEPTH_COMPONENT24,
  			});
  			GodotWebXR.session.updateRenderState({ layers: [layer] });
  
  			GodotWebXR.layer = layer;
  			GodotWebXR.view_count = new_view_count;
  			return layer;
  		},
  getSubImage:() => {
  			if (!GodotWebXR.pose) {
  				return null;
  			}
  			const layer = GodotWebXR.getLayer();
  			if (layer === null) {
  				return null;
  			}
  
  			// Because we always use "texture-array" for multiview and "texture"
  			// when there is only 1 view, it should be safe to only grab the
  			// subimage for the first view.
  			return GodotWebXR.gl_binding.getViewSubImage(layer, GodotWebXR.pose.views[0]);
  		},
  getTextureId:(texture) => {
  			if (texture.name !== undefined) {
  				return texture.name;
  			}
  
  			const id = GL.getNewId(GL.textures);
  			texture.name = id;
  			GL.textures[id] = texture;
  
  			return id;
  		},
  addInputSource:(input_source) => {
  			let name = -1;
  			if (input_source.targetRayMode === 'tracked-pointer' && input_source.handedness === 'left') {
  				name = 0;
  			} else if (input_source.targetRayMode === 'tracked-pointer' && input_source.handedness === 'right') {
  				name = 1;
  			} else {
  				for (let i = 2; i < 16; i++) {
  					if (!GodotWebXR.input_sources[i]) {
  						name = i;
  						break;
  					}
  				}
  			}
  			if (name >= 0) {
  				GodotWebXR.input_sources[name] = input_source;
  				input_source.name = name;
  
  				// Find a free touch index for screen sources.
  				if (input_source.targetRayMode === 'screen') {
  					let touch_index = -1;
  					for (let i = 0; i < 5; i++) {
  						if (!GodotWebXR.touches[i]) {
  							touch_index = i;
  							break;
  						}
  					}
  					if (touch_index >= 0) {
  						GodotWebXR.touches[touch_index] = input_source;
  						input_source.touch_index = touch_index;
  					}
  				}
  			}
  			return name;
  		},
  removeInputSource:(input_source) => {
  			if (input_source.name !== undefined) {
  				const name = input_source.name;
  				if (name >= 0 && name < 16) {
  					GodotWebXR.input_sources[name] = null;
  				}
  
  				if (input_source.touch_index !== undefined) {
  					const touch_index = input_source.touch_index;
  					if (touch_index >= 0 && touch_index < 5) {
  						GodotWebXR.touches[touch_index] = null;
  					}
  				}
  				return name;
  			}
  			return -1;
  		},
  getInputSourceId:(input_source) => {
  			if (input_source !== undefined) {
  				return input_source.name;
  			}
  			return -1;
  		},
  getTouchIndex:(input_source) => {
  			if (input_source.touch_index !== undefined) {
  				return input_source.touch_index;
  			}
  			return -1;
  		},
  };
  function _godot_webxr_get_bounds_geometry(r_points) {
  		if (!GodotWebXR.space || !GodotWebXR.space.boundsGeometry) {
  			return 0;
  		}
  
  		const point_count = GodotWebXR.space.boundsGeometry.length;
  		if (point_count === 0) {
  			return 0;
  		}
  
  		const buf = GodotRuntime.malloc(point_count * 3 * 4);
  		for (let i = 0; i < point_count; i++) {
  			const point = GodotWebXR.space.boundsGeometry[i];
  			GodotRuntime.setHeapValue(buf + ((i * 3) + 0) * 4, point.x, 'float');
  			GodotRuntime.setHeapValue(buf + ((i * 3) + 1) * 4, point.y, 'float');
  			GodotRuntime.setHeapValue(buf + ((i * 3) + 2) * 4, point.z, 'float');
  		}
  		GodotRuntime.setHeapValue(r_points, buf, 'i32');
  
  		return point_count;
  	}

  function _godot_webxr_get_color_texture() {
  		const subimage = GodotWebXR.getSubImage();
  		if (subimage === null) {
  			return 0;
  		}
  		return GodotWebXR.getTextureId(subimage.colorTexture);
  	}

  function _godot_webxr_get_depth_texture() {
  		const subimage = GodotWebXR.getSubImage();
  		if (subimage === null) {
  			return 0;
  		}
  		if (!subimage.depthStencilTexture) {
  			return 0;
  		}
  		return GodotWebXR.getTextureId(subimage.depthStencilTexture);
  	}

  function _godot_webxr_get_frame_rate() {
  		if (!GodotWebXR.session || GodotWebXR.session.frameRate === undefined) {
  			return 0;
  		}
  		return GodotWebXR.session.frameRate;
  	}

  function _godot_webxr_get_projection_for_view(p_view, r_transform) {
  		if (!GodotWebXR.session || !GodotWebXR.pose) {
  			return false;
  		}
  
  		const matrix = GodotWebXR.pose.views[p_view].projectionMatrix;
  		for (let i = 0; i < 16; i++) {
  			GodotRuntime.setHeapValue(r_transform + (i * 4), matrix[i], 'float');
  		}
  
  		return true;
  	}

  function _godot_webxr_get_render_target_size(r_size) {
  		const subimage = GodotWebXR.getSubImage();
  		if (subimage === null) {
  			return false;
  		}
  
  		GodotRuntime.setHeapValue(r_size + 0, subimage.viewport.width, 'i32');
  		GodotRuntime.setHeapValue(r_size + 4, subimage.viewport.height, 'i32');
  
  		return true;
  	}

  function _godot_webxr_get_supported_frame_rates(r_frame_rates) {
  		if (!GodotWebXR.session || GodotWebXR.session.supportedFrameRates === undefined) {
  			return 0;
  		}
  
  		const frame_rate_count = GodotWebXR.session.supportedFrameRates.length;
  		if (frame_rate_count === 0) {
  			return 0;
  		}
  
  		const buf = GodotRuntime.malloc(frame_rate_count * 4);
  		for (let i = 0; i < frame_rate_count; i++) {
  			GodotRuntime.setHeapValue(buf + (i * 4), GodotWebXR.session.supportedFrameRates[i], 'float');
  		}
  		GodotRuntime.setHeapValue(r_frame_rates, buf, 'i32');
  
  		return frame_rate_count;
  	}

  function _godot_webxr_get_transform_for_view(p_view, r_transform) {
  		if (!GodotWebXR.session || !GodotWebXR.pose) {
  			return false;
  		}
  
  		const views = GodotWebXR.pose.views;
  		let matrix;
  		if (p_view >= 0) {
  			matrix = views[p_view].transform.matrix;
  		} else {
  			// For -1 (or any other negative value) return the HMD transform.
  			matrix = GodotWebXR.pose.transform.matrix;
  		}
  
  		for (let i = 0; i < 16; i++) {
  			GodotRuntime.setHeapValue(r_transform + (i * 4), matrix[i], 'float');
  		}
  
  		return true;
  	}

  function _godot_webxr_get_velocity_texture() {
  		const subimage = GodotWebXR.getSubImage();
  		if (subimage === null) {
  			return 0;
  		}
  		if (!subimage.motionVectorTexture) {
  			return 0;
  		}
  		return GodotWebXR.getTextureId(subimage.motionVectorTexture);
  	}

  function _godot_webxr_get_view_count() {
  		if (!GodotWebXR.session || !GodotWebXR.pose) {
  			return 1;
  		}
  		const view_count = GodotWebXR.pose.views.length;
  		return view_count > 0 ? view_count : 1;
  	}

  function _godot_webxr_get_visibility_state() {
  		if (!GodotWebXR.session || !GodotWebXR.session.visibilityState) {
  			return 0;
  		}
  
  		return GodotRuntime.allocString(GodotWebXR.session.visibilityState);
  	}

  
  var _godot_webxr_initialize = function (p_session_mode, p_required_features, p_optional_features, p_requested_reference_spaces, p_on_session_started, p_on_session_ended, p_on_session_failed, p_on_input_event, p_on_simple_event) {
  		GodotWebXR.monkeyPatchRequestAnimationFrame(true);
  
  		const session_mode = GodotRuntime.parseString(p_session_mode);
  		const required_features = GodotRuntime.parseString(p_required_features).split(',').map((s) => s.trim()).filter((s) => s !== '');
  		const optional_features = GodotRuntime.parseString(p_optional_features).split(',').map((s) => s.trim()).filter((s) => s !== '');
  		const requested_reference_space_types = GodotRuntime.parseString(p_requested_reference_spaces).split(',').map((s) => s.trim());
  		const onstarted = GodotRuntime.get_func(p_on_session_started);
  		const onended = GodotRuntime.get_func(p_on_session_ended);
  		const onfailed = GodotRuntime.get_func(p_on_session_failed);
  		const oninputevent = GodotRuntime.get_func(p_on_input_event);
  		const onsimpleevent = GodotRuntime.get_func(p_on_simple_event);
  
  		const session_init = {};
  		if (required_features.length > 0) {
  			session_init['requiredFeatures'] = required_features;
  		}
  		if (optional_features.length > 0) {
  			session_init['optionalFeatures'] = optional_features;
  		}
  
  		navigator.xr.requestSession(session_mode, session_init).then(function (session) {
  			GodotWebXR.session = session;
  
  			session.addEventListener('end', function (evt) {
  				onended();
  			});
  
  			session.addEventListener('inputsourceschange', function (evt) {
  				evt.added.forEach(GodotWebXR.addInputSource);
  				evt.removed.forEach(GodotWebXR.removeInputSource);
  			});
  
  			['selectstart', 'selectend', 'squeezestart', 'squeezeend'].forEach((input_event, index) => {
  				session.addEventListener(input_event, function (evt) {
  					// Since this happens in-between normal frames, we need to
  					// grab the frame from the event in order to get poses for
  					// the input sources.
  					GodotWebXR.frame = evt.frame;
  					oninputevent(index, GodotWebXR.getInputSourceId(evt.inputSource));
  					GodotWebXR.frame = null;
  				});
  			});
  
  			session.addEventListener('visibilitychange', function (evt) {
  				const c_str = GodotRuntime.allocString('visibility_state_changed');
  				onsimpleevent(c_str);
  				GodotRuntime.free(c_str);
  			});
  
  			// Store onsimpleevent so we can use it later.
  			GodotWebXR.onsimpleevent = onsimpleevent;
  
  			const gl_context_handle = _emscripten_webgl_get_current_context(); // eslint-disable-line no-undef
  			const gl = GL.getContext(gl_context_handle).GLctx;
  			GodotWebXR.gl = gl;
  
  			gl.makeXRCompatible().then(function () {
  				GodotWebXR.gl_binding = new XRWebGLBinding(session, gl); // eslint-disable-line no-undef
  
  				// This will trigger the layer to get created.
  				GodotWebXR.getLayer();
  
  				function onReferenceSpaceSuccess(reference_space, reference_space_type) {
  					GodotWebXR.space = reference_space;
  
  					// Using reference_space.addEventListener() crashes when
  					// using the polyfill with the WebXR Emulator extension,
  					// so we set the event property instead.
  					reference_space.onreset = function (evt) {
  						const c_str = GodotRuntime.allocString('reference_space_reset');
  						onsimpleevent(c_str);
  						GodotRuntime.free(c_str);
  					};
  
  					// Now that both GodotWebXR.session and GodotWebXR.space are
  					// set, we need to pause and resume the main loop for the XR
  					// main loop to kick in.
  					GodotWebXR.pauseResumeMainLoop();
  
  					// Call in setTimeout() so that errors in the onstarted()
  					// callback don't bubble up here and cause Godot to try the
  					// next reference space.
  					window.setTimeout(function () {
  						const c_str = GodotRuntime.allocString(reference_space_type);
  						onstarted(c_str);
  						GodotRuntime.free(c_str);
  					}, 0);
  				}
  
  				function requestReferenceSpace() {
  					const reference_space_type = requested_reference_space_types.shift();
  					session.requestReferenceSpace(reference_space_type)
  						.then((refSpace) => {
  							onReferenceSpaceSuccess(refSpace, reference_space_type);
  						})
  						.catch(() => {
  							if (requested_reference_space_types.length === 0) {
  								const c_str = GodotRuntime.allocString('Unable to get any of the requested reference space types');
  								onfailed(c_str);
  								GodotRuntime.free(c_str);
  							} else {
  								requestReferenceSpace();
  							}
  						});
  				}
  
  				requestReferenceSpace();
  			}).catch(function (error) {
  				const c_str = GodotRuntime.allocString(`Unable to make WebGL context compatible with WebXR: ${error}`);
  				onfailed(c_str);
  				GodotRuntime.free(c_str);
  			});
  		}).catch(function (error) {
  			const c_str = GodotRuntime.allocString(`Unable to start session: ${error}`);
  			onfailed(c_str);
  			GodotRuntime.free(c_str);
  		});
  	};

  function _godot_webxr_is_session_supported(p_session_mode, p_callback) {
  		const session_mode = GodotRuntime.parseString(p_session_mode);
  		const cb = GodotRuntime.get_func(p_callback);
  		if (navigator.xr) {
  			navigator.xr.isSessionSupported(session_mode).then(function (supported) {
  				const c_str = GodotRuntime.allocString(session_mode);
  				cb(c_str, supported ? 1 : 0);
  				GodotRuntime.free(c_str);
  			});
  		} else {
  			const c_str = GodotRuntime.allocString(session_mode);
  			cb(c_str, 0);
  			GodotRuntime.free(c_str);
  		}
  	}

  function _godot_webxr_is_supported() {
  		return !!navigator.xr;
  	}

  var _godot_webxr_uninitialize = function () {
  		if (GodotWebXR.session) {
  			GodotWebXR.session.end()
  				// Prevent exception when session has already ended.
  				.catch((e) => { });
  		}
  
  		GodotWebXR.session = null;
  		GodotWebXR.gl_binding = null;
  		GodotWebXR.layer = null;
  		GodotWebXR.space = null;
  		GodotWebXR.frame = null;
  		GodotWebXR.pose = null;
  		GodotWebXR.view_count = 1;
  		GodotWebXR.input_sources = new Array(16);
  		GodotWebXR.touches = new Array(5);
  		GodotWebXR.onsimpleevent = null;
  
  		// Disable the monkey-patched window.requestAnimationFrame() and
  		// pause/restart the main loop to activate it on all platforms.
  		GodotWebXR.monkeyPatchRequestAnimationFrame(false);
  		GodotWebXR.pauseResumeMainLoop();
  	};

  function _godot_webxr_update_input_source(p_input_source_id, r_target_pose, r_target_ray_mode, r_touch_index, r_has_grip_pose, r_grip_pose, r_has_standard_mapping, r_button_count, r_buttons, r_axes_count, r_axes) {
  		if (!GodotWebXR.session || !GodotWebXR.frame) {
  			return 0;
  		}
  
  		if (p_input_source_id < 0 || p_input_source_id >= GodotWebXR.input_sources.length || !GodotWebXR.input_sources[p_input_source_id]) {
  			return false;
  		}
  
  		const input_source = GodotWebXR.input_sources[p_input_source_id];
  		const frame = GodotWebXR.frame;
  		const space = GodotWebXR.space;
  
  		// Target pose.
  		const target_pose = frame.getPose(input_source.targetRaySpace, space);
  		if (!target_pose) {
  			// This can mean that the controller lost tracking.
  			return false;
  		}
  		const target_pose_matrix = target_pose.transform.matrix;
  		for (let i = 0; i < 16; i++) {
  			GodotRuntime.setHeapValue(r_target_pose + (i * 4), target_pose_matrix[i], 'float');
  		}
  
  		// Target ray mode.
  		let target_ray_mode = 0;
  		switch (input_source.targetRayMode) {
  		case 'gaze':
  			target_ray_mode = 1;
  			break;
  
  		case 'tracked-pointer':
  			target_ray_mode = 2;
  			break;
  
  		case 'screen':
  			target_ray_mode = 3;
  			break;
  
  		default:
  		}
  		GodotRuntime.setHeapValue(r_target_ray_mode, target_ray_mode, 'i32');
  
  		// Touch index.
  		GodotRuntime.setHeapValue(r_touch_index, GodotWebXR.getTouchIndex(input_source), 'i32');
  
  		// Grip pose.
  		let has_grip_pose = false;
  		if (input_source.gripSpace) {
  			const grip_pose = frame.getPose(input_source.gripSpace, space);
  			if (grip_pose) {
  				const grip_pose_matrix = grip_pose.transform.matrix;
  				for (let i = 0; i < 16; i++) {
  					GodotRuntime.setHeapValue(r_grip_pose + (i * 4), grip_pose_matrix[i], 'float');
  				}
  				has_grip_pose = true;
  			}
  		}
  		GodotRuntime.setHeapValue(r_has_grip_pose, has_grip_pose ? 1 : 0, 'i32');
  
  		// Gamepad data (mapping, buttons and axes).
  		let has_standard_mapping = false;
  		let button_count = 0;
  		let axes_count = 0;
  		if (input_source.gamepad) {
  			if (input_source.gamepad.mapping === 'xr-standard') {
  				has_standard_mapping = true;
  			}
  
  			button_count = Math.min(input_source.gamepad.buttons.length, 10);
  			for (let i = 0; i < button_count; i++) {
  				GodotRuntime.setHeapValue(r_buttons + (i * 4), input_source.gamepad.buttons[i].value, 'float');
  			}
  
  			axes_count = Math.min(input_source.gamepad.axes.length, 10);
  			for (let i = 0; i < axes_count; i++) {
  				GodotRuntime.setHeapValue(r_axes + (i * 4), input_source.gamepad.axes[i], 'float');
  			}
  		}
  		GodotRuntime.setHeapValue(r_has_standard_mapping, has_standard_mapping ? 1 : 0, 'i32');
  		GodotRuntime.setHeapValue(r_button_count, button_count, 'i32');
  		GodotRuntime.setHeapValue(r_axes_count, axes_count, 'i32');
  
  		return true;
  	}

  function _godot_webxr_update_target_frame_rate(p_frame_rate) {
  		if (!GodotWebXR.session || GodotWebXR.session.updateTargetFrameRate === undefined) {
  			return;
  		}
  
  		GodotWebXR.session.updateTargetFrameRate(p_frame_rate).then(() => {
  			const c_str = GodotRuntime.allocString('display_refresh_rate_changed');
  			GodotWebXR.onsimpleevent(c_str);
  			GodotRuntime.free(c_str);
  		});
  	}

  
  var arraySum = (array, index) => {
      var sum = 0;
      for (var i = 0; i <= index; sum += array[i++]) {
        // no-op
      }
      return sum;
    };
  
  
  var MONTH_DAYS_LEAP = [31,29,31,30,31,30,31,31,30,31,30,31];
  
  var MONTH_DAYS_REGULAR = [31,28,31,30,31,30,31,31,30,31,30,31];
  var addDays = (date, days) => {
      var newDate = new Date(date.getTime());
      while (days > 0) {
        var leap = isLeapYear(newDate.getFullYear());
        var currentMonth = newDate.getMonth();
        var daysInCurrentMonth = (leap ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[currentMonth];
  
        if (days > daysInCurrentMonth-newDate.getDate()) {
          // we spill over to next month
          days -= (daysInCurrentMonth-newDate.getDate()+1);
          newDate.setDate(1);
          if (currentMonth < 11) {
            newDate.setMonth(currentMonth+1)
          } else {
            newDate.setMonth(0);
            newDate.setFullYear(newDate.getFullYear()+1);
          }
        } else {
          // we stay in current month
          newDate.setDate(newDate.getDate()+days);
          return newDate;
        }
      }
  
      return newDate;
    };
  
  
  
  
  var writeArrayToMemory = (array, buffer) => {
      assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)')
      HEAP8.set(array, buffer);
    };
  
  var _strftime = (s, maxsize, format, tm) => {
      // size_t strftime(char *restrict s, size_t maxsize, const char *restrict format, const struct tm *restrict timeptr);
      // http://pubs.opengroup.org/onlinepubs/009695399/functions/strftime.html
  
      var tm_zone = HEAP32[(((tm)+(40))>>2)];
  
      var date = {
        tm_sec: HEAP32[((tm)>>2)],
        tm_min: HEAP32[(((tm)+(4))>>2)],
        tm_hour: HEAP32[(((tm)+(8))>>2)],
        tm_mday: HEAP32[(((tm)+(12))>>2)],
        tm_mon: HEAP32[(((tm)+(16))>>2)],
        tm_year: HEAP32[(((tm)+(20))>>2)],
        tm_wday: HEAP32[(((tm)+(24))>>2)],
        tm_yday: HEAP32[(((tm)+(28))>>2)],
        tm_isdst: HEAP32[(((tm)+(32))>>2)],
        tm_gmtoff: HEAP32[(((tm)+(36))>>2)],
        tm_zone: tm_zone ? UTF8ToString(tm_zone) : ''
      };
  
      var pattern = UTF8ToString(format);
  
      // expand format
      var EXPANSION_RULES_1 = {
        '%c': '%a %b %d %H:%M:%S %Y',     // Replaced by the locale's appropriate date and time representation - e.g., Mon Aug  3 14:02:01 2013
        '%D': '%m/%d/%y',                 // Equivalent to %m / %d / %y
        '%F': '%Y-%m-%d',                 // Equivalent to %Y - %m - %d
        '%h': '%b',                       // Equivalent to %b
        '%r': '%I:%M:%S %p',              // Replaced by the time in a.m. and p.m. notation
        '%R': '%H:%M',                    // Replaced by the time in 24-hour notation
        '%T': '%H:%M:%S',                 // Replaced by the time
        '%x': '%m/%d/%y',                 // Replaced by the locale's appropriate date representation
        '%X': '%H:%M:%S',                 // Replaced by the locale's appropriate time representation
        // Modified Conversion Specifiers
        '%Ec': '%c',                      // Replaced by the locale's alternative appropriate date and time representation.
        '%EC': '%C',                      // Replaced by the name of the base year (period) in the locale's alternative representation.
        '%Ex': '%m/%d/%y',                // Replaced by the locale's alternative date representation.
        '%EX': '%H:%M:%S',                // Replaced by the locale's alternative time representation.
        '%Ey': '%y',                      // Replaced by the offset from %EC (year only) in the locale's alternative representation.
        '%EY': '%Y',                      // Replaced by the full alternative year representation.
        '%Od': '%d',                      // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading zeros if there is any alternative symbol for zero; otherwise, with leading <space> characters.
        '%Oe': '%e',                      // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading <space> characters.
        '%OH': '%H',                      // Replaced by the hour (24-hour clock) using the locale's alternative numeric symbols.
        '%OI': '%I',                      // Replaced by the hour (12-hour clock) using the locale's alternative numeric symbols.
        '%Om': '%m',                      // Replaced by the month using the locale's alternative numeric symbols.
        '%OM': '%M',                      // Replaced by the minutes using the locale's alternative numeric symbols.
        '%OS': '%S',                      // Replaced by the seconds using the locale's alternative numeric symbols.
        '%Ou': '%u',                      // Replaced by the weekday as a number in the locale's alternative representation (Monday=1).
        '%OU': '%U',                      // Replaced by the week number of the year (Sunday as the first day of the week, rules corresponding to %U ) using the locale's alternative numeric symbols.
        '%OV': '%V',                      // Replaced by the week number of the year (Monday as the first day of the week, rules corresponding to %V ) using the locale's alternative numeric symbols.
        '%Ow': '%w',                      // Replaced by the number of the weekday (Sunday=0) using the locale's alternative numeric symbols.
        '%OW': '%W',                      // Replaced by the week number of the year (Monday as the first day of the week) using the locale's alternative numeric symbols.
        '%Oy': '%y',                      // Replaced by the year (offset from %C ) using the locale's alternative numeric symbols.
      };
      for (var rule in EXPANSION_RULES_1) {
        pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_1[rule]);
      }
  
      var WEEKDAYS = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'];
      var MONTHS = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'];
  
      function leadingSomething(value, digits, character) {
        var str = typeof value == 'number' ? value.toString() : (value || '');
        while (str.length < digits) {
          str = character[0]+str;
        }
        return str;
      }
  
      function leadingNulls(value, digits) {
        return leadingSomething(value, digits, '0');
      }
  
      function compareByDay(date1, date2) {
        function sgn(value) {
          return value < 0 ? -1 : (value > 0 ? 1 : 0);
        }
  
        var compare;
        if ((compare = sgn(date1.getFullYear()-date2.getFullYear())) === 0) {
          if ((compare = sgn(date1.getMonth()-date2.getMonth())) === 0) {
            compare = sgn(date1.getDate()-date2.getDate());
          }
        }
        return compare;
      }
  
      function getFirstWeekStartDate(janFourth) {
          switch (janFourth.getDay()) {
            case 0: // Sunday
              return new Date(janFourth.getFullYear()-1, 11, 29);
            case 1: // Monday
              return janFourth;
            case 2: // Tuesday
              return new Date(janFourth.getFullYear(), 0, 3);
            case 3: // Wednesday
              return new Date(janFourth.getFullYear(), 0, 2);
            case 4: // Thursday
              return new Date(janFourth.getFullYear(), 0, 1);
            case 5: // Friday
              return new Date(janFourth.getFullYear()-1, 11, 31);
            case 6: // Saturday
              return new Date(janFourth.getFullYear()-1, 11, 30);
          }
      }
  
      function getWeekBasedYear(date) {
          var thisDate = addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday);
  
          var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4);
          var janFourthNextYear = new Date(thisDate.getFullYear()+1, 0, 4);
  
          var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
          var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
  
          if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) {
            // this date is after the start of the first week of this year
            if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) {
              return thisDate.getFullYear()+1;
            }
            return thisDate.getFullYear();
          }
          return thisDate.getFullYear()-1;
      }
  
      var EXPANSION_RULES_2 = {
        '%a': (date) => WEEKDAYS[date.tm_wday].substring(0,3) ,
        '%A': (date) => WEEKDAYS[date.tm_wday],
        '%b': (date) => MONTHS[date.tm_mon].substring(0,3),
        '%B': (date) => MONTHS[date.tm_mon],
        '%C': (date) => {
          var year = date.tm_year+1900;
          return leadingNulls((year/100)|0,2);
        },
        '%d': (date) => leadingNulls(date.tm_mday, 2),
        '%e': (date) => leadingSomething(date.tm_mday, 2, ' '),
        '%g': (date) => {
          // %g, %G, and %V give values according to the ISO 8601:2000 standard week-based year.
          // In this system, weeks begin on a Monday and week 1 of the year is the week that includes
          // January 4th, which is also the week that includes the first Thursday of the year, and
          // is also the first week that contains at least four days in the year.
          // If the first Monday of January is the 2nd, 3rd, or 4th, the preceding days are part of
          // the last week of the preceding year; thus, for Saturday 2nd January 1999,
          // %G is replaced by 1998 and %V is replaced by 53. If December 29th, 30th,
          // or 31st is a Monday, it and any following days are part of week 1 of the following year.
          // Thus, for Tuesday 30th December 1997, %G is replaced by 1998 and %V is replaced by 01.
  
          return getWeekBasedYear(date).toString().substring(2);
        },
        '%G': (date) => getWeekBasedYear(date),
        '%H': (date) => leadingNulls(date.tm_hour, 2),
        '%I': (date) => {
          var twelveHour = date.tm_hour;
          if (twelveHour == 0) twelveHour = 12;
          else if (twelveHour > 12) twelveHour -= 12;
          return leadingNulls(twelveHour, 2);
        },
        '%j': (date) => {
          // Day of the year (001-366)
          return leadingNulls(date.tm_mday + arraySum(isLeapYear(date.tm_year+1900) ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, date.tm_mon-1), 3);
        },
        '%m': (date) => leadingNulls(date.tm_mon+1, 2),
        '%M': (date) => leadingNulls(date.tm_min, 2),
        '%n': () => '\n',
        '%p': (date) => {
          if (date.tm_hour >= 0 && date.tm_hour < 12) {
            return 'AM';
          }
          return 'PM';
        },
        '%S': (date) => leadingNulls(date.tm_sec, 2),
        '%t': () => '\t',
        '%u': (date) => date.tm_wday || 7,
        '%U': (date) => {
          var days = date.tm_yday + 7 - date.tm_wday;
          return leadingNulls(Math.floor(days / 7), 2);
        },
        '%V': (date) => {
          // Replaced by the week number of the year (Monday as the first day of the week)
          // as a decimal number [01,53]. If the week containing 1 January has four
          // or more days in the new year, then it is considered week 1.
          // Otherwise, it is the last week of the previous year, and the next week is week 1.
          // Both January 4th and the first Thursday of January are always in week 1. [ tm_year, tm_wday, tm_yday]
          var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7 ) / 7);
          // If 1 Jan is just 1-3 days past Monday, the previous week
          // is also in this year.
          if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) {
            val++;
          }
          if (!val) {
            val = 52;
            // If 31 December of prev year a Thursday, or Friday of a
            // leap year, then the prev year has 53 weeks.
            var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7;
            if (dec31 == 4 || (dec31 == 5 && isLeapYear(date.tm_year%400-1))) {
              val++;
            }
          } else if (val == 53) {
            // If 1 January is not a Thursday, and not a Wednesday of a
            // leap year, then this year has only 52 weeks.
            var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7;
            if (jan1 != 4 && (jan1 != 3 || !isLeapYear(date.tm_year)))
              val = 1;
          }
          return leadingNulls(val, 2);
        },
        '%w': (date) => date.tm_wday,
        '%W': (date) => {
          var days = date.tm_yday + 7 - ((date.tm_wday + 6) % 7);
          return leadingNulls(Math.floor(days / 7), 2);
        },
        '%y': (date) => {
          // Replaced by the last two digits of the year as a decimal number [00,99]. [ tm_year]
          return (date.tm_year+1900).toString().substring(2);
        },
        // Replaced by the year as a decimal number (for example, 1997). [ tm_year]
        '%Y': (date) => date.tm_year+1900,
        '%z': (date) => {
          // Replaced by the offset from UTC in the ISO 8601:2000 standard format ( +hhmm or -hhmm ).
          // For example, "-0430" means 4 hours 30 minutes behind UTC (west of Greenwich).
          var off = date.tm_gmtoff;
          var ahead = off >= 0;
          off = Math.abs(off) / 60;
          // convert from minutes into hhmm format (which means 60 minutes = 100 units)
          off = (off / 60)*100 + (off % 60);
          return (ahead ? '+' : '-') + String("0000" + off).slice(-4);
        },
        '%Z': (date) => date.tm_zone,
        '%%': () => '%'
      };
  
      // Replace %% with a pair of NULLs (which cannot occur in a C string), then
      // re-inject them after processing.
      pattern = pattern.replace(/%%/g, '\0\0')
      for (var rule in EXPANSION_RULES_2) {
        if (pattern.includes(rule)) {
          pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_2[rule](date));
        }
      }
      pattern = pattern.replace(/\0\0/g, '%')
  
      var bytes = intArrayFromString(pattern, false);
      if (bytes.length > maxsize) {
        return 0;
      }
  
      writeArrayToMemory(bytes, s);
      return bytes.length-1;
    };

  var _strftime_l = (s, maxsize, format, tm, loc) => {
      return _strftime(s, maxsize, format, tm); // no locale support yet
    };



  
  var stringToUTF8OnStack = (str) => {
      var size = lengthBytesUTF8(str) + 1;
      var ret = stackAlloc(size);
      stringToUTF8(str, ret, size);
      return ret;
    };


  function getCFunc(ident) {
      var func = Module['_' + ident]; // closure exported function
      assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported');
      return func;
    }
  
  
  
  
  
    /**
     * @param {string|null=} returnType
     * @param {Array=} argTypes
     * @param {Arguments|Array=} args
     * @param {Object=} opts
     */
  var ccall = function(ident, returnType, argTypes, args, opts) {
      // For fast lookup of conversion functions
      var toC = {
        'string': (str) => {
          var ret = 0;
          if (str !== null && str !== undefined && str !== 0) { // null string
            // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
            ret = stringToUTF8OnStack(str);
          }
          return ret;
        },
        'array': (arr) => {
          var ret = stackAlloc(arr.length);
          writeArrayToMemory(arr, ret);
          return ret;
        }
      };
  
      function convertReturnValue(ret) {
        if (returnType === 'string') {
          
          return UTF8ToString(ret);
        }
        if (returnType === 'boolean') return Boolean(ret);
        return ret;
      }
  
      var func = getCFunc(ident);
      var cArgs = [];
      var stack = 0;
      assert(returnType !== 'array', 'Return type should not be "array".');
      if (args) {
        for (var i = 0; i < args.length; i++) {
          var converter = toC[argTypes[i]];
          if (converter) {
            if (stack === 0) stack = stackSave();
            cArgs[i] = converter(args[i]);
          } else {
            cArgs[i] = args[i];
          }
        }
      }
      var ret = func.apply(null, cArgs);
      function onDone(ret) {
        if (stack !== 0) stackRestore(stack);
        return convertReturnValue(ret);
      }
  
      ret = onDone(ret);
      return ret;
    };
  
    /**
     * @param {string=} returnType
     * @param {Array=} argTypes
     * @param {Object=} opts
     */
  function cwrap(ident, returnType, argTypes, opts) {
      return function() {
        return ccall(ident, returnType, argTypes, arguments, opts);
      }
    }

  var FSNode = /** @constructor */ function(parent, name, mode, rdev) {
    if (!parent) {
      parent = this;  // root node sets parent to itself
    }
    this.parent = parent;
    this.mount = parent.mount;
    this.mounted = null;
    this.id = FS.nextInode++;
    this.name = name;
    this.mode = mode;
    this.node_ops = {};
    this.stream_ops = {};
    this.rdev = rdev;
  };
  var readMode = 292/*292*/ | 73/*73*/;
  var writeMode = 146/*146*/;
  Object.defineProperties(FSNode.prototype, {
   read: {
    get: /** @this{FSNode} */function() {
     return (this.mode & readMode) === readMode;
    },
    set: /** @this{FSNode} */function(val) {
     val ? this.mode |= readMode : this.mode &= ~readMode;
    }
   },
   write: {
    get: /** @this{FSNode} */function() {
     return (this.mode & writeMode) === writeMode;
    },
    set: /** @this{FSNode} */function(val) {
     val ? this.mode |= writeMode : this.mode &= ~writeMode;
    }
   },
   isFolder: {
    get: /** @this{FSNode} */function() {
     return FS.isDir(this.mode);
    }
   },
   isDevice: {
    get: /** @this{FSNode} */function() {
     return FS.isChrdev(this.mode);
    }
   }
  });
  FS.FSNode = FSNode;
  FS.createPreloadedFile = FS_createPreloadedFile;
  FS.staticInit();;
ERRNO_CODES = {
      'EPERM': 63,
      'ENOENT': 44,
      'ESRCH': 71,
      'EINTR': 27,
      'EIO': 29,
      'ENXIO': 60,
      'E2BIG': 1,
      'ENOEXEC': 45,
      'EBADF': 8,
      'ECHILD': 12,
      'EAGAIN': 6,
      'EWOULDBLOCK': 6,
      'ENOMEM': 48,
      'EACCES': 2,
      'EFAULT': 21,
      'ENOTBLK': 105,
      'EBUSY': 10,
      'EEXIST': 20,
      'EXDEV': 75,
      'ENODEV': 43,
      'ENOTDIR': 54,
      'EISDIR': 31,
      'EINVAL': 28,
      'ENFILE': 41,
      'EMFILE': 33,
      'ENOTTY': 59,
      'ETXTBSY': 74,
      'EFBIG': 22,
      'ENOSPC': 51,
      'ESPIPE': 70,
      'EROFS': 69,
      'EMLINK': 34,
      'EPIPE': 64,
      'EDOM': 18,
      'ERANGE': 68,
      'ENOMSG': 49,
      'EIDRM': 24,
      'ECHRNG': 106,
      'EL2NSYNC': 156,
      'EL3HLT': 107,
      'EL3RST': 108,
      'ELNRNG': 109,
      'EUNATCH': 110,
      'ENOCSI': 111,
      'EL2HLT': 112,
      'EDEADLK': 16,
      'ENOLCK': 46,
      'EBADE': 113,
      'EBADR': 114,
      'EXFULL': 115,
      'ENOANO': 104,
      'EBADRQC': 103,
      'EBADSLT': 102,
      'EDEADLOCK': 16,
      'EBFONT': 101,
      'ENOSTR': 100,
      'ENODATA': 116,
      'ETIME': 117,
      'ENOSR': 118,
      'ENONET': 119,
      'ENOPKG': 120,
      'EREMOTE': 121,
      'ENOLINK': 47,
      'EADV': 122,
      'ESRMNT': 123,
      'ECOMM': 124,
      'EPROTO': 65,
      'EMULTIHOP': 36,
      'EDOTDOT': 125,
      'EBADMSG': 9,
      'ENOTUNIQ': 126,
      'EBADFD': 127,
      'EREMCHG': 128,
      'ELIBACC': 129,
      'ELIBBAD': 130,
      'ELIBSCN': 131,
      'ELIBMAX': 132,
      'ELIBEXEC': 133,
      'ENOSYS': 52,
      'ENOTEMPTY': 55,
      'ENAMETOOLONG': 37,
      'ELOOP': 32,
      'EOPNOTSUPP': 138,
      'EPFNOSUPPORT': 139,
      'ECONNRESET': 15,
      'ENOBUFS': 42,
      'EAFNOSUPPORT': 5,
      'EPROTOTYPE': 67,
      'ENOTSOCK': 57,
      'ENOPROTOOPT': 50,
      'ESHUTDOWN': 140,
      'ECONNREFUSED': 14,
      'EADDRINUSE': 3,
      'ECONNABORTED': 13,
      'ENETUNREACH': 40,
      'ENETDOWN': 38,
      'ETIMEDOUT': 73,
      'EHOSTDOWN': 142,
      'EHOSTUNREACH': 23,
      'EINPROGRESS': 26,
      'EALREADY': 7,
      'EDESTADDRREQ': 17,
      'EMSGSIZE': 35,
      'EPROTONOSUPPORT': 66,
      'ESOCKTNOSUPPORT': 137,
      'EADDRNOTAVAIL': 4,
      'ENETRESET': 39,
      'EISCONN': 30,
      'ENOTCONN': 53,
      'ETOOMANYREFS': 141,
      'EUSERS': 136,
      'EDQUOT': 19,
      'ESTALE': 72,
      'ENOTSUP': 138,
      'ENOMEDIUM': 148,
      'EILSEQ': 25,
      'EOVERFLOW': 61,
      'ECANCELED': 11,
      'ENOTRECOVERABLE': 56,
      'EOWNERDEAD': 62,
      'ESTRPIPE': 135,
    };;

      // exports
      Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas) { Browser.requestFullscreen(lockPointer, resizeCanvas) };
      Module["requestFullScreen"] = function Module_requestFullScreen() { Browser.requestFullScreen() };
      Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) };
      Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) };
      Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() };
      Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() };
      Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() };
      Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) };
      var preloadedImages = {};
      var preloadedAudios = {};;
var GLctx;;
var miniTempWebGLIntBuffersStorage = new Int32Array(288);
  for (/**@suppress{duplicate}*/var i = 0; i < 288; ++i) {
  miniTempWebGLIntBuffers[i] = miniTempWebGLIntBuffersStorage.subarray(0, i+1);
  }
  ;
var miniTempWebGLFloatBuffersStorage = new Float32Array(288);
  for (/**@suppress{duplicate}*/var i = 0; i < 288; ++i) {
  miniTempWebGLFloatBuffers[i] = miniTempWebGLFloatBuffersStorage.subarray(0, i+1);
  }
  ;
Module["request_quit"] = function() { GodotOS.request_quit() };Module["onExit"] = GodotOS.cleanup;GodotOS._fs_sync_promise = Promise.resolve();;
Module["initConfig"] = GodotConfig.init_config;;
Module["initFS"] = GodotFS.init;Module["copyToFS"] = GodotFS.copy_to_fs;;
GodotOS.atexit(function(resolve, reject) { GodotDisplayCursor.clear(); resolve(); });;
GodotOS.atexit(function(resolve, reject) { GodotEventListeners.clear(); resolve(); });;
GodotOS.atexit(function(resolve, reject) { GodotDisplayVK.clear(); resolve(); });;
GodotJSWrapper.proxies = new Map();;
function checkIncomingModuleAPI() {
  ignoredModuleProp('fetchSettings');
}
var wasmImports = {
  __assert_fail: ___assert_fail,
  __call_sighandler: ___call_sighandler,
  __syscall__newselect: ___syscall__newselect,
  __syscall_accept4: ___syscall_accept4,
  __syscall_bind: ___syscall_bind,
  __syscall_chdir: ___syscall_chdir,
  __syscall_chmod: ___syscall_chmod,
  __syscall_connect: ___syscall_connect,
  __syscall_faccessat: ___syscall_faccessat,
  __syscall_fchmod: ___syscall_fchmod,
  __syscall_fcntl64: ___syscall_fcntl64,
  __syscall_fstat64: ___syscall_fstat64,
  __syscall_getcwd: ___syscall_getcwd,
  __syscall_getdents64: ___syscall_getdents64,
  __syscall_getsockname: ___syscall_getsockname,
  __syscall_getsockopt: ___syscall_getsockopt,
  __syscall_ioctl: ___syscall_ioctl,
  __syscall_listen: ___syscall_listen,
  __syscall_lstat64: ___syscall_lstat64,
  __syscall_mkdirat: ___syscall_mkdirat,
  __syscall_newfstatat: ___syscall_newfstatat,
  __syscall_openat: ___syscall_openat,
  __syscall_poll: ___syscall_poll,
  __syscall_readlinkat: ___syscall_readlinkat,
  __syscall_recvfrom: ___syscall_recvfrom,
  __syscall_renameat: ___syscall_renameat,
  __syscall_rmdir: ___syscall_rmdir,
  __syscall_sendto: ___syscall_sendto,
  __syscall_socket: ___syscall_socket,
  __syscall_stat64: ___syscall_stat64,
  __syscall_statfs64: ___syscall_statfs64,
  __syscall_symlink: ___syscall_symlink,
  __syscall_unlinkat: ___syscall_unlinkat,
  _emscripten_get_now_is_monotonic: __emscripten_get_now_is_monotonic,
  _emscripten_throw_longjmp: __emscripten_throw_longjmp,
  _gmtime_js: __gmtime_js,
  _localtime_js: __localtime_js,
  _setitimer_js: __setitimer_js,
  _tzset_js: __tzset_js,
  abort: _abort,
  emscripten_cancel_main_loop: _emscripten_cancel_main_loop,
  emscripten_console_error: _emscripten_console_error,
  emscripten_date_now: _emscripten_date_now,
  emscripten_force_exit: _emscripten_force_exit,
  emscripten_get_heap_max: _emscripten_get_heap_max,
  emscripten_get_now: _emscripten_get_now,
  emscripten_memcpy_big: _emscripten_memcpy_big,
  emscripten_resize_heap: _emscripten_resize_heap,
  emscripten_set_canvas_element_size: _emscripten_set_canvas_element_size,
  emscripten_set_main_loop: _emscripten_set_main_loop,
  emscripten_webgl_commit_frame: _emscripten_webgl_commit_frame,
  emscripten_webgl_create_context: _emscripten_webgl_create_context,
  emscripten_webgl_destroy_context: _emscripten_webgl_destroy_context,
  emscripten_webgl_enable_extension: _emscripten_webgl_enable_extension,
  emscripten_webgl_init_context_attributes: _emscripten_webgl_init_context_attributes,
  emscripten_webgl_make_context_current: _emscripten_webgl_make_context_current,
  environ_get: _environ_get,
  environ_sizes_get: _environ_sizes_get,
  exit: _exit,
  fd_close: _fd_close,
  fd_fdstat_get: _fd_fdstat_get,
  fd_read: _fd_read,
  fd_seek: _fd_seek,
  fd_write: _fd_write,
  getaddrinfo: _getaddrinfo,
  getnameinfo: _getnameinfo,
  glActiveTexture: _glActiveTexture,
  glAttachShader: _glAttachShader,
  glBeginTransformFeedback: _glBeginTransformFeedback,
  glBindBuffer: _glBindBuffer,
  glBindBufferBase: _glBindBufferBase,
  glBindBufferRange: _glBindBufferRange,
  glBindFramebuffer: _glBindFramebuffer,
  glBindRenderbuffer: _glBindRenderbuffer,
  glBindTexture: _glBindTexture,
  glBindVertexArray: _glBindVertexArray,
  glBlendColor: _glBlendColor,
  glBlendEquation: _glBlendEquation,
  glBlendFunc: _glBlendFunc,
  glBlendFuncSeparate: _glBlendFuncSeparate,
  glBlitFramebuffer: _glBlitFramebuffer,
  glBufferData: _glBufferData,
  glBufferSubData: _glBufferSubData,
  glCheckFramebufferStatus: _glCheckFramebufferStatus,
  glClear: _glClear,
  glClearBufferfv: _glClearBufferfv,
  glClearColor: _glClearColor,
  glClearDepthf: _glClearDepthf,
  glColorMask: _glColorMask,
  glCompileShader: _glCompileShader,
  glCompressedTexImage2D: _glCompressedTexImage2D,
  glCopyBufferSubData: _glCopyBufferSubData,
  glCreateProgram: _glCreateProgram,
  glCreateShader: _glCreateShader,
  glCullFace: _glCullFace,
  glDeleteBuffers: _glDeleteBuffers,
  glDeleteFramebuffers: _glDeleteFramebuffers,
  glDeleteProgram: _glDeleteProgram,
  glDeleteQueries: _glDeleteQueries,
  glDeleteRenderbuffers: _glDeleteRenderbuffers,
  glDeleteShader: _glDeleteShader,
  glDeleteSync: _glDeleteSync,
  glDeleteTextures: _glDeleteTextures,
  glDeleteVertexArrays: _glDeleteVertexArrays,
  glDepthFunc: _glDepthFunc,
  glDepthMask: _glDepthMask,
  glDisable: _glDisable,
  glDisableVertexAttribArray: _glDisableVertexAttribArray,
  glDrawArrays: _glDrawArrays,
  glDrawArraysInstanced: _glDrawArraysInstanced,
  glDrawElements: _glDrawElements,
  glDrawElementsInstanced: _glDrawElementsInstanced,
  glEnable: _glEnable,
  glEnableVertexAttribArray: _glEnableVertexAttribArray,
  glEndTransformFeedback: _glEndTransformFeedback,
  glFenceSync: _glFenceSync,
  glFinish: _glFinish,
  glFramebufferRenderbuffer: _glFramebufferRenderbuffer,
  glFramebufferTexture2D: _glFramebufferTexture2D,
  glFramebufferTextureLayer: _glFramebufferTextureLayer,
  glFrontFace: _glFrontFace,
  glGenBuffers: _glGenBuffers,
  glGenFramebuffers: _glGenFramebuffers,
  glGenQueries: _glGenQueries,
  glGenRenderbuffers: _glGenRenderbuffers,
  glGenTextures: _glGenTextures,
  glGenVertexArrays: _glGenVertexArrays,
  glGenerateMipmap: _glGenerateMipmap,
  glGetFloatv: _glGetFloatv,
  glGetInteger64v: _glGetInteger64v,
  glGetIntegerv: _glGetIntegerv,
  glGetProgramInfoLog: _glGetProgramInfoLog,
  glGetProgramiv: _glGetProgramiv,
  glGetShaderInfoLog: _glGetShaderInfoLog,
  glGetShaderiv: _glGetShaderiv,
  glGetString: _glGetString,
  glGetStringi: _glGetStringi,
  glGetSynciv: _glGetSynciv,
  glGetUniformBlockIndex: _glGetUniformBlockIndex,
  glGetUniformLocation: _glGetUniformLocation,
  glLinkProgram: _glLinkProgram,
  glPixelStorei: _glPixelStorei,
  glReadBuffer: _glReadBuffer,
  glReadPixels: _glReadPixels,
  glRenderbufferStorage: _glRenderbufferStorage,
  glRenderbufferStorageMultisample: _glRenderbufferStorageMultisample,
  glScissor: _glScissor,
  glShaderSource: _glShaderSource,
  glTexImage2D: _glTexImage2D,
  glTexImage3D: _glTexImage3D,
  glTexParameterf: _glTexParameterf,
  glTexParameteri: _glTexParameteri,
  glTexStorage2D: _glTexStorage2D,
  glTexSubImage3D: _glTexSubImage3D,
  glTransformFeedbackVaryings: _glTransformFeedbackVaryings,
  glUniform1f: _glUniform1f,
  glUniform1i: _glUniform1i,
  glUniform1iv: _glUniform1iv,
  glUniform1ui: _glUniform1ui,
  glUniform1uiv: _glUniform1uiv,
  glUniform2f: _glUniform2f,
  glUniform2fv: _glUniform2fv,
  glUniform2iv: _glUniform2iv,
  glUniform3fv: _glUniform3fv,
  glUniform4f: _glUniform4f,
  glUniform4fv: _glUniform4fv,
  glUniformBlockBinding: _glUniformBlockBinding,
  glUniformMatrix4fv: _glUniformMatrix4fv,
  glUseProgram: _glUseProgram,
  glVertexAttrib4f: _glVertexAttrib4f,
  glVertexAttribDivisor: _glVertexAttribDivisor,
  glVertexAttribI4ui: _glVertexAttribI4ui,
  glVertexAttribIPointer: _glVertexAttribIPointer,
  glVertexAttribPointer: _glVertexAttribPointer,
  glViewport: _glViewport,
  godot_audio_has_worklet: _godot_audio_has_worklet,
  godot_audio_init: _godot_audio_init,
  godot_audio_input_start: _godot_audio_input_start,
  godot_audio_input_stop: _godot_audio_input_stop,
  godot_audio_is_available: _godot_audio_is_available,
  godot_audio_resume: _godot_audio_resume,
  godot_audio_worklet_create: _godot_audio_worklet_create,
  godot_audio_worklet_start_no_threads: _godot_audio_worklet_start_no_threads,
  godot_js_config_canvas_id_get: _godot_js_config_canvas_id_get,
  godot_js_config_locale_get: _godot_js_config_locale_get,
  godot_js_display_alert: _godot_js_display_alert,
  godot_js_display_canvas_focus: _godot_js_display_canvas_focus,
  godot_js_display_canvas_is_focused: _godot_js_display_canvas_is_focused,
  godot_js_display_clipboard_get: _godot_js_display_clipboard_get,
  godot_js_display_clipboard_set: _godot_js_display_clipboard_set,
  godot_js_display_cursor_is_hidden: _godot_js_display_cursor_is_hidden,
  godot_js_display_cursor_is_locked: _godot_js_display_cursor_is_locked,
  godot_js_display_cursor_lock_set: _godot_js_display_cursor_lock_set,
  godot_js_display_cursor_set_custom_shape: _godot_js_display_cursor_set_custom_shape,
  godot_js_display_cursor_set_shape: _godot_js_display_cursor_set_shape,
  godot_js_display_cursor_set_visible: _godot_js_display_cursor_set_visible,
  godot_js_display_desired_size_set: _godot_js_display_desired_size_set,
  godot_js_display_fullscreen_cb: _godot_js_display_fullscreen_cb,
  godot_js_display_fullscreen_exit: _godot_js_display_fullscreen_exit,
  godot_js_display_fullscreen_request: _godot_js_display_fullscreen_request,
  godot_js_display_has_webgl: _godot_js_display_has_webgl,
  godot_js_display_is_swap_ok_cancel: _godot_js_display_is_swap_ok_cancel,
  godot_js_display_notification_cb: _godot_js_display_notification_cb,
  godot_js_display_pixel_ratio_get: _godot_js_display_pixel_ratio_get,
  godot_js_display_screen_dpi_get: _godot_js_display_screen_dpi_get,
  godot_js_display_screen_size_get: _godot_js_display_screen_size_get,
  godot_js_display_setup_canvas: _godot_js_display_setup_canvas,
  godot_js_display_size_update: _godot_js_display_size_update,
  godot_js_display_touchscreen_is_available: _godot_js_display_touchscreen_is_available,
  godot_js_display_tts_available: _godot_js_display_tts_available,
  godot_js_display_vk_available: _godot_js_display_vk_available,
  godot_js_display_vk_cb: _godot_js_display_vk_cb,
  godot_js_display_vk_hide: _godot_js_display_vk_hide,
  godot_js_display_vk_show: _godot_js_display_vk_show,
  godot_js_display_window_blur_cb: _godot_js_display_window_blur_cb,
  godot_js_display_window_icon_set: _godot_js_display_window_icon_set,
  godot_js_display_window_size_get: _godot_js_display_window_size_get,
  godot_js_display_window_title_set: _godot_js_display_window_title_set,
  godot_js_eval: _godot_js_eval,
  godot_js_fetch_create: _godot_js_fetch_create,
  godot_js_fetch_free: _godot_js_fetch_free,
  godot_js_fetch_http_status_get: _godot_js_fetch_http_status_get,
  godot_js_fetch_is_chunked: _godot_js_fetch_is_chunked,
  godot_js_fetch_read_chunk: _godot_js_fetch_read_chunk,
  godot_js_fetch_read_headers: _godot_js_fetch_read_headers,
  godot_js_fetch_state_get: _godot_js_fetch_state_get,
  godot_js_input_drop_files_cb: _godot_js_input_drop_files_cb,
  godot_js_input_gamepad_cb: _godot_js_input_gamepad_cb,
  godot_js_input_gamepad_sample: _godot_js_input_gamepad_sample,
  godot_js_input_gamepad_sample_count: _godot_js_input_gamepad_sample_count,
  godot_js_input_gamepad_sample_get: _godot_js_input_gamepad_sample_get,
  godot_js_input_key_cb: _godot_js_input_key_cb,
  godot_js_input_mouse_button_cb: _godot_js_input_mouse_button_cb,
  godot_js_input_mouse_move_cb: _godot_js_input_mouse_move_cb,
  godot_js_input_mouse_wheel_cb: _godot_js_input_mouse_wheel_cb,
  godot_js_input_paste_cb: _godot_js_input_paste_cb,
  godot_js_input_touch_cb: _godot_js_input_touch_cb,
  godot_js_input_vibrate_handheld: _godot_js_input_vibrate_handheld,
  godot_js_os_download_buffer: _godot_js_os_download_buffer,
  godot_js_os_execute: _godot_js_os_execute,
  godot_js_os_finish_async: _godot_js_os_finish_async,
  godot_js_os_fs_is_persistent: _godot_js_os_fs_is_persistent,
  godot_js_os_fs_sync: _godot_js_os_fs_sync,
  godot_js_os_has_feature: _godot_js_os_has_feature,
  godot_js_os_hw_concurrency_get: _godot_js_os_hw_concurrency_get,
  godot_js_os_request_quit_cb: _godot_js_os_request_quit_cb,
  godot_js_os_shell_open: _godot_js_os_shell_open,
  godot_js_pwa_cb: _godot_js_pwa_cb,
  godot_js_pwa_update: _godot_js_pwa_update,
  godot_js_rtc_datachannel_close: _godot_js_rtc_datachannel_close,
  godot_js_rtc_datachannel_connect: _godot_js_rtc_datachannel_connect,
  godot_js_rtc_datachannel_destroy: _godot_js_rtc_datachannel_destroy,
  godot_js_rtc_datachannel_get_buffered_amount: _godot_js_rtc_datachannel_get_buffered_amount,
  godot_js_rtc_datachannel_id_get: _godot_js_rtc_datachannel_id_get,
  godot_js_rtc_datachannel_is_negotiated: _godot_js_rtc_datachannel_is_negotiated,
  godot_js_rtc_datachannel_is_ordered: _godot_js_rtc_datachannel_is_ordered,
  godot_js_rtc_datachannel_label_get: _godot_js_rtc_datachannel_label_get,
  godot_js_rtc_datachannel_max_packet_lifetime_get: _godot_js_rtc_datachannel_max_packet_lifetime_get,
  godot_js_rtc_datachannel_max_retransmits_get: _godot_js_rtc_datachannel_max_retransmits_get,
  godot_js_rtc_datachannel_protocol_get: _godot_js_rtc_datachannel_protocol_get,
  godot_js_rtc_datachannel_ready_state_get: _godot_js_rtc_datachannel_ready_state_get,
  godot_js_rtc_datachannel_send: _godot_js_rtc_datachannel_send,
  godot_js_rtc_pc_close: _godot_js_rtc_pc_close,
  godot_js_rtc_pc_create: _godot_js_rtc_pc_create,
  godot_js_rtc_pc_datachannel_create: _godot_js_rtc_pc_datachannel_create,
  godot_js_rtc_pc_destroy: _godot_js_rtc_pc_destroy,
  godot_js_rtc_pc_ice_candidate_add: _godot_js_rtc_pc_ice_candidate_add,
  godot_js_rtc_pc_local_description_set: _godot_js_rtc_pc_local_description_set,
  godot_js_rtc_pc_offer_create: _godot_js_rtc_pc_offer_create,
  godot_js_rtc_pc_remote_description_set: _godot_js_rtc_pc_remote_description_set,
  godot_js_tts_get_voices: _godot_js_tts_get_voices,
  godot_js_tts_is_paused: _godot_js_tts_is_paused,
  godot_js_tts_is_speaking: _godot_js_tts_is_speaking,
  godot_js_tts_pause: _godot_js_tts_pause,
  godot_js_tts_resume: _godot_js_tts_resume,
  godot_js_tts_speak: _godot_js_tts_speak,
  godot_js_tts_stop: _godot_js_tts_stop,
  godot_js_websocket_buffered_amount: _godot_js_websocket_buffered_amount,
  godot_js_websocket_close: _godot_js_websocket_close,
  godot_js_websocket_create: _godot_js_websocket_create,
  godot_js_websocket_destroy: _godot_js_websocket_destroy,
  godot_js_websocket_send: _godot_js_websocket_send,
  godot_js_wrapper_create_cb: _godot_js_wrapper_create_cb,
  godot_js_wrapper_create_object: _godot_js_wrapper_create_object,
  godot_js_wrapper_interface_get: _godot_js_wrapper_interface_get,
  godot_js_wrapper_object_call: _godot_js_wrapper_object_call,
  godot_js_wrapper_object_get: _godot_js_wrapper_object_get,
  godot_js_wrapper_object_getvar: _godot_js_wrapper_object_getvar,
  godot_js_wrapper_object_set: _godot_js_wrapper_object_set,
  godot_js_wrapper_object_set_cb_ret: _godot_js_wrapper_object_set_cb_ret,
  godot_js_wrapper_object_setvar: _godot_js_wrapper_object_setvar,
  godot_js_wrapper_object_unref: _godot_js_wrapper_object_unref,
  godot_webgl2_glFramebufferTextureMultiviewOVR: _godot_webgl2_glFramebufferTextureMultiviewOVR,
  godot_webgl2_glGetBufferSubData: _godot_webgl2_glGetBufferSubData,
  godot_webxr_get_bounds_geometry: _godot_webxr_get_bounds_geometry,
  godot_webxr_get_color_texture: _godot_webxr_get_color_texture,
  godot_webxr_get_depth_texture: _godot_webxr_get_depth_texture,
  godot_webxr_get_frame_rate: _godot_webxr_get_frame_rate,
  godot_webxr_get_projection_for_view: _godot_webxr_get_projection_for_view,
  godot_webxr_get_render_target_size: _godot_webxr_get_render_target_size,
  godot_webxr_get_supported_frame_rates: _godot_webxr_get_supported_frame_rates,
  godot_webxr_get_transform_for_view: _godot_webxr_get_transform_for_view,
  godot_webxr_get_velocity_texture: _godot_webxr_get_velocity_texture,
  godot_webxr_get_view_count: _godot_webxr_get_view_count,
  godot_webxr_get_visibility_state: _godot_webxr_get_visibility_state,
  godot_webxr_initialize: _godot_webxr_initialize,
  godot_webxr_is_session_supported: _godot_webxr_is_session_supported,
  godot_webxr_is_supported: _godot_webxr_is_supported,
  godot_webxr_uninitialize: _godot_webxr_uninitialize,
  godot_webxr_update_input_source: _godot_webxr_update_input_source,
  godot_webxr_update_target_frame_rate: _godot_webxr_update_target_frame_rate,
  invoke_ii: invoke_ii,
  invoke_iii: invoke_iii,
  invoke_iiii: invoke_iiii,
  invoke_iiiii: invoke_iiiii,
  invoke_iiiiiii: invoke_iiiiiii,
  invoke_iiiiiiiiii: invoke_iiiiiiiiii,
  invoke_v: invoke_v,
  invoke_vi: invoke_vi,
  invoke_vii: invoke_vii,
  invoke_viii: invoke_viii,
  invoke_viiii: invoke_viiii,
  strftime: _strftime,
  strftime_l: _strftime_l
};
var asm = createWasm();
var ___wasm_call_ctors = createExportWrapper('__wasm_call_ctors');
var _free = createExportWrapper('free');
var __Z14godot_web_mainiPPc = Module['__Z14godot_web_mainiPPc'] = createExportWrapper('_Z14godot_web_mainiPPc');
var _main = Module['_main'] = createExportWrapper('__main_argc_argv');
var ___errno_location = createExportWrapper('__errno_location');
var _malloc = createExportWrapper('malloc');
var _fflush = Module['_fflush'] = createExportWrapper('fflush');
var setTempRet0 = createExportWrapper('setTempRet0');
var _htonl = createExportWrapper('htonl');
var _htons = createExportWrapper('htons');
var _ntohs = createExportWrapper('ntohs');
var __emwebxr_on_input_event = Module['__emwebxr_on_input_event'] = createExportWrapper('_emwebxr_on_input_event');
var __emwebxr_on_simple_event = Module['__emwebxr_on_simple_event'] = createExportWrapper('_emwebxr_on_simple_event');
var ___funcs_on_exit = createExportWrapper('__funcs_on_exit');
var _emscripten_builtin_memalign = createExportWrapper('emscripten_builtin_memalign');
var __emscripten_timeout = createExportWrapper('_emscripten_timeout');
var _setThrew = createExportWrapper('setThrew');
var _emscripten_stack_init = () => (_emscripten_stack_init = wasmExports['emscripten_stack_init'])();
var _emscripten_stack_get_free = () => (_emscripten_stack_get_free = wasmExports['emscripten_stack_get_free'])();
var _emscripten_stack_get_base = () => (_emscripten_stack_get_base = wasmExports['emscripten_stack_get_base'])();
var _emscripten_stack_get_end = () => (_emscripten_stack_get_end = wasmExports['emscripten_stack_get_end'])();
var stackSave = createExportWrapper('stackSave');
var stackRestore = createExportWrapper('stackRestore');
var stackAlloc = createExportWrapper('stackAlloc');
var _emscripten_stack_get_current = () => (_emscripten_stack_get_current = wasmExports['emscripten_stack_get_current'])();
var dynCall_ji = Module['dynCall_ji'] = createExportWrapper('dynCall_ji');
var dynCall_jiii = Module['dynCall_jiii'] = createExportWrapper('dynCall_jiii');
var dynCall_viji = Module['dynCall_viji'] = createExportWrapper('dynCall_viji');
var dynCall_jii = Module['dynCall_jii'] = createExportWrapper('dynCall_jii');
var dynCall_vij = Module['dynCall_vij'] = createExportWrapper('dynCall_vij');
var dynCall_jiiiiiii = Module['dynCall_jiiiiiii'] = createExportWrapper('dynCall_jiiiiiii');
var dynCall_vijiiiiiiiii = Module['dynCall_vijiiiiiiiii'] = createExportWrapper('dynCall_vijiiiiiiiii');
var dynCall_vijj = Module['dynCall_vijj'] = createExportWrapper('dynCall_vijj');
var dynCall_vijiiiffi = Module['dynCall_vijiiiffi'] = createExportWrapper('dynCall_vijiiiffi');
var dynCall_vijiiifii = Module['dynCall_vijiiifii'] = createExportWrapper('dynCall_vijiiifii');
var dynCall_vijii = Module['dynCall_vijii'] = createExportWrapper('dynCall_vijii');
var dynCall_iij = Module['dynCall_iij'] = createExportWrapper('dynCall_iij');
var dynCall_vijif = Module['dynCall_vijif'] = createExportWrapper('dynCall_vijif');
var dynCall_vijifff = Module['dynCall_vijifff'] = createExportWrapper('dynCall_vijifff');
var dynCall_viij = Module['dynCall_viij'] = createExportWrapper('dynCall_viij');
var dynCall_fiji = Module['dynCall_fiji'] = createExportWrapper('dynCall_fiji');
var dynCall_jij = Module['dynCall_jij'] = createExportWrapper('dynCall_jij');
var dynCall_vijiiffifffi = Module['dynCall_vijiiffifffi'] = createExportWrapper('dynCall_vijiiffifffi');
var dynCall_vijf = Module['dynCall_vijf'] = createExportWrapper('dynCall_vijf');
var dynCall_fij = Module['dynCall_fij'] = createExportWrapper('dynCall_fij');
var dynCall_iijj = Module['dynCall_iijj'] = createExportWrapper('dynCall_iijj');
var dynCall_vijji = Module['dynCall_vijji'] = createExportWrapper('dynCall_vijji');
var dynCall_vijiiii = Module['dynCall_vijiiii'] = createExportWrapper('dynCall_vijiiii');
var dynCall_iijjfj = Module['dynCall_iijjfj'] = createExportWrapper('dynCall_iijjfj');
var dynCall_vijiii = Module['dynCall_vijiii'] = createExportWrapper('dynCall_vijiii');
var dynCall_vijiji = Module['dynCall_vijiji'] = createExportWrapper('dynCall_vijiji');
var dynCall_jijii = Module['dynCall_jijii'] = createExportWrapper('dynCall_jijii');
var dynCall_viiji = Module['dynCall_viiji'] = createExportWrapper('dynCall_viiji');
var dynCall_vijd = Module['dynCall_vijd'] = createExportWrapper('dynCall_vijd');
var dynCall_vijid = Module['dynCall_vijid'] = createExportWrapper('dynCall_vijid');
var dynCall_vijiiiii = Module['dynCall_vijiiiii'] = createExportWrapper('dynCall_vijiiiii');
var dynCall_vijij = Module['dynCall_vijij'] = createExportWrapper('dynCall_vijij');
var dynCall_jiji = Module['dynCall_jiji'] = createExportWrapper('dynCall_jiji');
var dynCall_vijiiiiiii = Module['dynCall_vijiiiiiii'] = createExportWrapper('dynCall_vijiiiiiii');
var dynCall_viijfii = Module['dynCall_viijfii'] = createExportWrapper('dynCall_viijfii');
var dynCall_viijii = Module['dynCall_viijii'] = createExportWrapper('dynCall_viijii');
var dynCall_viiiiiiiiiiijjjjjjifiiiiii = Module['dynCall_viiiiiiiiiiijjjjjjifiiiiii'] = createExportWrapper('dynCall_viiiiiiiiiiijjjjjjifiiiiii');
var dynCall_viiiiiji = Module['dynCall_viiiiiji'] = createExportWrapper('dynCall_viiiiiji');
var dynCall_viijiiii = Module['dynCall_viijiiii'] = createExportWrapper('dynCall_viijiiii');
var dynCall_viijiii = Module['dynCall_viijiii'] = createExportWrapper('dynCall_viijiii');
var dynCall_iiji = Module['dynCall_iiji'] = createExportWrapper('dynCall_iiji');
var dynCall_viiij = Module['dynCall_viiij'] = createExportWrapper('dynCall_viiij');
var dynCall_viijd = Module['dynCall_viijd'] = createExportWrapper('dynCall_viijd');
var dynCall_diij = Module['dynCall_diij'] = createExportWrapper('dynCall_diij');
var dynCall_viiiji = Module['dynCall_viiiji'] = createExportWrapper('dynCall_viiiji');
var dynCall_viiiij = Module['dynCall_viiiij'] = createExportWrapper('dynCall_viiiij');
var dynCall_viiijj = Module['dynCall_viiijj'] = createExportWrapper('dynCall_viiijj');
var dynCall_viijji = Module['dynCall_viijji'] = createExportWrapper('dynCall_viijji');
var dynCall_jiiij = Module['dynCall_jiiij'] = createExportWrapper('dynCall_jiiij');
var dynCall_jiijjj = Module['dynCall_jiijjj'] = createExportWrapper('dynCall_jiijjj');
var dynCall_jiijj = Module['dynCall_jiijj'] = createExportWrapper('dynCall_jiijj');
var dynCall_iiij = Module['dynCall_iiij'] = createExportWrapper('dynCall_iiij');
var dynCall_viiijiji = Module['dynCall_viiijiji'] = createExportWrapper('dynCall_viiijiji');
var dynCall_viiijjiji = Module['dynCall_viiijjiji'] = createExportWrapper('dynCall_viiijjiji');
var dynCall_viijj = Module['dynCall_viijj'] = createExportWrapper('dynCall_viijj');
var dynCall_viijiji = Module['dynCall_viijiji'] = createExportWrapper('dynCall_viijiji');
var dynCall_iiiiijiii = Module['dynCall_iiiiijiii'] = createExportWrapper('dynCall_iiiiijiii');
var dynCall_iiiiiijd = Module['dynCall_iiiiiijd'] = createExportWrapper('dynCall_iiiiiijd');
var dynCall_diidj = Module['dynCall_diidj'] = createExportWrapper('dynCall_diidj');
var dynCall_viiiijij = Module['dynCall_viiiijij'] = createExportWrapper('dynCall_viiiijij');
var dynCall_viiidjj = Module['dynCall_viiidjj'] = createExportWrapper('dynCall_viiidjj');
var dynCall_viidj = Module['dynCall_viidj'] = createExportWrapper('dynCall_viidj');
var dynCall_iiijj = Module['dynCall_iiijj'] = createExportWrapper('dynCall_iiijj');
var dynCall_jiid = Module['dynCall_jiid'] = createExportWrapper('dynCall_jiid');
var dynCall_jiij = Module['dynCall_jiij'] = createExportWrapper('dynCall_jiij');
var dynCall_viiiiddji = Module['dynCall_viiiiddji'] = createExportWrapper('dynCall_viiiiddji');
var dynCall_fijj = Module['dynCall_fijj'] = createExportWrapper('dynCall_fijj');
var dynCall_jiiii = Module['dynCall_jiiii'] = createExportWrapper('dynCall_jiiii');
var dynCall_iiiijf = Module['dynCall_iiiijf'] = createExportWrapper('dynCall_iiiijf');
var dynCall_iiiiiiji = Module['dynCall_iiiiiiji'] = createExportWrapper('dynCall_iiiiiiji');
var dynCall_iiiiiiiji = Module['dynCall_iiiiiiiji'] = createExportWrapper('dynCall_iiiiiiiji');
var dynCall_jiiiii = Module['dynCall_jiiiii'] = createExportWrapper('dynCall_jiiiii');
var dynCall_vijiiiiii = Module['dynCall_vijiiiiii'] = createExportWrapper('dynCall_vijiiiiii');
var dynCall_vijiff = Module['dynCall_vijiff'] = createExportWrapper('dynCall_vijiff');
var dynCall_vijff = Module['dynCall_vijff'] = createExportWrapper('dynCall_vijff');
var dynCall_vijjjj = Module['dynCall_vijjjj'] = createExportWrapper('dynCall_vijjjj');
var dynCall_viiiiijj = Module['dynCall_viiiiijj'] = createExportWrapper('dynCall_viiiiijj');
var dynCall_viiiiifiijii = Module['dynCall_viiiiifiijii'] = createExportWrapper('dynCall_viiiiifiijii');
var dynCall_viiiiifiiijjii = Module['dynCall_viiiiifiiijjii'] = createExportWrapper('dynCall_viiiiifiiijjii');
var dynCall_viiiiifiiijii = Module['dynCall_viiiiifiiijii'] = createExportWrapper('dynCall_viiiiifiiijii');
var dynCall_viiiiifiiiijjii = Module['dynCall_viiiiifiiiijjii'] = createExportWrapper('dynCall_viiiiifiiiijjii');
var dynCall_viijiiiiiiiii = Module['dynCall_viijiiiiiiiii'] = createExportWrapper('dynCall_viijiiiiiiiii');
var dynCall_viiijii = Module['dynCall_viiijii'] = createExportWrapper('dynCall_viiijii');
var dynCall_iiiij = Module['dynCall_iiiij'] = createExportWrapper('dynCall_iiiij');
var dynCall_jiifff = Module['dynCall_jiifff'] = createExportWrapper('dynCall_jiifff');
var dynCall_jiiifi = Module['dynCall_jiiifi'] = createExportWrapper('dynCall_jiiifi');
var dynCall_viiiiiiij = Module['dynCall_viiiiiiij'] = createExportWrapper('dynCall_viiiiiiij');
var dynCall_viiiiij = Module['dynCall_viiiiij'] = createExportWrapper('dynCall_viiiiij');
var dynCall_jiiifiiiii = Module['dynCall_jiiifiiiii'] = createExportWrapper('dynCall_jiiifiiiii');
var dynCall_viiiifijii = Module['dynCall_viiiifijii'] = createExportWrapper('dynCall_viiiifijii');
var dynCall_viiiifiijjii = Module['dynCall_viiiifiijjii'] = createExportWrapper('dynCall_viiiifiijjii');
var dynCall_vijiiifiijii = Module['dynCall_vijiiifiijii'] = createExportWrapper('dynCall_vijiiifiijii');
var dynCall_vijiiifiiijjii = Module['dynCall_vijiiifiiijjii'] = createExportWrapper('dynCall_vijiiifiiijjii');
var dynCall_vijiiifiiijii = Module['dynCall_vijiiifiiijii'] = createExportWrapper('dynCall_vijiiifiiijii');
var dynCall_vijiiifiiiijjii = Module['dynCall_vijiiifiiiijjii'] = createExportWrapper('dynCall_vijiiifiiiijjii');
var dynCall_fijiiii = Module['dynCall_fijiiii'] = createExportWrapper('dynCall_fijiiii');
var dynCall_fijiiiii = Module['dynCall_fijiiiii'] = createExportWrapper('dynCall_fijiiiii');
var dynCall_iijii = Module['dynCall_iijii'] = createExportWrapper('dynCall_iijii');
var dynCall_iijiijiiiii = Module['dynCall_iijiijiiiii'] = createExportWrapper('dynCall_iijiijiiiii');
var dynCall_vijjii = Module['dynCall_vijjii'] = createExportWrapper('dynCall_vijjii');
var dynCall_vijiif = Module['dynCall_vijiif'] = createExportWrapper('dynCall_vijiif');
var dynCall_iijijiiiii = Module['dynCall_iijijiiiii'] = createExportWrapper('dynCall_iijijiiiii');
var dynCall_vijijj = Module['dynCall_vijijj'] = createExportWrapper('dynCall_vijijj');
var dynCall_vijiiijj = Module['dynCall_vijiiijj'] = createExportWrapper('dynCall_vijiiijj');
var dynCall_vijiijj = Module['dynCall_vijiijj'] = createExportWrapper('dynCall_vijiijj');
var dynCall_vijjiji = Module['dynCall_vijjiji'] = createExportWrapper('dynCall_vijjiji');
var dynCall_vijjiijii = Module['dynCall_vijjiijii'] = createExportWrapper('dynCall_vijjiijii');
var dynCall_fijii = Module['dynCall_fijii'] = createExportWrapper('dynCall_fijii');
var dynCall_iiiiiiij = Module['dynCall_iiiiiiij'] = createExportWrapper('dynCall_iiiiiiij');
var dynCall_vijiiiij = Module['dynCall_vijiiiij'] = createExportWrapper('dynCall_vijiiiij');
var dynCall_jijj = Module['dynCall_jijj'] = createExportWrapper('dynCall_jijj');
var dynCall_jiiif = Module['dynCall_jiiif'] = createExportWrapper('dynCall_jiiif');
var dynCall_vijiiiiiidddd = Module['dynCall_vijiiiiiidddd'] = createExportWrapper('dynCall_vijiiiiiidddd');
var dynCall_jiijiiii = Module['dynCall_jiijiiii'] = createExportWrapper('dynCall_jiijiiii');
var dynCall_jiiji = Module['dynCall_jiiji'] = createExportWrapper('dynCall_jiiji');
var dynCall_jiiiji = Module['dynCall_jiiiji'] = createExportWrapper('dynCall_jiiiji');
var dynCall_jiijii = Module['dynCall_jiijii'] = createExportWrapper('dynCall_jiijii');
var dynCall_iijiiij = Module['dynCall_iijiiij'] = createExportWrapper('dynCall_iijiiij');
var dynCall_jijjjiiiiijii = Module['dynCall_jijjjiiiiijii'] = createExportWrapper('dynCall_jijjjiiiiijii');
var dynCall_jijiiiiifiii = Module['dynCall_jijiiiiifiii'] = createExportWrapper('dynCall_jijiiiiifiii');
var dynCall_viijiiiiiifiii = Module['dynCall_viijiiiiiifiii'] = createExportWrapper('dynCall_viijiiiiiifiii');
var dynCall_vijiffifff = Module['dynCall_vijiffifff'] = createExportWrapper('dynCall_vijiffifff');
var dynCall_vijiffff = Module['dynCall_vijiffff'] = createExportWrapper('dynCall_vijiffff');
var dynCall_vijjf = Module['dynCall_vijjf'] = createExportWrapper('dynCall_vijjf');
var dynCall_vijiiifi = Module['dynCall_vijiiifi'] = createExportWrapper('dynCall_vijiiifi');
var dynCall_vijiifi = Module['dynCall_vijiifi'] = createExportWrapper('dynCall_vijiifi');
var dynCall_vijifi = Module['dynCall_vijifi'] = createExportWrapper('dynCall_vijifi');
var dynCall_vijijiii = Module['dynCall_vijijiii'] = createExportWrapper('dynCall_vijijiii');
var dynCall_vijijiiii = Module['dynCall_vijijiiii'] = createExportWrapper('dynCall_vijijiiii');
var dynCall_vijijiiiff = Module['dynCall_vijijiiiff'] = createExportWrapper('dynCall_vijijiiiff');
var dynCall_vijijii = Module['dynCall_vijijii'] = createExportWrapper('dynCall_vijijii');
var dynCall_vijiijiiiiii = Module['dynCall_vijiijiiiiii'] = createExportWrapper('dynCall_vijiijiiiiii');
var dynCall_vijiiij = Module['dynCall_vijiiij'] = createExportWrapper('dynCall_vijiiij');
var dynCall_vijiiiiiiji = Module['dynCall_vijiiiiiiji'] = createExportWrapper('dynCall_vijiiiiiiji');
var dynCall_vijjj = Module['dynCall_vijjj'] = createExportWrapper('dynCall_vijjj');
var dynCall_vijdddd = Module['dynCall_vijdddd'] = createExportWrapper('dynCall_vijdddd');
var dynCall_vijififi = Module['dynCall_vijififi'] = createExportWrapper('dynCall_vijififi');
var dynCall_vijfff = Module['dynCall_vijfff'] = createExportWrapper('dynCall_vijfff');
var dynCall_vijfiff = Module['dynCall_vijfiff'] = createExportWrapper('dynCall_vijfiff');
var dynCall_vijfi = Module['dynCall_vijfi'] = createExportWrapper('dynCall_vijfi');
var dynCall_vijffffi = Module['dynCall_vijffffi'] = createExportWrapper('dynCall_vijffffi');
var dynCall_vijiiffi = Module['dynCall_vijiiffi'] = createExportWrapper('dynCall_vijiiffi');
var dynCall_vijiifffffff = Module['dynCall_vijiifffffff'] = createExportWrapper('dynCall_vijiifffffff');
var dynCall_vijifiifffffifff = Module['dynCall_vijifiifffffifff'] = createExportWrapper('dynCall_vijifiifffffifff');
var dynCall_vijiiffffiffffj = Module['dynCall_vijiiffffiffffj'] = createExportWrapper('dynCall_vijiiffffiffffj');
var dynCall_vijiifff = Module['dynCall_vijiifff'] = createExportWrapper('dynCall_vijiifff');
var dynCall_vijiffffffff = Module['dynCall_vijiffffffff'] = createExportWrapper('dynCall_vijiffffffff');
var dynCall_vijiifiififff = Module['dynCall_vijiifiififff'] = createExportWrapper('dynCall_vijiifiififff');
var dynCall_vijifffij = Module['dynCall_vijifffij'] = createExportWrapper('dynCall_vijifffij');
var dynCall_viijjjiifjii = Module['dynCall_viijjjiifjii'] = createExportWrapper('dynCall_viijjjiifjii');
var dynCall_dij = Module['dynCall_dij'] = createExportWrapper('dynCall_dij');
var dynCall_vijjjii = Module['dynCall_vijjjii'] = createExportWrapper('dynCall_vijjjii');
var dynCall_jiiiiiiiiii = Module['dynCall_jiiiiiiiiii'] = createExportWrapper('dynCall_jiiiiiiiiii');
var dynCall_jiiiiii = Module['dynCall_jiiiiii'] = createExportWrapper('dynCall_jiiiiii');
var dynCall_jiiiiiiii = Module['dynCall_jiiiiiiii'] = createExportWrapper('dynCall_jiiiiiiii');
var dynCall_iijji = Module['dynCall_iijji'] = createExportWrapper('dynCall_iijji');
var dynCall_jjj = Module['dynCall_jjj'] = createExportWrapper('dynCall_jjj');
var dynCall_jjjj = Module['dynCall_jjjj'] = createExportWrapper('dynCall_jjjj');
var dynCall_viiiiji = Module['dynCall_viiiiji'] = createExportWrapper('dynCall_viiiiji');
var dynCall_ij = Module['dynCall_ij'] = createExportWrapper('dynCall_ij');
var dynCall_iijjiii = Module['dynCall_iijjiii'] = createExportWrapper('dynCall_iijjiii');
var dynCall_iiiiij = Module['dynCall_iiiiij'] = createExportWrapper('dynCall_iiiiij');
var dynCall_iiiiijj = Module['dynCall_iiiiijj'] = createExportWrapper('dynCall_iiiiijj');
var dynCall_iiiiiijj = Module['dynCall_iiiiiijj'] = createExportWrapper('dynCall_iiiiiijj');

function invoke_vi(index,a1) {
  var sp = stackSave();
  try {
    getWasmTableEntry(index)(a1);
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}

function invoke_viii(index,a1,a2,a3) {
  var sp = stackSave();
  try {
    getWasmTableEntry(index)(a1,a2,a3);
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}

function invoke_vii(index,a1,a2) {
  var sp = stackSave();
  try {
    getWasmTableEntry(index)(a1,a2);
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}

function invoke_viiii(index,a1,a2,a3,a4) {
  var sp = stackSave();
  try {
    getWasmTableEntry(index)(a1,a2,a3,a4);
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}

function invoke_iii(index,a1,a2) {
  var sp = stackSave();
  try {
    return getWasmTableEntry(index)(a1,a2);
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}

function invoke_ii(index,a1) {
  var sp = stackSave();
  try {
    return getWasmTableEntry(index)(a1);
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}

function invoke_v(index) {
  var sp = stackSave();
  try {
    getWasmTableEntry(index)();
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}

function invoke_iiii(index,a1,a2,a3) {
  var sp = stackSave();
  try {
    return getWasmTableEntry(index)(a1,a2,a3);
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}

function invoke_iiiii(index,a1,a2,a3,a4) {
  var sp = stackSave();
  try {
    return getWasmTableEntry(index)(a1,a2,a3,a4);
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}

function invoke_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
  var sp = stackSave();
  try {
    return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9);
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}

function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6) {
  var sp = stackSave();
  try {
    return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6);
  } catch(e) {
    stackRestore(sp);
    if (e !== e+0) throw e;
    _setThrew(1, 0);
  }
}


// include: postamble.js
// === Auto-generated postamble setup entry stuff ===

Module['callMain'] = callMain;
Module['cwrap'] = cwrap;
var missingLibrarySymbols = [
  'writeI53ToI64Clamped',
  'writeI53ToI64Signaling',
  'writeI53ToU64Clamped',
  'writeI53ToU64Signaling',
  'convertI32PairToI53',
  'convertU32PairToI53',
  'getHostByName',
  'getCallstack',
  'emscriptenLog',
  'convertPCtoSourceLocation',
  'readEmAsmArgs',
  'jstoi_s',
  'listenOnce',
  'autoResumeAudioContext',
  'dynCallLegacy',
  'getDynCaller',
  'dynCall',
  'asmjsMangle',
  'handleAllocatorInit',
  'HandleAllocator',
  'getNativeTypeSize',
  'STACK_SIZE',
  'STACK_ALIGN',
  'POINTER_SIZE',
  'ASSERTIONS',
  'uleb128Encode',
  'sigToWasmTypes',
  'generateFuncType',
  'convertJsFunctionToWasm',
  'getEmptyTableSlot',
  'updateTableMap',
  'getFunctionAddress',
  'addFunction',
  'removeFunction',
  'reallyNegative',
  'unSign',
  'strLen',
  'reSign',
  'formatString',
  'intArrayToString',
  'AsciiToString',
  'UTF16ToString',
  'stringToUTF16',
  'lengthBytesUTF16',
  'UTF32ToString',
  'stringToUTF32',
  'lengthBytesUTF32',
  'registerKeyEventCallback',
  'getBoundingClientRect',
  'fillMouseEventData',
  'registerMouseEventCallback',
  'registerWheelEventCallback',
  'registerUiEventCallback',
  'registerFocusEventCallback',
  'fillDeviceOrientationEventData',
  'registerDeviceOrientationEventCallback',
  'fillDeviceMotionEventData',
  'registerDeviceMotionEventCallback',
  'screenOrientation',
  'fillOrientationChangeEventData',
  'registerOrientationChangeEventCallback',
  'fillFullscreenChangeEventData',
  'registerFullscreenChangeEventCallback',
  'JSEvents_requestFullscreen',
  'JSEvents_resizeCanvasForFullscreen',
  'registerRestoreOldStyle',
  'hideEverythingExceptGivenElement',
  'restoreHiddenElements',
  'setLetterbox',
  'softFullscreenResizeWebGLRenderTarget',
  'doRequestFullscreen',
  'fillPointerlockChangeEventData',
  'registerPointerlockChangeEventCallback',
  'registerPointerlockErrorEventCallback',
  'requestPointerLock',
  'fillVisibilityChangeEventData',
  'registerVisibilityChangeEventCallback',
  'registerTouchEventCallback',
  'fillGamepadEventData',
  'registerGamepadEventCallback',
  'registerBeforeUnloadEventCallback',
  'fillBatteryEventData',
  'battery',
  'registerBatteryEventCallback',
  'setCanvasElementSize',
  'getCanvasElementSize',
  'jsStackTrace',
  'stackTrace',
  'checkWasiClock',
  'wasiRightsToMuslOFlags',
  'wasiOFlagsToMuslOFlags',
  'createDyncallWrapper',
  'setImmediateWrapped',
  'clearImmediateWrapped',
  'polyfillSetImmediate',
  'getPromise',
  'makePromise',
  'idsToPromises',
  'makePromiseCallback',
  'ExceptionInfo',
  'findMatchingCatch',
  '_setNetworkCallback',
  'emscriptenWebGLGetUniform',
  'emscriptenWebGLGetVertexAttrib',
  '__glGetActiveAttribOrUniform',
  'writeGLArray',
  'registerWebGlEventCallback',
  'runAndAbortIfError',
  'SDL_unicode',
  'SDL_ttfContext',
  'SDL_audio',
  'GLFW_Window',
  'emscriptenWebGLGetIndexed',
  'ALLOC_NORMAL',
  'ALLOC_STACK',
  'allocate',
  'writeStringToMemory',
  'writeAsciiToMemory',
];
missingLibrarySymbols.forEach(missingLibrarySymbol)

var unexportedSymbols = [
  'run',
  'addOnPreRun',
  'addOnInit',
  'addOnPreMain',
  'addOnExit',
  'addOnPostRun',
  'addRunDependency',
  'removeRunDependency',
  'FS_createFolder',
  'FS_createPath',
  'FS_createDataFile',
  'FS_createLazyFile',
  'FS_createLink',
  'FS_createDevice',
  'FS_unlink',
  'out',
  'err',
  'abort',
  'keepRuntimeAlive',
  'wasmMemory',
  'wasmTable',
  'wasmExports',
  'stackAlloc',
  'stackSave',
  'stackRestore',
  'getTempRet0',
  'setTempRet0',
  'writeStackCookie',
  'checkStackCookie',
  'writeI53ToI64',
  'readI53FromI64',
  'readI53FromU64',
  'convertI32PairToI53Checked',
  'ptrToString',
  'zeroMemory',
  'exitJS',
  'getHeapMax',
  'growMemory',
  'ENV',
  'MONTH_DAYS_REGULAR',
  'MONTH_DAYS_LEAP',
  'MONTH_DAYS_REGULAR_CUMULATIVE',
  'MONTH_DAYS_LEAP_CUMULATIVE',
  'isLeapYear',
  'ydayFromDate',
  'arraySum',
  'addDays',
  'ERRNO_CODES',
  'ERRNO_MESSAGES',
  'setErrNo',
  'inetPton4',
  'inetNtop4',
  'inetPton6',
  'inetNtop6',
  'readSockaddr',
  'writeSockaddr',
  'DNS',
  'Protocols',
  'Sockets',
  'initRandomFill',
  'randomFill',
  'timers',
  'warnOnce',
  'UNWIND_CACHE',
  'readEmAsmArgsArray',
  'jstoi_q',
  'getExecutableName',
  'handleException',
  'runtimeKeepalivePush',
  'runtimeKeepalivePop',
  'callUserCallback',
  'maybeExit',
  'safeSetTimeout',
  'asyncLoad',
  'alignMemory',
  'mmapAlloc',
  'getCFunc',
  'ccall',
  'freeTableIndexes',
  'functionsInTableMap',
  'setValue',
  'getValue',
  'PATH',
  'PATH_FS',
  'UTF8Decoder',
  'UTF8ArrayToString',
  'UTF8ToString',
  'stringToUTF8Array',
  'stringToUTF8',
  'lengthBytesUTF8',
  'intArrayFromString',
  'stringToAscii',
  'UTF16Decoder',
  'stringToNewUTF8',
  'stringToUTF8OnStack',
  'writeArrayToMemory',
  'JSEvents',
  'specialHTMLTargets',
  'maybeCStringToJsString',
  'findEventTarget',
  'findCanvasEventTarget',
  'currentFullscreenStrategy',
  'restoreOldWindowedStyle',
  'demangle',
  'demangleAll',
  'ExitStatus',
  'getEnvStrings',
  'doReadv',
  'doWritev',
  'promiseMap',
  'uncaughtExceptionCount',
  'exceptionLast',
  'exceptionCaught',
  'Browser',
  'setMainLoop',
  'wget',
  'SYSCALLS',
  'getSocketFromFD',
  'getSocketAddress',
  'preloadPlugins',
  'FS_createPreloadedFile',
  'FS_modeStringToFlags',
  'FS_getMode',
  'FS_stdin_getChar_buffer',
  'FS_stdin_getChar',
  'FS',
  'MEMFS',
  'TTY',
  'PIPEFS',
  'SOCKFS',
  'tempFixedLengthArray',
  'miniTempWebGLFloatBuffers',
  'miniTempWebGLIntBuffers',
  'heapObjectForWebGLType',
  'heapAccessShiftForWebGLHeap',
  'webgl_enable_ANGLE_instanced_arrays',
  'webgl_enable_OES_vertex_array_object',
  'webgl_enable_WEBGL_draw_buffers',
  'webgl_enable_WEBGL_multi_draw',
  'GL',
  'emscriptenWebGLGet',
  'computeUnpackAlignedImageSize',
  'colorChannelsInGlTextureFormat',
  'emscriptenWebGLGetTexPixelData',
  '__glGenObject',
  'webglGetUniformLocation',
  'webglPrepareUniformLocationsBeforeFirstUse',
  'webglGetLeftBracePos',
  'emscripten_webgl_power_preferences',
  'AL',
  'GLUT',
  'EGL',
  'GLEW',
  'IDBStore',
  'SDL',
  'SDL_gfx',
  'GLFW',
  'webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance',
  'webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance',
  'allocateUTF8',
  'allocateUTF8OnStack',
  'GodotWebXR',
  'GodotWebSocket',
  'GodotRTCDataChannel',
  'GodotRTCPeerConnection',
  'GodotAudio',
  'GodotAudioWorklet',
  'GodotAudioScript',
  'GodotDisplayVK',
  'GodotDisplayCursor',
  'GodotDisplayScreen',
  'GodotDisplay',
  'GodotFetch',
  'IDHandler',
  'GodotConfig',
  'GodotFS',
  'GodotOS',
  'GodotEventListeners',
  'GodotPWA',
  'GodotRuntime',
  'GodotInputGamepads',
  'GodotInputDragDrop',
  'GodotInput',
  'GodotWebGL2',
  'GodotJSWrapper',
  'IDBFS',
];
unexportedSymbols.forEach(unexportedRuntimeSymbol);



var calledRun;

dependenciesFulfilled = function runCaller() {
  // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
  if (!calledRun) run();
  if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
};

function callMain(args = []) {
  assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on Module["onRuntimeInitialized"])');
  assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called');

  var entryFunction = _main;

  args.unshift(thisProgram);

  var argc = args.length;
  var argv = stackAlloc((argc + 1) * 4);
  var argv_ptr = argv >> 2;
  args.forEach((arg) => {
    HEAP32[argv_ptr++] = stringToUTF8OnStack(arg);
  });
  HEAP32[argv_ptr] = 0;

  try {

    var ret = entryFunction(argc, argv);

    // if we're not running an evented main loop, it's time to exit
    exitJS(ret, /* implicit = */ true);
    return ret;
  }
  catch (e) {
    return handleException(e);
  }
}

function stackCheckInit() {
  // This is normally called automatically during __wasm_call_ctors but need to
  // get these values before even running any of the ctors so we call it redundantly
  // here.
  _emscripten_stack_init();
  // TODO(sbc): Move writeStackCookie to native to to avoid this.
  writeStackCookie();
}

function run(args = arguments_) {

  if (runDependencies > 0) {
    return;
  }

    stackCheckInit();

  preRun();

  // a preRun added a dependency, run will be called later
  if (runDependencies > 0) {
    return;
  }

  function doRun() {
    // run may have just been called through dependencies being fulfilled just in this very frame,
    // or while the async setStatus time below was happening
    if (calledRun) return;
    calledRun = true;
    Module['calledRun'] = true;

    if (ABORT) return;

    initRuntime();

    preMain();

    readyPromiseResolve(Module);
    if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();

    if (shouldRunNow) callMain(args);

    postRun();
  }

  if (Module['setStatus']) {
    Module['setStatus']('Running...');
    setTimeout(function() {
      setTimeout(function() {
        Module['setStatus']('');
      }, 1);
      doRun();
    }, 1);
  } else
  {
    doRun();
  }
  checkStackCookie();
}

if (Module['preInit']) {
  if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
  while (Module['preInit'].length > 0) {
    Module['preInit'].pop()();
  }
}

// shouldRunNow refers to calling main(), not run().
var shouldRunNow = false;

if (Module['noInitialRun']) shouldRunNow = false;

run();


// end include: postamble.js


  return moduleArg.ready
}

);
})();
if (typeof exports === 'object' && typeof module === 'object')
  module.exports = Godot;
else if (typeof define === 'function' && define['amd'])
  define([], () => Godot);

const Features = { // eslint-disable-line no-unused-vars
	/**
	 * Check whether WebGL is available. Optionally, specify a particular version of WebGL to check for.
	 *
	 * @param {number=} [majorVersion=1] The major WebGL version to check for.
	 * @returns {boolean} If the given major version of WebGL is available.
	 * @function Engine.isWebGLAvailable
	 */
	isWebGLAvailable: function (majorVersion = 1) {
		try {
			return !!document.createElement('canvas').getContext(['webgl', 'webgl2'][majorVersion - 1]);
		} catch (e) { /* Not available */ }
		return false;
	},

	/**
	 * Check whether the Fetch API available and supports streaming responses.
	 *
	 * @returns {boolean} If the Fetch API is available and supports streaming responses.
	 * @function Engine.isFetchAvailable
	 */
	isFetchAvailable: function () {
		return 'fetch' in window && 'Response' in window && 'body' in window.Response.prototype;
	},

	/**
	 * Check whether the engine is running in a Secure Context.
	 *
	 * @returns {boolean} If the engine is running in a Secure Context.
	 * @function Engine.isSecureContext
	 */
	isSecureContext: function () {
		return window['isSecureContext'] === true;
	},

	/**
	 * Check whether the engine is cross origin isolated.
	 * This value is dependent on Cross-Origin-Opener-Policy and Cross-Origin-Embedder-Policy headers sent by the server.
	 *
	 * @returns {boolean} If the engine is running in a Secure Context.
	 * @function Engine.isSecureContext
	 */
	isCrossOriginIsolated: function () {
		return window['crossOriginIsolated'] === true;
	},

	/**
	 * Check whether SharedBufferArray is available.
	 *
	 * Most browsers require the page to be running in a secure context, and the
	 * the server to provide specific CORS headers for SharedArrayBuffer to be available.
	 *
	 * @returns {boolean} If SharedArrayBuffer is available.
	 * @function Engine.isSharedArrayBufferAvailable
	 */
	isSharedArrayBufferAvailable: function () {
		return 'SharedArrayBuffer' in window;
	},

	/**
	 * Check whether the AudioContext supports AudioWorkletNodes.
	 *
	 * @returns {boolean} If AudioWorkletNode is available.
	 * @function Engine.isAudioWorkletAvailable
	 */
	isAudioWorkletAvailable: function () {
		return 'AudioContext' in window && 'audioWorklet' in AudioContext.prototype;
	},

	/**
	 * Return an array of missing required features (as string).
	 *
	 * @returns {Array<string>} A list of human-readable missing features.
	 * @function Engine.getMissingFeatures
	 */
	getMissingFeatures: function () {
		const missing = [];
		if (!Features.isWebGLAvailable(2)) {
			missing.push('WebGL2 - Check web browser configuration and hardware support');
		}
		if (!Features.isFetchAvailable()) {
			missing.push('Fetch - Check web browser version');
		}

		/**
		 * @type {boolean}
		 */
		// eslint-disable-next-line no-undef
		const compiledWithThreads = false;
		if (compiledWithThreads) {
			if (!Features.isSecureContext()) {
				missing.push('Secure Context - Check web server configuration (use HTTPS)');
			}
			if (!Features.isCrossOriginIsolated()) {
				missing.push('Cross Origin Isolation - Check web server configuration (send correct headers)');
			}
			if (!Features.isSharedArrayBufferAvailable()) {
				missing.push('SharedArrayBuffer - Check web server configuration (send correct headers)');
			}
		}
		// Audio is normally optional since we have a dummy fallback.
		return missing;
	},
};

const Preloader = /** @constructor */ function () { // eslint-disable-line no-unused-vars
	function getTrackedResponse(response, load_status) {
		function onloadprogress(reader, controller) {
			return reader.read().then(function (result) {
				if (load_status.done) {
					return Promise.resolve();
				}
				if (result.value) {
					controller.enqueue(result.value);
					load_status.loaded += result.value.length;
				}
				if (!result.done) {
					return onloadprogress(reader, controller);
				}
				load_status.done = true;
				return Promise.resolve();
			});
		}
		const reader = response.body.getReader();
		return new Response(new ReadableStream({
			start: function (controller) {
				onloadprogress(reader, controller).then(function () {
					controller.close();
				});
			},
		}), { headers: response.headers });
	}

	function loadFetch(file, tracker, fileSize, raw) {
		tracker[file] = {
			total: fileSize || 0,
			loaded: 0,
			done: false,
		};
		return fetch(file).then(function (response) {
			if (!response.ok) {
				return Promise.reject(new Error(`Failed loading file '${file}'`));
			}
			const tr = getTrackedResponse(response, tracker[file]);
			if (raw) {
				return Promise.resolve(tr);
			}
			return tr.arrayBuffer();
		});
	}

	function retry(func, attempts = 1) {
		function onerror(err) {
			if (attempts <= 1) {
				return Promise.reject(err);
			}
			return new Promise(function (resolve, reject) {
				setTimeout(function () {
					retry(func, attempts - 1).then(resolve).catch(reject);
				}, 1000);
			});
		}
		return func().catch(onerror);
	}

	const DOWNLOAD_ATTEMPTS_MAX = 4;
	const loadingFiles = {};
	const lastProgress = { loaded: 0, total: 0 };
	let progressFunc = null;

	const animateProgress = function () {
		let loaded = 0;
		let total = 0;
		let totalIsValid = true;
		let progressIsFinal = true;

		Object.keys(loadingFiles).forEach(function (file) {
			const stat = loadingFiles[file];
			if (!stat.done) {
				progressIsFinal = false;
			}
			if (!totalIsValid || stat.total === 0) {
				totalIsValid = false;
				total = 0;
			} else {
				total += stat.total;
			}
			loaded += stat.loaded;
		});
		if (loaded !== lastProgress.loaded || total !== lastProgress.total) {
			lastProgress.loaded = loaded;
			lastProgress.total = total;
			if (typeof progressFunc === 'function') {
				progressFunc(loaded, total);
			}
		}
		if (!progressIsFinal) {
			requestAnimationFrame(animateProgress);
		}
	};

	this.animateProgress = animateProgress;

	this.setProgressFunc = function (callback) {
		progressFunc = callback;
	};

	this.loadPromise = function (file, fileSize, raw = false) {
		return retry(loadFetch.bind(null, file, loadingFiles, fileSize, raw), DOWNLOAD_ATTEMPTS_MAX);
	};

	this.preloadedFiles = [];
	this.preload = function (pathOrBuffer, destPath, fileSize) {
		let buffer = null;
		if (typeof pathOrBuffer === 'string') {
			const me = this;
			return this.loadPromise(pathOrBuffer, fileSize).then(function (buf) {
				me.preloadedFiles.push({
					path: destPath || pathOrBuffer,
					buffer: buf,
				});
				return Promise.resolve();
			});
		} else if (pathOrBuffer instanceof ArrayBuffer) {
			buffer = new Uint8Array(pathOrBuffer);
		} else if (ArrayBuffer.isView(pathOrBuffer)) {
			buffer = new Uint8Array(pathOrBuffer.buffer);
		}
		if (buffer) {
			this.preloadedFiles.push({
				path: destPath,
				buffer: pathOrBuffer,
			});
			return Promise.resolve();
		}
		return Promise.reject(new Error('Invalid object for preloading'));
	};
};

/**
 * An object used to configure the Engine instance based on godot export options, and to override those in custom HTML
 * templates if needed.
 *
 * @header Engine configuration
 * @summary The Engine configuration object. This is just a typedef, create it like a regular object, e.g.:
 *
 * ``const MyConfig = { executable: 'godot', unloadAfterInit: false }``
 *
 * @typedef {Object} EngineConfig
 */
const EngineConfig = {}; // eslint-disable-line no-unused-vars

/**
 * @struct
 * @constructor
 * @ignore
 */
const InternalConfig = function (initConfig) { // eslint-disable-line no-unused-vars
	const cfg = /** @lends {InternalConfig.prototype} */ {
		/**
		 * Whether the unload the engine automatically after the instance is initialized.
		 *
		 * @memberof EngineConfig
		 * @default
		 * @type {boolean}
		 */
		unloadAfterInit: true,
		/**
		 * The HTML DOM Canvas object to use.
		 *
		 * By default, the first canvas element in the document will be used is none is specified.
		 *
		 * @memberof EngineConfig
		 * @default
		 * @type {?HTMLCanvasElement}
		 */
		canvas: null,
		/**
		 * The name of the WASM file without the extension. (Set by Godot Editor export process).
		 *
		 * @memberof EngineConfig
		 * @default
		 * @type {string}
		 */
		executable: '',
		/**
		 * An alternative name for the game pck to load. The executable name is used otherwise.
		 *
		 * @memberof EngineConfig
		 * @default
		 * @type {?string}
		 */
		mainPack: null,
		/**
		 * Specify a language code to select the proper localization for the game.
		 *
		 * The browser locale will be used if none is specified. See complete list of
		 * :ref:`supported locales <doc_locales>`.
		 *
		 * @memberof EngineConfig
		 * @type {?string}
		 * @default
		 */
		locale: null,
		/**
		 * The canvas resize policy determines how the canvas should be resized by Godot.
		 *
		 * ``0`` means Godot won't do any resizing. This is useful if you want to control the canvas size from
		 * javascript code in your template.
		 *
		 * ``1`` means Godot will resize the canvas on start, and when changing window size via engine functions.
		 *
		 * ``2`` means Godot will adapt the canvas size to match the whole browser window.
		 *
		 * @memberof EngineConfig
		 * @type {number}
		 * @default
		 */
		canvasResizePolicy: 2,
		/**
		 * The arguments to be passed as command line arguments on startup.
		 *
		 * See :ref:`command line tutorial <doc_command_line_tutorial>`.
		 *
		 * **Note**: :js:meth:`startGame <Engine.prototype.startGame>` will always add the ``--main-pack`` argument.
		 *
		 * @memberof EngineConfig
		 * @type {Array<string>}
		 * @default
		 */
		args: [],
		/**
		 * When enabled, the game canvas will automatically grab the focus when the engine starts.
		 *
		 * @memberof EngineConfig
		 * @type {boolean}
		 * @default
		 */
		focusCanvas: true,
		/**
		 * When enabled, this will turn on experimental virtual keyboard support on mobile.
		 *
		 * @memberof EngineConfig
		 * @type {boolean}
		 * @default
		 */
		experimentalVK: false,
		/**
		 * The progressive web app service worker to install.
		 * @memberof EngineConfig
		 * @default
		 * @type {string}
		 */
		serviceWorker: '',
		/**
		 * @ignore
		 * @type {Array.<string>}
		 */
		persistentPaths: ['/userfs'],
		/**
		 * @ignore
		 * @type {boolean}
		 */
		persistentDrops: false,
		/**
		 * @ignore
		 * @type {Array.<string>}
		 */
		gdextensionLibs: [],
		/**
		 * @ignore
		 * @type {Array.<string>}
		 */
		fileSizes: [],
		/**
		 * A callback function for handling Godot's ``OS.execute`` calls.
		 *
		 * This is for example used in the Web Editor template to switch between project manager and editor, and for running the game.
		 *
		 * @callback EngineConfig.onExecute
		 * @param {string} path The path that Godot's wants executed.
		 * @param {Array.<string>} args The arguments of the "command" to execute.
		 */
		/**
		 * @ignore
		 * @type {?function(string, Array.<string>)}
		 */
		onExecute: null,
		/**
		 * A callback function for being notified when the Godot instance quits.
		 *
		 * **Note**: This function will not be called if the engine crashes or become unresponsive.
		 *
		 * @callback EngineConfig.onExit
		 * @param {number} status_code The status code returned by Godot on exit.
		 */
		/**
		 * @ignore
		 * @type {?function(number)}
		 */
		onExit: null,
		/**
		 * A callback function for displaying download progress.
		 *
		 * The function is called once per frame while downloading files, so the usage of ``requestAnimationFrame()``
		 * is not necessary.
		 *
		 * If the callback function receives a total amount of bytes as 0, this means that it is impossible to calculate.
		 * Possible reasons include:
		 *
		 * -  Files are delivered with server-side chunked compression
		 * -  Files are delivered with server-side compression on Chromium
		 * -  Not all file downloads have started yet (usually on servers without multi-threading)
		 *
		 * @callback EngineConfig.onProgress
		 * @param {number} current The current amount of downloaded bytes so far.
		 * @param {number} total The total amount of bytes to be downloaded.
		 */
		/**
		 * @ignore
		 * @type {?function(number, number)}
		 */
		onProgress: null,
		/**
		 * A callback function for handling the standard output stream. This method should usually only be used in debug pages.
		 *
		 * By default, ``console.log()`` is used.
		 *
		 * @callback EngineConfig.onPrint
		 * @param {...*} [var_args] A variadic number of arguments to be printed.
		 */
		/**
		 * @ignore
		 * @type {?function(...*)}
		 */
		onPrint: function () {
			console.log.apply(console, Array.from(arguments)); // eslint-disable-line no-console
		},
		/**
		 * A callback function for handling the standard error stream. This method should usually only be used in debug pages.
		 *
		 * By default, ``console.error()`` is used.
		 *
		 * @callback EngineConfig.onPrintError
		 * @param {...*} [var_args] A variadic number of arguments to be printed as errors.
		*/
		/**
		 * @ignore
		 * @type {?function(...*)}
		 */
		onPrintError: function (var_args) {
			console.error.apply(console, Array.from(arguments)); // eslint-disable-line no-console
		},
	};

	/**
	 * @ignore
	 * @struct
	 * @constructor
	 * @param {EngineConfig} opts
	 */
	function Config(opts) {
		this.update(opts);
	}

	Config.prototype = cfg;

	/**
	 * @ignore
	 * @param {EngineConfig} opts
	 */
	Config.prototype.update = function (opts) {
		const config = opts || {};
		// NOTE: We must explicitly pass the default, accessing it via
		// the key will fail due to closure compiler renames.
		function parse(key, def) {
			if (typeof (config[key]) === 'undefined') {
				return def;
			}
			return config[key];
		}
		// Module config
		this.unloadAfterInit = parse('unloadAfterInit', this.unloadAfterInit);
		this.onPrintError = parse('onPrintError', this.onPrintError);
		this.onPrint = parse('onPrint', this.onPrint);
		this.onProgress = parse('onProgress', this.onProgress);

		// Godot config
		this.canvas = parse('canvas', this.canvas);
		this.executable = parse('executable', this.executable);
		this.mainPack = parse('mainPack', this.mainPack);
		this.locale = parse('locale', this.locale);
		this.canvasResizePolicy = parse('canvasResizePolicy', this.canvasResizePolicy);
		this.persistentPaths = parse('persistentPaths', this.persistentPaths);
		this.persistentDrops = parse('persistentDrops', this.persistentDrops);
		this.experimentalVK = parse('experimentalVK', this.experimentalVK);
		this.focusCanvas = parse('focusCanvas', this.focusCanvas);
		this.serviceWorker = parse('serviceWorker', this.serviceWorker);
		this.gdextensionLibs = parse('gdextensionLibs', this.gdextensionLibs);
		this.fileSizes = parse('fileSizes', this.fileSizes);
		this.args = parse('args', this.args);
		this.onExecute = parse('onExecute', this.onExecute);
		this.onExit = parse('onExit', this.onExit);
	};

	/**
	 * @ignore
	 * @param {string} loadPath
	 * @param {Response} response
	 */
	Config.prototype.getModuleConfig = function (loadPath, response) {
		let r = response;
		return {
			'print': this.onPrint,
			'printErr': this.onPrintError,
			'thisProgram': this.executable,
			'noExitRuntime': false,
			'dynamicLibraries': [`${loadPath}.side.wasm`],
			'instantiateWasm': function (imports, onSuccess) {
				function done(result) {
					onSuccess(result['instance'], result['module']);
				}
				if (typeof (WebAssembly.instantiateStreaming) !== 'undefined') {
					WebAssembly.instantiateStreaming(Promise.resolve(r), imports).then(done);
				} else {
					r.arrayBuffer().then(function (buffer) {
						WebAssembly.instantiate(buffer, imports).then(done);
					});
				}
				r = null;
				return {};
			},
			'locateFile': function (path) {
				if (!path.startsWith('godot.')) {
					return path;
				} else if (path.endsWith('.worker.js')) {
					return `${loadPath}.worker.js`;
				} else if (path.endsWith('.audio.worklet.js')) {
					return `${loadPath}.audio.worklet.js`;
				} else if (path.endsWith('.js')) {
					return `${loadPath}.js`;
				} else if (path.endsWith('.side.wasm')) {
					return `${loadPath}.side.wasm`;
				} else if (path.endsWith('.wasm')) {
					return `${loadPath}.wasm`;
				}
				return path;
			},
		};
	};

	/**
	 * @ignore
	 * @param {function()} cleanup
	 */
	Config.prototype.getGodotConfig = function (cleanup) {
		// Try to find a canvas
		if (!(this.canvas instanceof HTMLCanvasElement)) {
			const nodes = document.getElementsByTagName('canvas');
			if (nodes.length && nodes[0] instanceof HTMLCanvasElement) {
				const first = nodes[0];
				this.canvas = /** @type {!HTMLCanvasElement} */ (first);
			}
			if (!this.canvas) {
				throw new Error('No canvas found in page');
			}
		}
		// Canvas can grab focus on click, or key events won't work.
		if (this.canvas.tabIndex < 0) {
			this.canvas.tabIndex = 0;
		}

		// Browser locale, or custom one if defined.
		let locale = this.locale;
		if (!locale) {
			locale = navigator.languages ? navigator.languages[0] : navigator.language;
			locale = locale.split('.')[0];
		}
		locale = locale.replace('-', '_');
		const onExit = this.onExit;

		// Godot configuration.
		return {
			'canvas': this.canvas,
			'canvasResizePolicy': this.canvasResizePolicy,
			'locale': locale,
			'persistentDrops': this.persistentDrops,
			'virtualKeyboard': this.experimentalVK,
			'focusCanvas': this.focusCanvas,
			'onExecute': this.onExecute,
			'onExit': function (p_code) {
				cleanup(); // We always need to call the cleanup callback to free memory.
				if (typeof (onExit) === 'function') {
					onExit(p_code);
				}
			},
		};
	};
	return new Config(initConfig);
};

/**
 * Projects exported for the Web expose the :js:class:`Engine` class to the JavaScript environment, that allows
 * fine control over the engine's start-up process.
 *
 * This API is built in an asynchronous manner and requires basic understanding
 * of `Promises <https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Using_promises>`__.
 *
 * @module Engine
 * @header Web export JavaScript reference
 */
const Engine = (function () {
	const preloader = new Preloader();

	let loadPromise = null;
	let loadPath = '';
	let initPromise = null;

	/**
	 * @classdesc The ``Engine`` class provides methods for loading and starting exported projects on the Web. For default export
	 * settings, this is already part of the exported HTML page. To understand practical use of the ``Engine`` class,
	 * see :ref:`Custom HTML page for Web export <doc_customizing_html5_shell>`.
	 *
	 * @description Create a new Engine instance with the given configuration.
	 *
	 * @global
	 * @constructor
	 * @param {EngineConfig} initConfig The initial config for this instance.
	 */
	function Engine(initConfig) { // eslint-disable-line no-shadow
		this.config = new InternalConfig(initConfig);
		this.rtenv = null;
	}

	/**
	 * Load the engine from the specified base path.
	 *
	 * @param {string} basePath Base path of the engine to load.
	 * @param {number=} [size=0] The file size if known.
	 * @returns {Promise} A Promise that resolves once the engine is loaded.
	 *
	 * @function Engine.load
	 */
	Engine.load = function (basePath, size) {
		if (loadPromise == null) {
			loadPath = basePath;
			loadPromise = preloader.loadPromise(`${loadPath}.wasm`, size, true);
			requestAnimationFrame(preloader.animateProgress);
		}
		return loadPromise;
	};

	/**
	 * Unload the engine to free memory.
	 *
	 * This method will be called automatically depending on the configuration. See :js:attr:`unloadAfterInit`.
	 *
	 * @function Engine.unload
	 */
	Engine.unload = function () {
		loadPromise = null;
	};

	/**
	 * Safe Engine constructor, creates a new prototype for every new instance to avoid prototype pollution.
	 * @ignore
	 * @constructor
	 */
	function SafeEngine(initConfig) {
		const proto = /** @lends Engine.prototype */ {
			/**
			 * Initialize the engine instance. Optionally, pass the base path to the engine to load it,
			 * if it hasn't been loaded yet. See :js:meth:`Engine.load`.
			 *
			 * @param {string=} basePath Base path of the engine to load.
			 * @return {Promise} A ``Promise`` that resolves once the engine is loaded and initialized.
			 */
			init: function (basePath) {
				if (initPromise) {
					return initPromise;
				}
				if (loadPromise == null) {
					if (!basePath) {
						initPromise = Promise.reject(new Error('A base path must be provided when calling `init` and the engine is not loaded.'));
						return initPromise;
					}
					Engine.load(basePath, this.config.fileSizes[`${basePath}.wasm`]);
				}
				const me = this;
				function doInit(promise) {
					// Care! Promise chaining is bogus with old emscripten versions.
					// This caused a regression with the Mono build (which uses an older emscripten version).
					// Make sure to test that when refactoring.
					return new Promise(function (resolve, reject) {
						promise.then(function (response) {
							const cloned = new Response(response.clone().body, { 'headers': [['content-type', 'application/wasm']] });
							Godot(me.config.getModuleConfig(loadPath, cloned)).then(function (module) {
								const paths = me.config.persistentPaths;
								module['initFS'](paths).then(function (err) {
									me.rtenv = module;
									if (me.config.unloadAfterInit) {
										Engine.unload();
									}
									resolve();
								});
							});
						});
					});
				}
				preloader.setProgressFunc(this.config.onProgress);
				initPromise = doInit(loadPromise);
				return initPromise;
			},

			/**
			 * Load a file so it is available in the instance's file system once it runs. Must be called **before** starting the
			 * instance.
			 *
			 * If not provided, the ``path`` is derived from the URL of the loaded file.
			 *
			 * @param {string|ArrayBuffer} file The file to preload.
			 *
			 * If a ``string`` the file will be loaded from that path.
			 *
			 * If an ``ArrayBuffer`` or a view on one, the buffer will used as the content of the file.
			 *
			 * @param {string=} path Path by which the file will be accessible. Required, if ``file`` is not a string.
			 *
			 * @returns {Promise} A Promise that resolves once the file is loaded.
			 */
			preloadFile: function (file, path) {
				return preloader.preload(file, path, this.config.fileSizes[file]);
			},

			/**
			 * Start the engine instance using the given override configuration (if any).
			 * :js:meth:`startGame <Engine.prototype.startGame>` can be used in typical cases instead.
			 *
			 * This will initialize the instance if it is not initialized. For manual initialization, see :js:meth:`init <Engine.prototype.init>`.
			 * The engine must be loaded beforehand.
			 *
			 * Fails if a canvas cannot be found on the page, or not specified in the configuration.
			 *
			 * @param {EngineConfig} override An optional configuration override.
			 * @return {Promise} Promise that resolves once the engine started.
			 */
			start: function (override) {
				this.config.update(override);
				const me = this;
				return me.init().then(function () {
					if (!me.rtenv) {
						return Promise.reject(new Error('The engine must be initialized before it can be started'));
					}

					let config = {};
					try {
						config = me.config.getGodotConfig(function () {
							me.rtenv = null;
						});
					} catch (e) {
						return Promise.reject(e);
					}
					// Godot configuration.
					me.rtenv['initConfig'](config);

					// Preload GDExtension libraries.
					const libs = [];
					if (me.config.gdextensionLibs.length > 0 && !me.rtenv['loadDynamicLibrary']) {
						return Promise.reject(new Error('GDExtension libraries are not supported by this engine version. '
							+ 'Enable "Extensions Support" for your export preset and/or build your custom template with "dlink_enabled=yes".'));
					}
					me.config.gdextensionLibs.forEach(function (lib) {
						libs.push(me.rtenv['loadDynamicLibrary'](lib, { 'loadAsync': true }));
					});
					return Promise.all(libs).then(function () {
						return new Promise(function (resolve, reject) {
							preloader.preloadedFiles.forEach(function (file) {
								me.rtenv['copyToFS'](file.path, file.buffer);
							});
							preloader.preloadedFiles.length = 0; // Clear memory
							me.rtenv['callMain'](me.config.args);
							initPromise = null;
							if (me.config.serviceWorker && 'serviceWorker' in navigator) {
								navigator.serviceWorker.register(me.config.serviceWorker);
							}
							resolve();
						});
					});
				});
			},

			/**
			 * Start the game instance using the given configuration override (if any).
			 *
			 * This will initialize the instance if it is not initialized. For manual initialization, see :js:meth:`init <Engine.prototype.init>`.
			 *
			 * This will load the engine if it is not loaded, and preload the main pck.
			 *
			 * This method expects the initial config (or the override) to have both the :js:attr:`executable` and :js:attr:`mainPack`
			 * properties set (normally done by the editor during export).
			 *
			 * @param {EngineConfig} override An optional configuration override.
			 * @return {Promise} Promise that resolves once the game started.
			 */
			startGame: function (override) {
				this.config.update(override);
				// Add main-pack argument.
				const exe = this.config.executable;
				const pack = this.config.mainPack || `${exe}.pck`;
				this.config.args = ['--main-pack', pack].concat(this.config.args);
				// Start and init with execName as loadPath if not inited.
				const me = this;
				return Promise.all([
					this.init(exe),
					this.preloadFile(pack, pack),
				]).then(function () {
					return me.start.apply(me);
				});
			},

			/**
			 * Create a file at the specified ``path`` with the passed as ``buffer`` in the instance's file system.
			 *
			 * @param {string} path The location where the file will be created.
			 * @param {ArrayBuffer} buffer The content of the file.
			 */
			copyToFS: function (path, buffer) {
				if (this.rtenv == null) {
					throw new Error('Engine must be inited before copying files');
				}
				this.rtenv['copyToFS'](path, buffer);
			},

			/**
			 * Request that the current instance quit.
			 *
			 * This is akin the user pressing the close button in the window manager, and will
			 * have no effect if the engine has crashed, or is stuck in a loop.
			 *
			 */
			requestQuit: function () {
				if (this.rtenv) {
					this.rtenv['request_quit']();
				}
			},
		};

		Engine.prototype = proto;
		// Closure compiler exported instance methods.
		Engine.prototype['init'] = Engine.prototype.init;
		Engine.prototype['preloadFile'] = Engine.prototype.preloadFile;
		Engine.prototype['start'] = Engine.prototype.start;
		Engine.prototype['startGame'] = Engine.prototype.startGame;
		Engine.prototype['copyToFS'] = Engine.prototype.copyToFS;
		Engine.prototype['requestQuit'] = Engine.prototype.requestQuit;
		// Also expose static methods as instance methods
		Engine.prototype['load'] = Engine.load;
		Engine.prototype['unload'] = Engine.unload;
		return new Engine(initConfig);
	}

	// Closure compiler exported static methods.
	SafeEngine['load'] = Engine.load;
	SafeEngine['unload'] = Engine.unload;

	// Feature-detection utilities.
	SafeEngine['isWebGLAvailable'] = Features.isWebGLAvailable;
	SafeEngine['isFetchAvailable'] = Features.isFetchAvailable;
	SafeEngine['isSecureContext'] = Features.isSecureContext;
	SafeEngine['isCrossOriginIsolated'] = Features.isCrossOriginIsolated;
	SafeEngine['isSharedArrayBufferAvailable'] = Features.isSharedArrayBufferAvailable;
	SafeEngine['isAudioWorkletAvailable'] = Features.isAudioWorkletAvailable;
	SafeEngine['getMissingFeatures'] = Features.getMissingFeatures;

	return SafeEngine;
}());
if (typeof window !== 'undefined') {
	window['Engine'] = Engine;
}