diff --git a/go.mod b/go.mod index ddd640e68..a6b2ccb81 100644 --- a/go.mod +++ b/go.mod @@ -4,7 +4,7 @@ go 1.22.0 require ( github.com/go-ini/ini v1.67.0 - github.com/go-mysql-org/go-mysql v1.7.0 + github.com/go-mysql-org/go-mysql v1.8.0 github.com/go-sql-driver/mysql v1.8.1 github.com/google/uuid v1.6.0 github.com/openark/golib v0.0.0-20210531070646-355f37940af8 @@ -15,10 +15,19 @@ require ( require ( filippo.io/edwards25519 v1.1.0 // indirect - github.com/pingcap/errors v0.11.5-0.20210425183316-da1aaba5fb63 // indirect - github.com/shopspring/decimal v0.0.0-20180709203117-cd690d0c9e24 // indirect + github.com/Masterminds/semver v1.5.0 // indirect + github.com/goccy/go-json v0.10.2 // indirect + github.com/klauspost/compress v1.17.1 // indirect + github.com/pingcap/errors v0.11.5-0.20221009092201-b66cddb77c32 // indirect + github.com/pingcap/log v1.1.1-0.20230317032135-a0d097d16e22 // indirect + github.com/pingcap/tidb/pkg/parser v0.0.0-20231103042308-035ad5ccbe67 // indirect + github.com/shopspring/decimal v1.2.0 // indirect github.com/siddontang/go v0.0.0-20180604090527-bdc77568d726 // indirect github.com/siddontang/go-log v0.0.0-20180807004314-8d05993dda07 // indirect - go.uber.org/atomic v1.7.0 // indirect + go.uber.org/atomic v1.11.0 // indirect + go.uber.org/multierr v1.11.0 // indirect + go.uber.org/zap v1.26.0 // indirect + golang.org/x/exp v0.0.0-20231006140011-7918f672742d // indirect golang.org/x/sys v0.19.0 // indirect + gopkg.in/natefinch/lumberjack.v2 v2.2.1 // indirect ) diff --git a/go.sum b/go.sum index 5b18128f6..60049290b 100644 --- a/go.sum +++ b/go.sum @@ -1,122 +1,95 @@ filippo.io/edwards25519 v1.1.0 h1:FNf4tywRC1HmFuKW5xopWpigGjJKiJSV0Cqo0cJWDaA= filippo.io/edwards25519 v1.1.0/go.mod h1:BxyFTGdWcka3PhytdK4V28tE5sGfRvvvRV7EaN4VDT4= github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/Masterminds/semver v1.5.0 h1:H65muMkzWKEuNDnfl9d70GUjFniHKHRbFPGBuZ3QEww= +github.com/Masterminds/semver v1.5.0/go.mod h1:MB6lktGJrhw8PrUyiEoblNEGEQ+RzHPF078ddwwvV3Y= github.com/benbjohnson/clock v1.1.0/go.mod h1:J11/hYXuz8f4ySSvYwY0FKfm+ezbsZBKZxNJlLklBHA= -github.com/cznic/mathutil v0.0.0-20181122101859-297441e03548/go.mod h1:e6NPNENfs9mPDVNRekM7lKScauxd5kXTr1Mfyig6TDM= -github.com/cznic/sortutil v0.0.0-20181122101858-f5f958428db8/go.mod h1:q2w6Bg5jeox1B+QkJ6Wp/+Vn0G/bo3f1uY7Fn3vivIQ= -github.com/cznic/strutil v0.0.0-20171016134553-529a34b1c186/go.mod h1:AHHPPPXTw0h6pVabbcbyGRK1DckRn7r/STdZEeIDzZc= github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/go-ini/ini v1.67.0 h1:z6ZrTEZqSWOTyH2FlglNbNgARyHG8oLW9gMELqKr06A= github.com/go-ini/ini v1.67.0/go.mod h1:ByCAeIL28uOIIG0E3PJtZPDL8WnHpFKFOtgjp+3Ies8= -github.com/go-mysql-org/go-mysql v1.7.0 h1:qE5FTRb3ZeTQmlk3pjE+/m2ravGxxRDrVDTyDe9tvqI= -github.com/go-mysql-org/go-mysql v1.7.0/go.mod h1:9cRWLtuXNKhamUPMkrDVzBhaomGvqLRLtBiyjvjc4pk= -github.com/go-sql-driver/mysql v1.5.0/go.mod h1:DCzpHaOWr8IXmIStZouvnhqoel9Qv2LBy8hT2VhHyBg= -github.com/go-sql-driver/mysql v1.6.0/go.mod h1:DCzpHaOWr8IXmIStZouvnhqoel9Qv2LBy8hT2VhHyBg= +github.com/go-mysql-org/go-mysql v1.8.0 h1:bN+/Q5yyQXQOAabXPkI3GZX43w4Tsj2DIthjC9i6CkQ= +github.com/go-mysql-org/go-mysql v1.8.0/go.mod h1:kwbF156Z9Sy8amP3E1SZp7/s/0PuJj/xKaOWToQiq0Y= github.com/go-sql-driver/mysql v1.8.1 h1:LedoTUt/eveggdHS9qUFC1EFSa8bU2+1pZjSRpvNJ1Y= github.com/go-sql-driver/mysql v1.8.1/go.mod h1:wEBSXgmK//2ZFJyE+qWnIsVGmvmEKlqwuVSjsCm7DZg= -github.com/google/uuid v1.3.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= +github.com/goccy/go-json v0.10.2 h1:CrxCmQqYDkv1z7lO7Wbh2HN93uovUHgrECaO5ZrCXAU= +github.com/goccy/go-json v0.10.2/go.mod h1:6MelG93GURQebXPDq3khkgXZkazVtN9CRI+MGFi0w8I= github.com/google/uuid v1.6.0 h1:NIvaJDMOsjHA8n1jAhLSgzrAzy1Hgr+hNrb57e+94F0= github.com/google/uuid v1.6.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= -github.com/jmoiron/sqlx v1.3.3/go.mod h1:2BljVx/86SuTyjE+aPYlHCTNvZrnJXghYGpNiXLBMCQ= +github.com/klauspost/compress v1.17.1 h1:NE3C767s2ak2bweCZo3+rdP4U/HoyVXLv/X9f2gPS5g= +github.com/klauspost/compress v1.17.1/go.mod h1:ntbaceVETuRiXiv4DpjP66DpAtAGkEQskQzEyD//IeE= github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo= github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ= github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= -github.com/lib/pq v1.2.0/go.mod h1:5WUZQaWbwv1U+lTReE5YruASi9Al49XbQIvNi/34Woo= -github.com/mattn/go-sqlite3 v1.14.6/go.mod h1:NyWgC/yNuGj7Q9rpYnZvas74GogHl5/Z4A/KQRfk6bU= github.com/openark/golib v0.0.0-20210531070646-355f37940af8 h1:9ciIHNuyFqRWi9NpMNw9sVLB6z1ItpP5ZhTY9Q1xVu4= github.com/openark/golib v0.0.0-20210531070646-355f37940af8/go.mod h1:1jj8x1eDVZxgc/Z4VyamX4qTbAdHPUQA6NeVtCd8Sl8= -github.com/pingcap/check v0.0.0-20190102082844-67f458068fc8 h1:USx2/E1bX46VG32FIw034Au6seQ2fY9NEILmNh/UlQg= -github.com/pingcap/check v0.0.0-20190102082844-67f458068fc8/go.mod h1:B1+S9LNcuMyLH/4HMTViQOJevkGiik3wW2AN9zb2fNQ= github.com/pingcap/errors v0.11.0/go.mod h1:Oi8TUi2kEtXXLMJk9l1cGmz20kV3TaQ0usTwv5KuLY8= -github.com/pingcap/errors v0.11.5-0.20210425183316-da1aaba5fb63 h1:+FZIDR/D97YOPik4N4lPDaUcLDF/EQPogxtlHB2ZZRM= -github.com/pingcap/errors v0.11.5-0.20210425183316-da1aaba5fb63/go.mod h1:X2r9ueLEUZgtx2cIogM0v4Zj5uvvzhuuiu7Pn8HzMPg= -github.com/pingcap/log v0.0.0-20210625125904-98ed8e2eb1c7/go.mod h1:8AanEdAHATuRurdGxZXBz0At+9avep+ub7U1AGYLIMM= -github.com/pingcap/tidb/parser v0.0.0-20221126021158-6b02a5d8ba7d/go.mod h1:ElJiub4lRy6UZDb+0JHDkGEdr6aOli+ykhyej7VCLoI= +github.com/pingcap/errors v0.11.5-0.20221009092201-b66cddb77c32 h1:m5ZsBa5o/0CkzZXfXLaThzKuR85SnHHetqBCpzQ30h8= +github.com/pingcap/errors v0.11.5-0.20221009092201-b66cddb77c32/go.mod h1:X2r9ueLEUZgtx2cIogM0v4Zj5uvvzhuuiu7Pn8HzMPg= +github.com/pingcap/log v1.1.1-0.20230317032135-a0d097d16e22 h1:2SOzvGvE8beiC1Y4g9Onkvu6UmuBBOeWRGQEjJaT/JY= +github.com/pingcap/log v1.1.1-0.20230317032135-a0d097d16e22/go.mod h1:DWQW5jICDR7UJh4HtxXSM20Churx4CQL0fwL/SoOSA4= +github.com/pingcap/tidb/pkg/parser v0.0.0-20231103042308-035ad5ccbe67 h1:m0RZ583HjzG3NweDi4xAcK54NBBPJh+zXp5Fp60dHtw= +github.com/pingcap/tidb/pkg/parser v0.0.0-20231103042308-035ad5ccbe67/go.mod h1:yRkiqLFwIqibYg2P7h4bclHjHcJiIFRLKhGRyBcKYus= github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= -github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= -github.com/remyoudompheng/bigfft v0.0.0-20200410134404-eec4a21b6bb0/go.mod h1:qqbHyh8v60DhA7CoWK5oRCqLrMHRGoxYCSS9EjAz6Eo= -github.com/shopspring/decimal v0.0.0-20180709203117-cd690d0c9e24 h1:pntxY8Ary0t43dCZ5dqY4YTJCObLY1kIXl0uzMv+7DE= -github.com/shopspring/decimal v0.0.0-20180709203117-cd690d0c9e24/go.mod h1:M+9NzErvs504Cn4c5DxATwIqPbtswREoFCre64PpcG4= +github.com/shopspring/decimal v1.2.0 h1:abSATXmQEYyShuxI4/vyW3tV1MrKAJzCZ/0zLUXYbsQ= +github.com/shopspring/decimal v1.2.0/go.mod h1:DKyhrW/HYNuLGql+MJL6WCR6knT2jwCFRcu2hWCYk4o= github.com/siddontang/go v0.0.0-20180604090527-bdc77568d726 h1:xT+JlYxNGqyT+XcU8iUrN18JYed2TvG9yN5ULG2jATM= github.com/siddontang/go v0.0.0-20180604090527-bdc77568d726/go.mod h1:3yhqj7WBBfRhbBlzyOC3gUxftwsU0u8gqevxwIHQpMw= github.com/siddontang/go-log v0.0.0-20180807004314-8d05993dda07 h1:oI+RNwuC9jF2g2lP0u0cVEEZrc/AYBCuFdvwrLWM/6Q= github.com/siddontang/go-log v0.0.0-20180807004314-8d05993dda07/go.mod h1:yFdBgwXP24JziuRl2NMUahT7nGLNOKi1SIiFxMttVD4= github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= -github.com/stretchr/objx v0.4.0/go.mod h1:YvHI0jy2hoMjB+UWwv71VJQ9isScKT/TqJzVSSt89Yw= github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= -github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= -github.com/stretchr/testify v1.8.0 h1:pSgiaMZlXftHpm5L7V1+rVB+AZJydKsMxsQBIJw4PKk= -github.com/stretchr/testify v1.8.0/go.mod h1:yNjHg4UonilssWZ8iaSj1OCr/vHnekPRkoO+kdMU+MU= -github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= -go.uber.org/atomic v1.3.2/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE= +github.com/stretchr/testify v1.8.4 h1:CcVxjf3Q8PM0mHUKJCdn+eZZtm5yQwehR5yeSVQQcUk= +github.com/stretchr/testify v1.8.4/go.mod h1:sz/lmYIOXD/1dqDmKjjqLyZ2RngseejIcXlSw2iwfAo= go.uber.org/atomic v1.6.0/go.mod h1:sABNBOSYdrvTF6hTgEIbc7YasKWGhgEQZyfxyTvoXHQ= -go.uber.org/atomic v1.7.0 h1:ADUqmZGgLDDfbSL9ZmPxKTybcoEYHgpYfELNoN+7hsw= go.uber.org/atomic v1.7.0/go.mod h1:fEN4uk6kAWBTFdckzkM89CLk9XfWZrxpCo0nPH17wJc= +go.uber.org/atomic v1.9.0/go.mod h1:fEN4uk6kAWBTFdckzkM89CLk9XfWZrxpCo0nPH17wJc= +go.uber.org/atomic v1.11.0 h1:ZvwS0R+56ePWxUNi+Atn9dWONBPp/AUETXlHW0DxSjE= +go.uber.org/atomic v1.11.0/go.mod h1:LUxbIzbOniOlMKjJjyPfpl4v+PKK2cNJn91OQbhoJI0= go.uber.org/goleak v1.1.10/go.mod h1:8a7PlsEVH3e/a/GLqe5IIrQx6GzcnRmZEufDUTk4A7A= -go.uber.org/multierr v1.1.0/go.mod h1:wR5kodmAFQ0UK8QlbwjlSNy0Z68gJhDJUG5sjR94q/0= +go.uber.org/goleak v1.2.1 h1:NBol2c7O1ZokfZ0LEU9K6Whx/KnwvepVetCUhtKja4A= +go.uber.org/goleak v1.2.1/go.mod h1:qlT2yGI9QafXHhZZLxlSuNsMw3FFLxBr+tBRlmO1xH4= go.uber.org/multierr v1.6.0/go.mod h1:cdWPpRnG4AhwMwsgIHip0KRBQjJy5kYEpYjJxpXp9iU= -go.uber.org/zap v1.9.1/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q= -go.uber.org/zap v1.18.1/go.mod h1:xg/QME4nWcxGxrpdeYfq7UvYrLh66cuVKdrbD1XF/NI= +go.uber.org/multierr v1.7.0/go.mod h1:7EAYxJLBy9rStEaz58O2t4Uvip6FSURkq8/ppBp95ak= +go.uber.org/multierr v1.11.0 h1:blXXJkSxSSfBVBlC76pxqeO+LN3aDfLQo+309xJstO0= +go.uber.org/multierr v1.11.0/go.mod h1:20+QtiLqy0Nd6FdQB9TLXag12DsQkrbs3htMFfDN80Y= +go.uber.org/zap v1.19.0/go.mod h1:xg/QME4nWcxGxrpdeYfq7UvYrLh66cuVKdrbD1XF/NI= +go.uber.org/zap v1.26.0 h1:sI7k6L95XOKS281NhVKOFCUNIvv9e0w4BF8N3u+tCRo= +go.uber.org/zap v1.26.0/go.mod h1:dtElttAiwGvoJ/vj4IwHBS/gXsEu/pZ50mUIRWuG0so= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= -golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= -golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= -golang.org/x/exp v0.0.0-20181106170214-d68db9428509/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/exp v0.0.0-20231006140011-7918f672742d h1:jtJma62tbqLibJ5sFQz8bKtEM8rJBtfilJ2qTU199MI= +golang.org/x/exp v0.0.0-20231006140011-7918f672742d/go.mod h1:ldy0pHrwJyGW56pPQzzkH36rKxoZW1tw7ZJpeKx+hdo= golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= -golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= -golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= -golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= golang.org/x/net v0.24.0 h1:1PcaxkF854Fu3+lvBIx5SYn9wRlBzzcnHZSiaFFAb0w= golang.org/x/net v0.24.0/go.mod h1:2Q7sJY5mzlzWjKtYUEXSlBWCdyaioyXzRB2RtU8KVE8= golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.19.0 h1:q5f1RH2jigJ1MoAWp2KTp3gm5zAGFUTarQZ5U386+4o= golang.org/x/sys v0.19.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= golang.org/x/term v0.19.0 h1:+ThwsDv+tYfnJFhF4L8jITxu1tdTWRTZpdsWgEgjL6Q= golang.org/x/term v0.19.0/go.mod h1:2CuTdWZ7KHSQwUzKva0cbMg6q2DMI3Mmxp+gKJbskEk= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= -golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= -golang.org/x/text v0.3.6/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= golang.org/x/text v0.14.0 h1:ScX5w1eTa3QqT8oi6+ziP7dTV1S2+ALU0bI+0zXKWiQ= golang.org/x/text v0.14.0/go.mod h1:18ZOQIKpY8NJVqYksKHtTdi31H5itFRjB5/qKTNYzSU= -golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20191029041327-9cc4af7d6b2c/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20191108193012-7d206e10da11/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= -golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= -golang.org/x/tools v0.0.0-20201125231158-b5590deeca9b/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= -golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= -golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/natefinch/lumberjack.v2 v2.0.0/go.mod h1:l0ndWWf7gzL7RNwBG7wST/UCcT4T24xpD6X8LsfU/+k= +gopkg.in/natefinch/lumberjack.v2 v2.2.1 h1:bBRl1b0OH9s/DuPhuXpNl+VtCaJXFZ5/uEFST95x9zc= +gopkg.in/natefinch/lumberjack.v2 v2.2.1/go.mod h1:YD8tP3GAjkrDg1eZH7EGmyESg/lsYskCTPBJVb9jqSc= gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= gopkg.in/yaml.v2 v2.2.8/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA= gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= -modernc.org/fileutil v1.0.0/go.mod h1:JHsWpkrk/CnVV1H/eGlFf85BEpfkrp56ro8nojIq9Q8= -modernc.org/golex v1.0.1/go.mod h1:QCA53QtsT1NdGkaZZkF5ezFwk4IXh4BGNafAARTC254= -modernc.org/lex v1.0.0/go.mod h1:G6rxMTy3cH2iA0iXL/HRRv4Znu8MK4higxph/lE7ypk= -modernc.org/lexer v1.0.0/go.mod h1:F/Dld0YKYdZCLQ7bD0USbWL4YKCyTDRDHiDTOs0q0vk= -modernc.org/mathutil v1.0.0/go.mod h1:wU0vUrJsVWBZ4P6e7xtFJEhFSNsfRLJ8H458uRjg03k= -modernc.org/mathutil v1.4.1/go.mod h1:mZW8CKdRPY1v87qxC/wUdX5O1qDzXMP5TH3wjfpga6E= -modernc.org/parser v1.0.0/go.mod h1:H20AntYJ2cHHL6MHthJ8LZzXCdDCHMWt1KZXtIMjejA= -modernc.org/parser v1.0.2/go.mod h1:TXNq3HABP3HMaqLK7brD1fLA/LfN0KS6JxZn71QdDqs= -modernc.org/scanner v1.0.1/go.mod h1:OIzD2ZtjYk6yTuyqZr57FmifbM9fIH74SumloSsajuE= -modernc.org/sortutil v1.0.0/go.mod h1:1QO0q8IlIlmjBIwm6t/7sof874+xCfZouyqZMLIAtxM= -modernc.org/strutil v1.0.0/go.mod h1:lstksw84oURvj9y3tn8lGvRxyRC1S2+g5uuIzNfIOBs= -modernc.org/strutil v1.1.0/go.mod h1:lstksw84oURvj9y3tn8lGvRxyRC1S2+g5uuIzNfIOBs= -modernc.org/y v1.0.1/go.mod h1:Ho86I+LVHEI+LYXoUKlmOMAM1JTXOCfj8qi1T8PsClE= diff --git a/go/binlog/gomysql_reader.go b/go/binlog/gomysql_reader.go index d42ba1f30..cdcc33068 100644 --- a/go/binlog/gomysql_reader.go +++ b/go/binlog/gomysql_reader.go @@ -160,6 +160,10 @@ func (this *GoMySQLReader) StreamEvents(canStopStreaming func() bool, entriesCha if err := this.handleRowsEvent(ev, binlogEvent, entriesChannel); err != nil { return err } + case *replication.TransactionPayloadEvent: + if err := this.handleTransactionPayloadEvent(binlogEvent, entriesChannel); err != nil { + return err + } } } this.migrationContext.Log.Debugf("done streaming events") @@ -171,3 +175,62 @@ func (this *GoMySQLReader) Close() error { this.binlogSyncer.Close() return nil } + +// handleLoadQueryEvent +func (this *GoMySQLReader) handleTransactionPayloadEvent(rowsEvents *replication.TransactionPayloadEvent, entriesChannel chan<- *BinlogEntry) (err error) { + if this.currentCoordinates.IsLogPosOverflowBeyond4Bytes(&this.LastAppliedRowsEventHint) { + return fmt.Errorf("Unexpected rows event at %+v, the binlog end_log_pos is overflow 4 bytes", this.currentCoordinates) + } + if this.currentCoordinates.SmallerThanOrEquals(&this.LastAppliedRowsEventHint) { + this.migrationContext.Log.Debugf("Skipping handled query at %+v", this.currentCoordinates) + return nil + } + for _, ev := range rowsEvents.Events { + switch rowsEvent := ev.Event.(type) { + case *replication.RowsEvent: + // if err := this.handleRowsEvent(ev, binlogEvent, entriesChannel); err != nil { + // return err + // } + dml := ToEventDML(ev.Header.EventType.String()) + if dml == NotDML { + return fmt.Errorf("Unknown DML type: %s", ev.Header.EventType.String()) + } + for i, row := range rowsEvent.Rows { + if dml == UpdateDML && i%2 == 1 { + // An update has two rows (WHERE+SET) + // We do both at the same time + continue + } + binlogEntry := NewBinlogEntryAt(this.currentCoordinates) + binlogEntry.DmlEvent = NewBinlogDMLEvent( + string(rowsEvent.Table.Schema), + string(rowsEvent.Table.Table), + dml, + ) + switch dml { + case InsertDML: + { + binlogEntry.DmlEvent.NewColumnValues = sql.ToColumnValues(row) + } + case UpdateDML: + { + binlogEntry.DmlEvent.WhereColumnValues = sql.ToColumnValues(row) + binlogEntry.DmlEvent.NewColumnValues = sql.ToColumnValues(rowsEvent.Rows[i+1]) + } + case DeleteDML: + { + binlogEntry.DmlEvent.WhereColumnValues = sql.ToColumnValues(row) + } + } + // The channel will do the throttling. Whoever is reading from the channel + // decides whether action is taken synchronously (meaning we wait before + // next iteration) or asynchronously (we keep pushing more events) + // In reality, reads will be synchronous + entriesChannel <- binlogEntry + } + + } + } + this.LastAppliedRowsEventHint = this.currentCoordinates + return +} diff --git a/vendor/github.com/Masterminds/semver/.travis.yml b/vendor/github.com/Masterminds/semver/.travis.yml new file mode 100644 index 000000000..096369d44 --- /dev/null +++ b/vendor/github.com/Masterminds/semver/.travis.yml @@ -0,0 +1,29 @@ +language: go + +go: + - 1.6.x + - 1.7.x + - 1.8.x + - 1.9.x + - 1.10.x + - 1.11.x + - 1.12.x + - tip + +# Setting sudo access to false will let Travis CI use containers rather than +# VMs to run the tests. For more details see: +# - http://docs.travis-ci.com/user/workers/container-based-infrastructure/ +# - http://docs.travis-ci.com/user/workers/standard-infrastructure/ +sudo: false + +script: + - make setup + - make test + +notifications: + webhooks: + urls: + - https://webhooks.gitter.im/e/06e3328629952dabe3e0 + on_success: change # options: [always|never|change] default: always + on_failure: always # options: [always|never|change] default: always + on_start: never # options: [always|never|change] default: always diff --git a/vendor/github.com/Masterminds/semver/CHANGELOG.md b/vendor/github.com/Masterminds/semver/CHANGELOG.md new file mode 100644 index 000000000..e405c9a84 --- /dev/null +++ b/vendor/github.com/Masterminds/semver/CHANGELOG.md @@ -0,0 +1,109 @@ +# 1.5.0 (2019-09-11) + +## Added + +- #103: Add basic fuzzing for `NewVersion()` (thanks @jesse-c) + +## Changed + +- #82: Clarify wildcard meaning in range constraints and update tests for it (thanks @greysteil) +- #83: Clarify caret operator range for pre-1.0.0 dependencies (thanks @greysteil) +- #72: Adding docs comment pointing to vert for a cli +- #71: Update the docs on pre-release comparator handling +- #89: Test with new go versions (thanks @thedevsaddam) +- #87: Added $ to ValidPrerelease for better validation (thanks @jeremycarroll) + +## Fixed + +- #78: Fix unchecked error in example code (thanks @ravron) +- #70: Fix the handling of pre-releases and the 0.0.0 release edge case +- #97: Fixed copyright file for proper display on GitHub +- #107: Fix handling prerelease when sorting alphanum and num +- #109: Fixed where Validate sometimes returns wrong message on error + +# 1.4.2 (2018-04-10) + +## Changed +- #72: Updated the docs to point to vert for a console appliaction +- #71: Update the docs on pre-release comparator handling + +## Fixed +- #70: Fix the handling of pre-releases and the 0.0.0 release edge case + +# 1.4.1 (2018-04-02) + +## Fixed +- Fixed #64: Fix pre-release precedence issue (thanks @uudashr) + +# 1.4.0 (2017-10-04) + +## Changed +- #61: Update NewVersion to parse ints with a 64bit int size (thanks @zknill) + +# 1.3.1 (2017-07-10) + +## Fixed +- Fixed #57: number comparisons in prerelease sometimes inaccurate + +# 1.3.0 (2017-05-02) + +## Added +- #45: Added json (un)marshaling support (thanks @mh-cbon) +- Stability marker. See https://masterminds.github.io/stability/ + +## Fixed +- #51: Fix handling of single digit tilde constraint (thanks @dgodd) + +## Changed +- #55: The godoc icon moved from png to svg + +# 1.2.3 (2017-04-03) + +## Fixed +- #46: Fixed 0.x.x and 0.0.x in constraints being treated as * + +# Release 1.2.2 (2016-12-13) + +## Fixed +- #34: Fixed issue where hyphen range was not working with pre-release parsing. + +# Release 1.2.1 (2016-11-28) + +## Fixed +- #24: Fixed edge case issue where constraint "> 0" does not handle "0.0.1-alpha" + properly. + +# Release 1.2.0 (2016-11-04) + +## Added +- #20: Added MustParse function for versions (thanks @adamreese) +- #15: Added increment methods on versions (thanks @mh-cbon) + +## Fixed +- Issue #21: Per the SemVer spec (section 9) a pre-release is unstable and + might not satisfy the intended compatibility. The change here ignores pre-releases + on constraint checks (e.g., ~ or ^) when a pre-release is not part of the + constraint. For example, `^1.2.3` will ignore pre-releases while + `^1.2.3-alpha` will include them. + +# Release 1.1.1 (2016-06-30) + +## Changed +- Issue #9: Speed up version comparison performance (thanks @sdboyer) +- Issue #8: Added benchmarks (thanks @sdboyer) +- Updated Go Report Card URL to new location +- Updated Readme to add code snippet formatting (thanks @mh-cbon) +- Updating tagging to v[SemVer] structure for compatibility with other tools. + +# Release 1.1.0 (2016-03-11) + +- Issue #2: Implemented validation to provide reasons a versions failed a + constraint. + +# Release 1.0.1 (2015-12-31) + +- Fixed #1: * constraint failing on valid versions. + +# Release 1.0.0 (2015-10-20) + +- Initial release diff --git a/vendor/github.com/Masterminds/semver/LICENSE.txt b/vendor/github.com/Masterminds/semver/LICENSE.txt new file mode 100644 index 000000000..9ff7da9c4 --- /dev/null +++ b/vendor/github.com/Masterminds/semver/LICENSE.txt @@ -0,0 +1,19 @@ +Copyright (C) 2014-2019, Matt Butcher and Matt Farina + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/vendor/github.com/Masterminds/semver/Makefile b/vendor/github.com/Masterminds/semver/Makefile new file mode 100644 index 000000000..a7a1b4e36 --- /dev/null +++ b/vendor/github.com/Masterminds/semver/Makefile @@ -0,0 +1,36 @@ +.PHONY: setup +setup: + go get -u gopkg.in/alecthomas/gometalinter.v1 + gometalinter.v1 --install + +.PHONY: test +test: validate lint + @echo "==> Running tests" + go test -v + +.PHONY: validate +validate: + @echo "==> Running static validations" + @gometalinter.v1 \ + --disable-all \ + --enable deadcode \ + --severity deadcode:error \ + --enable gofmt \ + --enable gosimple \ + --enable ineffassign \ + --enable misspell \ + --enable vet \ + --tests \ + --vendor \ + --deadline 60s \ + ./... || exit_code=1 + +.PHONY: lint +lint: + @echo "==> Running linters" + @gometalinter.v1 \ + --disable-all \ + --enable golint \ + --vendor \ + --deadline 60s \ + ./... || : diff --git a/vendor/github.com/Masterminds/semver/README.md b/vendor/github.com/Masterminds/semver/README.md new file mode 100644 index 000000000..1b52d2f43 --- /dev/null +++ b/vendor/github.com/Masterminds/semver/README.md @@ -0,0 +1,194 @@ +# SemVer + +The `semver` package provides the ability to work with [Semantic Versions](http://semver.org) in Go. Specifically it provides the ability to: + +* Parse semantic versions +* Sort semantic versions +* Check if a semantic version fits within a set of constraints +* Optionally work with a `v` prefix + +[![Stability: +Active](https://masterminds.github.io/stability/active.svg)](https://masterminds.github.io/stability/active.html) +[![Build Status](https://travis-ci.org/Masterminds/semver.svg)](https://travis-ci.org/Masterminds/semver) [![Build status](https://ci.appveyor.com/api/projects/status/jfk66lib7hb985k8/branch/master?svg=true&passingText=windows%20build%20passing&failingText=windows%20build%20failing)](https://ci.appveyor.com/project/mattfarina/semver/branch/master) [![GoDoc](https://godoc.org/github.com/Masterminds/semver?status.svg)](https://godoc.org/github.com/Masterminds/semver) [![Go Report Card](https://goreportcard.com/badge/github.com/Masterminds/semver)](https://goreportcard.com/report/github.com/Masterminds/semver) + +If you are looking for a command line tool for version comparisons please see +[vert](https://github.com/Masterminds/vert) which uses this library. + +## Parsing Semantic Versions + +To parse a semantic version use the `NewVersion` function. For example, + +```go + v, err := semver.NewVersion("1.2.3-beta.1+build345") +``` + +If there is an error the version wasn't parseable. The version object has methods +to get the parts of the version, compare it to other versions, convert the +version back into a string, and get the original string. For more details +please see the [documentation](https://godoc.org/github.com/Masterminds/semver). + +## Sorting Semantic Versions + +A set of versions can be sorted using the [`sort`](https://golang.org/pkg/sort/) +package from the standard library. For example, + +```go + raw := []string{"1.2.3", "1.0", "1.3", "2", "0.4.2",} + vs := make([]*semver.Version, len(raw)) + for i, r := range raw { + v, err := semver.NewVersion(r) + if err != nil { + t.Errorf("Error parsing version: %s", err) + } + + vs[i] = v + } + + sort.Sort(semver.Collection(vs)) +``` + +## Checking Version Constraints + +Checking a version against version constraints is one of the most featureful +parts of the package. + +```go + c, err := semver.NewConstraint(">= 1.2.3") + if err != nil { + // Handle constraint not being parseable. + } + + v, _ := semver.NewVersion("1.3") + if err != nil { + // Handle version not being parseable. + } + // Check if the version meets the constraints. The a variable will be true. + a := c.Check(v) +``` + +## Basic Comparisons + +There are two elements to the comparisons. First, a comparison string is a list +of comma separated and comparisons. These are then separated by || separated or +comparisons. For example, `">= 1.2, < 3.0.0 || >= 4.2.3"` is looking for a +comparison that's greater than or equal to 1.2 and less than 3.0.0 or is +greater than or equal to 4.2.3. + +The basic comparisons are: + +* `=`: equal (aliased to no operator) +* `!=`: not equal +* `>`: greater than +* `<`: less than +* `>=`: greater than or equal to +* `<=`: less than or equal to + +## Working With Pre-release Versions + +Pre-releases, for those not familiar with them, are used for software releases +prior to stable or generally available releases. Examples of pre-releases include +development, alpha, beta, and release candidate releases. A pre-release may be +a version such as `1.2.3-beta.1` while the stable release would be `1.2.3`. In the +order of precidence, pre-releases come before their associated releases. In this +example `1.2.3-beta.1 < 1.2.3`. + +According to the Semantic Version specification pre-releases may not be +API compliant with their release counterpart. It says, + +> A pre-release version indicates that the version is unstable and might not satisfy the intended compatibility requirements as denoted by its associated normal version. + +SemVer comparisons without a pre-release comparator will skip pre-release versions. +For example, `>=1.2.3` will skip pre-releases when looking at a list of releases +while `>=1.2.3-0` will evaluate and find pre-releases. + +The reason for the `0` as a pre-release version in the example comparison is +because pre-releases can only contain ASCII alphanumerics and hyphens (along with +`.` separators), per the spec. Sorting happens in ASCII sort order, again per the spec. The lowest character is a `0` in ASCII sort order (see an [ASCII Table](http://www.asciitable.com/)) + +Understanding ASCII sort ordering is important because A-Z comes before a-z. That +means `>=1.2.3-BETA` will return `1.2.3-alpha`. What you might expect from case +sensitivity doesn't apply here. This is due to ASCII sort ordering which is what +the spec specifies. + +## Hyphen Range Comparisons + +There are multiple methods to handle ranges and the first is hyphens ranges. +These look like: + +* `1.2 - 1.4.5` which is equivalent to `>= 1.2, <= 1.4.5` +* `2.3.4 - 4.5` which is equivalent to `>= 2.3.4, <= 4.5` + +## Wildcards In Comparisons + +The `x`, `X`, and `*` characters can be used as a wildcard character. This works +for all comparison operators. When used on the `=` operator it falls +back to the pack level comparison (see tilde below). For example, + +* `1.2.x` is equivalent to `>= 1.2.0, < 1.3.0` +* `>= 1.2.x` is equivalent to `>= 1.2.0` +* `<= 2.x` is equivalent to `< 3` +* `*` is equivalent to `>= 0.0.0` + +## Tilde Range Comparisons (Patch) + +The tilde (`~`) comparison operator is for patch level ranges when a minor +version is specified and major level changes when the minor number is missing. +For example, + +* `~1.2.3` is equivalent to `>= 1.2.3, < 1.3.0` +* `~1` is equivalent to `>= 1, < 2` +* `~2.3` is equivalent to `>= 2.3, < 2.4` +* `~1.2.x` is equivalent to `>= 1.2.0, < 1.3.0` +* `~1.x` is equivalent to `>= 1, < 2` + +## Caret Range Comparisons (Major) + +The caret (`^`) comparison operator is for major level changes. This is useful +when comparisons of API versions as a major change is API breaking. For example, + +* `^1.2.3` is equivalent to `>= 1.2.3, < 2.0.0` +* `^0.0.1` is equivalent to `>= 0.0.1, < 1.0.0` +* `^1.2.x` is equivalent to `>= 1.2.0, < 2.0.0` +* `^2.3` is equivalent to `>= 2.3, < 3` +* `^2.x` is equivalent to `>= 2.0.0, < 3` + +# Validation + +In addition to testing a version against a constraint, a version can be validated +against a constraint. When validation fails a slice of errors containing why a +version didn't meet the constraint is returned. For example, + +```go + c, err := semver.NewConstraint("<= 1.2.3, >= 1.4") + if err != nil { + // Handle constraint not being parseable. + } + + v, _ := semver.NewVersion("1.3") + if err != nil { + // Handle version not being parseable. + } + + // Validate a version against a constraint. + a, msgs := c.Validate(v) + // a is false + for _, m := range msgs { + fmt.Println(m) + + // Loops over the errors which would read + // "1.3 is greater than 1.2.3" + // "1.3 is less than 1.4" + } +``` + +# Fuzzing + + [dvyukov/go-fuzz](https://github.com/dvyukov/go-fuzz) is used for fuzzing. + +1. `go-fuzz-build` +2. `go-fuzz -workdir=fuzz` + +# Contribute + +If you find an issue or want to contribute please file an [issue](https://github.com/Masterminds/semver/issues) +or [create a pull request](https://github.com/Masterminds/semver/pulls). diff --git a/vendor/github.com/Masterminds/semver/appveyor.yml b/vendor/github.com/Masterminds/semver/appveyor.yml new file mode 100644 index 000000000..b2778df15 --- /dev/null +++ b/vendor/github.com/Masterminds/semver/appveyor.yml @@ -0,0 +1,44 @@ +version: build-{build}.{branch} + +clone_folder: C:\gopath\src\github.com\Masterminds\semver +shallow_clone: true + +environment: + GOPATH: C:\gopath + +platform: + - x64 + +install: + - go version + - go env + - go get -u gopkg.in/alecthomas/gometalinter.v1 + - set PATH=%PATH%;%GOPATH%\bin + - gometalinter.v1.exe --install + +build_script: + - go install -v ./... + +test_script: + - "gometalinter.v1 \ + --disable-all \ + --enable deadcode \ + --severity deadcode:error \ + --enable gofmt \ + --enable gosimple \ + --enable ineffassign \ + --enable misspell \ + --enable vet \ + --tests \ + --vendor \ + --deadline 60s \ + ./... || exit_code=1" + - "gometalinter.v1 \ + --disable-all \ + --enable golint \ + --vendor \ + --deadline 60s \ + ./... || :" + - go test -v + +deploy: off diff --git a/vendor/github.com/Masterminds/semver/collection.go b/vendor/github.com/Masterminds/semver/collection.go new file mode 100644 index 000000000..a78235895 --- /dev/null +++ b/vendor/github.com/Masterminds/semver/collection.go @@ -0,0 +1,24 @@ +package semver + +// Collection is a collection of Version instances and implements the sort +// interface. See the sort package for more details. +// https://golang.org/pkg/sort/ +type Collection []*Version + +// Len returns the length of a collection. The number of Version instances +// on the slice. +func (c Collection) Len() int { + return len(c) +} + +// Less is needed for the sort interface to compare two Version objects on the +// slice. If checks if one is less than the other. +func (c Collection) Less(i, j int) bool { + return c[i].LessThan(c[j]) +} + +// Swap is needed for the sort interface to replace the Version objects +// at two different positions in the slice. +func (c Collection) Swap(i, j int) { + c[i], c[j] = c[j], c[i] +} diff --git a/vendor/github.com/Masterminds/semver/constraints.go b/vendor/github.com/Masterminds/semver/constraints.go new file mode 100644 index 000000000..b94b93413 --- /dev/null +++ b/vendor/github.com/Masterminds/semver/constraints.go @@ -0,0 +1,423 @@ +package semver + +import ( + "errors" + "fmt" + "regexp" + "strings" +) + +// Constraints is one or more constraint that a semantic version can be +// checked against. +type Constraints struct { + constraints [][]*constraint +} + +// NewConstraint returns a Constraints instance that a Version instance can +// be checked against. If there is a parse error it will be returned. +func NewConstraint(c string) (*Constraints, error) { + + // Rewrite - ranges into a comparison operation. + c = rewriteRange(c) + + ors := strings.Split(c, "||") + or := make([][]*constraint, len(ors)) + for k, v := range ors { + cs := strings.Split(v, ",") + result := make([]*constraint, len(cs)) + for i, s := range cs { + pc, err := parseConstraint(s) + if err != nil { + return nil, err + } + + result[i] = pc + } + or[k] = result + } + + o := &Constraints{constraints: or} + return o, nil +} + +// Check tests if a version satisfies the constraints. +func (cs Constraints) Check(v *Version) bool { + // loop over the ORs and check the inner ANDs + for _, o := range cs.constraints { + joy := true + for _, c := range o { + if !c.check(v) { + joy = false + break + } + } + + if joy { + return true + } + } + + return false +} + +// Validate checks if a version satisfies a constraint. If not a slice of +// reasons for the failure are returned in addition to a bool. +func (cs Constraints) Validate(v *Version) (bool, []error) { + // loop over the ORs and check the inner ANDs + var e []error + + // Capture the prerelease message only once. When it happens the first time + // this var is marked + var prerelesase bool + for _, o := range cs.constraints { + joy := true + for _, c := range o { + // Before running the check handle the case there the version is + // a prerelease and the check is not searching for prereleases. + if c.con.pre == "" && v.pre != "" { + if !prerelesase { + em := fmt.Errorf("%s is a prerelease version and the constraint is only looking for release versions", v) + e = append(e, em) + prerelesase = true + } + joy = false + + } else { + + if !c.check(v) { + em := fmt.Errorf(c.msg, v, c.orig) + e = append(e, em) + joy = false + } + } + } + + if joy { + return true, []error{} + } + } + + return false, e +} + +var constraintOps map[string]cfunc +var constraintMsg map[string]string +var constraintRegex *regexp.Regexp + +func init() { + constraintOps = map[string]cfunc{ + "": constraintTildeOrEqual, + "=": constraintTildeOrEqual, + "!=": constraintNotEqual, + ">": constraintGreaterThan, + "<": constraintLessThan, + ">=": constraintGreaterThanEqual, + "=>": constraintGreaterThanEqual, + "<=": constraintLessThanEqual, + "=<": constraintLessThanEqual, + "~": constraintTilde, + "~>": constraintTilde, + "^": constraintCaret, + } + + constraintMsg = map[string]string{ + "": "%s is not equal to %s", + "=": "%s is not equal to %s", + "!=": "%s is equal to %s", + ">": "%s is less than or equal to %s", + "<": "%s is greater than or equal to %s", + ">=": "%s is less than %s", + "=>": "%s is less than %s", + "<=": "%s is greater than %s", + "=<": "%s is greater than %s", + "~": "%s does not have same major and minor version as %s", + "~>": "%s does not have same major and minor version as %s", + "^": "%s does not have same major version as %s", + } + + ops := make([]string, 0, len(constraintOps)) + for k := range constraintOps { + ops = append(ops, regexp.QuoteMeta(k)) + } + + constraintRegex = regexp.MustCompile(fmt.Sprintf( + `^\s*(%s)\s*(%s)\s*$`, + strings.Join(ops, "|"), + cvRegex)) + + constraintRangeRegex = regexp.MustCompile(fmt.Sprintf( + `\s*(%s)\s+-\s+(%s)\s*`, + cvRegex, cvRegex)) +} + +// An individual constraint +type constraint struct { + // The callback function for the restraint. It performs the logic for + // the constraint. + function cfunc + + msg string + + // The version used in the constraint check. For example, if a constraint + // is '<= 2.0.0' the con a version instance representing 2.0.0. + con *Version + + // The original parsed version (e.g., 4.x from != 4.x) + orig string + + // When an x is used as part of the version (e.g., 1.x) + minorDirty bool + dirty bool + patchDirty bool +} + +// Check if a version meets the constraint +func (c *constraint) check(v *Version) bool { + return c.function(v, c) +} + +type cfunc func(v *Version, c *constraint) bool + +func parseConstraint(c string) (*constraint, error) { + m := constraintRegex.FindStringSubmatch(c) + if m == nil { + return nil, fmt.Errorf("improper constraint: %s", c) + } + + ver := m[2] + orig := ver + minorDirty := false + patchDirty := false + dirty := false + if isX(m[3]) { + ver = "0.0.0" + dirty = true + } else if isX(strings.TrimPrefix(m[4], ".")) || m[4] == "" { + minorDirty = true + dirty = true + ver = fmt.Sprintf("%s.0.0%s", m[3], m[6]) + } else if isX(strings.TrimPrefix(m[5], ".")) { + dirty = true + patchDirty = true + ver = fmt.Sprintf("%s%s.0%s", m[3], m[4], m[6]) + } + + con, err := NewVersion(ver) + if err != nil { + + // The constraintRegex should catch any regex parsing errors. So, + // we should never get here. + return nil, errors.New("constraint Parser Error") + } + + cs := &constraint{ + function: constraintOps[m[1]], + msg: constraintMsg[m[1]], + con: con, + orig: orig, + minorDirty: minorDirty, + patchDirty: patchDirty, + dirty: dirty, + } + return cs, nil +} + +// Constraint functions +func constraintNotEqual(v *Version, c *constraint) bool { + if c.dirty { + + // If there is a pre-release on the version but the constraint isn't looking + // for them assume that pre-releases are not compatible. See issue 21 for + // more details. + if v.Prerelease() != "" && c.con.Prerelease() == "" { + return false + } + + if c.con.Major() != v.Major() { + return true + } + if c.con.Minor() != v.Minor() && !c.minorDirty { + return true + } else if c.minorDirty { + return false + } + + return false + } + + return !v.Equal(c.con) +} + +func constraintGreaterThan(v *Version, c *constraint) bool { + + // If there is a pre-release on the version but the constraint isn't looking + // for them assume that pre-releases are not compatible. See issue 21 for + // more details. + if v.Prerelease() != "" && c.con.Prerelease() == "" { + return false + } + + return v.Compare(c.con) == 1 +} + +func constraintLessThan(v *Version, c *constraint) bool { + // If there is a pre-release on the version but the constraint isn't looking + // for them assume that pre-releases are not compatible. See issue 21 for + // more details. + if v.Prerelease() != "" && c.con.Prerelease() == "" { + return false + } + + if !c.dirty { + return v.Compare(c.con) < 0 + } + + if v.Major() > c.con.Major() { + return false + } else if v.Minor() > c.con.Minor() && !c.minorDirty { + return false + } + + return true +} + +func constraintGreaterThanEqual(v *Version, c *constraint) bool { + + // If there is a pre-release on the version but the constraint isn't looking + // for them assume that pre-releases are not compatible. See issue 21 for + // more details. + if v.Prerelease() != "" && c.con.Prerelease() == "" { + return false + } + + return v.Compare(c.con) >= 0 +} + +func constraintLessThanEqual(v *Version, c *constraint) bool { + // If there is a pre-release on the version but the constraint isn't looking + // for them assume that pre-releases are not compatible. See issue 21 for + // more details. + if v.Prerelease() != "" && c.con.Prerelease() == "" { + return false + } + + if !c.dirty { + return v.Compare(c.con) <= 0 + } + + if v.Major() > c.con.Major() { + return false + } else if v.Minor() > c.con.Minor() && !c.minorDirty { + return false + } + + return true +} + +// ~*, ~>* --> >= 0.0.0 (any) +// ~2, ~2.x, ~2.x.x, ~>2, ~>2.x ~>2.x.x --> >=2.0.0, <3.0.0 +// ~2.0, ~2.0.x, ~>2.0, ~>2.0.x --> >=2.0.0, <2.1.0 +// ~1.2, ~1.2.x, ~>1.2, ~>1.2.x --> >=1.2.0, <1.3.0 +// ~1.2.3, ~>1.2.3 --> >=1.2.3, <1.3.0 +// ~1.2.0, ~>1.2.0 --> >=1.2.0, <1.3.0 +func constraintTilde(v *Version, c *constraint) bool { + // If there is a pre-release on the version but the constraint isn't looking + // for them assume that pre-releases are not compatible. See issue 21 for + // more details. + if v.Prerelease() != "" && c.con.Prerelease() == "" { + return false + } + + if v.LessThan(c.con) { + return false + } + + // ~0.0.0 is a special case where all constraints are accepted. It's + // equivalent to >= 0.0.0. + if c.con.Major() == 0 && c.con.Minor() == 0 && c.con.Patch() == 0 && + !c.minorDirty && !c.patchDirty { + return true + } + + if v.Major() != c.con.Major() { + return false + } + + if v.Minor() != c.con.Minor() && !c.minorDirty { + return false + } + + return true +} + +// When there is a .x (dirty) status it automatically opts in to ~. Otherwise +// it's a straight = +func constraintTildeOrEqual(v *Version, c *constraint) bool { + // If there is a pre-release on the version but the constraint isn't looking + // for them assume that pre-releases are not compatible. See issue 21 for + // more details. + if v.Prerelease() != "" && c.con.Prerelease() == "" { + return false + } + + if c.dirty { + c.msg = constraintMsg["~"] + return constraintTilde(v, c) + } + + return v.Equal(c.con) +} + +// ^* --> (any) +// ^2, ^2.x, ^2.x.x --> >=2.0.0, <3.0.0 +// ^2.0, ^2.0.x --> >=2.0.0, <3.0.0 +// ^1.2, ^1.2.x --> >=1.2.0, <2.0.0 +// ^1.2.3 --> >=1.2.3, <2.0.0 +// ^1.2.0 --> >=1.2.0, <2.0.0 +func constraintCaret(v *Version, c *constraint) bool { + // If there is a pre-release on the version but the constraint isn't looking + // for them assume that pre-releases are not compatible. See issue 21 for + // more details. + if v.Prerelease() != "" && c.con.Prerelease() == "" { + return false + } + + if v.LessThan(c.con) { + return false + } + + if v.Major() != c.con.Major() { + return false + } + + return true +} + +var constraintRangeRegex *regexp.Regexp + +const cvRegex string = `v?([0-9|x|X|\*]+)(\.[0-9|x|X|\*]+)?(\.[0-9|x|X|\*]+)?` + + `(-([0-9A-Za-z\-]+(\.[0-9A-Za-z\-]+)*))?` + + `(\+([0-9A-Za-z\-]+(\.[0-9A-Za-z\-]+)*))?` + +func isX(x string) bool { + switch x { + case "x", "*", "X": + return true + default: + return false + } +} + +func rewriteRange(i string) string { + m := constraintRangeRegex.FindAllStringSubmatch(i, -1) + if m == nil { + return i + } + o := i + for _, v := range m { + t := fmt.Sprintf(">= %s, <= %s", v[1], v[11]) + o = strings.Replace(o, v[0], t, 1) + } + + return o +} diff --git a/vendor/github.com/Masterminds/semver/doc.go b/vendor/github.com/Masterminds/semver/doc.go new file mode 100644 index 000000000..6a6c24c6d --- /dev/null +++ b/vendor/github.com/Masterminds/semver/doc.go @@ -0,0 +1,115 @@ +/* +Package semver provides the ability to work with Semantic Versions (http://semver.org) in Go. + +Specifically it provides the ability to: + + * Parse semantic versions + * Sort semantic versions + * Check if a semantic version fits within a set of constraints + * Optionally work with a `v` prefix + +Parsing Semantic Versions + +To parse a semantic version use the `NewVersion` function. For example, + + v, err := semver.NewVersion("1.2.3-beta.1+build345") + +If there is an error the version wasn't parseable. The version object has methods +to get the parts of the version, compare it to other versions, convert the +version back into a string, and get the original string. For more details +please see the documentation at https://godoc.org/github.com/Masterminds/semver. + +Sorting Semantic Versions + +A set of versions can be sorted using the `sort` package from the standard library. +For example, + + raw := []string{"1.2.3", "1.0", "1.3", "2", "0.4.2",} + vs := make([]*semver.Version, len(raw)) + for i, r := range raw { + v, err := semver.NewVersion(r) + if err != nil { + t.Errorf("Error parsing version: %s", err) + } + + vs[i] = v + } + + sort.Sort(semver.Collection(vs)) + +Checking Version Constraints + +Checking a version against version constraints is one of the most featureful +parts of the package. + + c, err := semver.NewConstraint(">= 1.2.3") + if err != nil { + // Handle constraint not being parseable. + } + + v, err := semver.NewVersion("1.3") + if err != nil { + // Handle version not being parseable. + } + // Check if the version meets the constraints. The a variable will be true. + a := c.Check(v) + +Basic Comparisons + +There are two elements to the comparisons. First, a comparison string is a list +of comma separated and comparisons. These are then separated by || separated or +comparisons. For example, `">= 1.2, < 3.0.0 || >= 4.2.3"` is looking for a +comparison that's greater than or equal to 1.2 and less than 3.0.0 or is +greater than or equal to 4.2.3. + +The basic comparisons are: + + * `=`: equal (aliased to no operator) + * `!=`: not equal + * `>`: greater than + * `<`: less than + * `>=`: greater than or equal to + * `<=`: less than or equal to + +Hyphen Range Comparisons + +There are multiple methods to handle ranges and the first is hyphens ranges. +These look like: + + * `1.2 - 1.4.5` which is equivalent to `>= 1.2, <= 1.4.5` + * `2.3.4 - 4.5` which is equivalent to `>= 2.3.4, <= 4.5` + +Wildcards In Comparisons + +The `x`, `X`, and `*` characters can be used as a wildcard character. This works +for all comparison operators. When used on the `=` operator it falls +back to the pack level comparison (see tilde below). For example, + + * `1.2.x` is equivalent to `>= 1.2.0, < 1.3.0` + * `>= 1.2.x` is equivalent to `>= 1.2.0` + * `<= 2.x` is equivalent to `<= 3` + * `*` is equivalent to `>= 0.0.0` + +Tilde Range Comparisons (Patch) + +The tilde (`~`) comparison operator is for patch level ranges when a minor +version is specified and major level changes when the minor number is missing. +For example, + + * `~1.2.3` is equivalent to `>= 1.2.3, < 1.3.0` + * `~1` is equivalent to `>= 1, < 2` + * `~2.3` is equivalent to `>= 2.3, < 2.4` + * `~1.2.x` is equivalent to `>= 1.2.0, < 1.3.0` + * `~1.x` is equivalent to `>= 1, < 2` + +Caret Range Comparisons (Major) + +The caret (`^`) comparison operator is for major level changes. This is useful +when comparisons of API versions as a major change is API breaking. For example, + + * `^1.2.3` is equivalent to `>= 1.2.3, < 2.0.0` + * `^1.2.x` is equivalent to `>= 1.2.0, < 2.0.0` + * `^2.3` is equivalent to `>= 2.3, < 3` + * `^2.x` is equivalent to `>= 2.0.0, < 3` +*/ +package semver diff --git a/vendor/github.com/Masterminds/semver/version.go b/vendor/github.com/Masterminds/semver/version.go new file mode 100644 index 000000000..400d4f934 --- /dev/null +++ b/vendor/github.com/Masterminds/semver/version.go @@ -0,0 +1,425 @@ +package semver + +import ( + "bytes" + "encoding/json" + "errors" + "fmt" + "regexp" + "strconv" + "strings" +) + +// The compiled version of the regex created at init() is cached here so it +// only needs to be created once. +var versionRegex *regexp.Regexp +var validPrereleaseRegex *regexp.Regexp + +var ( + // ErrInvalidSemVer is returned a version is found to be invalid when + // being parsed. + ErrInvalidSemVer = errors.New("Invalid Semantic Version") + + // ErrInvalidMetadata is returned when the metadata is an invalid format + ErrInvalidMetadata = errors.New("Invalid Metadata string") + + // ErrInvalidPrerelease is returned when the pre-release is an invalid format + ErrInvalidPrerelease = errors.New("Invalid Prerelease string") +) + +// SemVerRegex is the regular expression used to parse a semantic version. +const SemVerRegex string = `v?([0-9]+)(\.[0-9]+)?(\.[0-9]+)?` + + `(-([0-9A-Za-z\-]+(\.[0-9A-Za-z\-]+)*))?` + + `(\+([0-9A-Za-z\-]+(\.[0-9A-Za-z\-]+)*))?` + +// ValidPrerelease is the regular expression which validates +// both prerelease and metadata values. +const ValidPrerelease string = `^([0-9A-Za-z\-]+(\.[0-9A-Za-z\-]+)*)$` + +// Version represents a single semantic version. +type Version struct { + major, minor, patch int64 + pre string + metadata string + original string +} + +func init() { + versionRegex = regexp.MustCompile("^" + SemVerRegex + "$") + validPrereleaseRegex = regexp.MustCompile(ValidPrerelease) +} + +// NewVersion parses a given version and returns an instance of Version or +// an error if unable to parse the version. +func NewVersion(v string) (*Version, error) { + m := versionRegex.FindStringSubmatch(v) + if m == nil { + return nil, ErrInvalidSemVer + } + + sv := &Version{ + metadata: m[8], + pre: m[5], + original: v, + } + + var temp int64 + temp, err := strconv.ParseInt(m[1], 10, 64) + if err != nil { + return nil, fmt.Errorf("Error parsing version segment: %s", err) + } + sv.major = temp + + if m[2] != "" { + temp, err = strconv.ParseInt(strings.TrimPrefix(m[2], "."), 10, 64) + if err != nil { + return nil, fmt.Errorf("Error parsing version segment: %s", err) + } + sv.minor = temp + } else { + sv.minor = 0 + } + + if m[3] != "" { + temp, err = strconv.ParseInt(strings.TrimPrefix(m[3], "."), 10, 64) + if err != nil { + return nil, fmt.Errorf("Error parsing version segment: %s", err) + } + sv.patch = temp + } else { + sv.patch = 0 + } + + return sv, nil +} + +// MustParse parses a given version and panics on error. +func MustParse(v string) *Version { + sv, err := NewVersion(v) + if err != nil { + panic(err) + } + return sv +} + +// String converts a Version object to a string. +// Note, if the original version contained a leading v this version will not. +// See the Original() method to retrieve the original value. Semantic Versions +// don't contain a leading v per the spec. Instead it's optional on +// implementation. +func (v *Version) String() string { + var buf bytes.Buffer + + fmt.Fprintf(&buf, "%d.%d.%d", v.major, v.minor, v.patch) + if v.pre != "" { + fmt.Fprintf(&buf, "-%s", v.pre) + } + if v.metadata != "" { + fmt.Fprintf(&buf, "+%s", v.metadata) + } + + return buf.String() +} + +// Original returns the original value passed in to be parsed. +func (v *Version) Original() string { + return v.original +} + +// Major returns the major version. +func (v *Version) Major() int64 { + return v.major +} + +// Minor returns the minor version. +func (v *Version) Minor() int64 { + return v.minor +} + +// Patch returns the patch version. +func (v *Version) Patch() int64 { + return v.patch +} + +// Prerelease returns the pre-release version. +func (v *Version) Prerelease() string { + return v.pre +} + +// Metadata returns the metadata on the version. +func (v *Version) Metadata() string { + return v.metadata +} + +// originalVPrefix returns the original 'v' prefix if any. +func (v *Version) originalVPrefix() string { + + // Note, only lowercase v is supported as a prefix by the parser. + if v.original != "" && v.original[:1] == "v" { + return v.original[:1] + } + return "" +} + +// IncPatch produces the next patch version. +// If the current version does not have prerelease/metadata information, +// it unsets metadata and prerelease values, increments patch number. +// If the current version has any of prerelease or metadata information, +// it unsets both values and keeps curent patch value +func (v Version) IncPatch() Version { + vNext := v + // according to http://semver.org/#spec-item-9 + // Pre-release versions have a lower precedence than the associated normal version. + // according to http://semver.org/#spec-item-10 + // Build metadata SHOULD be ignored when determining version precedence. + if v.pre != "" { + vNext.metadata = "" + vNext.pre = "" + } else { + vNext.metadata = "" + vNext.pre = "" + vNext.patch = v.patch + 1 + } + vNext.original = v.originalVPrefix() + "" + vNext.String() + return vNext +} + +// IncMinor produces the next minor version. +// Sets patch to 0. +// Increments minor number. +// Unsets metadata. +// Unsets prerelease status. +func (v Version) IncMinor() Version { + vNext := v + vNext.metadata = "" + vNext.pre = "" + vNext.patch = 0 + vNext.minor = v.minor + 1 + vNext.original = v.originalVPrefix() + "" + vNext.String() + return vNext +} + +// IncMajor produces the next major version. +// Sets patch to 0. +// Sets minor to 0. +// Increments major number. +// Unsets metadata. +// Unsets prerelease status. +func (v Version) IncMajor() Version { + vNext := v + vNext.metadata = "" + vNext.pre = "" + vNext.patch = 0 + vNext.minor = 0 + vNext.major = v.major + 1 + vNext.original = v.originalVPrefix() + "" + vNext.String() + return vNext +} + +// SetPrerelease defines the prerelease value. +// Value must not include the required 'hypen' prefix. +func (v Version) SetPrerelease(prerelease string) (Version, error) { + vNext := v + if len(prerelease) > 0 && !validPrereleaseRegex.MatchString(prerelease) { + return vNext, ErrInvalidPrerelease + } + vNext.pre = prerelease + vNext.original = v.originalVPrefix() + "" + vNext.String() + return vNext, nil +} + +// SetMetadata defines metadata value. +// Value must not include the required 'plus' prefix. +func (v Version) SetMetadata(metadata string) (Version, error) { + vNext := v + if len(metadata) > 0 && !validPrereleaseRegex.MatchString(metadata) { + return vNext, ErrInvalidMetadata + } + vNext.metadata = metadata + vNext.original = v.originalVPrefix() + "" + vNext.String() + return vNext, nil +} + +// LessThan tests if one version is less than another one. +func (v *Version) LessThan(o *Version) bool { + return v.Compare(o) < 0 +} + +// GreaterThan tests if one version is greater than another one. +func (v *Version) GreaterThan(o *Version) bool { + return v.Compare(o) > 0 +} + +// Equal tests if two versions are equal to each other. +// Note, versions can be equal with different metadata since metadata +// is not considered part of the comparable version. +func (v *Version) Equal(o *Version) bool { + return v.Compare(o) == 0 +} + +// Compare compares this version to another one. It returns -1, 0, or 1 if +// the version smaller, equal, or larger than the other version. +// +// Versions are compared by X.Y.Z. Build metadata is ignored. Prerelease is +// lower than the version without a prerelease. +func (v *Version) Compare(o *Version) int { + // Compare the major, minor, and patch version for differences. If a + // difference is found return the comparison. + if d := compareSegment(v.Major(), o.Major()); d != 0 { + return d + } + if d := compareSegment(v.Minor(), o.Minor()); d != 0 { + return d + } + if d := compareSegment(v.Patch(), o.Patch()); d != 0 { + return d + } + + // At this point the major, minor, and patch versions are the same. + ps := v.pre + po := o.Prerelease() + + if ps == "" && po == "" { + return 0 + } + if ps == "" { + return 1 + } + if po == "" { + return -1 + } + + return comparePrerelease(ps, po) +} + +// UnmarshalJSON implements JSON.Unmarshaler interface. +func (v *Version) UnmarshalJSON(b []byte) error { + var s string + if err := json.Unmarshal(b, &s); err != nil { + return err + } + temp, err := NewVersion(s) + if err != nil { + return err + } + v.major = temp.major + v.minor = temp.minor + v.patch = temp.patch + v.pre = temp.pre + v.metadata = temp.metadata + v.original = temp.original + temp = nil + return nil +} + +// MarshalJSON implements JSON.Marshaler interface. +func (v *Version) MarshalJSON() ([]byte, error) { + return json.Marshal(v.String()) +} + +func compareSegment(v, o int64) int { + if v < o { + return -1 + } + if v > o { + return 1 + } + + return 0 +} + +func comparePrerelease(v, o string) int { + + // split the prelease versions by their part. The separator, per the spec, + // is a . + sparts := strings.Split(v, ".") + oparts := strings.Split(o, ".") + + // Find the longer length of the parts to know how many loop iterations to + // go through. + slen := len(sparts) + olen := len(oparts) + + l := slen + if olen > slen { + l = olen + } + + // Iterate over each part of the prereleases to compare the differences. + for i := 0; i < l; i++ { + // Since the lentgh of the parts can be different we need to create + // a placeholder. This is to avoid out of bounds issues. + stemp := "" + if i < slen { + stemp = sparts[i] + } + + otemp := "" + if i < olen { + otemp = oparts[i] + } + + d := comparePrePart(stemp, otemp) + if d != 0 { + return d + } + } + + // Reaching here means two versions are of equal value but have different + // metadata (the part following a +). They are not identical in string form + // but the version comparison finds them to be equal. + return 0 +} + +func comparePrePart(s, o string) int { + // Fastpath if they are equal + if s == o { + return 0 + } + + // When s or o are empty we can use the other in an attempt to determine + // the response. + if s == "" { + if o != "" { + return -1 + } + return 1 + } + + if o == "" { + if s != "" { + return 1 + } + return -1 + } + + // When comparing strings "99" is greater than "103". To handle + // cases like this we need to detect numbers and compare them. According + // to the semver spec, numbers are always positive. If there is a - at the + // start like -99 this is to be evaluated as an alphanum. numbers always + // have precedence over alphanum. Parsing as Uints because negative numbers + // are ignored. + + oi, n1 := strconv.ParseUint(o, 10, 64) + si, n2 := strconv.ParseUint(s, 10, 64) + + // The case where both are strings compare the strings + if n1 != nil && n2 != nil { + if s > o { + return 1 + } + return -1 + } else if n1 != nil { + // o is a string and s is a number + return -1 + } else if n2 != nil { + // s is a string and o is a number + return 1 + } + // Both are numbers + if si > oi { + return 1 + } + return -1 + +} diff --git a/vendor/github.com/Masterminds/semver/version_fuzz.go b/vendor/github.com/Masterminds/semver/version_fuzz.go new file mode 100644 index 000000000..b42bcd62b --- /dev/null +++ b/vendor/github.com/Masterminds/semver/version_fuzz.go @@ -0,0 +1,10 @@ +// +build gofuzz + +package semver + +func Fuzz(data []byte) int { + if _, err := NewVersion(string(data)); err != nil { + return 0 + } + return 1 +} diff --git a/vendor/github.com/go-mysql-org/go-mysql/client/auth.go b/vendor/github.com/go-mysql-org/go-mysql/client/auth.go index eb2db6eb9..5a8f3937a 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/client/auth.go +++ b/vendor/github.com/go-mysql-org/go-mysql/client/auth.go @@ -9,6 +9,7 @@ import ( . "github.com/go-mysql-org/go-mysql/mysql" "github.com/go-mysql-org/go-mysql/packet" "github.com/pingcap/errors" + "github.com/pingcap/tidb/pkg/parser/charset" ) const defaultAuthPluginName = AUTH_NATIVE_PASSWORD @@ -26,7 +27,11 @@ func authPluginAllowed(pluginName string) bool { return false } -// See: http://dev.mysql.com/doc/internals/en/connection-phase-packets.html#packet-Protocol::Handshake +// See: +// - https://dev.mysql.com/doc/dev/mysql-server/latest/page_protocol_connection_phase_packets_protocol_handshake_v10.html +// - https://github.com/alibaba/canal/blob/0ec46991499a22870dde4ae736b2586cbcbfea94/driver/src/main/java/com/alibaba/otter/canal/parse/driver/mysql/packets/server/HandshakeInitializationPacket.java#L89 +// - https://github.com/vapor/mysql-nio/blob/main/Sources/MySQLNIO/Protocol/MySQLProtocol%2BHandshakeV10.swift +// - https://github.com/github/vitess-gh/blob/70ae1a2b3a116ff6411b0f40852d6e71382f6e07/go/mysql/client.go func (c *Conn) readInitialHandshake() error { data, err := c.ReadPacket() if err != nil { @@ -40,22 +45,28 @@ func (c *Conn) readInitialHandshake() error { if data[0] < MinProtocolVersion { return errors.Errorf("invalid protocol version %d, must >= 10", data[0]) } + pos := 1 // skip mysql version // mysql version end with 0x00 - pos := 1 + bytes.IndexByte(data[1:], 0x00) + 1 + version := data[pos : bytes.IndexByte(data[pos:], 0x00)+1] + c.serverVersion = string(version) + pos += len(version) + 1 /*trailing zero byte*/ // connection id length is 4 c.connectionID = binary.LittleEndian.Uint32(data[pos : pos+4]) pos += 4 - c.salt = []byte{} - c.salt = append(c.salt, data[pos:pos+8]...) + // first 8 bytes of the plugin provided data (scramble) + c.salt = append(c.salt[:0], data[pos:pos+8]...) + pos += 8 - // skip filter - pos += 8 + 1 + if data[pos] != 0 { // 0x00 byte, terminating the first part of a scramble + return errors.Errorf("expect 0x00 after scramble, got %q", rune(data[pos])) + } + pos++ - // capability lower 2 bytes + // The lower 2 bytes of the Capabilities Flags c.capability = uint32(binary.LittleEndian.Uint16(data[pos : pos+2])) // check protocol if c.capability&CLIENT_PROTOCOL_41 == 0 { @@ -67,35 +78,55 @@ func (c *Conn) readInitialHandshake() error { pos += 2 if len(data) > pos { - // skip server charset - //c.charset = data[pos] + // default server a_protocol_character_set, only the lower 8-bits + // c.charset = data[pos] pos += 1 c.status = binary.LittleEndian.Uint16(data[pos : pos+2]) pos += 2 - // capability flags (upper 2 bytes) + + // The upper 2 bytes of the Capabilities Flags c.capability = uint32(binary.LittleEndian.Uint16(data[pos:pos+2]))<<16 | c.capability pos += 2 - // auth_data is end with 0x00, min data length is 13 + 8 = 21 - // ref to https://dev.mysql.com/doc/internals/en/connection-phase-packets.html#packet-Protocol::Handshake - maxAuthDataLen := 21 - if c.capability&CLIENT_PLUGIN_AUTH != 0 && int(data[pos]) > maxAuthDataLen { - maxAuthDataLen = int(data[pos]) + // length of the combined auth_plugin_data (scramble), if auth_plugin_data_len is > 0 + authPluginDataLen := data[pos] + if (c.capability&CLIENT_PLUGIN_AUTH == 0) && (authPluginDataLen > 0) { + return errors.Errorf("invalid auth plugin data filler %d", authPluginDataLen) } + pos++ - // skip reserved (all [00]) - pos += 10 + 1 + // skip reserved (all [00] ?) + pos += 10 - // auth_data is end with 0x00, so we need to trim 0x00 - resetOfAuthDataEndPos := pos + maxAuthDataLen - 8 - 1 - c.salt = append(c.salt, data[pos:resetOfAuthDataEndPos]...) + if c.capability&CLIENT_SECURE_CONNECTION != 0 { + // Rest of the plugin provided data (scramble) - // skip reset of end pos - pos = resetOfAuthDataEndPos + 1 + // https://dev.mysql.com/doc/dev/mysql-server/latest/page_protocol_connection_phase_packets_protocol_handshake_v10.html + // $len=MAX(13, length of auth-plugin-data - 8) + // + // https://github.com/mysql/mysql-server/blob/1bfe02bdad6604d54913c62614bde57a055c8332/sql/auth/sql_authentication.cc#L1641-L1642 + // the first packet *must* have at least 20 bytes of a scramble. + // if a plugin provided less, we pad it to 20 with zeros + rest := int(authPluginDataLen) - 8 + if max := 12 + 1; rest < max { + rest = max + } + + authPluginDataPart2 := data[pos : pos+rest] + pos += rest + + c.salt = append(c.salt, authPluginDataPart2...) + } if c.capability&CLIENT_PLUGIN_AUTH != 0 { - c.authPluginName = string(data[pos : len(data)-1]) + c.authPluginName = string(data[pos : pos+bytes.IndexByte(data[pos:], 0x00)]) + pos += len(c.authPluginName) + + if data[pos] != 0 { + return errors.Errorf("expect 0x00 after authPluginName, got %q", rune(data[pos])) + } + // pos++ // ineffectual } } @@ -171,7 +202,9 @@ func (c *Conn) writeAuthHandshake() error { // in the library are supported here capability |= c.ccaps&CLIENT_FOUND_ROWS | c.ccaps&CLIENT_IGNORE_SPACE | c.ccaps&CLIENT_MULTI_STATEMENTS | c.ccaps&CLIENT_MULTI_RESULTS | - c.ccaps&CLIENT_PS_MULTI_RESULTS | c.ccaps&CLIENT_CONNECT_ATTRS + c.ccaps&CLIENT_PS_MULTI_RESULTS | c.ccaps&CLIENT_CONNECT_ATTRS | + c.ccaps&CLIENT_COMPRESS | c.ccaps&CLIENT_ZSTD_COMPRESSION_ALGORITHM | + c.ccaps&CLIENT_LOCAL_FILES // To enable TLS / SSL if c.tlsConfig != nil { @@ -194,14 +227,14 @@ func (c *Conn) writeAuthHandshake() error { capability |= CLIENT_PLUGIN_AUTH_LENENC_CLIENT_DATA } - //packet length - //capability 4 - //max-packet size 4 - //charset 1 - //reserved all[0] 23 - //username - //auth - //mysql_native_password + null-terminated + // packet length + // capability 4 + // max-packet size 4 + // charset 1 + // reserved all[0] 23 + // username + // auth + // mysql_native_password + null-terminated length := 4 + 4 + 1 + 23 + len(c.user) + 1 + len(authRespLEI) + len(auth) + 21 + 1 if addNull { length++ @@ -217,6 +250,9 @@ func (c *Conn) writeAuthHandshake() error { capability |= CLIENT_CONNECT_ATTRS length += len(attrData) } + if c.ccaps&CLIENT_ZSTD_COMPRESSION_ALGORITHM > 0 { + length++ + } data := make([]byte, length+4) @@ -233,8 +269,21 @@ func (c *Conn) writeAuthHandshake() error { data[11] = 0x00 // Charset [1 byte] - // use default collation id 33 here, is utf-8 - data[12] = DEFAULT_COLLATION_ID + // use default collation id 33 here, is `utf8mb3_general_ci` + collationName := c.collation + if len(collationName) == 0 { + collationName = DEFAULT_COLLATION_NAME + } + collation, err := charset.GetCollationByName(collationName) + if err != nil { + return fmt.Errorf("invalid collation name %s", collationName) + } + + // the MySQL protocol calls for the collation id to be sent as 1, where only the + // lower 8 bits are used in this field. But wireshark shows that the first byte of + // the 23 bytes of filler is used to send the right middle 8 bits of the collation id. + // see https://github.com/mysql/mysql-server/pull/541 + data[12] = byte(collation.ID & 0xff) // SSL Connection Request Packet // http://dev.mysql.com/doc/internals/en/connection-phase-packets.html#packet-Protocol::SSLRequest @@ -290,7 +339,12 @@ func (c *Conn) writeAuthHandshake() error { // connection attributes if len(attrData) > 0 { - copy(data[pos:], attrData) + pos += copy(data[pos:], attrData) + } + + if c.ccaps&CLIENT_ZSTD_COMPRESSION_ALGORITHM > 0 { + // zstd_compression_level + data[pos] = 0x03 } return c.WritePacket(data) diff --git a/vendor/github.com/go-mysql-org/go-mysql/client/conn.go b/vendor/github.com/go-mysql-org/go-mysql/client/conn.go index 5b65af892..bef9b2de9 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/client/conn.go +++ b/vendor/github.com/go-mysql-org/go-mysql/client/conn.go @@ -6,13 +6,16 @@ import ( "crypto/tls" "fmt" "net" + "runtime" "strings" "time" + "github.com/pingcap/errors" + "github.com/pingcap/tidb/pkg/parser/charset" + . "github.com/go-mysql-org/go-mysql/mysql" "github.com/go-mysql-org/go-mysql/packet" "github.com/go-mysql-org/go-mysql/utils" - "github.com/pingcap/errors" ) type Conn struct { @@ -24,6 +27,7 @@ type Conn struct { tlsConfig *tls.Config proto string + serverVersion string // server capabilities capability uint32 // client-set capabilities only @@ -34,6 +38,8 @@ type Conn struct { status uint16 charset string + // sets the collation to be set on the auth handshake, this does not issue a 'set names' command + collation string salt []byte authPluginName string @@ -64,18 +70,30 @@ func Connect(addr string, user string, password string, dbName string, options . ctx, cancel := context.WithTimeout(context.Background(), time.Second*10) defer cancel() - dialer := &net.Dialer{} + return ConnectWithContext(ctx, addr, user, password, dbName, options...) +} +// ConnectWithContext to a MySQL addr using the provided context. +func ConnectWithContext(ctx context.Context, addr string, user string, password string, dbName string, options ...func(*Conn)) (*Conn, error) { + dialer := &net.Dialer{} return ConnectWithDialer(ctx, "", addr, user, password, dbName, dialer.DialContext, options...) } // Dialer connects to the address on the named network using the provided context. type Dialer func(ctx context.Context, network, address string) (net.Conn, error) -// Connect to a MySQL server using the given Dialer. +// ConnectWithDialer to a MySQL server using the given Dialer. func ConnectWithDialer(ctx context.Context, network string, addr string, user string, password string, dbName string, dialer Dialer, options ...func(*Conn)) (*Conn, error) { c := new(Conn) + c.attributes = map[string]string{ + "_client_name": "go-mysql", + // "_client_version": "0.1", + "_os": runtime.GOOS, + "_platform": runtime.GOARCH, + "_runtime_version": runtime.Version(), + } + if network == "" { network = getNetProto(addr) } @@ -110,6 +128,27 @@ func ConnectWithDialer(ctx context.Context, network string, addr string, user st return nil, errors.Trace(err) } + if c.ccaps&CLIENT_COMPRESS > 0 { + c.Conn.Compression = MYSQL_COMPRESS_ZLIB + } else if c.ccaps&CLIENT_ZSTD_COMPRESSION_ALGORITHM > 0 { + c.Conn.Compression = MYSQL_COMPRESS_ZSTD + } + + // if a collation was set with a ID of > 255, then we need to call SET NAMES ... + // since the auth handshake response only support collations with 1-byte ids + if len(c.collation) != 0 { + collation, err := charset.GetCollationByName(c.collation) + if err != nil { + return nil, errors.Trace(fmt.Errorf("invalid collation name %s", c.collation)) + } + + if collation.ID > 255 { + if _, err := c.exec(fmt.Sprintf("SET NAMES %s COLLATE %s", c.charset, c.collation)); err != nil { + return nil, errors.Trace(err) + } + } + } + return c, nil } @@ -117,18 +156,18 @@ func (c *Conn) handshake() error { var err error if err = c.readInitialHandshake(); err != nil { c.Close() - return errors.Trace(err) + return errors.Trace(fmt.Errorf("readInitialHandshake: %w", err)) } if err := c.writeAuthHandshake(); err != nil { c.Close() - return errors.Trace(err) + return errors.Trace(fmt.Errorf("writeAuthHandshake: %w", err)) } if err := c.handleAuthResult(); err != nil { c.Close() - return errors.Trace(err) + return errors.Trace(fmt.Errorf("handleAuthResult: %w", err)) } return nil @@ -138,6 +177,13 @@ func (c *Conn) Close() error { return c.Conn.Close() } +func (c *Conn) Quit() error { + if err := c.writeCommand(COM_QUIT); err != nil { + return err + } + return c.Close() +} + func (c *Conn) Ping() error { if err := c.writeCommand(COM_PING); err != nil { return errors.Trace(err) @@ -193,6 +239,14 @@ func (c *Conn) GetDB() string { return c.db } +func (c *Conn) GetServerVersion() string { + return c.serverVersion +} + +func (c *Conn) CompareServerVersion(v string) (int, error) { + return CompareServerVersions(c.serverVersion, v) +} + func (c *Conn) Execute(command string, args ...interface{}) (*Result, error) { if len(args) == 0 { return c.exec(command) @@ -307,7 +361,9 @@ func (c *Conn) Rollback() error { } func (c *Conn) SetAttributes(attributes map[string]string) { - c.attributes = attributes + for k, v := range attributes { + c.attributes[k] = v + } } func (c *Conn) SetCharset(charset string) error { @@ -323,6 +379,19 @@ func (c *Conn) SetCharset(charset string) error { } } +func (c *Conn) SetCollation(collation string) error { + if len(c.serverVersion) != 0 { + return errors.Trace(errors.Errorf("cannot set collation after connection is established")) + } + + c.collation = collation + return nil +} + +func (c *Conn) GetCollation() string { + return c.collation +} + func (c *Conn) FieldList(table string, wildcard string) ([]*Field, error) { if err := c.writeCommandStrStr(COM_FIELD_LIST, table, wildcard); err != nil { return nil, errors.Trace(err) @@ -398,3 +467,129 @@ func (c *Conn) exec(query string) (*Result, error) { return c.readResult(false) } + +func (c *Conn) CapabilityString() string { + var caps []string + capability := c.capability + for i := 0; capability != 0; i++ { + field := uint32(1 << i) + if capability&field == 0 { + continue + } + capability ^= field + + switch field { + case CLIENT_LONG_PASSWORD: + caps = append(caps, "CLIENT_LONG_PASSWORD") + case CLIENT_FOUND_ROWS: + caps = append(caps, "CLIENT_FOUND_ROWS") + case CLIENT_LONG_FLAG: + caps = append(caps, "CLIENT_LONG_FLAG") + case CLIENT_CONNECT_WITH_DB: + caps = append(caps, "CLIENT_CONNECT_WITH_DB") + case CLIENT_NO_SCHEMA: + caps = append(caps, "CLIENT_NO_SCHEMA") + case CLIENT_COMPRESS: + caps = append(caps, "CLIENT_COMPRESS") + case CLIENT_ODBC: + caps = append(caps, "CLIENT_ODBC") + case CLIENT_LOCAL_FILES: + caps = append(caps, "CLIENT_LOCAL_FILES") + case CLIENT_IGNORE_SPACE: + caps = append(caps, "CLIENT_IGNORE_SPACE") + case CLIENT_PROTOCOL_41: + caps = append(caps, "CLIENT_PROTOCOL_41") + case CLIENT_INTERACTIVE: + caps = append(caps, "CLIENT_INTERACTIVE") + case CLIENT_SSL: + caps = append(caps, "CLIENT_SSL") + case CLIENT_IGNORE_SIGPIPE: + caps = append(caps, "CLIENT_IGNORE_SIGPIPE") + case CLIENT_TRANSACTIONS: + caps = append(caps, "CLIENT_TRANSACTIONS") + case CLIENT_RESERVED: + caps = append(caps, "CLIENT_RESERVED") + case CLIENT_SECURE_CONNECTION: + caps = append(caps, "CLIENT_SECURE_CONNECTION") + case CLIENT_MULTI_STATEMENTS: + caps = append(caps, "CLIENT_MULTI_STATEMENTS") + case CLIENT_MULTI_RESULTS: + caps = append(caps, "CLIENT_MULTI_RESULTS") + case CLIENT_PS_MULTI_RESULTS: + caps = append(caps, "CLIENT_PS_MULTI_RESULTS") + case CLIENT_PLUGIN_AUTH: + caps = append(caps, "CLIENT_PLUGIN_AUTH") + case CLIENT_CONNECT_ATTRS: + caps = append(caps, "CLIENT_CONNECT_ATTRS") + case CLIENT_PLUGIN_AUTH_LENENC_CLIENT_DATA: + caps = append(caps, "CLIENT_PLUGIN_AUTH_LENENC_CLIENT_DATA") + case CLIENT_CAN_HANDLE_EXPIRED_PASSWORDS: + caps = append(caps, "CLIENT_CAN_HANDLE_EXPIRED_PASSWORDS") + case CLIENT_SESSION_TRACK: + caps = append(caps, "CLIENT_SESSION_TRACK") + case CLIENT_DEPRECATE_EOF: + caps = append(caps, "CLIENT_DEPRECATE_EOF") + case CLIENT_OPTIONAL_RESULTSET_METADATA: + caps = append(caps, "CLIENT_OPTIONAL_RESULTSET_METADATA") + case CLIENT_ZSTD_COMPRESSION_ALGORITHM: + caps = append(caps, "CLIENT_ZSTD_COMPRESSION_ALGORITHM") + case CLIENT_QUERY_ATTRIBUTES: + caps = append(caps, "CLIENT_QUERY_ATTRIBUTES") + case MULTI_FACTOR_AUTHENTICATION: + caps = append(caps, "MULTI_FACTOR_AUTHENTICATION") + case CLIENT_CAPABILITY_EXTENSION: + caps = append(caps, "CLIENT_CAPABILITY_EXTENSION") + case CLIENT_SSL_VERIFY_SERVER_CERT: + caps = append(caps, "CLIENT_SSL_VERIFY_SERVER_CERT") + case CLIENT_REMEMBER_OPTIONS: + caps = append(caps, "CLIENT_REMEMBER_OPTIONS") + default: + caps = append(caps, fmt.Sprintf("(%d)", field)) + } + } + + return strings.Join(caps, "|") +} + +func (c *Conn) StatusString() string { + var stats []string + status := c.status + for i := 0; status != 0; i++ { + field := uint16(1 << i) + if status&field == 0 { + continue + } + status ^= field + + switch field { + case SERVER_STATUS_IN_TRANS: + stats = append(stats, "SERVER_STATUS_IN_TRANS") + case SERVER_STATUS_AUTOCOMMIT: + stats = append(stats, "SERVER_STATUS_AUTOCOMMIT") + case SERVER_MORE_RESULTS_EXISTS: + stats = append(stats, "SERVER_MORE_RESULTS_EXISTS") + case SERVER_STATUS_NO_GOOD_INDEX_USED: + stats = append(stats, "SERVER_STATUS_NO_GOOD_INDEX_USED") + case SERVER_STATUS_NO_INDEX_USED: + stats = append(stats, "SERVER_STATUS_NO_INDEX_USED") + case SERVER_STATUS_CURSOR_EXISTS: + stats = append(stats, "SERVER_STATUS_CURSOR_EXISTS") + case SERVER_STATUS_LAST_ROW_SEND: + stats = append(stats, "SERVER_STATUS_LAST_ROW_SEND") + case SERVER_STATUS_DB_DROPPED: + stats = append(stats, "SERVER_STATUS_DB_DROPPED") + case SERVER_STATUS_NO_BACKSLASH_ESCAPED: + stats = append(stats, "SERVER_STATUS_NO_BACKSLASH_ESCAPED") + case SERVER_STATUS_METADATA_CHANGED: + stats = append(stats, "SERVER_STATUS_METADATA_CHANGED") + case SERVER_QUERY_WAS_SLOW: + stats = append(stats, "SERVER_QUERY_WAS_SLOW") + case SERVER_PS_OUT_PARAMS: + stats = append(stats, "SERVER_PS_OUT_PARAMS") + default: + stats = append(stats, fmt.Sprintf("(%d)", field)) + } + } + + return strings.Join(stats, "|") +} diff --git a/vendor/github.com/go-mysql-org/go-mysql/client/pool.go b/vendor/github.com/go-mysql-org/go-mysql/client/pool.go index 263d52773..91341a537 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/client/pool.go +++ b/vendor/github.com/go-mysql-org/go-mysql/client/pool.go @@ -2,6 +2,7 @@ package client import ( "context" + "log" "math" "math/rand" "sync" @@ -42,6 +43,9 @@ type ( } readyConnection chan Connection + ctx context.Context + cancel context.CancelFunc + wg sync.WaitGroup } ConnectionStats struct { @@ -74,59 +78,109 @@ var ( MaxNewConnectionAtOnce = 5 ) -// NewPool initializes new connection pool and uses params: addr, user, password, dbName and options. -// minAlive specifies the minimum number of open connections that the pool will try to maintain. -// maxAlive specifies the maximum number of open connections (for internal reasons, -// may be greater by 1 inside newConnectionProducer). -// maxIdle specifies the maximum number of idle connections (see DefaultIdleTimeout). -func NewPool( - logFunc LogFunc, - minAlive int, - maxAlive int, - maxIdle int, +// NewPoolWithOptions initializes new connection pool and uses params: addr, user, password, dbName and options. +func NewPoolWithOptions( addr string, user string, password string, dbName string, - options ...func(conn *Conn), -) *Pool { - if minAlive > maxAlive { - minAlive = maxAlive + options ...PoolOption, +) (*Pool, error) { + po := getDefaultPoolOptions() + + po.addr = addr + po.user = user + po.password = password + po.dbName = dbName + + for _, o := range options { + o(&po) } - if maxIdle > maxAlive { - maxIdle = maxAlive + + if po.minAlive > po.maxAlive { + po.minAlive = po.maxAlive } - if maxIdle <= minAlive { - maxIdle = minAlive + if po.maxIdle > po.maxAlive { + po.maxIdle = po.maxAlive + } + if po.maxIdle <= po.minAlive { + po.maxIdle = po.minAlive } pool := &Pool{ - logFunc: logFunc, - minAlive: minAlive, - maxAlive: maxAlive, - maxIdle: maxIdle, + logFunc: po.logFunc, + minAlive: po.minAlive, + maxAlive: po.maxAlive, + maxIdle: po.maxIdle, idleCloseTimeout: Timestamp(math.Ceil(DefaultIdleTimeout.Seconds())), idlePingTimeout: Timestamp(math.Ceil(MaxIdleTimeoutWithoutPing.Seconds())), connect: func() (*Conn, error) { - return Connect(addr, user, password, dbName, options...) + return Connect(addr, user, password, dbName, po.connOptions...) }, readyConnection: make(chan Connection), } + pool.ctx, pool.cancel = context.WithCancel(context.Background()) + pool.synchro.idleConnections = make([]Connection, 0, pool.maxIdle) + pool.wg.Add(1) go pool.newConnectionProducer() if pool.minAlive > 0 { - pool.logFunc(`Pool: Setup %d new connections (minimal pool size)...`, pool.minAlive) - pool.startNewConnections(pool.minAlive) + go pool.startNewConnections(pool.minAlive) } + pool.wg.Add(1) go pool.closeOldIdleConnections() + if po.newPoolPingTimeout > 0 { + ctx, cancel := context.WithTimeout(pool.ctx, po.newPoolPingTimeout) + err := pool.checkConnection(ctx) + cancel() + if err != nil { + pool.Close() + return nil, errors.Errorf("checkConnection: %s", err) + } + } + + return pool, nil +} + +// NewPool initializes new connection pool and uses params: addr, user, password, dbName and options. +// minAlive specifies the minimum number of open connections that the pool will try to maintain. +// maxAlive specifies the maximum number of open connections (for internal reasons, +// may be greater by 1 inside newConnectionProducer). +// maxIdle specifies the maximum number of idle connections (see DefaultIdleTimeout). +// +// Deprecated: use NewPoolWithOptions +func NewPool( + logFunc LogFunc, + minAlive int, + maxAlive int, + maxIdle int, + addr string, + user string, + password string, + dbName string, + options ...func(conn *Conn), +) *Pool { + pool, err := NewPoolWithOptions( + addr, + user, + password, + dbName, + WithLogFunc(logFunc), + WithPoolLimits(minAlive, maxAlive, maxIdle), + WithConnOptions(options...), + ) + if err != nil { + pool.logFunc(`Pool: NewPool: %s`, err.Error()) + } + return pool } @@ -143,6 +197,9 @@ func (pool *Pool) GetStats(stats *ConnectionStats) { // GetConn returns connection from the pool or create new func (pool *Pool) GetConn(ctx context.Context) (*Conn, error) { for { + if pool.ctx.Err() != nil { + return nil, errors.Errorf("failed get conn, pool closed") + } connection, err := pool.getConnection(ctx) if err != nil { return nil, err @@ -224,6 +281,8 @@ func (pool *Pool) putConnectionUnsafe(connection Connection) { } func (pool *Pool) newConnectionProducer() { + defer pool.wg.Done() + var connection Connection var err error @@ -252,12 +311,30 @@ func (pool *Pool) newConnectionProducer() { pool.synchro.stats.TotalCount-- // Bad luck, should try again pool.synchro.Unlock() - time.Sleep(time.Duration(10+rand.Intn(90)) * time.Millisecond) - continue + pool.logFunc("Cannot establish new db connection: %s", err.Error()) + + timer := time.NewTimer( + time.Duration(10+rand.Intn(90)) * time.Millisecond, + ) + + select { + case <-timer.C: + continue + case <-pool.ctx.Done(): + if !timer.Stop() { + <-timer.C + } + return + } } } - pool.readyConnection <- connection + select { + case pool.readyConnection <- connection: + case <-pool.ctx.Done(): + pool.closeConn(connection.conn) + return + } } } @@ -293,19 +370,26 @@ func (pool *Pool) getIdleConnectionUnsafe() Connection { } func (pool *Pool) closeOldIdleConnections() { + defer pool.wg.Done() + var toPing []Connection ticker := time.NewTicker(5 * time.Second) - for range ticker.C { - toPing = pool.getOldIdleConnections(toPing[:0]) - if len(toPing) == 0 { - continue - } - pool.recheckConnections(toPing) + for { + select { + case <-pool.ctx.Done(): + return + case <-ticker.C: + toPing = pool.getOldIdleConnections(toPing[:0]) + if len(toPing) == 0 { + continue + } + pool.recheckConnections(toPing) - if !pool.spawnConnectionsIfNeeded() { - pool.closeIdleConnectionsIfCan() + if !pool.spawnConnectionsIfNeeded() { + pool.closeIdleConnectionsIfCan() + } } } } @@ -447,6 +531,8 @@ func (pool *Pool) closeConn(conn *Conn) { } func (pool *Pool) startNewConnections(count int) { + pool.logFunc(`Pool: Setup %d new connections (minimal pool size)...`, count) + connections := make([]Connection, 0, count) for i := 0; i < count; i++ { if conn, err := pool.createNewConnection(); err == nil { @@ -454,6 +540,8 @@ func (pool *Pool) startNewConnections(count int) { pool.synchro.stats.TotalCount++ pool.synchro.Unlock() connections = append(connections, conn) + } else { + pool.logFunc(`Pool: createNewConnection: %s`, err) } } @@ -475,3 +563,50 @@ func (pool *Pool) ping(conn *Conn) error { } return err } + +// Close only shutdown idle connections. we couldn't control the connection which not in the pool. +// So before call Close, Call PutConn to put all connections that in use back to connection pool first. +func (pool *Pool) Close() { + pool.cancel() + //wait newConnectionProducer exit. + pool.wg.Wait() + //close idle connections + pool.synchro.Lock() + for _, connection := range pool.synchro.idleConnections { + pool.synchro.stats.TotalCount-- + _ = connection.conn.Close() + } + pool.synchro.idleConnections = nil + pool.synchro.Unlock() +} + +// checkConnection tries to connect and ping DB server +func (pool *Pool) checkConnection(ctx context.Context) error { + errChan := make(chan error, 1) + + go func() { + conn, err := pool.connect() + if err == nil { + err = conn.Ping() + _ = conn.Close() + } + errChan <- err + }() + + select { + case err := <-errChan: + return err + case <-ctx.Done(): + return ctx.Err() + } +} + +// getDefaultPoolOptions returns pool config for low load services +func getDefaultPoolOptions() poolOptions { + return poolOptions{ + logFunc: log.Printf, + minAlive: 1, + maxAlive: 10, + maxIdle: 2, + } +} diff --git a/vendor/github.com/go-mysql-org/go-mysql/client/pool_options.go b/vendor/github.com/go-mysql-org/go-mysql/client/pool_options.go new file mode 100644 index 000000000..f47b00716 --- /dev/null +++ b/vendor/github.com/go-mysql-org/go-mysql/client/pool_options.go @@ -0,0 +1,60 @@ +package client + +import ( + "time" +) + +type ( + poolOptions struct { + logFunc LogFunc + + minAlive int + maxAlive int + maxIdle int + + addr string + user string + password string + dbName string + + connOptions []func(conn *Conn) + + newPoolPingTimeout time.Duration + } +) + +type ( + PoolOption func(o *poolOptions) +) + +// WithPoolLimits sets pool limits: +// - minAlive specifies the minimum number of open connections that the pool will try to maintain. +// - maxAlive specifies the maximum number of open connections (for internal reasons, +// may be greater by 1 inside newConnectionProducer). +// - maxIdle specifies the maximum number of idle connections (see DefaultIdleTimeout). +func WithPoolLimits(minAlive, maxAlive, maxIdle int) PoolOption { + return func(o *poolOptions) { + o.minAlive = minAlive + o.maxAlive = maxAlive + o.maxIdle = maxIdle + } +} + +func WithLogFunc(f LogFunc) PoolOption { + return func(o *poolOptions) { + o.logFunc = f + } +} + +func WithConnOptions(options ...func(conn *Conn)) PoolOption { + return func(o *poolOptions) { + o.connOptions = append(o.connOptions, options...) + } +} + +// WithNewPoolPingTimeout enables connect & ping to DB during the pool initialization +func WithNewPoolPingTimeout(timeout time.Duration) PoolOption { + return func(o *poolOptions) { + o.newPoolPingTimeout = timeout + } +} diff --git a/vendor/github.com/go-mysql-org/go-mysql/client/resp.go b/vendor/github.com/go-mysql-org/go-mysql/client/resp.go index ab809cc67..ad72deff6 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/client/resp.go +++ b/vendor/github.com/go-mysql-org/go-mysql/client/resp.go @@ -6,6 +6,7 @@ import ( "crypto/x509" "encoding/binary" "encoding/pem" + "fmt" "github.com/pingcap/errors" "github.com/siddontang/go/hack" @@ -60,9 +61,9 @@ func (c *Conn) handleOKPacket(data []byte) (*Result, error) { // pos += 2 } - //new ok package will check CLIENT_SESSION_TRACK too, but I don't support it now. + // new ok package will check CLIENT_SESSION_TRACK too, but I don't support it now. - //skip info + // skip info return r, nil } @@ -75,7 +76,7 @@ func (c *Conn) handleErrorPacket(data []byte) error { pos += 2 if c.capability&CLIENT_PROTOCOL_41 > 0 { - //skip '#' + // skip '#' pos++ e.State = hack.String(data[pos : pos+5]) pos += 5 @@ -89,11 +90,11 @@ func (c *Conn) handleErrorPacket(data []byte) error { func (c *Conn) handleAuthResult() error { data, switchToPlugin, err := c.readAuthResult() if err != nil { - return err + return fmt.Errorf("readAuthResult: %w", err) } // handle auth switch, only support 'sha256_password', and 'caching_sha2_password' if switchToPlugin != "" { - //fmt.Printf("now switching auth plugin to '%s'\n", switchToPlugin) + // fmt.Printf("now switching auth plugin to '%s'\n", switchToPlugin) if data == nil { data = c.salt } else { @@ -168,7 +169,7 @@ func (c *Conn) handleAuthResult() error { func (c *Conn) readAuthResult() ([]byte, string, error) { data, err := c.ReadPacket() if err != nil { - return nil, "", err + return nil, "", fmt.Errorf("ReadPacket: %w", err) } // see: https://insidemysql.com/preparing-your-community-connector-for-mysql-8-part-2-sha256/ @@ -343,7 +344,7 @@ func (c *Conn) readResultColumns(result *Result) (err error) { rawPkgLen := len(result.RawPkg) result.RawPkg, err = c.ReadPacketReuseMem(result.RawPkg) if err != nil { - return + return err } data = result.RawPkg[rawPkgLen:] @@ -351,7 +352,7 @@ func (c *Conn) readResultColumns(result *Result) (err error) { if c.isEOFPacket(data) { if c.capability&CLIENT_PROTOCOL_41 > 0 { result.Warnings = binary.LittleEndian.Uint16(data[1:]) - //todo add strict_mode, warning will be treat as error + // todo add strict_mode, warning will be treat as error result.Status = binary.LittleEndian.Uint16(data[3:]) c.status = result.Status } @@ -360,7 +361,7 @@ func (c *Conn) readResultColumns(result *Result) (err error) { err = ErrMalformPacket } - return + return err } if result.Fields[i] == nil { @@ -368,7 +369,7 @@ func (c *Conn) readResultColumns(result *Result) (err error) { } err = result.Fields[i].Parse(data) if err != nil { - return + return err } result.FieldNames[hack.String(result.Fields[i].Name)] = i @@ -384,7 +385,7 @@ func (c *Conn) readResultRows(result *Result, isBinary bool) (err error) { rawPkgLen := len(result.RawPkg) result.RawPkg, err = c.ReadPacketReuseMem(result.RawPkg) if err != nil { - return + return err } data = result.RawPkg[rawPkgLen:] @@ -392,7 +393,7 @@ func (c *Conn) readResultRows(result *Result, isBinary bool) (err error) { if c.isEOFPacket(data) { if c.capability&CLIENT_PROTOCOL_41 > 0 { result.Warnings = binary.LittleEndian.Uint16(data[1:]) - //todo add strict_mode, warning will be treat as error + // todo add strict_mode, warning will be treat as error result.Status = binary.LittleEndian.Uint16(data[3:]) c.status = result.Status } @@ -433,7 +434,7 @@ func (c *Conn) readResultRowsStreaming(result *Result, isBinary bool, perRowCb S for { data, err = c.ReadPacketReuseMem(data[:0]) if err != nil { - return + return err } // EOF Packet diff --git a/vendor/github.com/go-mysql-org/go-mysql/mysql/const.go b/vendor/github.com/go-mysql-org/go-mysql/mysql/const.go index e2f3a0afe..0cb7fc704 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/mysql/const.go +++ b/vendor/github.com/go-mysql-org/go-mysql/mysql/const.go @@ -76,6 +76,8 @@ const ( ) const ( + // https://dev.mysql.com/doc/dev/mysql-server/latest/group__group__cs__capabilities__flags.html + CLIENT_LONG_PASSWORD uint32 = 1 << iota CLIENT_FOUND_ROWS CLIENT_LONG_FLAG @@ -98,6 +100,16 @@ const ( CLIENT_PLUGIN_AUTH CLIENT_CONNECT_ATTRS CLIENT_PLUGIN_AUTH_LENENC_CLIENT_DATA + CLIENT_CAN_HANDLE_EXPIRED_PASSWORDS + CLIENT_SESSION_TRACK + CLIENT_DEPRECATE_EOF + CLIENT_OPTIONAL_RESULTSET_METADATA + CLIENT_ZSTD_COMPRESSION_ALGORITHM + CLIENT_QUERY_ATTRIBUTES + MULTI_FACTOR_AUTHENTICATION + CLIENT_CAPABILITY_EXTENSION + CLIENT_SSL_VERIFY_SERVER_CERT + CLIENT_REMEMBER_OPTIONS ) const ( @@ -119,7 +131,7 @@ const ( MYSQL_TYPE_VARCHAR MYSQL_TYPE_BIT - //mysql 5.6 + // mysql 5.6 MYSQL_TYPE_TIMESTAMP2 MYSQL_TYPE_DATETIME2 MYSQL_TYPE_TIME2 @@ -158,11 +170,19 @@ const ( ) const ( + DEFAULT_ADDR = "127.0.0.1:3306" + DEFAULT_USER = "root" + DEFAULT_PASSWORD = "" + DEFAULT_FLAVOR = "mysql" DEFAULT_CHARSET = "utf8" DEFAULT_COLLATION_ID uint8 = 33 DEFAULT_COLLATION_NAME string = "utf8_general_ci" ) +const ( + DEFAULT_DUMP_EXECUTION_PATH = "mysqldump" +) + // Like vitess, use flavor for different MySQL versions, const ( MySQLFlavor = "mysql" @@ -173,3 +193,9 @@ const ( MYSQL_OPTION_MULTI_STATEMENTS_ON = iota MYSQL_OPTION_MULTI_STATEMENTS_OFF ) + +const ( + MYSQL_COMPRESS_NONE = iota + MYSQL_COMPRESS_ZLIB + MYSQL_COMPRESS_ZSTD +) diff --git a/vendor/github.com/go-mysql-org/go-mysql/mysql/field.go b/vendor/github.com/go-mysql-org/go-mysql/mysql/field.go index 7ffce4004..da83dca2c 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/mysql/field.go +++ b/vendor/github.com/go-mysql-org/go-mysql/mysql/field.go @@ -2,6 +2,9 @@ package mysql import ( "encoding/binary" + "fmt" + "strconv" + "strings" "github.com/go-mysql-org/go-mysql/utils" ) @@ -49,42 +52,42 @@ func (f *Field) Parse(p FieldData) (err error) { //skip catelog, always def n, err = SkipLengthEncodedString(p) if err != nil { - return + return err } pos += n //schema f.Schema, _, n, err = LengthEncodedString(p[pos:]) if err != nil { - return + return err } pos += n //table f.Table, _, n, err = LengthEncodedString(p[pos:]) if err != nil { - return + return err } pos += n //org_table f.OrgTable, _, n, err = LengthEncodedString(p[pos:]) if err != nil { - return + return err } pos += n //name f.Name, _, n, err = LengthEncodedString(p[pos:]) if err != nil { - return + return err } pos += n //org_name f.OrgName, _, n, err = LengthEncodedString(p[pos:]) if err != nil { - return + return err } pos += n @@ -123,7 +126,7 @@ func (f *Field) Parse(p FieldData) (err error) { if pos+int(f.DefaultValueLength) > len(p) { err = ErrMalformPacket - return + return err } //default value string[$len] @@ -210,3 +213,31 @@ func (fv *FieldValue) Value() interface{} { return nil } } + +// String returns a MySQL literal string that equals the value. +func (fv *FieldValue) String() string { + switch fv.Type { + case FieldValueTypeNull: + return "NULL" + case FieldValueTypeUnsigned: + return strconv.FormatUint(fv.AsUint64(), 10) + case FieldValueTypeSigned: + return strconv.FormatInt(fv.AsInt64(), 10) + case FieldValueTypeFloat: + return strconv.FormatFloat(fv.AsFloat64(), 'f', -1, 64) + case FieldValueTypeString: + b := strings.Builder{} + b.Grow(len(fv.str) + 2) + b.WriteByte('\'') + for i := range fv.str { + if fv.str[i] == '\'' { + b.WriteByte('\\') + } + b.WriteByte(fv.str[i]) + } + b.WriteByte('\'') + return b.String() + default: + return fmt.Sprintf("unknown type %d of FieldValue", fv.Type) + } +} diff --git a/vendor/github.com/go-mysql-org/go-mysql/mysql/gtid.go b/vendor/github.com/go-mysql-org/go-mysql/mysql/gtid.go index ae519ef25..b73bd7eda 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/mysql/gtid.go +++ b/vendor/github.com/go-mysql-org/go-mysql/mysql/gtid.go @@ -29,3 +29,7 @@ func ParseGTIDSet(flavor string, s string) (GTIDSet, error) { return nil, errors.Errorf("invalid flavor %s", flavor) } } + +type BinlogGTIDEvent interface { + GTIDNext() (GTIDSet, error) +} diff --git a/vendor/github.com/go-mysql-org/go-mysql/mysql/mariadb_gtid.go b/vendor/github.com/go-mysql-org/go-mysql/mysql/mariadb_gtid.go index 8bfffd092..6e472c657 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/mysql/mariadb_gtid.go +++ b/vendor/github.com/go-mysql-org/go-mysql/mysql/mariadb_gtid.go @@ -103,13 +103,13 @@ func (gtid *MariadbGTID) forward(newer *MariadbGTID) error { // MariadbGTIDSet is a set of mariadb gtid type MariadbGTIDSet struct { - Sets map[uint32]*MariadbGTID + Sets map[uint32]map[uint32]*MariadbGTID } // ParseMariadbGTIDSet parses str into mariadb gtid sets func ParseMariadbGTIDSet(str string) (GTIDSet, error) { s := new(MariadbGTIDSet) - s.Sets = make(map[uint32]*MariadbGTID) + s.Sets = make(map[uint32]map[uint32]*MariadbGTID) if str == "" { return s, nil } @@ -126,14 +126,17 @@ func (s *MariadbGTIDSet) AddSet(gtid *MariadbGTID) error { return nil } - o, ok := s.Sets[gtid.DomainID] - if ok { + if serverSets, ok := s.Sets[gtid.DomainID]; !ok { + s.Sets[gtid.DomainID] = map[uint32]*MariadbGTID{ + gtid.ServerID: gtid, + } + } else if o, ok := serverSets[gtid.ServerID]; !ok { + serverSets[gtid.ServerID] = gtid + } else { err := o.forward(gtid) if err != nil { return errors.Trace(err) } - } else { - s.Sets[gtid.DomainID] = gtid } return nil @@ -159,7 +162,9 @@ func (s *MariadbGTIDSet) Update(GTIDStr string) error { func (s *MariadbGTIDSet) String() string { sets := make([]string, 0, len(s.Sets)) for _, set := range s.Sets { - sets = append(sets, set.String()) + for _, gtid := range set { + sets = append(sets, gtid.String()) + } } sort.Strings(sets) @@ -170,10 +175,12 @@ func (s *MariadbGTIDSet) String() string { func (s *MariadbGTIDSet) Encode() []byte { var buf bytes.Buffer sep := "" - for _, gtid := range s.Sets { - buf.WriteString(sep) - buf.WriteString(gtid.String()) - sep = "," + for _, set := range s.Sets { + for _, gtid := range set { + buf.WriteString(sep) + buf.WriteString(gtid.String()) + sep = "," + } } return buf.Bytes() @@ -182,10 +189,13 @@ func (s *MariadbGTIDSet) Encode() []byte { // Clone clones a mariadb gtid set func (s *MariadbGTIDSet) Clone() GTIDSet { clone := &MariadbGTIDSet{ - Sets: make(map[uint32]*MariadbGTID), + Sets: make(map[uint32]map[uint32]*MariadbGTID), } - for domainID, gtid := range s.Sets { - clone.Sets[domainID] = gtid.Clone() + for domainID, set := range s.Sets { + clone.Sets[domainID] = make(map[uint32]*MariadbGTID) + for serverID, gtid := range set { + clone.Sets[domainID][serverID] = gtid.Clone() + } } return clone @@ -202,15 +212,21 @@ func (s *MariadbGTIDSet) Equal(o GTIDSet) bool { return false } - for domainID, gtid := range other.Sets { - o, ok := s.Sets[domainID] + for domainID, set := range other.Sets { + serverSet, ok := s.Sets[domainID] if !ok { return false } - - if *gtid != *o { + if len(serverSet) != len(set) { return false } + for serverID, gtid := range set { + if o, ok := serverSet[serverID]; !ok { + return false + } else if *gtid != *o { + return false + } + } } return true @@ -223,14 +239,17 @@ func (s *MariadbGTIDSet) Contain(o GTIDSet) bool { return false } - for doaminID, gtid := range other.Sets { - o, ok := s.Sets[doaminID] + for doaminID, set := range other.Sets { + serverSet, ok := s.Sets[doaminID] if !ok { return false } - - if !o.Contain(gtid) { - return false + for serverID, gtid := range set { + if o, ok := serverSet[serverID]; !ok { + return false + } else if !o.Contain(gtid) { + return false + } } } diff --git a/vendor/github.com/go-mysql-org/go-mysql/mysql/position.go b/vendor/github.com/go-mysql-org/go-mysql/mysql/position.go index c592d6363..09bd95f70 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/mysql/position.go +++ b/vendor/github.com/go-mysql-org/go-mysql/mysql/position.go @@ -6,12 +6,14 @@ import ( "strings" ) -// For binlog filename + position based replication +// Position for binlog filename + position based replication type Position struct { Name string Pos uint32 } +// Compare the position information between the p and o, +// if p > o return 1 means the position of p is further back than o. func (p Position) Compare(o Position) int { // First compare binlog name nameCmp := CompareBinlogFileName(p.Name, o.Name) @@ -32,6 +34,9 @@ func (p Position) String() string { return fmt.Sprintf("(%s, %d)", p.Name, p.Pos) } +// CompareBinlogFileName compares the binlog filename of a and b. +// if a>b will return 1. +// if b>a will return -1. func CompareBinlogFileName(a, b string) int { // sometimes it's convenient to construct a `Position` literal with no `Name` if a == "" && b == "" { @@ -61,9 +66,11 @@ func CompareBinlogFileName(a, b string) int { return n[:i], seq } + // get the basename(aBase) and the serial number(aSeq) aBase, aSeq := splitBinlogName(a) bBase, bSeq := splitBinlogName(b) + // aBase and bBase generally will be equal if they are both from the same database configuration. if aBase > bBase { return 1 } else if aBase < bBase { diff --git a/vendor/github.com/go-mysql-org/go-mysql/mysql/resultset_helper.go b/vendor/github.com/go-mysql-org/go-mysql/mysql/resultset_helper.go index 8c632066a..36c0f0a3b 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/mysql/resultset_helper.go +++ b/vendor/github.com/go-mysql-org/go-mysql/mysql/resultset_helper.go @@ -220,7 +220,7 @@ func BuildSimpleBinaryResultset(names []string, values [][]interface{}) (*Result } } if value == nil { - nullBitmap[(i+2)/8] |= 1 << (uint(i+2) % 8) + nullBitmap[(j+2)/8] |= 1 << (uint(j+2) % 8) continue } diff --git a/vendor/github.com/go-mysql-org/go-mysql/mysql/util.go b/vendor/github.com/go-mysql-org/go-mysql/mysql/util.go index e8d436fa2..5abe540bc 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/mysql/util.go +++ b/vendor/github.com/go-mysql-org/go-mysql/mysql/util.go @@ -1,6 +1,8 @@ package mysql import ( + "bytes" + "compress/zlib" "crypto/rand" "crypto/rsa" "crypto/sha1" @@ -13,6 +15,7 @@ import ( "strings" "time" + "github.com/Masterminds/semver" "github.com/pingcap/errors" "github.com/siddontang/go/hack" ) @@ -91,6 +94,24 @@ func EncryptPassword(password string, seed []byte, pub *rsa.PublicKey) ([]byte, return rsa.EncryptOAEP(sha1v, rand.Reader, pub, plain, nil) } +func DecompressMariadbData(data []byte) ([]byte, error) { + // algorithm always 0=zlib + // algorithm := (data[pos] & 0x07) >> 4 + headerSize := int(data[0] & 0x07) + uncompressedDataSize := BFixedLengthInt(data[1 : 1+headerSize]) + uncompressedData := make([]byte, uncompressedDataSize) + r, err := zlib.NewReader(bytes.NewReader(data[1+headerSize:])) + if err != nil { + return nil, err + } + defer r.Close() + _, err = io.ReadFull(r, uncompressedData) + if err != nil { + return nil, err + } + return uncompressedData, nil +} + // AppendLengthEncodedInteger: encodes a uint64 value and appends it to the given bytes slice func AppendLengthEncodedInteger(b []byte, n uint64) []byte { switch { @@ -379,6 +400,23 @@ func ErrorEqual(err1, err2 error) bool { return e1.Error() == e2.Error() } +func CompareServerVersions(a, b string) (int, error) { + var ( + aVer, bVer *semver.Version + err error + ) + + if aVer, err = semver.NewVersion(a); err != nil { + return 0, fmt.Errorf("cannot parse %q as semver: %w", a, err) + } + + if bVer, err = semver.NewVersion(b); err != nil { + return 0, fmt.Errorf("cannot parse %q as semver: %w", b, err) + } + + return aVer.Compare(bVer), nil +} + var encodeRef = map[byte]byte{ '\x00': '0', '\'': '\'', diff --git a/vendor/github.com/go-mysql-org/go-mysql/packet/conn.go b/vendor/github.com/go-mysql-org/go-mysql/packet/conn.go index 8d020fe92..6096d4f06 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/packet/conn.go +++ b/vendor/github.com/go-mysql-org/go-mysql/packet/conn.go @@ -3,17 +3,20 @@ package packet import ( "bufio" "bytes" + "compress/zlib" "crypto/rand" "crypto/rsa" "crypto/sha1" "crypto/x509" "encoding/pem" + goErrors "errors" "io" "net" "sync" . "github.com/go-mysql-org/go-mysql/mysql" "github.com/go-mysql-org/go-mysql/utils" + "github.com/klauspost/compress/zstd" "github.com/pingcap/errors" ) @@ -56,6 +59,16 @@ type Conn struct { header [4]byte Sequence uint8 + + Compression uint8 + + CompressedSequence uint8 + + compressedHeader [7]byte + + compressedReader io.Reader + + compressedReaderActive bool } func NewConn(conn net.Conn) *Conn { @@ -94,6 +107,23 @@ func (c *Conn) ReadPacketReuseMem(dst []byte) ([]byte, error) { utils.BytesBufferPut(buf) }() + if c.Compression != MYSQL_COMPRESS_NONE { + // it's possible that we're using compression but the server response with a compressed + // packet with uncompressed length of 0. In this case we leave compressedReader nil. The + // compressedReaderActive flag is important to track the state of the reader, allowing + // for the compressedReader to be reset after a packet write. Without this flag, when a + // compressed packet with uncompressed length of 0 is read, the compressedReader would + // be nil, and we'd incorrectly attempt to read the next packet as compressed. + if !c.compressedReaderActive { + var err error + c.compressedReader, err = c.newCompressedPacketReader() + if err != nil { + return nil, err + } + c.compressedReaderActive = true + } + } + if err := c.ReadPacketTo(buf); err != nil { return nil, errors.Trace(err) } @@ -120,7 +150,44 @@ func (c *Conn) ReadPacketReuseMem(dst []byte) ([]byte, error) { return result, nil } -func (c *Conn) copyN(dst io.Writer, src io.Reader, n int64) (written int64, err error) { +// newCompressedPacketReader creates a new compressed packet reader. +func (c *Conn) newCompressedPacketReader() (io.Reader, error) { + if _, err := io.ReadFull(c.reader, c.compressedHeader[:7]); err != nil { + return nil, errors.Wrapf(ErrBadConn, "io.ReadFull(compressedHeader) failed. err %v", err) + } + + compressedSequence := c.compressedHeader[3] + if compressedSequence != c.CompressedSequence { + return nil, errors.Errorf("invalid compressed sequence %d != %d", + compressedSequence, c.CompressedSequence) + } + + compressedLength := int(uint32(c.compressedHeader[0]) | uint32(c.compressedHeader[1])<<8 | uint32(c.compressedHeader[2])<<16) + uncompressedLength := int(uint32(c.compressedHeader[4]) | uint32(c.compressedHeader[5])<<8 | uint32(c.compressedHeader[6])<<16) + if uncompressedLength > 0 { + limitedReader := io.LimitReader(c.reader, int64(compressedLength)) + switch c.Compression { + case MYSQL_COMPRESS_ZLIB: + return zlib.NewReader(limitedReader) + case MYSQL_COMPRESS_ZSTD: + return zstd.NewReader(limitedReader) + } + } + + return nil, nil +} + +func (c *Conn) currentPacketReader() io.Reader { + if c.Compression == MYSQL_COMPRESS_NONE || c.compressedReader == nil { + return c.reader + } else { + return c.compressedReader + } +} + +func (c *Conn) copyN(dst io.Writer, n int64) (int64, error) { + var written int64 + for n > 0 { bcap := cap(c.copyNBuf) if int64(bcap) > n { @@ -128,14 +195,33 @@ func (c *Conn) copyN(dst io.Writer, src io.Reader, n int64) (written int64, err } buf := c.copyNBuf[:bcap] - rd, err := io.ReadAtLeast(src, buf, bcap) + // Call ReadAtLeast with the currentPacketReader as it may change on every iteration + // of this loop. + rd, err := io.ReadAtLeast(c.currentPacketReader(), buf, bcap) + n -= int64(rd) + // ReadAtLeast will return EOF or ErrUnexpectedEOF when fewer than the min + // bytes are read. In this case, and when we have compression then advance + // the sequence number and reset the compressed reader to continue reading + // the remaining bytes in the next compressed packet. + if c.Compression != MYSQL_COMPRESS_NONE && + (goErrors.Is(err, io.ErrUnexpectedEOF) || goErrors.Is(err, io.EOF)) { + // we have read to EOF and read an incomplete uncompressed packet + // so advance the compressed sequence number and reset the compressed reader + // to get the remaining unread uncompressed bytes from the next compressed packet. + c.CompressedSequence++ + if c.compressedReader, err = c.newCompressedPacketReader(); err != nil { + return written, errors.Trace(err) + } + } + if err != nil { return written, errors.Trace(err) } - wr, err := dst.Write(buf) + // careful to only write from the buffer the number of bytes read + wr, err := dst.Write(buf[:rd]) written += int64(wr) if err != nil { return written, errors.Trace(err) @@ -146,8 +232,20 @@ func (c *Conn) copyN(dst io.Writer, src io.Reader, n int64) (written int64, err } func (c *Conn) ReadPacketTo(w io.Writer) error { - if _, err := io.ReadFull(c.reader, c.header[:4]); err != nil { + b := utils.BytesBufferGet() + defer func() { + utils.BytesBufferPut(b) + }() + + // packets that come in a compressed packet may be partial + // so use the copyN function to read the packet header into a + // buffer, since copyN is capable of getting the next compressed + // packet and updating the Conn state with a new compressedReader. + if _, err := c.copyN(b, 4); err != nil { return errors.Wrapf(ErrBadConn, "io.ReadFull(header) failed. err %v", err) + } else { + // copy was successful so copy the 4 bytes from the buffer to the header + copy(c.header[:4], b.Bytes()[:4]) } length := int(uint32(c.header[0]) | uint32(c.header[1])<<8 | uint32(c.header[2])<<16) @@ -164,7 +262,7 @@ func (c *Conn) ReadPacketTo(w io.Writer) error { buf.Grow(length) } - if n, err := c.copyN(w, c.reader, int64(length)); err != nil { + if n, err := c.copyN(w, int64(length)); err != nil { return errors.Wrapf(ErrBadConn, "io.CopyN failed. err %v, copied %v, expected %v", err, n, length) } else if n != int64(length) { return errors.Wrapf(ErrBadConn, "io.CopyN failed(n != int64(length)). %v bytes copied, while %v expected", n, length) @@ -173,7 +271,7 @@ func (c *Conn) ReadPacketTo(w io.Writer) error { return nil } - if err := c.ReadPacketTo(w); err != nil { + if err = c.ReadPacketTo(w); err != nil { return errors.Wrap(err, "ReadPacketTo failed") } } @@ -209,14 +307,93 @@ func (c *Conn) WritePacket(data []byte) error { data[2] = byte(length >> 16) data[3] = c.Sequence - if n, err := c.Write(data); err != nil { - return errors.Wrapf(ErrBadConn, "Write failed. err %v", err) - } else if n != len(data) { - return errors.Wrapf(ErrBadConn, "Write failed. only %v bytes written, while %v expected", n, len(data)) + switch c.Compression { + case MYSQL_COMPRESS_NONE: + if n, err := c.Write(data); err != nil { + return errors.Wrapf(ErrBadConn, "Write failed. err %v", err) + } else if n != len(data) { + return errors.Wrapf(ErrBadConn, "Write failed. only %v bytes written, while %v expected", n, len(data)) + } + case MYSQL_COMPRESS_ZLIB, MYSQL_COMPRESS_ZSTD: + if n, err := c.writeCompressed(data); err != nil { + return errors.Wrapf(ErrBadConn, "Write failed. err %v", err) + } else if n != len(data) { + return errors.Wrapf(ErrBadConn, "Write failed. only %v bytes written, while %v expected", n, len(data)) + } + c.compressedReader = nil + c.compressedReaderActive = false + default: + return errors.Wrapf(ErrBadConn, "Write failed. Unsuppored compression algorithm set") + } + + c.Sequence++ + return nil +} + +func (c *Conn) writeCompressed(data []byte) (n int, err error) { + var compressedLength, uncompressedLength int + var payload, compressedPacket bytes.Buffer + var w io.WriteCloser + minCompressLength := 50 + compressedHeader := make([]byte, 7) + + switch c.Compression { + case MYSQL_COMPRESS_ZLIB: + w, err = zlib.NewWriterLevel(&payload, zlib.HuffmanOnly) + case MYSQL_COMPRESS_ZSTD: + w, err = zstd.NewWriter(&payload) + } + if err != nil { + return 0, err + } + + if len(data) > minCompressLength { + uncompressedLength = len(data) + n, err = w.Write(data) + if err != nil { + return 0, err + } + err = w.Close() + if err != nil { + return 0, err + } + } + + if len(data) > minCompressLength { + compressedLength = len(payload.Bytes()) + } else { + compressedLength = len(data) + } + + c.CompressedSequence = 0 + compressedHeader[0] = byte(compressedLength) + compressedHeader[1] = byte(compressedLength >> 8) + compressedHeader[2] = byte(compressedLength >> 16) + compressedHeader[3] = c.CompressedSequence + compressedHeader[4] = byte(uncompressedLength) + compressedHeader[5] = byte(uncompressedLength >> 8) + compressedHeader[6] = byte(uncompressedLength >> 16) + _, err = compressedPacket.Write(compressedHeader) + if err != nil { + return 0, err + } + c.CompressedSequence++ + + if len(data) > minCompressLength { + _, err = compressedPacket.Write(payload.Bytes()) } else { - c.Sequence++ - return nil + n, err = compressedPacket.Write(data) + } + if err != nil { + return 0, err } + + _, err = c.Write(compressedPacket.Bytes()) + if err != nil { + return 0, err + } + + return n, nil } // WriteClearAuthPacket: Client clear text authentication packet diff --git a/vendor/github.com/go-mysql-org/go-mysql/replication/backup.go b/vendor/github.com/go-mysql-org/go-mysql/replication/backup.go index d75ba365f..86265ae70 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/replication/backup.go +++ b/vendor/github.com/go-mysql-org/go-mysql/replication/backup.go @@ -14,6 +14,25 @@ import ( // StartBackup: Like mysqlbinlog remote raw backup // Backup remote binlog from position (filename, offset) and write in backupDir func (b *BinlogSyncer) StartBackup(backupDir string, p Position, timeout time.Duration) error { + err := os.MkdirAll(backupDir, 0755) + if err != nil { + return errors.Trace(err) + } + return b.StartBackupWithHandler(p, timeout, func(filename string) (io.WriteCloser, error) { + return os.OpenFile(path.Join(backupDir, filename), os.O_CREATE|os.O_WRONLY, 0644) + }) +} + +// StartBackupWithHandler starts the backup process for the binary log using the specified position and handler. +// The process will continue until the timeout is reached or an error occurs. +// +// Parameters: +// - p: The starting position in the binlog from which to begin the backup. +// - timeout: The maximum duration to wait for new binlog events before stopping the backup process. +// If set to 0, a default very long timeout (30 days) is used instead. +// - handler: A function that takes a binlog filename and returns an WriteCloser for writing raw events to. +func (b *BinlogSyncer) StartBackupWithHandler(p Position, timeout time.Duration, + handler func(binlogFilename string) (io.WriteCloser, error)) (retErr error) { if timeout == 0 { // a very long timeout here timeout = 30 * 3600 * 24 * time.Second @@ -22,10 +41,6 @@ func (b *BinlogSyncer) StartBackup(backupDir string, p Position, timeout time.Du // Force use raw mode b.parser.SetRawMode(true) - if err := os.MkdirAll(backupDir, 0755); err != nil { - return errors.Trace(err) - } - s, err := b.StartSync(p) if err != nil { return errors.Trace(err) @@ -34,10 +49,14 @@ func (b *BinlogSyncer) StartBackup(backupDir string, p Position, timeout time.Du var filename string var offset uint32 - var f *os.File + var w io.WriteCloser defer func() { - if f != nil { - f.Close() + var closeErr error + if w != nil { + closeErr = w.Close() + } + if retErr == nil { + retErr = closeErr } }() @@ -67,26 +86,29 @@ func (b *BinlogSyncer) StartBackup(backupDir string, p Position, timeout time.Du } else if e.Header.EventType == FORMAT_DESCRIPTION_EVENT { // FormateDescriptionEvent is the first event in binlog, we will close old one and create a new - if f != nil { - f.Close() + if w != nil { + if err = w.Close(); err != nil { + w = nil + return errors.Trace(err) + } } if len(filename) == 0 { return errors.Errorf("empty binlog filename for FormateDescriptionEvent") } - f, err = os.OpenFile(path.Join(backupDir, filename), os.O_CREATE|os.O_WRONLY, 0644) + w, err = handler(filename) if err != nil { return errors.Trace(err) } // write binlog header fe'bin' - if _, err = f.Write(BinLogFileHeader); err != nil { + if _, err = w.Write(BinLogFileHeader); err != nil { return errors.Trace(err) } } - if n, err := f.Write(e.RawData); err != nil { + if n, err := w.Write(e.RawData); err != nil { return errors.Trace(err) } else if n != len(e.RawData) { return errors.Trace(io.ErrShortWrite) diff --git a/vendor/github.com/go-mysql-org/go-mysql/replication/binlogstreamer.go b/vendor/github.com/go-mysql-org/go-mysql/replication/binlogstreamer.go index 61254fba0..5214e92dd 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/replication/binlogstreamer.go +++ b/vendor/github.com/go-mysql-org/go-mysql/replication/binlogstreamer.go @@ -60,9 +60,9 @@ func (s *BinlogStreamer) GetEventWithStartTime(ctx context.Context, startTime ti // DumpEvents dumps all left events func (s *BinlogStreamer) DumpEvents() []*BinlogEvent { count := len(s.ch) - events := make([]*BinlogEvent, 0, count) - for i := 0; i < count; i++ { - events = append(events, <-s.ch) + events := make([]*BinlogEvent, count) + for i := range events { + events[i] = <-s.ch } return events } @@ -85,9 +85,17 @@ func (s *BinlogStreamer) closeWithError(err error) { } func NewBinlogStreamer() *BinlogStreamer { + return NewBinlogStreamerWithChanSize(10240) +} + +func NewBinlogStreamerWithChanSize(chanSize int) *BinlogStreamer { s := new(BinlogStreamer) - s.ch = make(chan *BinlogEvent, 10240) + if chanSize <= 0 { + chanSize = 10240 + } + + s.ch = make(chan *BinlogEvent, chanSize) s.ech = make(chan error, 4) return s diff --git a/vendor/github.com/go-mysql-org/go-mysql/replication/binlogsyncer.go b/vendor/github.com/go-mysql-org/go-mysql/replication/binlogsyncer.go index 7f8b06b72..72a22c45c 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/replication/binlogsyncer.go +++ b/vendor/github.com/go-mysql-org/go-mysql/replication/binlogsyncer.go @@ -121,7 +121,11 @@ type BinlogSyncerConfig struct { RowsEventDecodeFunc func(*RowsEvent, []byte) error + TableMapOptionalMetaDecodeFunc func([]byte) error + DiscardGTIDSet bool + + EventCacheCount int } // BinlogSyncer syncs binlog event from server. @@ -166,6 +170,9 @@ func NewBinlogSyncer(cfg BinlogSyncerConfig) *BinlogSyncer { dialer := &net.Dialer{} cfg.Dialer = dialer.DialContext } + if cfg.EventCacheCount == 0 { + cfg.EventCacheCount = 10240 + } // Clear the Password to avoid outputing it in log. pass := cfg.Password @@ -184,6 +191,7 @@ func NewBinlogSyncer(cfg BinlogSyncerConfig) *BinlogSyncer { b.parser.SetUseDecimal(b.cfg.UseDecimal) b.parser.SetVerifyChecksum(b.cfg.VerifyChecksum) b.parser.SetRowsEventDecodeFunc(b.cfg.RowsEventDecodeFunc) + b.parser.SetTableMapOptionalMetaDecodeFunc(b.cfg.TableMapOptionalMetaDecodeFunc) b.running = false b.ctx, b.cancel = context.WithCancel(context.Background()) @@ -393,7 +401,7 @@ func (b *BinlogSyncer) prepare() error { func (b *BinlogSyncer) startDumpStream() *BinlogStreamer { b.running = true - s := NewBinlogStreamer() + s := NewBinlogStreamerWithChanSize(b.cfg.EventCacheCount) b.wg.Add(1) go b.onStream(s) @@ -891,6 +899,10 @@ func (b *BinlogSyncer) newConnection(ctx context.Context) (*client.Conn, error) return client.ConnectWithDialer(timeoutCtx, "", addr, b.cfg.User, b.cfg.Password, "", b.cfg.Dialer, func(c *client.Conn) { c.SetTLSConfig(b.cfg.TLSConfig) + c.SetAttributes(map[string]string{"_client_role": "binary_log_listener"}) + if b.cfg.ReadTimeout > 0 { + _ = c.SetReadDeadline(time.Now().Add(b.cfg.ReadTimeout)) + } }) } diff --git a/vendor/github.com/go-mysql-org/go-mysql/replication/const.go b/vendor/github.com/go-mysql-org/go-mysql/replication/const.go index a8821ba25..9ebd80b37 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/replication/const.go +++ b/vendor/github.com/go-mysql-org/go-mysql/replication/const.go @@ -35,7 +35,7 @@ const ( const ( BINLOG_ROW_IMAGE_FULL = "FULL" - BINLOG_ROW_IAMGE_MINIMAL = "MINIMAL" + BINLOG_ROW_IMAGE_MINIMAL = "MINIMAL" BINLOG_ROW_IMAGE_NOBLOB = "NOBLOB" ) @@ -90,6 +90,9 @@ const ( TRANSACTION_CONTEXT_EVENT VIEW_CHANGE_EVENT XA_PREPARE_LOG_EVENT + PARTIAL_UPDATE_ROWS_EVENT + TRANSACTION_PAYLOAD_EVENT + HEARTBEAT_LOG_EVENT_V2 ) const ( @@ -98,6 +101,11 @@ const ( MARIADB_BINLOG_CHECKPOINT_EVENT MARIADB_GTID_EVENT MARIADB_GTID_LIST_EVENT + MARIADB_START_ENCRYPTION_EVENT + MARIADB_QUERY_COMPRESSED_EVENT + MARIADB_WRITE_ROWS_COMPRESSED_EVENT_V1 + MARIADB_UPDATE_ROWS_COMPRESSED_EVENT_V1 + MARIADB_DELETE_ROWS_COMPRESSED_EVENT_V1 ) func (e EventType) String() string { @@ -188,6 +196,22 @@ func (e EventType) String() string { return "ViewChangeEvent" case XA_PREPARE_LOG_EVENT: return "XAPrepareLogEvent" + case PARTIAL_UPDATE_ROWS_EVENT: + return "PartialUpdateRowsEvent" + case TRANSACTION_PAYLOAD_EVENT: + return "TransactionPayloadEvent" + case HEARTBEAT_LOG_EVENT_V2: + return "HeartbeatLogEventV2" + case MARIADB_START_ENCRYPTION_EVENT: + return "MariadbStartEncryptionEvent" + case MARIADB_QUERY_COMPRESSED_EVENT: + return "MariadbQueryCompressedEvent" + case MARIADB_WRITE_ROWS_COMPRESSED_EVENT_V1: + return "MariadbWriteRowsCompressedEventV1" + case MARIADB_UPDATE_ROWS_COMPRESSED_EVENT_V1: + return "MariadbUpdateRowsCompressedEventV1" + case MARIADB_DELETE_ROWS_COMPRESSED_EVENT_V1: + return "MariadbDeleteRowsCompressedEventV1" default: return "UnknownEvent" @@ -216,6 +240,7 @@ const ( TABLE_MAP_OPT_META_PRIMARY_KEY_WITH_PREFIX TABLE_MAP_OPT_META_ENUM_AND_SET_DEFAULT_CHARSET TABLE_MAP_OPT_META_ENUM_AND_SET_COLUMN_CHARSET + TABLE_MAP_OPT_META_COLUMN_VISIBILITY ) type IntVarEventType byte @@ -225,3 +250,8 @@ const ( LAST_INSERT_ID INSERT_ID ) + +const ( + ENUM_EXTRA_ROW_INFO_TYPECODE_NDB byte = iota + ENUM_EXTRA_ROW_INFO_TYPECODE_PARTITION +) diff --git a/vendor/github.com/go-mysql-org/go-mysql/replication/event.go b/vendor/github.com/go-mysql-org/go-mysql/replication/event.go index 5a1f5c654..b9e13bf1a 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/replication/event.go +++ b/vendor/github.com/go-mysql-org/go-mysql/replication/event.go @@ -225,18 +225,18 @@ type PreviousGTIDsEvent struct { } func (e *PreviousGTIDsEvent) Decode(data []byte) error { - var previousGTIDSets []string pos := 0 uuidCount := binary.LittleEndian.Uint16(data[pos : pos+8]) pos += 8 - for i := uint16(0); i < uuidCount; i++ { + previousGTIDSets := make([]string, uuidCount) + for i := range previousGTIDSets { uuid := e.decodeUuid(data[pos : pos+16]) pos += 16 sliceCount := binary.LittleEndian.Uint16(data[pos : pos+8]) pos += 8 - var intervals []string - for i := uint16(0); i < sliceCount; i++ { + intervals := make([]string, sliceCount) + for i := range intervals { start := e.decodeInterval(data[pos : pos+8]) pos += 8 stop := e.decodeInterval(data[pos : pos+8]) @@ -247,9 +247,9 @@ func (e *PreviousGTIDsEvent) Decode(data []byte) error { } else { interval = fmt.Sprintf("%d-%d", start, stop-1) } - intervals = append(intervals, interval) + intervals[i] = interval } - previousGTIDSets = append(previousGTIDSets, fmt.Sprintf("%s:%s", uuid, strings.Join(intervals, ":"))) + previousGTIDSets[i] = fmt.Sprintf("%s:%s", uuid, strings.Join(intervals, ":")) } e.GTIDSets = strings.Join(previousGTIDSets, ",") return nil @@ -297,6 +297,9 @@ type QueryEvent struct { Schema []byte Query []byte + // for mariadb QUERY_COMPRESSED_EVENT + compressed bool + // in fact QueryEvent dosen't have the GTIDSet information, just for beneficial to use GSet GTIDSet } @@ -328,7 +331,15 @@ func (e *QueryEvent) Decode(data []byte) error { //skip 0x00 pos++ - e.Query = data[pos:] + if e.compressed { + decompressedQuery, err := DecompressMariadbData(data[pos:]) + if err != nil { + return err + } + e.Query = decompressedQuery + } else { + e.Query = data[pos:] + } return nil } @@ -451,6 +462,14 @@ func (e *GTIDEvent) Dump(w io.Writer) { fmt.Fprintln(w) } +func (e *GTIDEvent) GTIDNext() (GTIDSet, error) { + u, err := uuid.FromBytes(e.SID) + if err != nil { + return nil, err + } + return ParseMysqlGTIDSet(strings.Join([]string{u.String(), strconv.FormatInt(e.GNO, 10)}, ":")) +} + // ImmediateCommitTime returns the commit time of this trx on the immediate server // or zero time if not available. func (e *GTIDEvent) ImmediateCommitTime() time.Time { @@ -614,6 +633,10 @@ func (e *MariadbGTIDEvent) Dump(w io.Writer) { fmt.Fprintln(w) } +func (e *MariadbGTIDEvent) GTIDNext() (GTIDSet, error) { + return ParseMariadbGTIDSet(e.GTID.String()) +} + type MariadbGTIDListEvent struct { GTIDs []MariadbGTID } diff --git a/vendor/github.com/go-mysql-org/go-mysql/replication/json_binary.go b/vendor/github.com/go-mysql-org/go-mysql/replication/json_binary.go index f1e0abd33..065dd6b2e 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/replication/json_binary.go +++ b/vendor/github.com/go-mysql-org/go-mysql/replication/json_binary.go @@ -1,13 +1,14 @@ package replication import ( - "encoding/json" "fmt" "math" - . "github.com/go-mysql-org/go-mysql/mysql" + "github.com/goccy/go-json" "github.com/pingcap/errors" "github.com/siddontang/go/hack" + + . "github.com/go-mysql-org/go-mysql/mysql" ) const ( @@ -44,6 +45,60 @@ const ( jsonbValueEntrySizeLarge = 1 + jsonbLargeOffsetSize ) +var ( + ErrCorruptedJSONDiff = fmt.Errorf("corrupted JSON diff") // ER_CORRUPTED_JSON_DIFF +) + +type ( + // JsonDiffOperation is an enum that describes what kind of operation a JsonDiff object represents. + // https://github.com/mysql/mysql-server/blob/8.0/sql/json_diff.h + JsonDiffOperation byte +) + +const ( + // The JSON value in the given path is replaced with a new value. + // + // It has the same effect as `JSON_REPLACE(col, path, value)`. + JsonDiffOperationReplace = JsonDiffOperation(iota) + + // Add a new element at the given path. + // + // If the path specifies an array element, it has the same effect as `JSON_ARRAY_INSERT(col, path, value)`. + // + // If the path specifies an object member, it has the same effect as `JSON_INSERT(col, path, value)`. + JsonDiffOperationInsert + + // The JSON value at the given path is removed from an array or object. + // + // It has the same effect as `JSON_REMOVE(col, path)`. + JsonDiffOperationRemove +) + +type ( + JsonDiff struct { + Op JsonDiffOperation + Path string + Value string + } +) + +func (op JsonDiffOperation) String() string { + switch op { + case JsonDiffOperationReplace: + return "Replace" + case JsonDiffOperationInsert: + return "Insert" + case JsonDiffOperationRemove: + return "Remove" + default: + return fmt.Sprintf("Unknown(%d)", op) + } +} + +func (jd *JsonDiff) String() string { + return fmt.Sprintf("json_diff(op:%s path:%s value:%s)", jd.Op, jd.Path, jd.Value) +} + func jsonbGetOffsetSize(isSmall bool) int { if isSmall { return jsonbSmallOffsetSize @@ -71,11 +126,6 @@ func jsonbGetValueEntrySize(isSmall bool) int { // decodeJsonBinary decodes the JSON binary encoding data and returns // the common JSON encoding data. func (e *RowsEvent) decodeJsonBinary(data []byte) ([]byte, error) { - // Sometimes, we can insert a NULL JSON even we set the JSON field as NOT NULL. - // If we meet this case, we can return an empty slice. - if len(data) == 0 { - return []byte{}, nil - } d := jsonBinaryDecoder{ useDecimal: e.useDecimal, ignoreDecodeErr: e.ignoreJSONDecodeErr, @@ -491,3 +541,43 @@ func (d *jsonBinaryDecoder) decodeVariableLength(data []byte) (int, int) { return 0, 0 } + +func (e *RowsEvent) decodeJsonPartialBinary(data []byte) (*JsonDiff, error) { + // see Json_diff_vector::read_binary() in mysql-server/sql/json_diff.cc + operationNumber := JsonDiffOperation(data[0]) + switch operationNumber { + case JsonDiffOperationReplace: + case JsonDiffOperationInsert: + case JsonDiffOperationRemove: + default: + return nil, ErrCorruptedJSONDiff + } + data = data[1:] + + pathLength, _, n := LengthEncodedInt(data) + data = data[n:] + + path := data[:pathLength] + data = data[pathLength:] + + diff := &JsonDiff{ + Op: operationNumber, + Path: string(path), + // Value will be filled below + } + + if operationNumber == JsonDiffOperationRemove { + return diff, nil + } + + valueLength, _, n := LengthEncodedInt(data) + data = data[n:] + + d, err := e.decodeJsonBinary(data[:valueLength]) + if err != nil { + return nil, fmt.Errorf("cannot read json diff for field %q: %w", path, err) + } + diff.Value = string(d) + + return diff, nil +} diff --git a/vendor/github.com/go-mysql-org/go-mysql/replication/parser.go b/vendor/github.com/go-mysql-org/go-mysql/replication/parser.go index 329159d26..4caf496c2 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/replication/parser.go +++ b/vendor/github.com/go-mysql-org/go-mysql/replication/parser.go @@ -42,6 +42,8 @@ type BinlogParser struct { verifyChecksum bool rowsEventDecodeFunc func(*RowsEvent, []byte) error + + tableMapOptionalMetaDecodeFunc func([]byte) error } func NewBinlogParser() *BinlogParser { @@ -218,6 +220,10 @@ func (p *BinlogParser) SetRowsEventDecodeFunc(rowsEventDecodeFunc func(*RowsEven p.rowsEventDecodeFunc = rowsEventDecodeFunc } +func (p *BinlogParser) SetTableMapOptionalMetaDecodeFunc(tableMapOptionalMetaDecondeFunc func([]byte) error) { + p.tableMapOptionalMetaDecodeFunc = tableMapOptionalMetaDecondeFunc +} + func (p *BinlogParser) parseHeader(data []byte) (*EventHeader, error) { h := new(EventHeader) err := h.Decode(data) @@ -249,11 +255,16 @@ func (p *BinlogParser) parseEvent(h *EventHeader, data []byte, rawData []byte) ( switch h.EventType { case QUERY_EVENT: e = &QueryEvent{} + case MARIADB_QUERY_COMPRESSED_EVENT: + e = &QueryEvent{ + compressed: true, + } case XID_EVENT: e = &XIDEvent{} case TABLE_MAP_EVENT: te := &TableMapEvent{ - flavor: p.flavor, + flavor: p.flavor, + optionalMetaDecodeFunc: p.tableMapOptionalMetaDecodeFunc, } if p.format.EventTypeHeaderLengths[TABLE_MAP_EVENT-1] == 6 { te.tableIDSize = 4 @@ -269,7 +280,12 @@ func (p *BinlogParser) parseEvent(h *EventHeader, data []byte, rawData []byte) ( UPDATE_ROWS_EVENTv1, WRITE_ROWS_EVENTv2, UPDATE_ROWS_EVENTv2, - DELETE_ROWS_EVENTv2: + DELETE_ROWS_EVENTv2, + MARIADB_WRITE_ROWS_COMPRESSED_EVENT_V1, + MARIADB_UPDATE_ROWS_COMPRESSED_EVENT_V1, + MARIADB_DELETE_ROWS_COMPRESSED_EVENT_V1, + PARTIAL_UPDATE_ROWS_EVENT: // Extension of UPDATE_ROWS_EVENT, allowing partial values according to binlog_row_value_options + e = p.newRowsEvent(h) case ROWS_QUERY_EVENT: e = &RowsQueryEvent{} @@ -295,6 +311,8 @@ func (p *BinlogParser) parseEvent(h *EventHeader, data []byte, rawData []byte) ( e = &PreviousGTIDsEvent{} case INTVAR_EVENT: e = &IntVarEvent{} + case TRANSACTION_PAYLOAD_EVENT: + e = p.newTransactionPayloadEvent() default: e = &GenericEvent{} } @@ -379,7 +397,9 @@ func (p *BinlogParser) verifyCrc32Checksum(rawData []byte) error { func (p *BinlogParser) newRowsEvent(h *EventHeader) *RowsEvent { e := &RowsEvent{} - if p.format.EventTypeHeaderLengths[h.EventType-1] == 6 { + + postHeaderLen := p.format.EventTypeHeaderLengths[h.EventType-1] + if postHeaderLen == 6 { e.tableIDSize = 4 } else { e.tableIDSize = 6 @@ -387,6 +407,7 @@ func (p *BinlogParser) newRowsEvent(h *EventHeader) *RowsEvent { e.needBitmap2 = false e.tables = p.tables + e.eventType = h.EventType e.parseTime = p.parseTime e.timestampStringLocation = p.timestampStringLocation e.useDecimal = p.useDecimal @@ -406,6 +427,16 @@ func (p *BinlogParser) newRowsEvent(h *EventHeader) *RowsEvent { case UPDATE_ROWS_EVENTv1: e.Version = 1 e.needBitmap2 = true + case MARIADB_WRITE_ROWS_COMPRESSED_EVENT_V1: + e.Version = 1 + e.compressed = true + case MARIADB_DELETE_ROWS_COMPRESSED_EVENT_V1: + e.Version = 1 + e.compressed = true + case MARIADB_UPDATE_ROWS_COMPRESSED_EVENT_V1: + e.Version = 1 + e.compressed = true + e.needBitmap2 = true case WRITE_ROWS_EVENTv2: e.Version = 2 case UPDATE_ROWS_EVENTv2: @@ -413,7 +444,17 @@ func (p *BinlogParser) newRowsEvent(h *EventHeader) *RowsEvent { e.needBitmap2 = true case DELETE_ROWS_EVENTv2: e.Version = 2 + case PARTIAL_UPDATE_ROWS_EVENT: + e.Version = 2 + e.needBitmap2 = true } return e } + +func (p *BinlogParser) newTransactionPayloadEvent() *TransactionPayloadEvent { + e := &TransactionPayloadEvent{} + e.format = *p.format + + return e +} diff --git a/vendor/github.com/go-mysql-org/go-mysql/replication/row_event.go b/vendor/github.com/go-mysql-org/go-mysql/replication/row_event.go index fa3c05268..a0d42e8ec 100644 --- a/vendor/github.com/go-mysql-org/go-mysql/replication/row_event.go +++ b/vendor/github.com/go-mysql-org/go-mysql/replication/row_event.go @@ -33,7 +33,7 @@ type TableMapEvent struct { ColumnType []byte ColumnMeta []uint16 - //len = (ColumnCount + 7) / 8 + // len = (ColumnCount + 7) / 8 NullBitmap []byte /* @@ -81,6 +81,11 @@ type TableMapEvent struct { // EnumSetDefaultCharset/EnumSetColumnCharset is similar to DefaultCharset/ColumnCharset but for enum/set columns. EnumSetDefaultCharset []uint64 EnumSetColumnCharset []uint64 + + // VisibilityBitmap stores bits that are set if corresponding column is not invisible (MySQL 8.0.23+) + VisibilityBitmap []byte + + optionalMetaDecodeFunc func(data []byte) (err error) } func (e *TableMapEvent) Decode(data []byte) error { @@ -97,7 +102,7 @@ func (e *TableMapEvent) Decode(data []byte) error { e.Schema = data[pos : pos+int(schemaLength)] pos += int(schemaLength) - //skip 0x00 + // skip 0x00 pos++ tableLength := data[pos] @@ -106,7 +111,7 @@ func (e *TableMapEvent) Decode(data []byte) error { e.Table = data[pos : pos+int(tableLength)] pos += int(tableLength) - //skip 0x00 + // skip 0x00 pos++ var n int @@ -137,8 +142,14 @@ func (e *TableMapEvent) Decode(data []byte) error { pos += nullBitmapSize - if err = e.decodeOptionalMeta(data[pos:]); err != nil { - return err + if e.optionalMetaDecodeFunc != nil { + if err = e.optionalMetaDecodeFunc(data[pos:]); err != nil { + return err + } + } else { + if err = e.decodeOptionalMeta(data[pos:]); err != nil { + return err + } } return nil @@ -196,13 +207,13 @@ func (e *TableMapEvent) decodeMeta(data []byte) error { for i, t := range e.ColumnType { switch t { case MYSQL_TYPE_STRING: - var x = uint16(data[pos]) << 8 //real type - x += uint16(data[pos+1]) //pack or field length + var x = uint16(data[pos]) << 8 // real type + x += uint16(data[pos+1]) // pack or field length e.ColumnMeta[i] = x pos += 2 case MYSQL_TYPE_NEWDECIMAL: - var x = uint16(data[pos]) << 8 //precision - x += uint16(data[pos+1]) //decimals + var x = uint16(data[pos]) << 8 // precision + x += uint16(data[pos+1]) // decimals e.ColumnMeta[i] = x pos += 2 case MYSQL_TYPE_VAR_STRING, @@ -312,6 +323,9 @@ func (e *TableMapEvent) decodeOptionalMeta(data []byte) (err error) { return err } + case TABLE_MAP_OPT_META_COLUMN_VISIBILITY: + e.VisibilityBitmap = v + default: // Ignore for future extension } @@ -421,6 +435,7 @@ func (e *TableMapEvent) Dump(w io.Writer) { fmt.Fprintf(w, "Primary key prefix: %v\n", e.PrimaryKeyPrefix) fmt.Fprintf(w, "Enum/set default charset: %v\n", e.EnumSetDefaultCharset) fmt.Fprintf(w, "Enum/set column charset: %v\n", e.EnumSetColumnCharset) + fmt.Fprintf(w, "Invisible Column bitmap: \n%s", hex.Dump(e.VisibilityBitmap)) unsignedMap := e.UnsignedMap() fmt.Fprintf(w, "UnsignedMap: %#v\n", unsignedMap) @@ -440,6 +455,9 @@ func (e *TableMapEvent) Dump(w io.Writer) { geometryTypeMap := e.GeometryTypeMap() fmt.Fprintf(w, "GeometryTypeMap: %#v\n", geometryTypeMap) + visibilityMap := e.VisibilityMap() + fmt.Fprintf(w, "VisibilityMap: %#v\n", visibilityMap) + nameMaxLen := 0 for _, name := range e.ColumnName { if len(name) > nameMaxLen { @@ -552,12 +570,9 @@ func (e *TableMapEvent) SetStrValueString() [][]string { if len(e.SetStrValue) == 0 { return nil } - e.setStrValueString = make([][]string, 0, len(e.SetStrValue)) - for _, vals := range e.SetStrValue { - e.setStrValueString = append( - e.setStrValueString, - e.bytesSlice2StrSlice(vals), - ) + e.setStrValueString = make([][]string, len(e.SetStrValue)) + for i, vals := range e.SetStrValue { + e.setStrValueString[i] = e.bytesSlice2StrSlice(vals) } } return e.setStrValueString @@ -570,12 +585,9 @@ func (e *TableMapEvent) EnumStrValueString() [][]string { if len(e.EnumStrValue) == 0 { return nil } - e.enumStrValueString = make([][]string, 0, len(e.EnumStrValue)) - for _, vals := range e.EnumStrValue { - e.enumStrValueString = append( - e.enumStrValueString, - e.bytesSlice2StrSlice(vals), - ) + e.enumStrValueString = make([][]string, len(e.EnumStrValue)) + for i, vals := range e.EnumStrValue { + e.enumStrValueString[i] = e.bytesSlice2StrSlice(vals) } } return e.enumStrValueString @@ -594,9 +606,9 @@ func (e *TableMapEvent) bytesSlice2StrSlice(src [][]byte) []string { if src == nil { return nil } - ret := make([]string, 0, len(src)) - for _, item := range src { - ret = append(ret, string(item)) + ret := make([]string, len(src)) + for i, item := range src { + ret[i] = string(item) } return ret } @@ -608,14 +620,19 @@ func (e *TableMapEvent) UnsignedMap() map[int]bool { if len(e.SignednessBitmap) == 0 { return nil } - p := 0 ret := make(map[int]bool) - for i := 0; i < int(e.ColumnCount); i++ { - if !e.IsNumericColumn(i) { - continue + i := 0 + for _, field := range e.SignednessBitmap { + for c := 0x80; c != 0; { + if e.IsNumericColumn(i) { + ret[i] = field&byte(c) != 0 + c >>= 1 + } + i++ + if i >= int(e.ColumnCount) { + return ret + } } - ret[i] = e.SignednessBitmap[p/8]&(1< visiblity. +// Invisible column was introduced in MySQL 8.0.23 +// nil is returned if not available. +func (e *TableMapEvent) VisibilityMap() map[int]bool { + if len(e.VisibilityBitmap) == 0 { + return nil + } + ret := make(map[int]bool) + i := 0 + for _, field := range e.VisibilityBitmap { + for c := 0x80; c != 0; c >>= 1 { + ret[i] = field&byte(c) != 0 + i++ + if uint64(i) >= e.ColumnCount { + return ret + } + } + } + return ret +} + // Below realType and IsXXXColumn are base from: // table_def::type in sql/rpl_utility.h // Table_map_log_event::print_columns in mysql-8.0/sql/log_event.cc and mariadb-10.5/sql/log_event_client.cc @@ -807,27 +845,79 @@ func (e *TableMapEvent) IsEnumOrSetColumn(i int) bool { return rtyp == MYSQL_TYPE_ENUM || rtyp == MYSQL_TYPE_SET } +// JsonColumnCount returns the number of JSON columns in this table +func (e *TableMapEvent) JsonColumnCount() uint64 { + count := uint64(0) + for _, t := range e.ColumnType { + if t == MYSQL_TYPE_JSON { + count++ + } + } + + return count +} + // RowsEventStmtEndFlag is set in the end of the statement. const RowsEventStmtEndFlag = 0x01 +// RowsEvent represents a MySQL rows event like DELETE_ROWS_EVENT, +// UPDATE_ROWS_EVENT, etc. +// RowsEvent.Rows saves the rows data, and the MySQL type to golang type mapping +// is +// - MYSQL_TYPE_NULL: nil +// - MYSQL_TYPE_LONG: int32 +// - MYSQL_TYPE_TINY: int8 +// - MYSQL_TYPE_SHORT: int16 +// - MYSQL_TYPE_INT24: int32 +// - MYSQL_TYPE_LONGLONG: int64 +// - MYSQL_TYPE_NEWDECIMAL: string / "github.com/shopspring/decimal".Decimal +// - MYSQL_TYPE_FLOAT: float32 +// - MYSQL_TYPE_DOUBLE: float64 +// - MYSQL_TYPE_BIT: int64 +// - MYSQL_TYPE_TIMESTAMP: string / time.Time +// - MYSQL_TYPE_TIMESTAMP2: string / time.Time +// - MYSQL_TYPE_DATETIME: string / time.Time +// - MYSQL_TYPE_DATETIME2: string / time.Time +// - MYSQL_TYPE_TIME: string +// - MYSQL_TYPE_TIME2: string +// - MYSQL_TYPE_DATE: string +// - MYSQL_TYPE_YEAR: int +// - MYSQL_TYPE_ENUM: int64 +// - MYSQL_TYPE_SET: int64 +// - MYSQL_TYPE_BLOB: []byte +// - MYSQL_TYPE_VARCHAR: string +// - MYSQL_TYPE_VAR_STRING: string +// - MYSQL_TYPE_STRING: string +// - MYSQL_TYPE_JSON: []byte / *replication.JsonDiff +// - MYSQL_TYPE_GEOMETRY: []byte type RowsEvent struct { - //0, 1, 2 + // 0, 1, 2 Version int tableIDSize int tables map[uint64]*TableMapEvent needBitmap2 bool + // for mariadb *_COMPRESSED_EVENT_V1 + compressed bool + + eventType EventType + Table *TableMapEvent TableID uint64 Flags uint16 - //if version == 2 - ExtraData []byte + // if version == 2 + // Use when DataLen value is greater than 2 + NdbFormat byte + NdbData []byte + + PartitionId uint16 + SourcePartitionId uint16 - //lenenc_int + // lenenc_int ColumnCount uint64 /* @@ -839,14 +929,14 @@ type RowsEvent struct { ColumnBitmap1, ColumnBitmap2 and SkippedColumns are not set on the full row image. */ - //len = (ColumnCount + 7) / 8 + // len = (ColumnCount + 7) / 8 ColumnBitmap1 []byte - //if UPDATE_ROWS_EVENTv1 or v2 - //len = (ColumnCount + 7) / 8 + // if UPDATE_ROWS_EVENTv1 or v2, or PARTIAL_UPDATE_ROWS_EVENT + // len = (ColumnCount + 7) / 8 ColumnBitmap2 []byte - //rows: invalid: int64, float64, bool, []byte, string + // rows: all return types from RowsEvent.decodeValue() Rows [][]interface{} SkippedColumns [][]int @@ -856,6 +946,41 @@ type RowsEvent struct { ignoreJSONDecodeErr bool } +// EnumRowImageType is allowed types for every row in mysql binlog. +// See https://github.com/mysql/mysql-server/blob/1bfe02bdad6604d54913c62614bde57a055c8332/sql/rpl_record.h#L39 +// enum class enum_row_image_type { WRITE_AI, UPDATE_BI, UPDATE_AI, DELETE_BI }; +type EnumRowImageType byte + +const ( + EnumRowImageTypeWriteAI = EnumRowImageType(iota) + EnumRowImageTypeUpdateBI + EnumRowImageTypeUpdateAI + EnumRowImageTypeDeleteBI +) + +func (t EnumRowImageType) String() string { + switch t { + case EnumRowImageTypeWriteAI: + return "WriteAI" + case EnumRowImageTypeUpdateBI: + return "UpdateBI" + case EnumRowImageTypeUpdateAI: + return "UpdateAI" + case EnumRowImageTypeDeleteBI: + return "DeleteBI" + default: + return fmt.Sprintf("(%d)", t) + } +} + +// Bits for binlog_row_value_options sysvar +type EnumBinlogRowValueOptions byte + +const ( + // Store JSON updates in partial form + EnumBinlogRowValueOptionsPartialJsonUpdates = EnumBinlogRowValueOptions(iota + 1) +) + func (e *RowsEvent) DecodeHeader(data []byte) (int, error) { pos := 0 e.TableID = FixedLengthInt(data[0:e.tableIDSize]) @@ -867,8 +992,12 @@ func (e *RowsEvent) DecodeHeader(data []byte) (int, error) { if e.Version == 2 { dataLen := binary.LittleEndian.Uint16(data[pos:]) pos += 2 - - e.ExtraData = data[pos : pos+int(dataLen-2)] + if dataLen > 2 { + err := e.decodeExtraData(data[pos:]) + if err != nil { + return 0, err + } + } pos += int(dataLen - 2) } @@ -897,7 +1026,40 @@ func (e *RowsEvent) DecodeHeader(data []byte) (int, error) { return pos, nil } +func (e *RowsEvent) decodeExtraData(data []byte) (err2 error) { + pos := 0 + extraDataType := data[pos] + pos += 1 + switch extraDataType { + case ENUM_EXTRA_ROW_INFO_TYPECODE_NDB: + var ndbLength int = int(data[pos]) + pos += 1 + e.NdbFormat = data[pos] + pos += 1 + e.NdbData = data[pos : pos+ndbLength-2] + case ENUM_EXTRA_ROW_INFO_TYPECODE_PARTITION: + if e.eventType == UPDATE_ROWS_EVENTv1 || e.eventType == UPDATE_ROWS_EVENTv2 || e.eventType == PARTIAL_UPDATE_ROWS_EVENT { + e.PartitionId = binary.LittleEndian.Uint16(data[pos:]) + pos += 2 + e.SourcePartitionId = binary.LittleEndian.Uint16(data[pos:]) + } else { + e.PartitionId = binary.LittleEndian.Uint16(data[pos:]) + } + } + return nil +} + func (e *RowsEvent) DecodeData(pos int, data []byte) (err2 error) { + if e.compressed { + data, err2 = DecompressMariadbData(data[pos:]) + if err2 != nil { + //nolint:nakedret + return + } + } + + // Rows_log_event::print_verbose() + var ( n int err error @@ -909,22 +1071,34 @@ func (e *RowsEvent) DecodeData(pos int, data []byte) (err2 error) { } }() - // Pre-allocate memory for rows. - rowsLen := e.ColumnCount + // Pre-allocate memory for rows: before image + (optional) after image + rowsLen := 1 if e.needBitmap2 { - rowsLen += e.ColumnCount + rowsLen++ } e.SkippedColumns = make([][]int, 0, rowsLen) e.Rows = make([][]interface{}, 0, rowsLen) + var rowImageType EnumRowImageType + switch e.eventType { + case WRITE_ROWS_EVENTv0, WRITE_ROWS_EVENTv1, WRITE_ROWS_EVENTv2, MARIADB_WRITE_ROWS_COMPRESSED_EVENT_V1: + rowImageType = EnumRowImageTypeWriteAI + case DELETE_ROWS_EVENTv0, DELETE_ROWS_EVENTv1, DELETE_ROWS_EVENTv2, MARIADB_DELETE_ROWS_COMPRESSED_EVENT_V1: + rowImageType = EnumRowImageTypeDeleteBI + default: + rowImageType = EnumRowImageTypeUpdateBI + } + for pos < len(data) { - if n, err = e.decodeRows(data[pos:], e.Table, e.ColumnBitmap1); err != nil { + // Parse the first image + if n, err = e.decodeImage(data[pos:], e.ColumnBitmap1, rowImageType); err != nil { return errors.Trace(err) } pos += n + // Parse the second image (for UPDATE only) if e.needBitmap2 { - if n, err = e.decodeRows(data[pos:], e.Table, e.ColumnBitmap2); err != nil { + if n, err = e.decodeImage(data[pos:], e.ColumnBitmap2, EnumRowImageTypeUpdateAI); err != nil { return errors.Trace(err) } pos += n @@ -946,12 +1120,34 @@ func isBitSet(bitmap []byte, i int) bool { return bitmap[i>>3]&(1<<(uint(i)&7)) > 0 } -func (e *RowsEvent) decodeRows(data []byte, table *TableMapEvent, bitmap []byte) (int, error) { - row := make([]interface{}, e.ColumnCount) - skips := make([]int, 0) +func isBitSetIncr(bitmap []byte, i *int) bool { + v := isBitSet(bitmap, *i) + *i++ + return v +} + +func (e *RowsEvent) decodeImage(data []byte, bitmap []byte, rowImageType EnumRowImageType) (int, error) { + // Rows_log_event::print_verbose_one_row() pos := 0 + var isPartialJsonUpdate bool + + var partialBitmap []byte + if e.eventType == PARTIAL_UPDATE_ROWS_EVENT && rowImageType == EnumRowImageTypeUpdateAI { + binlogRowValueOptions, _, n := LengthEncodedInt(data[pos:]) // binlog_row_value_options + pos += n + isPartialJsonUpdate = EnumBinlogRowValueOptions(binlogRowValueOptions)&EnumBinlogRowValueOptionsPartialJsonUpdates != 0 + if isPartialJsonUpdate { + byteCount := bitmapByteSize(int(e.Table.JsonColumnCount())) + partialBitmap = data[pos : pos+byteCount] + pos += byteCount + } + } + + row := make([]interface{}, e.ColumnCount) + skips := make([]int, 0) + // refer: https://github.com/alibaba/canal/blob/c3e38e50e269adafdd38a48c63a1740cde304c67/dbsync/src/main/java/com/taobao/tddl/dbsync/binlog/event/RowsLogBuffer.java#L63 count := 0 for i := 0; i < int(e.ColumnCount); i++ { @@ -959,30 +1155,38 @@ func (e *RowsEvent) decodeRows(data []byte, table *TableMapEvent, bitmap []byte) count++ } } - count = (count + 7) / 8 + count = bitmapByteSize(count) nullBitmap := data[pos : pos+count] pos += count - nullbitIndex := 0 + partialBitmapIndex := 0 + nullBitmapIndex := 0 - var n int - var err error for i := 0; i < int(e.ColumnCount); i++ { + /* + Note: need to read partial bit before reading cols_bitmap, since + the partial_bits bitmap has a bit for every JSON column + regardless of whether it is included in the bitmap or not. + */ + isPartial := isPartialJsonUpdate && + (rowImageType == EnumRowImageTypeUpdateAI) && + (e.Table.ColumnType[i] == MYSQL_TYPE_JSON) && + isBitSetIncr(partialBitmap, &partialBitmapIndex) + if !isBitSet(bitmap, i) { skips = append(skips, i) continue } - isNull := (uint32(nullBitmap[nullbitIndex/8]) >> uint32(nullbitIndex%8)) & 0x01 - nullbitIndex++ - - if isNull > 0 { + if isBitSetIncr(nullBitmap, &nullBitmapIndex) { row[i] = nil continue } - row[i], n, err = e.decodeValue(data[pos:], table.ColumnType[i], table.ColumnMeta[i]) + var n int + var err error + row[i], n, err = e.decodeValue(data[pos:], e.Table.ColumnType[i], e.Table.ColumnMeta[i], isPartial) if err != nil { return 0, err @@ -1011,7 +1215,7 @@ func (e *RowsEvent) parseFracTime(t interface{}) interface{} { } // see mysql sql/log_event.cc log_event_print_value -func (e *RowsEvent) decodeValue(data []byte, tp byte, meta uint16) (v interface{}, n int, err error) { +func (e *RowsEvent) decodeValue(data []byte, tp byte, meta uint16, isPartial bool) (v interface{}, n int, err error) { var length = 0 if tp == MYSQL_TYPE_STRING { @@ -1063,7 +1267,7 @@ func (e *RowsEvent) decodeValue(data []byte, tp byte, meta uint16) (v interface{ nbits := ((meta >> 8) * 8) + (meta & 0xFF) n = int(nbits+7) / 8 - //use int64 for bit + // use int64 for bit v, err = decodeBit(data, int(nbits), n) case MYSQL_TYPE_TIMESTAMP: n = 4 @@ -1161,10 +1365,37 @@ func (e *RowsEvent) decodeValue(data []byte, tp byte, meta uint16) (v interface{ // Refer: https://github.com/shyiko/mysql-binlog-connector-java/blob/master/src/main/java/com/github/shyiko/mysql/binlog/event/deserialization/AbstractRowsEventDataDeserializer.java#L404 length = int(FixedLengthInt(data[0:meta])) n = length + int(meta) - var d []byte - d, err = e.decodeJsonBinary(data[meta:n]) - if err == nil { - v = hack.String(d) + + /* + See https://github.com/mysql/mysql-server/blob/7b6fb0753b428537410f5b1b8dc60e5ccabc9f70/sql-common/json_binary.cc#L1077 + + Each document should start with a one-byte type specifier, so an + empty document is invalid according to the format specification. + Empty documents may appear due to inserts using the IGNORE keyword + or with non-strict SQL mode, which will insert an empty string if + the value NULL is inserted into a NOT NULL column. We choose to + interpret empty values as the JSON null literal. + + In our implementation (go-mysql) for backward compatibility we prefer return empty slice. + */ + if length == 0 { + v = []byte{} + } else { + if isPartial { + var diff *JsonDiff + diff, err = e.decodeJsonPartialBinary(data[meta:n]) + if err == nil { + v = diff + } else { + fmt.Printf("decodeJsonPartialBinary(%q) fail: %s\n", data[meta:n], err) + } + } else { + var d []byte + d, err = e.decodeJsonBinary(data[meta:n]) + if err == nil { + v = hack.String(d) + } + } } case MYSQL_TYPE_GEOMETRY: // MySQL saves Geometry as Blob in binlog @@ -1220,7 +1451,7 @@ func decodeDecimalDecompressValue(compIndx int, data []byte, mask uint8) (size i var zeros = [digitsPerInteger]byte{48, 48, 48, 48, 48, 48, 48, 48, 48} func decodeDecimal(data []byte, precision int, decimals int, useDecimal bool) (interface{}, int, error) { - //see python mysql replication and https://github.com/jeremycole/mysql_binlog + // see python mysql replication and https://github.com/jeremycole/mysql_binlog integral := precision - decimals uncompIntegral := integral / digitsPerInteger uncompFractional := decimals / digitsPerInteger @@ -1233,7 +1464,7 @@ func decodeDecimal(data []byte, precision int, decimals int, useDecimal bool) (i buf := make([]byte, binSize) copy(buf, data[:binSize]) - //must copy the data for later change + // must copy the data for later change data = buf // Support negative @@ -1248,7 +1479,7 @@ func decodeDecimal(data []byte, precision int, decimals int, useDecimal bool) (i res.WriteString("-") } - //clear sign + // clear sign data[0] ^= 0x80 zeroLeading := true @@ -1373,7 +1604,7 @@ func littleDecodeBit(data []byte, nbits int, length int) (value int64, err error } func decodeTimestamp2(data []byte, dec uint16, timestampStringLocation *time.Location) (interface{}, int, error) { - //get timestamp binary length + // get timestamp binary length n := int(4 + (dec+1)/2) sec := int64(binary.BigEndian.Uint32(data[0:4])) usec := int64(0) @@ -1400,7 +1631,7 @@ func decodeTimestamp2(data []byte, dec uint16, timestampStringLocation *time.Loc const DATETIMEF_INT_OFS int64 = 0x8000000000 func decodeDatetime2(data []byte, dec uint16) (interface{}, int, error) { - //get datetime binary length + // get datetime binary length n := int(5 + (dec+1)/2) intPart := int64(BFixedLengthInt(data[0:5])) - DATETIMEF_INT_OFS @@ -1420,7 +1651,7 @@ func decodeDatetime2(data []byte, dec uint16) (interface{}, int, error) { } tmp := intPart<<24 + frac - //handle sign??? + // handle sign??? if tmp < 0 { tmp = -tmp } @@ -1463,7 +1694,7 @@ const TIMEF_OFS int64 = 0x800000000000 const TIMEF_INT_OFS int64 = 0x800000 func decodeTime2(data []byte, dec uint16) (string, int, error) { - //time binary length + // time binary length n := int(3 + (dec+1)/2) tmp := int64(0) @@ -1576,14 +1807,18 @@ func (e *RowsEvent) Dump(w io.Writer) { fmt.Fprintf(w, "TableID: %d\n", e.TableID) fmt.Fprintf(w, "Flags: %d\n", e.Flags) fmt.Fprintf(w, "Column count: %d\n", e.ColumnCount) + fmt.Fprintf(w, "NDB data: %s\n", e.NdbData) fmt.Fprintf(w, "Values:\n") for _, rows := range e.Rows { fmt.Fprintf(w, "--\n") for j, d := range rows { - if _, ok := d.([]byte); ok { - fmt.Fprintf(w, "%d:%q\n", j, d) - } else { + switch dt := d.(type) { + case []byte: + fmt.Fprintf(w, "%d:%q\n", j, dt) + case *JsonDiff: + fmt.Fprintf(w, "%d:%s\n", j, dt) + default: fmt.Fprintf(w, "%d:%#v\n", j, d) } } @@ -1596,7 +1831,7 @@ type RowsQueryEvent struct { } func (e *RowsQueryEvent) Decode(data []byte) error { - //ignore length byte 1 + // ignore length byte 1 e.Query = data[1:] return nil } diff --git a/vendor/github.com/go-mysql-org/go-mysql/replication/transaction_payload_event.go b/vendor/github.com/go-mysql-org/go-mysql/replication/transaction_payload_event.go new file mode 100644 index 000000000..58826143d --- /dev/null +++ b/vendor/github.com/go-mysql-org/go-mysql/replication/transaction_payload_event.go @@ -0,0 +1,155 @@ +package replication + +import ( + "encoding/binary" + "encoding/hex" + "fmt" + "io" + + "github.com/klauspost/compress/zstd" + + . "github.com/go-mysql-org/go-mysql/mysql" +) + +// On The Wire: Field Types +// See also binary_log::codecs::binary::Transaction_payload::fields in MySQL +// https://dev.mysql.com/doc/dev/mysql-server/latest/classbinary__log_1_1codecs_1_1binary_1_1Transaction__payload.html#a9fff7ac12ba064f40e9216565c53d07b +const ( + OTW_PAYLOAD_HEADER_END_MARK = iota + OTW_PAYLOAD_SIZE_FIELD + OTW_PAYLOAD_COMPRESSION_TYPE_FIELD + OTW_PAYLOAD_UNCOMPRESSED_SIZE_FIELD +) + +// Compression Types +const ( + ZSTD = 0 + NONE = 255 +) + +type TransactionPayloadEvent struct { + format FormatDescriptionEvent + Size uint64 + UncompressedSize uint64 + CompressionType uint64 + Payload []byte + Events []*BinlogEvent +} + +func (e *TransactionPayloadEvent) compressionType() string { + switch e.CompressionType { + case ZSTD: + return "ZSTD" + case NONE: + return "NONE" + default: + return "Unknown" + } +} + +func (e *TransactionPayloadEvent) Dump(w io.Writer) { + fmt.Fprintf(w, "Payload Size: %d\n", e.Size) + fmt.Fprintf(w, "Payload Uncompressed Size: %d\n", e.UncompressedSize) + fmt.Fprintf(w, "Payload CompressionType: %s\n", e.compressionType()) + fmt.Fprintf(w, "Payload Body: \n%s", hex.Dump(e.Payload)) + fmt.Fprintln(w, "=== Start of events decoded from compressed payload ===") + for _, event := range e.Events { + event.Dump(w) + } + fmt.Fprintln(w, "=== End of events decoded from compressed payload ===") + fmt.Fprintln(w) +} + +func (e *TransactionPayloadEvent) Decode(data []byte) error { + err := e.decodeFields(data) + if err != nil { + return err + } + return e.decodePayload() +} + +func (e *TransactionPayloadEvent) decodeFields(data []byte) error { + offset := uint64(0) + + for { + fieldType := FixedLengthInt(data[offset : offset+1]) + offset++ + + if fieldType == OTW_PAYLOAD_HEADER_END_MARK { + e.Payload = data[offset:] + break + } else { + fieldLength := FixedLengthInt(data[offset : offset+1]) + offset++ + + switch fieldType { + case OTW_PAYLOAD_SIZE_FIELD: + e.Size = FixedLengthInt(data[offset : offset+fieldLength]) + case OTW_PAYLOAD_COMPRESSION_TYPE_FIELD: + e.CompressionType = FixedLengthInt(data[offset : offset+fieldLength]) + case OTW_PAYLOAD_UNCOMPRESSED_SIZE_FIELD: + e.UncompressedSize = FixedLengthInt(data[offset : offset+fieldLength]) + } + + offset += fieldLength + } + } + + return nil +} + +func (e *TransactionPayloadEvent) decodePayload() error { + if e.CompressionType != ZSTD { + return fmt.Errorf("TransactionPayloadEvent has compression type %d (%s)", + e.CompressionType, e.compressionType()) + } + + var decoder, err = zstd.NewReader(nil, zstd.WithDecoderConcurrency(0)) + if err != nil { + return err + } + defer decoder.Close() + + payloadUncompressed, err := decoder.DecodeAll(e.Payload, nil) + if err != nil { + return err + } + + // The uncompressed data needs to be split up into individual events for Parse() + // to work on them. We can't use e.parser directly as we need to disable checksums + // but we still need the initialization from the FormatDescriptionEvent. We can't + // modify e.parser as it is used elsewhere. + parser := NewBinlogParser() + parser.format = &FormatDescriptionEvent{ + Version: e.format.Version, + ServerVersion: e.format.ServerVersion, + CreateTimestamp: e.format.CreateTimestamp, + EventHeaderLength: e.format.EventHeaderLength, + EventTypeHeaderLengths: e.format.EventTypeHeaderLengths, + ChecksumAlgorithm: BINLOG_CHECKSUM_ALG_OFF, + } + + offset := uint32(0) + for { + payloadUncompressedLength := uint32(len(payloadUncompressed)) + if offset+13 > payloadUncompressedLength { + break + } + eventLength := binary.LittleEndian.Uint32(payloadUncompressed[offset+9 : offset+13]) + if offset+eventLength > payloadUncompressedLength { + return fmt.Errorf("Event length of %d with offset %d in uncompressed payload exceeds payload length of %d", + eventLength, offset, payloadUncompressedLength) + } + data := payloadUncompressed[offset : offset+eventLength] + + pe, err := parser.Parse(data) + if err != nil { + return err + } + e.Events = append(e.Events, pe) + + offset += eventLength + } + + return nil +} diff --git a/vendor/github.com/goccy/go-json/.codecov.yml b/vendor/github.com/goccy/go-json/.codecov.yml new file mode 100644 index 000000000..e98134570 --- /dev/null +++ b/vendor/github.com/goccy/go-json/.codecov.yml @@ -0,0 +1,32 @@ +codecov: + require_ci_to_pass: yes + +coverage: + precision: 2 + round: down + range: "70...100" + + status: + project: + default: + target: 70% + threshold: 2% + patch: off + changes: no + +parsers: + gcov: + branch_detection: + conditional: yes + loop: yes + method: no + macro: no + +comment: + layout: "header,diff" + behavior: default + require_changes: no + +ignore: + - internal/encoder/vm_color + - internal/encoder/vm_color_indent diff --git a/vendor/github.com/goccy/go-json/.gitignore b/vendor/github.com/goccy/go-json/.gitignore new file mode 100644 index 000000000..378283829 --- /dev/null +++ b/vendor/github.com/goccy/go-json/.gitignore @@ -0,0 +1,2 @@ +cover.html +cover.out diff --git a/vendor/github.com/goccy/go-json/.golangci.yml b/vendor/github.com/goccy/go-json/.golangci.yml new file mode 100644 index 000000000..57ae5a528 --- /dev/null +++ b/vendor/github.com/goccy/go-json/.golangci.yml @@ -0,0 +1,83 @@ +run: + skip-files: + - encode_optype.go + - ".*_test\\.go$" + +linters-settings: + govet: + enable-all: true + disable: + - shadow + +linters: + enable-all: true + disable: + - dogsled + - dupl + - exhaustive + - exhaustivestruct + - errorlint + - forbidigo + - funlen + - gci + - gochecknoglobals + - gochecknoinits + - gocognit + - gocritic + - gocyclo + - godot + - godox + - goerr113 + - gofumpt + - gomnd + - gosec + - ifshort + - lll + - makezero + - nakedret + - nestif + - nlreturn + - paralleltest + - testpackage + - thelper + - wrapcheck + - interfacer + - lll + - nakedret + - nestif + - nlreturn + - testpackage + - wsl + - varnamelen + - nilnil + - ireturn + - govet + - forcetypeassert + - cyclop + - containedctx + - revive + +issues: + exclude-rules: + # not needed + - path: /*.go + text: "ST1003: should not use underscores in package names" + linters: + - stylecheck + - path: /*.go + text: "don't use an underscore in package name" + linters: + - golint + - path: rtype.go + linters: + - golint + - stylecheck + - path: error.go + linters: + - staticcheck + + # Maximum issues count per one linter. Set to 0 to disable. Default is 50. + max-issues-per-linter: 0 + + # Maximum count of issues with the same text. Set to 0 to disable. Default is 3. + max-same-issues: 0 diff --git a/vendor/github.com/goccy/go-json/CHANGELOG.md b/vendor/github.com/goccy/go-json/CHANGELOG.md new file mode 100644 index 000000000..d09bb89c3 --- /dev/null +++ b/vendor/github.com/goccy/go-json/CHANGELOG.md @@ -0,0 +1,425 @@ +# v0.10.2 - 2023/03/20 + +### New features + +* Support DebugDOT option for debugging encoder ( #440 ) + +### Fix bugs + +* Fix combination of embedding structure and omitempty option ( #442 ) + +# v0.10.1 - 2023/03/13 + +### Fix bugs + +* Fix checkptr error for array decoder ( #415 ) +* Fix added buffer size check when decoding key ( #430 ) +* Fix handling of anonymous fields other than struct ( #431 ) +* Fix to not optimize when lower conversion can't handle byte-by-byte ( #432 ) +* Fix a problem that MarshalIndent does not work when UnorderedMap is specified ( #435 ) +* Fix mapDecoder.DecodeStream() for empty objects containing whitespace ( #425 ) +* Fix an issue that could not set the correct NextField for fields in the embedded structure ( #438 ) + +# v0.10.0 - 2022/11/29 + +### New features + +* Support JSON Path ( #250 ) + +### Fix bugs + +* Fix marshaler for map's key ( #409 ) + +# v0.9.11 - 2022/08/18 + +### Fix bugs + +* Fix unexpected behavior when buffer ends with backslash ( #383 ) +* Fix stream decoding of escaped character ( #387 ) + +# v0.9.10 - 2022/07/15 + +### Fix bugs + +* Fix boundary exception of type caching ( #382 ) + +# v0.9.9 - 2022/07/15 + +### Fix bugs + +* Fix encoding of directed interface with typed nil ( #377 ) +* Fix embedded primitive type encoding using alias ( #378 ) +* Fix slice/array type encoding with types implementing MarshalJSON ( #379 ) +* Fix unicode decoding when the expected buffer state is not met after reading ( #380 ) + +# v0.9.8 - 2022/06/30 + +### Fix bugs + +* Fix decoding of surrogate-pair ( #365 ) +* Fix handling of embedded primitive type ( #366 ) +* Add validation of escape sequence for decoder ( #367 ) +* Fix stream tokenizing respecting UseNumber ( #369 ) +* Fix encoding when struct pointer type that implements Marshal JSON is embedded ( #375 ) + +### Improve performance + +* Improve performance of linkRecursiveCode ( #368 ) + +# v0.9.7 - 2022/04/22 + +### Fix bugs + +#### Encoder + +* Add filtering process for encoding on slow path ( #355 ) +* Fix encoding of interface{} with pointer type ( #363 ) + +#### Decoder + +* Fix map key decoder that implements UnmarshalJSON ( #353 ) +* Fix decoding of []uint8 type ( #361 ) + +### New features + +* Add DebugWith option for encoder ( #356 ) + +# v0.9.6 - 2022/03/22 + +### Fix bugs + +* Correct the handling of the minimum value of int type for decoder ( #344 ) +* Fix bugs of stream decoder's bufferSize ( #349 ) +* Add a guard to use typeptr more safely ( #351 ) + +### Improve decoder performance + +* Improve escapeString's performance ( #345 ) + +### Others + +* Update go version for CI ( #347 ) + +# v0.9.5 - 2022/03/04 + +### Fix bugs + +* Fix panic when decoding time.Time with context ( #328 ) +* Fix reading the next character in buffer to nul consideration ( #338 ) +* Fix incorrect handling on skipValue ( #341 ) + +### Improve decoder performance + +* Improve performance when a payload contains escape sequence ( #334 ) + +# v0.9.4 - 2022/01/21 + +* Fix IsNilForMarshaler for string type with omitempty ( #323 ) +* Fix the case where the embedded field is at the end ( #326 ) + +# v0.9.3 - 2022/01/14 + +* Fix logic of removing struct field for decoder ( #322 ) + +# v0.9.2 - 2022/01/14 + +* Add invalid decoder to delay type error judgment at decode ( #321 ) + +# v0.9.1 - 2022/01/11 + +* Fix encoding of MarshalText/MarshalJSON operation with head offset ( #319 ) + +# v0.9.0 - 2022/01/05 + +### New feature + +* Supports dynamic filtering of struct fields ( #314 ) + +### Improve encoding performance + +* Improve map encoding performance ( #310 ) +* Optimize encoding path for escaped string ( #311 ) +* Add encoding option for performance ( #312 ) + +### Fix bugs + +* Fix panic at encoding map value on 1.18 ( #310 ) +* Fix MarshalIndent for interface type ( #317 ) + +# v0.8.1 - 2021/12/05 + +* Fix operation conversion from PtrHead to Head in Recursive type ( #305 ) + +# v0.8.0 - 2021/12/02 + +* Fix embedded field conflict behavior ( #300 ) +* Refactor compiler for encoder ( #301 #302 ) + +# v0.7.10 - 2021/10/16 + +* Fix conversion from pointer to uint64 ( #294 ) + +# v0.7.9 - 2021/09/28 + +* Fix encoding of nil value about interface type that has method ( #291 ) + +# v0.7.8 - 2021/09/01 + +* Fix mapassign_faststr for indirect struct type ( #283 ) +* Fix encoding of not empty interface type ( #284 ) +* Fix encoding of empty struct interface type ( #286 ) + +# v0.7.7 - 2021/08/25 + +* Fix invalid utf8 on stream decoder ( #279 ) +* Fix buffer length bug on string stream decoder ( #280 ) + +Thank you @orisano !! + +# v0.7.6 - 2021/08/13 + +* Fix nil slice assignment ( #276 ) +* Improve error message ( #277 ) + +# v0.7.5 - 2021/08/12 + +* Fix encoding of embedded struct with tags ( #265 ) +* Fix encoding of embedded struct that isn't first field ( #272 ) +* Fix decoding of binary type with escaped char ( #273 ) + +# v0.7.4 - 2021/07/06 + +* Fix encoding of indirect layout structure ( #264 ) + +# v0.7.3 - 2021/06/29 + +* Fix encoding of pointer type in empty interface ( #262 ) + +# v0.7.2 - 2021/06/26 + +### Fix decoder + +* Add decoder for func type to fix decoding of nil function value ( #257 ) +* Fix stream decoding of []byte type ( #258 ) + +### Performance + +* Improve decoding performance of map[string]interface{} type ( use `mapassign_faststr` ) ( #256 ) +* Improve encoding performance of empty interface type ( remove recursive calling of `vm.Run` ) ( #259 ) + +### Benchmark + +* Add bytedance/sonic as benchmark target ( #254 ) + +# v0.7.1 - 2021/06/18 + +### Fix decoder + +* Fix error when unmarshal empty array ( #253 ) + +# v0.7.0 - 2021/06/12 + +### Support context for MarshalJSON and UnmarshalJSON ( #248 ) + +* json.MarshalContext(context.Context, interface{}, ...json.EncodeOption) ([]byte, error) +* json.NewEncoder(io.Writer).EncodeContext(context.Context, interface{}, ...json.EncodeOption) error +* json.UnmarshalContext(context.Context, []byte, interface{}, ...json.DecodeOption) error +* json.NewDecoder(io.Reader).DecodeContext(context.Context, interface{}) error + +```go +type MarshalerContext interface { + MarshalJSON(context.Context) ([]byte, error) +} + +type UnmarshalerContext interface { + UnmarshalJSON(context.Context, []byte) error +} +``` + +### Add DecodeFieldPriorityFirstWin option ( #242 ) + +In the default behavior, go-json, like encoding/json, will reflect the result of the last evaluation when a field with the same name exists. I've added new options to allow you to change this behavior. `json.DecodeFieldPriorityFirstWin` option reflects the result of the first evaluation if a field with the same name exists. This behavior has a performance advantage as it allows the subsequent strings to be skipped if all fields have been evaluated. + +### Fix encoder + +* Fix indent number contains recursive type ( #249 ) +* Fix encoding of using empty interface as map key ( #244 ) + +### Fix decoder + +* Fix decoding fields containing escaped characters ( #237 ) + +### Refactor + +* Move some tests to subdirectory ( #243 ) +* Refactor package layout for decoder ( #238 ) + +# v0.6.1 - 2021/06/02 + +### Fix encoder + +* Fix value of totalLength for encoding ( #236 ) + +# v0.6.0 - 2021/06/01 + +### Support Colorize option for encoding (#233) + +```go +b, err := json.MarshalWithOption(v, json.Colorize(json.DefaultColorScheme)) +if err != nil { + ... +} +fmt.Println(string(b)) // print colored json +``` + +### Refactor + +* Fix opcode layout - Adjust memory layout of the opcode to 128 bytes in a 64-bit environment ( #230 ) +* Refactor encode option ( #231 ) +* Refactor escape string ( #232 ) + +# v0.5.1 - 2021/5/20 + +### Optimization + +* Add type addrShift to enable bigger encoder/decoder cache ( #213 ) + +### Fix decoder + +* Keep original reference of slice element ( #229 ) + +### Refactor + +* Refactor Debug mode for encoding ( #226 ) +* Generate VM sources for encoding ( #227 ) +* Refactor validator for null/true/false for decoding ( #221 ) + +# v0.5.0 - 2021/5/9 + +### Supports using omitempty and string tags at the same time ( #216 ) + +### Fix decoder + +* Fix stream decoder for unicode char ( #215 ) +* Fix decoding of slice element ( #219 ) +* Fix calculating of buffer length for stream decoder ( #220 ) + +### Refactor + +* replace skipWhiteSpace goto by loop ( #212 ) + +# v0.4.14 - 2021/5/4 + +### Benchmark + +* Add valyala/fastjson to benchmark ( #193 ) +* Add benchmark task for CI ( #211 ) + +### Fix decoder + +* Fix decoding of slice with unmarshal json type ( #198 ) +* Fix decoding of null value for interface type that does not implement Unmarshaler ( #205 ) +* Fix decoding of null value to []byte by json.Unmarshal ( #206 ) +* Fix decoding of backslash char at the end of string ( #207 ) +* Fix stream decoder for null/true/false value ( #208 ) +* Fix stream decoder for slow reader ( #211 ) + +### Performance + +* If cap of slice is enough, reuse slice data for compatibility with encoding/json ( #200 ) + +# v0.4.13 - 2021/4/20 + +### Fix json.Compact and json.Indent + +* Support validation the input buffer for json.Compact and json.Indent ( #189 ) +* Optimize json.Compact and json.Indent ( improve memory footprint ) ( #190 ) + +# v0.4.12 - 2021/4/15 + +### Fix encoder + +* Fix unnecessary indent for empty slice type ( #181 ) +* Fix encoding of omitempty feature for the slice or interface type ( #183 ) +* Fix encoding custom types zero values with omitempty when marshaller exists ( #187 ) + +### Fix decoder + +* Fix decoder for invalid top level value ( #184 ) +* Fix decoder for invalid number value ( #185 ) + +# v0.4.11 - 2021/4/3 + +* Improve decoder performance for interface type + +# v0.4.10 - 2021/4/2 + +### Fix encoder + +* Fixed a bug when encoding slice and map containing recursive structures +* Fixed a logic to determine if indirect reference + +# v0.4.9 - 2021/3/29 + +### Add debug mode + +If you use `json.MarshalWithOption(v, json.Debug())` and `panic` occurred in `go-json`, produces debug information to console. + +### Support a new feature to compatible with encoding/json + +- invalid UTF-8 is coerced to valid UTF-8 ( without performance down ) + +### Fix encoder + +- Fixed handling of MarshalJSON of function type + +### Fix decoding of slice of pointer type + +If there is a pointer value, go-json will use it. (This behavior is necessary to achieve the ability to prioritize pre-filled values). However, since slices are reused internally, there was a bug that referred to the previous pointer value. Therefore, it is not necessary to refer to the pointer value in advance for the slice element, so we explicitly initialize slice element by `nil`. + +# v0.4.8 - 2021/3/21 + +### Reduce memory usage at compile time + +* go-json have used about 2GB of memory at compile time, but now it can compile with about less than 550MB. + +### Fix any encoder's bug + +* Add many test cases for encoder +* Fix composite type ( slice/array/map ) +* Fix pointer types +* Fix encoding of MarshalJSON or MarshalText or json.Number type + +### Refactor encoder + +* Change package layout for reducing memory usage at compile +* Remove anonymous and only operation +* Remove root property from encodeCompileContext and opcode + +### Fix CI + +* Add Go 1.16 +* Remove Go 1.13 +* Fix `make cover` task + +### Number/Delim/Token/RawMessage use the types defined in encoding/json by type alias + +# v0.4.7 - 2021/02/22 + +### Fix decoder + +* Fix decoding of deep recursive structure +* Fix decoding of embedded unexported pointer field +* Fix invalid test case +* Fix decoding of invalid value +* Fix decoding of prefilled value +* Fix not being able to return UnmarshalTypeError when it should be returned +* Fix decoding of null value +* Fix decoding of type of null string +* Use pre allocated pointer if exists it at decoding + +### Reduce memory usage at compile + +* Integrate int/int8/int16/int32/int64 and uint/uint8/uint16/uint32/uint64 operation to reduce memory usage at compile + +### Remove unnecessary optype diff --git a/vendor/github.com/goccy/go-json/LICENSE b/vendor/github.com/goccy/go-json/LICENSE new file mode 100644 index 000000000..6449c8bff --- /dev/null +++ b/vendor/github.com/goccy/go-json/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2020 Masaaki Goshima + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/vendor/github.com/goccy/go-json/Makefile b/vendor/github.com/goccy/go-json/Makefile new file mode 100644 index 000000000..5bbfc4c9a --- /dev/null +++ b/vendor/github.com/goccy/go-json/Makefile @@ -0,0 +1,39 @@ +PKG := github.com/goccy/go-json + +BIN_DIR := $(CURDIR)/bin +PKGS := $(shell go list ./... | grep -v internal/cmd|grep -v test) +COVER_PKGS := $(foreach pkg,$(PKGS),$(subst $(PKG),.,$(pkg))) + +COMMA := , +EMPTY := +SPACE := $(EMPTY) $(EMPTY) +COVERPKG_OPT := $(subst $(SPACE),$(COMMA),$(COVER_PKGS)) + +$(BIN_DIR): + @mkdir -p $(BIN_DIR) + +.PHONY: cover +cover: + go test -coverpkg=$(COVERPKG_OPT) -coverprofile=cover.out ./... + +.PHONY: cover-html +cover-html: cover + go tool cover -html=cover.out + +.PHONY: lint +lint: golangci-lint + $(BIN_DIR)/golangci-lint run + +golangci-lint: | $(BIN_DIR) + @{ \ + set -e; \ + GOLANGCI_LINT_TMP_DIR=$$(mktemp -d); \ + cd $$GOLANGCI_LINT_TMP_DIR; \ + go mod init tmp; \ + GOBIN=$(BIN_DIR) go install github.com/golangci/golangci-lint/cmd/golangci-lint@v1.48.0; \ + rm -rf $$GOLANGCI_LINT_TMP_DIR; \ + } + +.PHONY: generate +generate: + go generate ./internal/... diff --git a/vendor/github.com/goccy/go-json/README.md b/vendor/github.com/goccy/go-json/README.md new file mode 100644 index 000000000..7bacc54f9 --- /dev/null +++ b/vendor/github.com/goccy/go-json/README.md @@ -0,0 +1,529 @@ +# go-json + +![Go](https://github.com/goccy/go-json/workflows/Go/badge.svg) +[![GoDoc](https://godoc.org/github.com/goccy/go-json?status.svg)](https://pkg.go.dev/github.com/goccy/go-json?tab=doc) +[![codecov](https://codecov.io/gh/goccy/go-json/branch/master/graph/badge.svg)](https://codecov.io/gh/goccy/go-json) + +Fast JSON encoder/decoder compatible with encoding/json for Go + + + +# Roadmap + +``` +* version ( expected release date ) + +* v0.9.0 + | + | while maintaining compatibility with encoding/json, we will add convenient APIs + | + v +* v1.0.0 +``` + +We are accepting requests for features that will be implemented between v0.9.0 and v.1.0.0. +If you have the API you need, please submit your issue [here](https://github.com/goccy/go-json/issues). + +# Features + +- Drop-in replacement of `encoding/json` +- Fast ( See [Benchmark section](https://github.com/goccy/go-json#benchmarks) ) +- Flexible customization with options +- Coloring the encoded string +- Can propagate context.Context to `MarshalJSON` or `UnmarshalJSON` +- Can dynamically filter the fields of the structure type-safely + +# Installation + +``` +go get github.com/goccy/go-json +``` + +# How to use + +Replace import statement from `encoding/json` to `github.com/goccy/go-json` + +``` +-import "encoding/json" ++import "github.com/goccy/go-json" +``` + +# JSON library comparison + +| name | encoder | decoder | compatible with `encoding/json` | +| :----: | :------: | :-----: | :-----------------------------: | +| encoding/json | yes | yes | N/A | +| [json-iterator/go](https://github.com/json-iterator/go) | yes | yes | partial | +| [easyjson](https://github.com/mailru/easyjson) | yes | yes | no | +| [gojay](https://github.com/francoispqt/gojay) | yes | yes | no | +| [segmentio/encoding/json](https://github.com/segmentio/encoding/tree/master/json) | yes | yes | partial | +| [jettison](https://github.com/wI2L/jettison) | yes | no | no | +| [simdjson-go](https://github.com/minio/simdjson-go) | no | yes | no | +| goccy/go-json | yes | yes | yes | + +- `json-iterator/go` isn't compatible with `encoding/json` in many ways (e.g. https://github.com/json-iterator/go/issues/229 ), but it hasn't been supported for a long time. +- `segmentio/encoding/json` is well supported for encoders, but some are not supported for decoder APIs such as `Token` ( streaming decode ) + +## Other libraries + +- [jingo](https://github.com/bet365/jingo) + +I tried the benchmark but it didn't work. +Also, it seems to panic when it receives an unexpected value because there is no error handling... + +- [ffjson](https://github.com/pquerna/ffjson) + +Benchmarking gave very slow results. +It seems that it is assumed that the user will use the buffer pool properly. +Also, development seems to have already stopped + +# Benchmarks + +``` +$ cd benchmarks +$ go test -bench . +``` + +## Encode + + + + +## Decode + + + + + + +# Fuzzing + +[go-json-fuzz](https://github.com/goccy/go-json-fuzz) is the repository for fuzzing tests. +If you run the test in this repository and find a bug, please commit to corpus to go-json-fuzz and report the issue to [go-json](https://github.com/goccy/go-json/issues). + +# How it works + +`go-json` is very fast in both encoding and decoding compared to other libraries. +It's easier to implement by using automatic code generation for performance or by using a dedicated interface, but `go-json` dares to stick to compatibility with `encoding/json` and is the simple interface. Despite this, we are developing with the aim of being the fastest library. + +Here, we explain the various speed-up techniques implemented by `go-json`. + +## Basic technique + +The techniques listed here are the ones used by most of the libraries listed above. + +### Buffer reuse + +Since the only value required for the result of `json.Marshal(interface{}) ([]byte, error)` is `[]byte`, the only value that must be allocated during encoding is the return value `[]byte` . + +Also, as the number of allocations increases, the performance will be affected, so the number of allocations should be kept as low as possible when creating `[]byte`. + +Therefore, there is a technique to reduce the number of times a new buffer must be allocated by reusing the buffer used for the previous encoding by using `sync.Pool`. + +Finally, you allocate a buffer that is as long as the resulting buffer and copy the contents into it, you only need to allocate the buffer once in theory. + +```go +type buffer struct { + data []byte +} + +var bufPool = sync.Pool{ + New: func() interface{} { + return &buffer{data: make([]byte, 0, 1024)} + }, +} + +buf := bufPool.Get().(*buffer) +data := encode(buf.data) // reuse buf.data + +newBuf := make([]byte, len(data)) +copy(newBuf, buf) + +buf.data = data +bufPool.Put(buf) +``` + +### Elimination of reflection + +As you know, the reflection operation is very slow. + +Therefore, using the fact that the address position where the type information is stored is fixed for each binary ( we call this `typeptr` ), +we can use the address in the type information to call a pre-built optimized process. + +For example, you can get the address to the type information from `interface{}` as follows and you can use that information to call a process that does not have reflection. + +To process without reflection, pass a pointer (`unsafe.Pointer`) to the value is stored. + +```go + +type emptyInterface struct { + typ unsafe.Pointer + ptr unsafe.Pointer +} + +var typeToEncoder = map[uintptr]func(unsafe.Pointer)([]byte, error){} + +func Marshal(v interface{}) ([]byte, error) { + iface := (*emptyInterface)(unsafe.Pointer(&v) + typeptr := uintptr(iface.typ) + if enc, exists := typeToEncoder[typeptr]; exists { + return enc(iface.ptr) + } + ... +} +``` + +※ In reality, `typeToEncoder` can be referenced by multiple goroutines, so exclusive control is required. + +## Unique speed-up technique + +## Encoder + +### Do not escape arguments of `Marshal` + +`json.Marshal` and `json.Unmarshal` receive `interface{}` value and they perform type determination dynamically to process. +In normal case, you need to use the `reflect` library to determine the type dynamically, but since `reflect.Type` is defined as `interface`, when you call the method of `reflect.Type`, The reflect's argument is escaped. + +Therefore, the arguments for `Marshal` and `Unmarshal` are always escaped to the heap. +However, `go-json` can use the feature of `reflect.Type` while avoiding escaping. + +`reflect.Type` is defined as `interface`, but in reality `reflect.Type` is implemented only by the structure `rtype` defined in the `reflect` package. +For this reason, to date `reflect.Type` is the same as `*reflect.rtype`. + +Therefore, by directly handling `*reflect.rtype`, which is an implementation of `reflect.Type`, it is possible to avoid escaping because it changes from `interface` to using `struct`. + +The technique for working with `*reflect.rtype` directly from `go-json` is implemented at [rtype.go](https://github.com/goccy/go-json/blob/master/internal/runtime/rtype.go) + +Also, the same technique is cut out as a library ( https://github.com/goccy/go-reflect ) + +Initially this feature was the default behavior of `go-json`. +But after careful testing, I found that I passed a large value to `json.Marshal()` and if the argument could not be assigned to the stack, it could not be properly escaped to the heap (a bug in the Go compiler). + +Therefore, this feature will be provided as an **optional** until this issue is resolved. + +To use it, add `NoEscape` like `MarshalNoEscape()` + +### Encoding using opcode sequence + +I explained that you can use `typeptr` to call a pre-built process from type information. + +In other libraries, this dedicated process is processed by making it an function calling like anonymous function, but function calls are inherently slow processes and should be avoided as much as possible. + +Therefore, `go-json` adopted the Instruction-based execution processing system, which is also used to implement virtual machines for programming language. + +If it is the first type to encode, create the opcode ( instruction ) sequence required for encoding. +From the second time onward, use `typeptr` to get the cached pre-built opcode sequence and encode it based on it. An example of the opcode sequence is shown below. + +```go +json.Marshal(struct{ + X int `json:"x"` + Y string `json:"y"` +}{X: 1, Y: "hello"}) +``` + +When encoding a structure like the one above, create a sequence of opcodes like this: + +``` +- opStructFieldHead ( `{` ) +- opStructFieldInt ( `"x": 1,` ) +- opStructFieldString ( `"y": "hello"` ) +- opStructEnd ( `}` ) +- opEnd +``` + +※ When processing each operation, write the letters on the right. + +In addition, each opcode is managed by the following structure ( +Pseudo code ). + +```go +type opType int +const ( + opStructFieldHead opType = iota + opStructFieldInt + opStructFieldStirng + opStructEnd + opEnd +) +type opcode struct { + op opType + key []byte + next *opcode +} +``` + +The process of encoding using the opcode sequence is roughly implemented as follows. + +```go +func encode(code *opcode, b []byte, p unsafe.Pointer) ([]byte, error) { + for { + switch code.op { + case opStructFieldHead: + b = append(b, '{') + code = code.next + case opStructFieldInt: + b = append(b, code.key...) + b = appendInt((*int)(unsafe.Pointer(uintptr(p)+code.offset))) + code = code.next + case opStructFieldString: + b = append(b, code.key...) + b = appendString((*string)(unsafe.Pointer(uintptr(p)+code.offset))) + code = code.next + case opStructEnd: + b = append(b, '}') + code = code.next + case opEnd: + goto END + } + } +END: + return b, nil +} +``` + +In this way, the huge `switch-case` is used to encode by manipulating the linked list opcodes to avoid unnecessary function calls. + +### Opcode sequence optimization + +One of the advantages of encoding using the opcode sequence is the ease of optimization. +The opcode sequence mentioned above is actually converted into the following optimized operations and used. + +``` +- opStructFieldHeadInt ( `{"x": 1,` ) +- opStructEndString ( `"y": "hello"}` ) +- opEnd +``` + +It has been reduced from 5 opcodes to 3 opcodes ! +Reducing the number of opcodees means reducing the number of branches with `switch-case`. +In other words, the closer the number of operations is to 1, the faster the processing can be performed. + +In `go-json`, optimization to reduce the number of opcodes itself like the above and it speeds up by preparing opcodes with optimized paths. + +### Change recursive call from CALL to JMP + +Recursive processing is required during encoding if the type is defined recursively as follows: + +```go +type T struct { + X int + U *U +} + +type U struct { + T *T +} + +b, err := json.Marshal(&T{ + X: 1, + U: &U{ + T: &T{ + X: 2, + }, + }, +}) +fmt.Println(string(b)) // {"X":1,"U":{"T":{"X":2,"U":null}}} +``` + +In `go-json`, recursive processing is processed by the operation type of ` opStructFieldRecursive`. + +In this operation, after acquiring the opcode sequence used for recursive processing, the function is **not** called recursively as it is, but the necessary values ​​are saved by itself and implemented by moving to the next operation. + +The technique of implementing recursive processing with the `JMP` operation while avoiding the `CALL` operation is a famous technique for implementing a high-speed virtual machine. + +For more details, please refer to [the article](https://engineering.mercari.com/blog/entry/1599563768-081104c850) ( but Japanese only ). + +### Dispatch by typeptr from map to slice + +When retrieving the data cached from the type information by `typeptr`, we usually use map. +Map requires exclusive control, so use `sync.Map` for a naive implementation. + +However, this is slow, so it's a good idea to use the `atomic` package for exclusive control as implemented by `segmentio/encoding/json` ( https://github.com/segmentio/encoding/blob/master/json/codec.go#L41-L55 ). + +This implementation slows down the set instead of speeding up the get, but it works well because of the nature of the library, it encodes much more for the same type. + +However, as a result of profiling, I noticed that `runtime.mapaccess2` accounts for a significant percentage of the execution time. So I thought if I could change the lookup from map to slice. + +There is an API named `typelinks` defined in the `runtime` package that the `reflect` package uses internally. +This allows you to get all the type information defined in the binary at runtime. + +The fact that all type information can be acquired means that by constructing slices in advance with the acquired total number of type information, it is possible to look up with the value of `typeptr` without worrying about out-of-range access. + +However, if there is too much type information, it will use a lot of memory, so by default we will only use this optimization if the slice size fits within **2Mib** . + +If this approach is not available, it will fall back to the `atomic` based process described above. + +If you want to know more, please refer to the implementation [here](https://github.com/goccy/go-json/blob/master/internal/runtime/type.go#L36-L100) + +## Decoder + +### Dispatch by typeptr from map to slice + +Like the encoder, the decoder also uses typeptr to call the dedicated process. + +### Faster termination character inspection using NUL character + +In order to decode, you have to traverse the input buffer character by position. +At that time, if you check whether the buffer has reached the end, it will be very slow. + +`buf` : `[]byte` type variable. holds the string passed to the decoder +`cursor` : `int64` type variable. holds the current read position + +```go +buflen := len(buf) +for ; cursor < buflen; cursor++ { // compare cursor and buflen at all times, it is so slow. + switch buf[cursor] { + case ' ', '\n', '\r', '\t': + } +} +``` + +Therefore, by adding the `NUL` (`\000`) character to the end of the read buffer as shown below, it is possible to check the termination character at the same time as other characters. + +```go +for { + switch buf[cursor] { + case ' ', '\n', '\r', '\t': + case '\000': + return nil + } + cursor++ +} +``` + +### Use Boundary Check Elimination + +Due to the `NUL` character optimization, the Go compiler does a boundary check every time, even though `buf[cursor]` does not cause out-of-range access. + +Therefore, `go-json` eliminates boundary check by fetching characters for hotspot by pointer operation. For example, the following code. + +```go +func char(ptr unsafe.Pointer, offset int64) byte { + return *(*byte)(unsafe.Pointer(uintptr(ptr) + uintptr(offset))) +} + +p := (*sliceHeader)(&unsafe.Pointer(buf)).data +for { + switch char(p, cursor) { + case ' ', '\n', '\r', '\t': + case '\000': + return nil + } + cursor++ +} +``` + +### Checking the existence of fields of struct using Bitmaps + +I found by the profiling result, in the struct decode, lookup process for field was taking a long time. + +For example, consider decoding a string like `{"a":1,"b":2,"c":3}` into the following structure: + +```go +type T struct { + A int `json:"a"` + B int `json:"b"` + C int `json:"c"` +} +``` + +At this time, it was found that it takes a lot of time to acquire the decoding process corresponding to the field from the field name as shown below during the decoding process. + +```go +fieldName := decodeKey(buf, cursor) // "a" or "b" or "c" +decoder, exists := fieldToDecoderMap[fieldName] // so slow +if exists { + decoder(buf, cursor) +} else { + skipValue(buf, cursor) +} +``` + +To improve this process, `json-iterator/go` is optimized so that it can be branched by switch-case when the number of fields in the structure is 10 or less (switch-case is faster than map). However, there is a risk of hash collision because the value hashed by the FNV algorithm is used for conditional branching. Also, `gojay` processes this part at high speed by letting the library user yourself write `switch-case`. + + +`go-json` considers and implements a new approach that is different from these. I call this **bitmap field optimization**. + +The range of values ​​per character can be represented by `[256]byte`. Also, if the number of fields in the structure is 8 or less, `int8` type can represent the state of each field. +In other words, it has the following structure. + +- Base ( 8bit ): `00000000` +- Key "a": `00000001` ( assign key "a" to the first bit ) +- Key "b": `00000010` ( assign key "b" to the second bit ) +- Key "c": `00000100` ( assign key "c" to the third bit ) + +Bitmap structure is the following + +``` + | key index(0) | +------------------------ + 0 | 00000000 | + 1 | 00000000 | +~~ | | +97 (a) | 00000001 | +98 (b) | 00000010 | +99 (c) | 00000100 | +~~ | | +255 | 00000000 | +``` + +You can think of this as a Bitmap with a height of `256` and a width of the maximum string length in the field name. +In other words, it can be represented by the following type . + +```go +[maxFieldKeyLength][256]int8 +``` + +When decoding a field character, check whether the corresponding character exists by referring to the pre-built bitmap like the following. + +```go +var curBit int8 = math.MaxInt8 // 11111111 + +c := char(buf, cursor) +bit := bitmap[keyIdx][c] +curBit &= bit +if curBit == 0 { + // not found field +} +``` + +If `curBit` is not `0` until the end of the field string, then the string is +You may have hit one of the fields. +But the possibility is that if the decoded string is shorter than the field string, you will get a false hit. + +- input: `{"a":1}` +```go +type T struct { + X int `json:"abc"` +} +``` +※ Since `a` is shorter than `abc`, it can decode to the end of the field character without `curBit` being 0. + +Rest assured. In this case, it doesn't matter because you can tell if you hit by comparing the string length of `a` with the string length of `abc`. + +Finally, calculate the position of the bit where `1` is set and get the corresponding value, and you're done. + +Using this technique, field lookups are possible with only bitwise operations and access to slices. + +`go-json` uses a similar technique for fields with 9 or more and 16 or less fields. At this time, Bitmap is constructed as `[maxKeyLen][256]int16` type. + +Currently, this optimization is not performed when the maximum length of the field name is long (specifically, 64 bytes or more) in addition to the limitation of the number of fields from the viewpoint of saving memory usage. + +### Others + +I have done a lot of other optimizations. I will find time to write about them. If you have any questions about what's written here or other optimizations, please visit the `#go-json` channel on `gophers.slack.com` . + +## Reference + +Regarding the story of go-json, there are the following articles in Japanese only. + +- https://speakerdeck.com/goccy/zui-su-falsejsonraiburariwoqiu-mete +- https://engineering.mercari.com/blog/entry/1599563768-081104c850/ + +# Looking for Sponsors + +I'm looking for sponsors this library. This library is being developed as a personal project in my spare time. If you want a quick response or problem resolution when using this library in your project, please register as a [sponsor](https://github.com/sponsors/goccy). I will cooperate as much as possible. Of course, this library is developed as an MIT license, so you can use it freely for free. + +# License + +MIT diff --git a/vendor/github.com/goccy/go-json/color.go b/vendor/github.com/goccy/go-json/color.go new file mode 100644 index 000000000..e80b22b48 --- /dev/null +++ b/vendor/github.com/goccy/go-json/color.go @@ -0,0 +1,68 @@ +package json + +import ( + "fmt" + + "github.com/goccy/go-json/internal/encoder" +) + +type ( + ColorFormat = encoder.ColorFormat + ColorScheme = encoder.ColorScheme +) + +const escape = "\x1b" + +type colorAttr int + +//nolint:deadcode,varcheck +const ( + fgBlackColor colorAttr = iota + 30 + fgRedColor + fgGreenColor + fgYellowColor + fgBlueColor + fgMagentaColor + fgCyanColor + fgWhiteColor +) + +//nolint:deadcode,varcheck +const ( + fgHiBlackColor colorAttr = iota + 90 + fgHiRedColor + fgHiGreenColor + fgHiYellowColor + fgHiBlueColor + fgHiMagentaColor + fgHiCyanColor + fgHiWhiteColor +) + +func createColorFormat(attr colorAttr) ColorFormat { + return ColorFormat{ + Header: wrapColor(attr), + Footer: resetColor(), + } +} + +func wrapColor(attr colorAttr) string { + return fmt.Sprintf("%s[%dm", escape, attr) +} + +func resetColor() string { + return wrapColor(colorAttr(0)) +} + +var ( + DefaultColorScheme = &ColorScheme{ + Int: createColorFormat(fgHiMagentaColor), + Uint: createColorFormat(fgHiMagentaColor), + Float: createColorFormat(fgHiMagentaColor), + Bool: createColorFormat(fgHiYellowColor), + String: createColorFormat(fgHiGreenColor), + Binary: createColorFormat(fgHiRedColor), + ObjectKey: createColorFormat(fgHiCyanColor), + Null: createColorFormat(fgBlueColor), + } +) diff --git a/vendor/github.com/goccy/go-json/decode.go b/vendor/github.com/goccy/go-json/decode.go new file mode 100644 index 000000000..74c6ac3bc --- /dev/null +++ b/vendor/github.com/goccy/go-json/decode.go @@ -0,0 +1,263 @@ +package json + +import ( + "context" + "fmt" + "io" + "reflect" + "unsafe" + + "github.com/goccy/go-json/internal/decoder" + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type Decoder struct { + s *decoder.Stream +} + +const ( + nul = '\000' +) + +type emptyInterface struct { + typ *runtime.Type + ptr unsafe.Pointer +} + +func unmarshal(data []byte, v interface{}, optFuncs ...DecodeOptionFunc) error { + src := make([]byte, len(data)+1) // append nul byte to the end + copy(src, data) + + header := (*emptyInterface)(unsafe.Pointer(&v)) + + if err := validateType(header.typ, uintptr(header.ptr)); err != nil { + return err + } + dec, err := decoder.CompileToGetDecoder(header.typ) + if err != nil { + return err + } + ctx := decoder.TakeRuntimeContext() + ctx.Buf = src + ctx.Option.Flags = 0 + for _, optFunc := range optFuncs { + optFunc(ctx.Option) + } + cursor, err := dec.Decode(ctx, 0, 0, header.ptr) + if err != nil { + decoder.ReleaseRuntimeContext(ctx) + return err + } + decoder.ReleaseRuntimeContext(ctx) + return validateEndBuf(src, cursor) +} + +func unmarshalContext(ctx context.Context, data []byte, v interface{}, optFuncs ...DecodeOptionFunc) error { + src := make([]byte, len(data)+1) // append nul byte to the end + copy(src, data) + + header := (*emptyInterface)(unsafe.Pointer(&v)) + + if err := validateType(header.typ, uintptr(header.ptr)); err != nil { + return err + } + dec, err := decoder.CompileToGetDecoder(header.typ) + if err != nil { + return err + } + rctx := decoder.TakeRuntimeContext() + rctx.Buf = src + rctx.Option.Flags = 0 + rctx.Option.Flags |= decoder.ContextOption + rctx.Option.Context = ctx + for _, optFunc := range optFuncs { + optFunc(rctx.Option) + } + cursor, err := dec.Decode(rctx, 0, 0, header.ptr) + if err != nil { + decoder.ReleaseRuntimeContext(rctx) + return err + } + decoder.ReleaseRuntimeContext(rctx) + return validateEndBuf(src, cursor) +} + +var ( + pathDecoder = decoder.NewPathDecoder() +) + +func extractFromPath(path *Path, data []byte, optFuncs ...DecodeOptionFunc) ([][]byte, error) { + if path.path.RootSelectorOnly { + return [][]byte{data}, nil + } + src := make([]byte, len(data)+1) // append nul byte to the end + copy(src, data) + + ctx := decoder.TakeRuntimeContext() + ctx.Buf = src + ctx.Option.Flags = 0 + ctx.Option.Flags |= decoder.PathOption + ctx.Option.Path = path.path + for _, optFunc := range optFuncs { + optFunc(ctx.Option) + } + paths, cursor, err := pathDecoder.DecodePath(ctx, 0, 0) + if err != nil { + decoder.ReleaseRuntimeContext(ctx) + return nil, err + } + decoder.ReleaseRuntimeContext(ctx) + if err := validateEndBuf(src, cursor); err != nil { + return nil, err + } + return paths, nil +} + +func unmarshalNoEscape(data []byte, v interface{}, optFuncs ...DecodeOptionFunc) error { + src := make([]byte, len(data)+1) // append nul byte to the end + copy(src, data) + + header := (*emptyInterface)(unsafe.Pointer(&v)) + + if err := validateType(header.typ, uintptr(header.ptr)); err != nil { + return err + } + dec, err := decoder.CompileToGetDecoder(header.typ) + if err != nil { + return err + } + + ctx := decoder.TakeRuntimeContext() + ctx.Buf = src + ctx.Option.Flags = 0 + for _, optFunc := range optFuncs { + optFunc(ctx.Option) + } + cursor, err := dec.Decode(ctx, 0, 0, noescape(header.ptr)) + if err != nil { + decoder.ReleaseRuntimeContext(ctx) + return err + } + decoder.ReleaseRuntimeContext(ctx) + return validateEndBuf(src, cursor) +} + +func validateEndBuf(src []byte, cursor int64) error { + for { + switch src[cursor] { + case ' ', '\t', '\n', '\r': + cursor++ + continue + case nul: + return nil + } + return errors.ErrSyntax( + fmt.Sprintf("invalid character '%c' after top-level value", src[cursor]), + cursor+1, + ) + } +} + +//nolint:staticcheck +//go:nosplit +func noescape(p unsafe.Pointer) unsafe.Pointer { + x := uintptr(p) + return unsafe.Pointer(x ^ 0) +} + +func validateType(typ *runtime.Type, p uintptr) error { + if typ == nil || typ.Kind() != reflect.Ptr || p == 0 { + return &InvalidUnmarshalError{Type: runtime.RType2Type(typ)} + } + return nil +} + +// NewDecoder returns a new decoder that reads from r. +// +// The decoder introduces its own buffering and may +// read data from r beyond the JSON values requested. +func NewDecoder(r io.Reader) *Decoder { + s := decoder.NewStream(r) + return &Decoder{ + s: s, + } +} + +// Buffered returns a reader of the data remaining in the Decoder's +// buffer. The reader is valid until the next call to Decode. +func (d *Decoder) Buffered() io.Reader { + return d.s.Buffered() +} + +// Decode reads the next JSON-encoded value from its +// input and stores it in the value pointed to by v. +// +// See the documentation for Unmarshal for details about +// the conversion of JSON into a Go value. +func (d *Decoder) Decode(v interface{}) error { + return d.DecodeWithOption(v) +} + +// DecodeContext reads the next JSON-encoded value from its +// input and stores it in the value pointed to by v with context.Context. +func (d *Decoder) DecodeContext(ctx context.Context, v interface{}) error { + d.s.Option.Flags |= decoder.ContextOption + d.s.Option.Context = ctx + return d.DecodeWithOption(v) +} + +func (d *Decoder) DecodeWithOption(v interface{}, optFuncs ...DecodeOptionFunc) error { + header := (*emptyInterface)(unsafe.Pointer(&v)) + typ := header.typ + ptr := uintptr(header.ptr) + typeptr := uintptr(unsafe.Pointer(typ)) + // noescape trick for header.typ ( reflect.*rtype ) + copiedType := *(**runtime.Type)(unsafe.Pointer(&typeptr)) + + if err := validateType(copiedType, ptr); err != nil { + return err + } + + dec, err := decoder.CompileToGetDecoder(typ) + if err != nil { + return err + } + if err := d.s.PrepareForDecode(); err != nil { + return err + } + s := d.s + for _, optFunc := range optFuncs { + optFunc(s.Option) + } + if err := dec.DecodeStream(s, 0, header.ptr); err != nil { + return err + } + s.Reset() + return nil +} + +func (d *Decoder) More() bool { + return d.s.More() +} + +func (d *Decoder) Token() (Token, error) { + return d.s.Token() +} + +// DisallowUnknownFields causes the Decoder to return an error when the destination +// is a struct and the input contains object keys which do not match any +// non-ignored, exported fields in the destination. +func (d *Decoder) DisallowUnknownFields() { + d.s.DisallowUnknownFields = true +} + +func (d *Decoder) InputOffset() int64 { + return d.s.TotalOffset() +} + +// UseNumber causes the Decoder to unmarshal a number into an interface{} as a +// Number instead of as a float64. +func (d *Decoder) UseNumber() { + d.s.UseNumber = true +} diff --git a/vendor/github.com/goccy/go-json/docker-compose.yml b/vendor/github.com/goccy/go-json/docker-compose.yml new file mode 100644 index 000000000..db40c79ad --- /dev/null +++ b/vendor/github.com/goccy/go-json/docker-compose.yml @@ -0,0 +1,13 @@ +version: '2' +services: + go-json: + image: golang:1.18 + volumes: + - '.:/go/src/go-json' + deploy: + resources: + limits: + memory: 620M + working_dir: /go/src/go-json + command: | + sh -c "go test -c . && ls go-json.test" diff --git a/vendor/github.com/goccy/go-json/encode.go b/vendor/github.com/goccy/go-json/encode.go new file mode 100644 index 000000000..4bd899f38 --- /dev/null +++ b/vendor/github.com/goccy/go-json/encode.go @@ -0,0 +1,326 @@ +package json + +import ( + "context" + "io" + "os" + "unsafe" + + "github.com/goccy/go-json/internal/encoder" + "github.com/goccy/go-json/internal/encoder/vm" + "github.com/goccy/go-json/internal/encoder/vm_color" + "github.com/goccy/go-json/internal/encoder/vm_color_indent" + "github.com/goccy/go-json/internal/encoder/vm_indent" +) + +// An Encoder writes JSON values to an output stream. +type Encoder struct { + w io.Writer + enabledIndent bool + enabledHTMLEscape bool + prefix string + indentStr string +} + +// NewEncoder returns a new encoder that writes to w. +func NewEncoder(w io.Writer) *Encoder { + return &Encoder{w: w, enabledHTMLEscape: true} +} + +// Encode writes the JSON encoding of v to the stream, followed by a newline character. +// +// See the documentation for Marshal for details about the conversion of Go values to JSON. +func (e *Encoder) Encode(v interface{}) error { + return e.EncodeWithOption(v) +} + +// EncodeWithOption call Encode with EncodeOption. +func (e *Encoder) EncodeWithOption(v interface{}, optFuncs ...EncodeOptionFunc) error { + ctx := encoder.TakeRuntimeContext() + ctx.Option.Flag = 0 + + err := e.encodeWithOption(ctx, v, optFuncs...) + + encoder.ReleaseRuntimeContext(ctx) + return err +} + +// EncodeContext call Encode with context.Context and EncodeOption. +func (e *Encoder) EncodeContext(ctx context.Context, v interface{}, optFuncs ...EncodeOptionFunc) error { + rctx := encoder.TakeRuntimeContext() + rctx.Option.Flag = 0 + rctx.Option.Flag |= encoder.ContextOption + rctx.Option.Context = ctx + + err := e.encodeWithOption(rctx, v, optFuncs...) + + encoder.ReleaseRuntimeContext(rctx) + return err +} + +func (e *Encoder) encodeWithOption(ctx *encoder.RuntimeContext, v interface{}, optFuncs ...EncodeOptionFunc) error { + if e.enabledHTMLEscape { + ctx.Option.Flag |= encoder.HTMLEscapeOption + } + ctx.Option.Flag |= encoder.NormalizeUTF8Option + ctx.Option.DebugOut = os.Stdout + for _, optFunc := range optFuncs { + optFunc(ctx.Option) + } + var ( + buf []byte + err error + ) + if e.enabledIndent { + buf, err = encodeIndent(ctx, v, e.prefix, e.indentStr) + } else { + buf, err = encode(ctx, v) + } + if err != nil { + return err + } + if e.enabledIndent { + buf = buf[:len(buf)-2] + } else { + buf = buf[:len(buf)-1] + } + buf = append(buf, '\n') + if _, err := e.w.Write(buf); err != nil { + return err + } + return nil +} + +// SetEscapeHTML specifies whether problematic HTML characters should be escaped inside JSON quoted strings. +// The default behavior is to escape &, <, and > to \u0026, \u003c, and \u003e to avoid certain safety problems that can arise when embedding JSON in HTML. +// +// In non-HTML settings where the escaping interferes with the readability of the output, SetEscapeHTML(false) disables this behavior. +func (e *Encoder) SetEscapeHTML(on bool) { + e.enabledHTMLEscape = on +} + +// SetIndent instructs the encoder to format each subsequent encoded value as if indented by the package-level function Indent(dst, src, prefix, indent). +// Calling SetIndent("", "") disables indentation. +func (e *Encoder) SetIndent(prefix, indent string) { + if prefix == "" && indent == "" { + e.enabledIndent = false + return + } + e.prefix = prefix + e.indentStr = indent + e.enabledIndent = true +} + +func marshalContext(ctx context.Context, v interface{}, optFuncs ...EncodeOptionFunc) ([]byte, error) { + rctx := encoder.TakeRuntimeContext() + rctx.Option.Flag = 0 + rctx.Option.Flag = encoder.HTMLEscapeOption | encoder.NormalizeUTF8Option | encoder.ContextOption + rctx.Option.Context = ctx + for _, optFunc := range optFuncs { + optFunc(rctx.Option) + } + + buf, err := encode(rctx, v) + if err != nil { + encoder.ReleaseRuntimeContext(rctx) + return nil, err + } + + // this line exists to escape call of `runtime.makeslicecopy` . + // if use `make([]byte, len(buf)-1)` and `copy(copied, buf)`, + // dst buffer size and src buffer size are differrent. + // in this case, compiler uses `runtime.makeslicecopy`, but it is slow. + buf = buf[:len(buf)-1] + copied := make([]byte, len(buf)) + copy(copied, buf) + + encoder.ReleaseRuntimeContext(rctx) + return copied, nil +} + +func marshal(v interface{}, optFuncs ...EncodeOptionFunc) ([]byte, error) { + ctx := encoder.TakeRuntimeContext() + + ctx.Option.Flag = 0 + ctx.Option.Flag |= (encoder.HTMLEscapeOption | encoder.NormalizeUTF8Option) + for _, optFunc := range optFuncs { + optFunc(ctx.Option) + } + + buf, err := encode(ctx, v) + if err != nil { + encoder.ReleaseRuntimeContext(ctx) + return nil, err + } + + // this line exists to escape call of `runtime.makeslicecopy` . + // if use `make([]byte, len(buf)-1)` and `copy(copied, buf)`, + // dst buffer size and src buffer size are differrent. + // in this case, compiler uses `runtime.makeslicecopy`, but it is slow. + buf = buf[:len(buf)-1] + copied := make([]byte, len(buf)) + copy(copied, buf) + + encoder.ReleaseRuntimeContext(ctx) + return copied, nil +} + +func marshalNoEscape(v interface{}) ([]byte, error) { + ctx := encoder.TakeRuntimeContext() + + ctx.Option.Flag = 0 + ctx.Option.Flag |= (encoder.HTMLEscapeOption | encoder.NormalizeUTF8Option) + + buf, err := encodeNoEscape(ctx, v) + if err != nil { + encoder.ReleaseRuntimeContext(ctx) + return nil, err + } + + // this line exists to escape call of `runtime.makeslicecopy` . + // if use `make([]byte, len(buf)-1)` and `copy(copied, buf)`, + // dst buffer size and src buffer size are differrent. + // in this case, compiler uses `runtime.makeslicecopy`, but it is slow. + buf = buf[:len(buf)-1] + copied := make([]byte, len(buf)) + copy(copied, buf) + + encoder.ReleaseRuntimeContext(ctx) + return copied, nil +} + +func marshalIndent(v interface{}, prefix, indent string, optFuncs ...EncodeOptionFunc) ([]byte, error) { + ctx := encoder.TakeRuntimeContext() + + ctx.Option.Flag = 0 + ctx.Option.Flag |= (encoder.HTMLEscapeOption | encoder.NormalizeUTF8Option | encoder.IndentOption) + for _, optFunc := range optFuncs { + optFunc(ctx.Option) + } + + buf, err := encodeIndent(ctx, v, prefix, indent) + if err != nil { + encoder.ReleaseRuntimeContext(ctx) + return nil, err + } + + buf = buf[:len(buf)-2] + copied := make([]byte, len(buf)) + copy(copied, buf) + + encoder.ReleaseRuntimeContext(ctx) + return copied, nil +} + +func encode(ctx *encoder.RuntimeContext, v interface{}) ([]byte, error) { + b := ctx.Buf[:0] + if v == nil { + b = encoder.AppendNull(ctx, b) + b = encoder.AppendComma(ctx, b) + return b, nil + } + header := (*emptyInterface)(unsafe.Pointer(&v)) + typ := header.typ + + typeptr := uintptr(unsafe.Pointer(typ)) + codeSet, err := encoder.CompileToGetCodeSet(ctx, typeptr) + if err != nil { + return nil, err + } + + p := uintptr(header.ptr) + ctx.Init(p, codeSet.CodeLength) + ctx.KeepRefs = append(ctx.KeepRefs, header.ptr) + + buf, err := encodeRunCode(ctx, b, codeSet) + if err != nil { + return nil, err + } + ctx.Buf = buf + return buf, nil +} + +func encodeNoEscape(ctx *encoder.RuntimeContext, v interface{}) ([]byte, error) { + b := ctx.Buf[:0] + if v == nil { + b = encoder.AppendNull(ctx, b) + b = encoder.AppendComma(ctx, b) + return b, nil + } + header := (*emptyInterface)(unsafe.Pointer(&v)) + typ := header.typ + + typeptr := uintptr(unsafe.Pointer(typ)) + codeSet, err := encoder.CompileToGetCodeSet(ctx, typeptr) + if err != nil { + return nil, err + } + + p := uintptr(header.ptr) + ctx.Init(p, codeSet.CodeLength) + buf, err := encodeRunCode(ctx, b, codeSet) + if err != nil { + return nil, err + } + + ctx.Buf = buf + return buf, nil +} + +func encodeIndent(ctx *encoder.RuntimeContext, v interface{}, prefix, indent string) ([]byte, error) { + b := ctx.Buf[:0] + if v == nil { + b = encoder.AppendNull(ctx, b) + b = encoder.AppendCommaIndent(ctx, b) + return b, nil + } + header := (*emptyInterface)(unsafe.Pointer(&v)) + typ := header.typ + + typeptr := uintptr(unsafe.Pointer(typ)) + codeSet, err := encoder.CompileToGetCodeSet(ctx, typeptr) + if err != nil { + return nil, err + } + + p := uintptr(header.ptr) + ctx.Init(p, codeSet.CodeLength) + buf, err := encodeRunIndentCode(ctx, b, codeSet, prefix, indent) + + ctx.KeepRefs = append(ctx.KeepRefs, header.ptr) + + if err != nil { + return nil, err + } + + ctx.Buf = buf + return buf, nil +} + +func encodeRunCode(ctx *encoder.RuntimeContext, b []byte, codeSet *encoder.OpcodeSet) ([]byte, error) { + if (ctx.Option.Flag & encoder.DebugOption) != 0 { + if (ctx.Option.Flag & encoder.ColorizeOption) != 0 { + return vm_color.DebugRun(ctx, b, codeSet) + } + return vm.DebugRun(ctx, b, codeSet) + } + if (ctx.Option.Flag & encoder.ColorizeOption) != 0 { + return vm_color.Run(ctx, b, codeSet) + } + return vm.Run(ctx, b, codeSet) +} + +func encodeRunIndentCode(ctx *encoder.RuntimeContext, b []byte, codeSet *encoder.OpcodeSet, prefix, indent string) ([]byte, error) { + ctx.Prefix = []byte(prefix) + ctx.IndentStr = []byte(indent) + if (ctx.Option.Flag & encoder.DebugOption) != 0 { + if (ctx.Option.Flag & encoder.ColorizeOption) != 0 { + return vm_color_indent.DebugRun(ctx, b, codeSet) + } + return vm_indent.DebugRun(ctx, b, codeSet) + } + if (ctx.Option.Flag & encoder.ColorizeOption) != 0 { + return vm_color_indent.Run(ctx, b, codeSet) + } + return vm_indent.Run(ctx, b, codeSet) +} diff --git a/vendor/github.com/goccy/go-json/error.go b/vendor/github.com/goccy/go-json/error.go new file mode 100644 index 000000000..5b2dcee50 --- /dev/null +++ b/vendor/github.com/goccy/go-json/error.go @@ -0,0 +1,41 @@ +package json + +import ( + "github.com/goccy/go-json/internal/errors" +) + +// Before Go 1.2, an InvalidUTF8Error was returned by Marshal when +// attempting to encode a string value with invalid UTF-8 sequences. +// As of Go 1.2, Marshal instead coerces the string to valid UTF-8 by +// replacing invalid bytes with the Unicode replacement rune U+FFFD. +// +// Deprecated: No longer used; kept for compatibility. +type InvalidUTF8Error = errors.InvalidUTF8Error + +// An InvalidUnmarshalError describes an invalid argument passed to Unmarshal. +// (The argument to Unmarshal must be a non-nil pointer.) +type InvalidUnmarshalError = errors.InvalidUnmarshalError + +// A MarshalerError represents an error from calling a MarshalJSON or MarshalText method. +type MarshalerError = errors.MarshalerError + +// A SyntaxError is a description of a JSON syntax error. +type SyntaxError = errors.SyntaxError + +// An UnmarshalFieldError describes a JSON object key that +// led to an unexported (and therefore unwritable) struct field. +// +// Deprecated: No longer used; kept for compatibility. +type UnmarshalFieldError = errors.UnmarshalFieldError + +// An UnmarshalTypeError describes a JSON value that was +// not appropriate for a value of a specific Go type. +type UnmarshalTypeError = errors.UnmarshalTypeError + +// An UnsupportedTypeError is returned by Marshal when attempting +// to encode an unsupported value type. +type UnsupportedTypeError = errors.UnsupportedTypeError + +type UnsupportedValueError = errors.UnsupportedValueError + +type PathError = errors.PathError diff --git a/vendor/github.com/goccy/go-json/internal/decoder/anonymous_field.go b/vendor/github.com/goccy/go-json/internal/decoder/anonymous_field.go new file mode 100644 index 000000000..b6876cf0d --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/anonymous_field.go @@ -0,0 +1,41 @@ +package decoder + +import ( + "unsafe" + + "github.com/goccy/go-json/internal/runtime" +) + +type anonymousFieldDecoder struct { + structType *runtime.Type + offset uintptr + dec Decoder +} + +func newAnonymousFieldDecoder(structType *runtime.Type, offset uintptr, dec Decoder) *anonymousFieldDecoder { + return &anonymousFieldDecoder{ + structType: structType, + offset: offset, + dec: dec, + } +} + +func (d *anonymousFieldDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + if *(*unsafe.Pointer)(p) == nil { + *(*unsafe.Pointer)(p) = unsafe_New(d.structType) + } + p = *(*unsafe.Pointer)(p) + return d.dec.DecodeStream(s, depth, unsafe.Pointer(uintptr(p)+d.offset)) +} + +func (d *anonymousFieldDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + if *(*unsafe.Pointer)(p) == nil { + *(*unsafe.Pointer)(p) = unsafe_New(d.structType) + } + p = *(*unsafe.Pointer)(p) + return d.dec.Decode(ctx, cursor, depth, unsafe.Pointer(uintptr(p)+d.offset)) +} + +func (d *anonymousFieldDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return d.dec.DecodePath(ctx, cursor, depth) +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/array.go b/vendor/github.com/goccy/go-json/internal/decoder/array.go new file mode 100644 index 000000000..4b23ed43f --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/array.go @@ -0,0 +1,176 @@ +package decoder + +import ( + "fmt" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type arrayDecoder struct { + elemType *runtime.Type + size uintptr + valueDecoder Decoder + alen int + structName string + fieldName string + zeroValue unsafe.Pointer +} + +func newArrayDecoder(dec Decoder, elemType *runtime.Type, alen int, structName, fieldName string) *arrayDecoder { + // workaround to avoid checkptr errors. cannot use `*(*unsafe.Pointer)(unsafe_New(elemType))` directly. + zeroValuePtr := unsafe_New(elemType) + zeroValue := **(**unsafe.Pointer)(unsafe.Pointer(&zeroValuePtr)) + return &arrayDecoder{ + valueDecoder: dec, + elemType: elemType, + size: elemType.Size(), + alen: alen, + structName: structName, + fieldName: fieldName, + zeroValue: zeroValue, + } +} + +func (d *arrayDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + depth++ + if depth > maxDecodeNestingDepth { + return errors.ErrExceededMaxDepth(s.char(), s.cursor) + } + + for { + switch s.char() { + case ' ', '\n', '\t', '\r': + case 'n': + if err := nullBytes(s); err != nil { + return err + } + return nil + case '[': + idx := 0 + s.cursor++ + if s.skipWhiteSpace() == ']' { + for idx < d.alen { + *(*unsafe.Pointer)(unsafe.Pointer(uintptr(p) + uintptr(idx)*d.size)) = d.zeroValue + idx++ + } + s.cursor++ + return nil + } + for { + if idx < d.alen { + if err := d.valueDecoder.DecodeStream(s, depth, unsafe.Pointer(uintptr(p)+uintptr(idx)*d.size)); err != nil { + return err + } + } else { + if err := s.skipValue(depth); err != nil { + return err + } + } + idx++ + switch s.skipWhiteSpace() { + case ']': + for idx < d.alen { + *(*unsafe.Pointer)(unsafe.Pointer(uintptr(p) + uintptr(idx)*d.size)) = d.zeroValue + idx++ + } + s.cursor++ + return nil + case ',': + s.cursor++ + continue + case nul: + if s.read() { + s.cursor++ + continue + } + goto ERROR + default: + goto ERROR + } + } + case nul: + if s.read() { + continue + } + goto ERROR + default: + goto ERROR + } + s.cursor++ + } +ERROR: + return errors.ErrUnexpectedEndOfJSON("array", s.totalOffset()) +} + +func (d *arrayDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + depth++ + if depth > maxDecodeNestingDepth { + return 0, errors.ErrExceededMaxDepth(buf[cursor], cursor) + } + + for { + switch buf[cursor] { + case ' ', '\n', '\t', '\r': + cursor++ + continue + case 'n': + if err := validateNull(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + return cursor, nil + case '[': + idx := 0 + cursor++ + cursor = skipWhiteSpace(buf, cursor) + if buf[cursor] == ']' { + for idx < d.alen { + *(*unsafe.Pointer)(unsafe.Pointer(uintptr(p) + uintptr(idx)*d.size)) = d.zeroValue + idx++ + } + cursor++ + return cursor, nil + } + for { + if idx < d.alen { + c, err := d.valueDecoder.Decode(ctx, cursor, depth, unsafe.Pointer(uintptr(p)+uintptr(idx)*d.size)) + if err != nil { + return 0, err + } + cursor = c + } else { + c, err := skipValue(buf, cursor, depth) + if err != nil { + return 0, err + } + cursor = c + } + idx++ + cursor = skipWhiteSpace(buf, cursor) + switch buf[cursor] { + case ']': + for idx < d.alen { + *(*unsafe.Pointer)(unsafe.Pointer(uintptr(p) + uintptr(idx)*d.size)) = d.zeroValue + idx++ + } + cursor++ + return cursor, nil + case ',': + cursor++ + continue + default: + return 0, errors.ErrInvalidCharacter(buf[cursor], "array", cursor) + } + } + default: + return 0, errors.ErrUnexpectedEndOfJSON("array", cursor) + } + } +} + +func (d *arrayDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: array decoder does not support decode path") +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/assign.go b/vendor/github.com/goccy/go-json/internal/decoder/assign.go new file mode 100644 index 000000000..c53e6ad9f --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/assign.go @@ -0,0 +1,438 @@ +package decoder + +import ( + "fmt" + "reflect" + "strconv" +) + +var ( + nilValue = reflect.ValueOf(nil) +) + +func AssignValue(src, dst reflect.Value) error { + if dst.Type().Kind() != reflect.Ptr { + return fmt.Errorf("invalid dst type. required pointer type: %T", dst.Type()) + } + casted, err := castValue(dst.Elem().Type(), src) + if err != nil { + return err + } + dst.Elem().Set(casted) + return nil +} + +func castValue(t reflect.Type, v reflect.Value) (reflect.Value, error) { + switch t.Kind() { + case reflect.Int: + vv, err := castInt(v) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(int(vv.Int())), nil + case reflect.Int8: + vv, err := castInt(v) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(int8(vv.Int())), nil + case reflect.Int16: + vv, err := castInt(v) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(int16(vv.Int())), nil + case reflect.Int32: + vv, err := castInt(v) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(int32(vv.Int())), nil + case reflect.Int64: + return castInt(v) + case reflect.Uint: + vv, err := castUint(v) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(uint(vv.Uint())), nil + case reflect.Uint8: + vv, err := castUint(v) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(uint8(vv.Uint())), nil + case reflect.Uint16: + vv, err := castUint(v) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(uint16(vv.Uint())), nil + case reflect.Uint32: + vv, err := castUint(v) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(uint32(vv.Uint())), nil + case reflect.Uint64: + return castUint(v) + case reflect.Uintptr: + vv, err := castUint(v) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(uintptr(vv.Uint())), nil + case reflect.String: + return castString(v) + case reflect.Bool: + return castBool(v) + case reflect.Float32: + vv, err := castFloat(v) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(float32(vv.Float())), nil + case reflect.Float64: + return castFloat(v) + case reflect.Array: + return castArray(t, v) + case reflect.Slice: + return castSlice(t, v) + case reflect.Map: + return castMap(t, v) + case reflect.Struct: + return castStruct(t, v) + } + return v, nil +} + +func castInt(v reflect.Value) (reflect.Value, error) { + switch v.Type().Kind() { + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + return v, nil + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + return reflect.ValueOf(int64(v.Uint())), nil + case reflect.String: + i64, err := strconv.ParseInt(v.String(), 10, 64) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(i64), nil + case reflect.Bool: + if v.Bool() { + return reflect.ValueOf(int64(1)), nil + } + return reflect.ValueOf(int64(0)), nil + case reflect.Float32, reflect.Float64: + return reflect.ValueOf(int64(v.Float())), nil + case reflect.Array: + if v.Len() > 0 { + return castInt(v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to int64 from empty array") + case reflect.Slice: + if v.Len() > 0 { + return castInt(v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to int64 from empty slice") + case reflect.Interface: + return castInt(reflect.ValueOf(v.Interface())) + case reflect.Map: + return nilValue, fmt.Errorf("failed to cast to int64 from map") + case reflect.Struct: + return nilValue, fmt.Errorf("failed to cast to int64 from struct") + case reflect.Ptr: + return castInt(v.Elem()) + } + return nilValue, fmt.Errorf("failed to cast to int64 from %s", v.Type().Kind()) +} + +func castUint(v reflect.Value) (reflect.Value, error) { + switch v.Type().Kind() { + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + return reflect.ValueOf(uint64(v.Int())), nil + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + return v, nil + case reflect.String: + u64, err := strconv.ParseUint(v.String(), 10, 64) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(u64), nil + case reflect.Bool: + if v.Bool() { + return reflect.ValueOf(uint64(1)), nil + } + return reflect.ValueOf(uint64(0)), nil + case reflect.Float32, reflect.Float64: + return reflect.ValueOf(uint64(v.Float())), nil + case reflect.Array: + if v.Len() > 0 { + return castUint(v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to uint64 from empty array") + case reflect.Slice: + if v.Len() > 0 { + return castUint(v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to uint64 from empty slice") + case reflect.Interface: + return castUint(reflect.ValueOf(v.Interface())) + case reflect.Map: + return nilValue, fmt.Errorf("failed to cast to uint64 from map") + case reflect.Struct: + return nilValue, fmt.Errorf("failed to cast to uint64 from struct") + case reflect.Ptr: + return castUint(v.Elem()) + } + return nilValue, fmt.Errorf("failed to cast to uint64 from %s", v.Type().Kind()) +} + +func castString(v reflect.Value) (reflect.Value, error) { + switch v.Type().Kind() { + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + return reflect.ValueOf(fmt.Sprint(v.Int())), nil + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + return reflect.ValueOf(fmt.Sprint(v.Uint())), nil + case reflect.String: + return v, nil + case reflect.Bool: + if v.Bool() { + return reflect.ValueOf("true"), nil + } + return reflect.ValueOf("false"), nil + case reflect.Float32, reflect.Float64: + return reflect.ValueOf(fmt.Sprint(v.Float())), nil + case reflect.Array: + if v.Len() > 0 { + return castString(v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to string from empty array") + case reflect.Slice: + if v.Len() > 0 { + return castString(v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to string from empty slice") + case reflect.Interface: + return castString(reflect.ValueOf(v.Interface())) + case reflect.Map: + return nilValue, fmt.Errorf("failed to cast to string from map") + case reflect.Struct: + return nilValue, fmt.Errorf("failed to cast to string from struct") + case reflect.Ptr: + return castString(v.Elem()) + } + return nilValue, fmt.Errorf("failed to cast to string from %s", v.Type().Kind()) +} + +func castBool(v reflect.Value) (reflect.Value, error) { + switch v.Type().Kind() { + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + switch v.Int() { + case 0: + return reflect.ValueOf(false), nil + case 1: + return reflect.ValueOf(true), nil + } + return nilValue, fmt.Errorf("failed to cast to bool from %d", v.Int()) + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + switch v.Uint() { + case 0: + return reflect.ValueOf(false), nil + case 1: + return reflect.ValueOf(true), nil + } + return nilValue, fmt.Errorf("failed to cast to bool from %d", v.Uint()) + case reflect.String: + b, err := strconv.ParseBool(v.String()) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(b), nil + case reflect.Bool: + return v, nil + case reflect.Float32, reflect.Float64: + switch v.Float() { + case 0: + return reflect.ValueOf(false), nil + case 1: + return reflect.ValueOf(true), nil + } + return nilValue, fmt.Errorf("failed to cast to bool from %f", v.Float()) + case reflect.Array: + if v.Len() > 0 { + return castBool(v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to string from empty array") + case reflect.Slice: + if v.Len() > 0 { + return castBool(v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to string from empty slice") + case reflect.Interface: + return castBool(reflect.ValueOf(v.Interface())) + case reflect.Map: + return nilValue, fmt.Errorf("failed to cast to string from map") + case reflect.Struct: + return nilValue, fmt.Errorf("failed to cast to string from struct") + case reflect.Ptr: + return castBool(v.Elem()) + } + return nilValue, fmt.Errorf("failed to cast to bool from %s", v.Type().Kind()) +} + +func castFloat(v reflect.Value) (reflect.Value, error) { + switch v.Type().Kind() { + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + return reflect.ValueOf(float64(v.Int())), nil + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + return reflect.ValueOf(float64(v.Uint())), nil + case reflect.String: + f64, err := strconv.ParseFloat(v.String(), 64) + if err != nil { + return nilValue, err + } + return reflect.ValueOf(f64), nil + case reflect.Bool: + if v.Bool() { + return reflect.ValueOf(float64(1)), nil + } + return reflect.ValueOf(float64(0)), nil + case reflect.Float32, reflect.Float64: + return v, nil + case reflect.Array: + if v.Len() > 0 { + return castFloat(v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to float64 from empty array") + case reflect.Slice: + if v.Len() > 0 { + return castFloat(v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to float64 from empty slice") + case reflect.Interface: + return castFloat(reflect.ValueOf(v.Interface())) + case reflect.Map: + return nilValue, fmt.Errorf("failed to cast to float64 from map") + case reflect.Struct: + return nilValue, fmt.Errorf("failed to cast to float64 from struct") + case reflect.Ptr: + return castFloat(v.Elem()) + } + return nilValue, fmt.Errorf("failed to cast to float64 from %s", v.Type().Kind()) +} + +func castArray(t reflect.Type, v reflect.Value) (reflect.Value, error) { + kind := v.Type().Kind() + if kind == reflect.Interface { + return castArray(t, reflect.ValueOf(v.Interface())) + } + if kind != reflect.Slice && kind != reflect.Array { + return nilValue, fmt.Errorf("failed to cast to array from %s", kind) + } + if t.Elem() == v.Type().Elem() { + return v, nil + } + if t.Len() != v.Len() { + return nilValue, fmt.Errorf("failed to cast [%d]array from slice of %d length", t.Len(), v.Len()) + } + ret := reflect.New(t).Elem() + for i := 0; i < v.Len(); i++ { + vv, err := castValue(t.Elem(), v.Index(i)) + if err != nil { + return nilValue, err + } + ret.Index(i).Set(vv) + } + return ret, nil +} + +func castSlice(t reflect.Type, v reflect.Value) (reflect.Value, error) { + kind := v.Type().Kind() + if kind == reflect.Interface { + return castSlice(t, reflect.ValueOf(v.Interface())) + } + if kind != reflect.Slice && kind != reflect.Array { + return nilValue, fmt.Errorf("failed to cast to slice from %s", kind) + } + if t.Elem() == v.Type().Elem() { + return v, nil + } + ret := reflect.MakeSlice(t, v.Len(), v.Len()) + for i := 0; i < v.Len(); i++ { + vv, err := castValue(t.Elem(), v.Index(i)) + if err != nil { + return nilValue, err + } + ret.Index(i).Set(vv) + } + return ret, nil +} + +func castMap(t reflect.Type, v reflect.Value) (reflect.Value, error) { + ret := reflect.MakeMap(t) + switch v.Type().Kind() { + case reflect.Map: + iter := v.MapRange() + for iter.Next() { + key, err := castValue(t.Key(), iter.Key()) + if err != nil { + return nilValue, err + } + value, err := castValue(t.Elem(), iter.Value()) + if err != nil { + return nilValue, err + } + ret.SetMapIndex(key, value) + } + return ret, nil + case reflect.Interface: + return castMap(t, reflect.ValueOf(v.Interface())) + case reflect.Slice: + if v.Len() > 0 { + return castMap(t, v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to map from empty slice") + } + return nilValue, fmt.Errorf("failed to cast to map from %s", v.Type().Kind()) +} + +func castStruct(t reflect.Type, v reflect.Value) (reflect.Value, error) { + ret := reflect.New(t).Elem() + switch v.Type().Kind() { + case reflect.Map: + iter := v.MapRange() + for iter.Next() { + key := iter.Key() + k, err := castString(key) + if err != nil { + return nilValue, err + } + fieldName := k.String() + field, ok := t.FieldByName(fieldName) + if ok { + value, err := castValue(field.Type, iter.Value()) + if err != nil { + return nilValue, err + } + ret.FieldByName(fieldName).Set(value) + } + } + return ret, nil + case reflect.Struct: + for i := 0; i < v.Type().NumField(); i++ { + name := v.Type().Field(i).Name + ret.FieldByName(name).Set(v.FieldByName(name)) + } + return ret, nil + case reflect.Interface: + return castStruct(t, reflect.ValueOf(v.Interface())) + case reflect.Slice: + if v.Len() > 0 { + return castStruct(t, v.Index(0)) + } + return nilValue, fmt.Errorf("failed to cast to struct from empty slice") + default: + return nilValue, fmt.Errorf("failed to cast to struct from %s", v.Type().Kind()) + } +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/bool.go b/vendor/github.com/goccy/go-json/internal/decoder/bool.go new file mode 100644 index 000000000..ba6cf5bc4 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/bool.go @@ -0,0 +1,83 @@ +package decoder + +import ( + "fmt" + "unsafe" + + "github.com/goccy/go-json/internal/errors" +) + +type boolDecoder struct { + structName string + fieldName string +} + +func newBoolDecoder(structName, fieldName string) *boolDecoder { + return &boolDecoder{structName: structName, fieldName: fieldName} +} + +func (d *boolDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + c := s.skipWhiteSpace() + for { + switch c { + case 't': + if err := trueBytes(s); err != nil { + return err + } + **(**bool)(unsafe.Pointer(&p)) = true + return nil + case 'f': + if err := falseBytes(s); err != nil { + return err + } + **(**bool)(unsafe.Pointer(&p)) = false + return nil + case 'n': + if err := nullBytes(s); err != nil { + return err + } + return nil + case nul: + if s.read() { + c = s.char() + continue + } + goto ERROR + } + break + } +ERROR: + return errors.ErrUnexpectedEndOfJSON("bool", s.totalOffset()) +} + +func (d *boolDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + cursor = skipWhiteSpace(buf, cursor) + switch buf[cursor] { + case 't': + if err := validateTrue(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + **(**bool)(unsafe.Pointer(&p)) = true + return cursor, nil + case 'f': + if err := validateFalse(buf, cursor); err != nil { + return 0, err + } + cursor += 5 + **(**bool)(unsafe.Pointer(&p)) = false + return cursor, nil + case 'n': + if err := validateNull(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + return cursor, nil + } + return 0, errors.ErrUnexpectedEndOfJSON("bool", cursor) +} + +func (d *boolDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: bool decoder does not support decode path") +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/bytes.go b/vendor/github.com/goccy/go-json/internal/decoder/bytes.go new file mode 100644 index 000000000..939bf4327 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/bytes.go @@ -0,0 +1,118 @@ +package decoder + +import ( + "encoding/base64" + "fmt" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type bytesDecoder struct { + typ *runtime.Type + sliceDecoder Decoder + stringDecoder *stringDecoder + structName string + fieldName string +} + +func byteUnmarshalerSliceDecoder(typ *runtime.Type, structName string, fieldName string) Decoder { + var unmarshalDecoder Decoder + switch { + case runtime.PtrTo(typ).Implements(unmarshalJSONType): + unmarshalDecoder = newUnmarshalJSONDecoder(runtime.PtrTo(typ), structName, fieldName) + case runtime.PtrTo(typ).Implements(unmarshalTextType): + unmarshalDecoder = newUnmarshalTextDecoder(runtime.PtrTo(typ), structName, fieldName) + default: + unmarshalDecoder, _ = compileUint8(typ, structName, fieldName) + } + return newSliceDecoder(unmarshalDecoder, typ, 1, structName, fieldName) +} + +func newBytesDecoder(typ *runtime.Type, structName string, fieldName string) *bytesDecoder { + return &bytesDecoder{ + typ: typ, + sliceDecoder: byteUnmarshalerSliceDecoder(typ, structName, fieldName), + stringDecoder: newStringDecoder(structName, fieldName), + structName: structName, + fieldName: fieldName, + } +} + +func (d *bytesDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + bytes, err := d.decodeStreamBinary(s, depth, p) + if err != nil { + return err + } + if bytes == nil { + s.reset() + return nil + } + decodedLen := base64.StdEncoding.DecodedLen(len(bytes)) + buf := make([]byte, decodedLen) + n, err := base64.StdEncoding.Decode(buf, bytes) + if err != nil { + return err + } + *(*[]byte)(p) = buf[:n] + s.reset() + return nil +} + +func (d *bytesDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + bytes, c, err := d.decodeBinary(ctx, cursor, depth, p) + if err != nil { + return 0, err + } + if bytes == nil { + return c, nil + } + cursor = c + decodedLen := base64.StdEncoding.DecodedLen(len(bytes)) + b := make([]byte, decodedLen) + n, err := base64.StdEncoding.Decode(b, bytes) + if err != nil { + return 0, err + } + *(*[]byte)(p) = b[:n] + return cursor, nil +} + +func (d *bytesDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: []byte decoder does not support decode path") +} + +func (d *bytesDecoder) decodeStreamBinary(s *Stream, depth int64, p unsafe.Pointer) ([]byte, error) { + c := s.skipWhiteSpace() + if c == '[' { + if d.sliceDecoder == nil { + return nil, &errors.UnmarshalTypeError{ + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + } + } + err := d.sliceDecoder.DecodeStream(s, depth, p) + return nil, err + } + return d.stringDecoder.decodeStreamByte(s) +} + +func (d *bytesDecoder) decodeBinary(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) ([]byte, int64, error) { + buf := ctx.Buf + cursor = skipWhiteSpace(buf, cursor) + if buf[cursor] == '[' { + if d.sliceDecoder == nil { + return nil, 0, &errors.UnmarshalTypeError{ + Type: runtime.RType2Type(d.typ), + Offset: cursor, + } + } + c, err := d.sliceDecoder.Decode(ctx, cursor, depth, p) + if err != nil { + return nil, 0, err + } + return nil, c, nil + } + return d.stringDecoder.decodeByte(buf, cursor) +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/compile.go b/vendor/github.com/goccy/go-json/internal/decoder/compile.go new file mode 100644 index 000000000..fab643764 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/compile.go @@ -0,0 +1,487 @@ +package decoder + +import ( + "encoding/json" + "fmt" + "reflect" + "strings" + "sync/atomic" + "unicode" + "unsafe" + + "github.com/goccy/go-json/internal/runtime" +) + +var ( + jsonNumberType = reflect.TypeOf(json.Number("")) + typeAddr *runtime.TypeAddr + cachedDecoderMap unsafe.Pointer // map[uintptr]decoder + cachedDecoder []Decoder +) + +func init() { + typeAddr = runtime.AnalyzeTypeAddr() + if typeAddr == nil { + typeAddr = &runtime.TypeAddr{} + } + cachedDecoder = make([]Decoder, typeAddr.AddrRange>>typeAddr.AddrShift+1) +} + +func loadDecoderMap() map[uintptr]Decoder { + p := atomic.LoadPointer(&cachedDecoderMap) + return *(*map[uintptr]Decoder)(unsafe.Pointer(&p)) +} + +func storeDecoder(typ uintptr, dec Decoder, m map[uintptr]Decoder) { + newDecoderMap := make(map[uintptr]Decoder, len(m)+1) + newDecoderMap[typ] = dec + + for k, v := range m { + newDecoderMap[k] = v + } + + atomic.StorePointer(&cachedDecoderMap, *(*unsafe.Pointer)(unsafe.Pointer(&newDecoderMap))) +} + +func compileToGetDecoderSlowPath(typeptr uintptr, typ *runtime.Type) (Decoder, error) { + decoderMap := loadDecoderMap() + if dec, exists := decoderMap[typeptr]; exists { + return dec, nil + } + + dec, err := compileHead(typ, map[uintptr]Decoder{}) + if err != nil { + return nil, err + } + storeDecoder(typeptr, dec, decoderMap) + return dec, nil +} + +func compileHead(typ *runtime.Type, structTypeToDecoder map[uintptr]Decoder) (Decoder, error) { + switch { + case implementsUnmarshalJSONType(runtime.PtrTo(typ)): + return newUnmarshalJSONDecoder(runtime.PtrTo(typ), "", ""), nil + case runtime.PtrTo(typ).Implements(unmarshalTextType): + return newUnmarshalTextDecoder(runtime.PtrTo(typ), "", ""), nil + } + return compile(typ.Elem(), "", "", structTypeToDecoder) +} + +func compile(typ *runtime.Type, structName, fieldName string, structTypeToDecoder map[uintptr]Decoder) (Decoder, error) { + switch { + case implementsUnmarshalJSONType(runtime.PtrTo(typ)): + return newUnmarshalJSONDecoder(runtime.PtrTo(typ), structName, fieldName), nil + case runtime.PtrTo(typ).Implements(unmarshalTextType): + return newUnmarshalTextDecoder(runtime.PtrTo(typ), structName, fieldName), nil + } + + switch typ.Kind() { + case reflect.Ptr: + return compilePtr(typ, structName, fieldName, structTypeToDecoder) + case reflect.Struct: + return compileStruct(typ, structName, fieldName, structTypeToDecoder) + case reflect.Slice: + elem := typ.Elem() + if elem.Kind() == reflect.Uint8 { + return compileBytes(elem, structName, fieldName) + } + return compileSlice(typ, structName, fieldName, structTypeToDecoder) + case reflect.Array: + return compileArray(typ, structName, fieldName, structTypeToDecoder) + case reflect.Map: + return compileMap(typ, structName, fieldName, structTypeToDecoder) + case reflect.Interface: + return compileInterface(typ, structName, fieldName) + case reflect.Uintptr: + return compileUint(typ, structName, fieldName) + case reflect.Int: + return compileInt(typ, structName, fieldName) + case reflect.Int8: + return compileInt8(typ, structName, fieldName) + case reflect.Int16: + return compileInt16(typ, structName, fieldName) + case reflect.Int32: + return compileInt32(typ, structName, fieldName) + case reflect.Int64: + return compileInt64(typ, structName, fieldName) + case reflect.Uint: + return compileUint(typ, structName, fieldName) + case reflect.Uint8: + return compileUint8(typ, structName, fieldName) + case reflect.Uint16: + return compileUint16(typ, structName, fieldName) + case reflect.Uint32: + return compileUint32(typ, structName, fieldName) + case reflect.Uint64: + return compileUint64(typ, structName, fieldName) + case reflect.String: + return compileString(typ, structName, fieldName) + case reflect.Bool: + return compileBool(structName, fieldName) + case reflect.Float32: + return compileFloat32(structName, fieldName) + case reflect.Float64: + return compileFloat64(structName, fieldName) + case reflect.Func: + return compileFunc(typ, structName, fieldName) + } + return newInvalidDecoder(typ, structName, fieldName), nil +} + +func isStringTagSupportedType(typ *runtime.Type) bool { + switch { + case implementsUnmarshalJSONType(runtime.PtrTo(typ)): + return false + case runtime.PtrTo(typ).Implements(unmarshalTextType): + return false + } + switch typ.Kind() { + case reflect.Map: + return false + case reflect.Slice: + return false + case reflect.Array: + return false + case reflect.Struct: + return false + case reflect.Interface: + return false + } + return true +} + +func compileMapKey(typ *runtime.Type, structName, fieldName string, structTypeToDecoder map[uintptr]Decoder) (Decoder, error) { + if runtime.PtrTo(typ).Implements(unmarshalTextType) { + return newUnmarshalTextDecoder(runtime.PtrTo(typ), structName, fieldName), nil + } + if typ.Kind() == reflect.String { + return newStringDecoder(structName, fieldName), nil + } + dec, err := compile(typ, structName, fieldName, structTypeToDecoder) + if err != nil { + return nil, err + } + for { + switch t := dec.(type) { + case *stringDecoder, *interfaceDecoder: + return dec, nil + case *boolDecoder, *intDecoder, *uintDecoder, *numberDecoder: + return newWrappedStringDecoder(typ, dec, structName, fieldName), nil + case *ptrDecoder: + dec = t.dec + default: + return newInvalidDecoder(typ, structName, fieldName), nil + } + } +} + +func compilePtr(typ *runtime.Type, structName, fieldName string, structTypeToDecoder map[uintptr]Decoder) (Decoder, error) { + dec, err := compile(typ.Elem(), structName, fieldName, structTypeToDecoder) + if err != nil { + return nil, err + } + return newPtrDecoder(dec, typ.Elem(), structName, fieldName), nil +} + +func compileInt(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newIntDecoder(typ, structName, fieldName, func(p unsafe.Pointer, v int64) { + *(*int)(p) = int(v) + }), nil +} + +func compileInt8(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newIntDecoder(typ, structName, fieldName, func(p unsafe.Pointer, v int64) { + *(*int8)(p) = int8(v) + }), nil +} + +func compileInt16(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newIntDecoder(typ, structName, fieldName, func(p unsafe.Pointer, v int64) { + *(*int16)(p) = int16(v) + }), nil +} + +func compileInt32(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newIntDecoder(typ, structName, fieldName, func(p unsafe.Pointer, v int64) { + *(*int32)(p) = int32(v) + }), nil +} + +func compileInt64(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newIntDecoder(typ, structName, fieldName, func(p unsafe.Pointer, v int64) { + *(*int64)(p) = v + }), nil +} + +func compileUint(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newUintDecoder(typ, structName, fieldName, func(p unsafe.Pointer, v uint64) { + *(*uint)(p) = uint(v) + }), nil +} + +func compileUint8(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newUintDecoder(typ, structName, fieldName, func(p unsafe.Pointer, v uint64) { + *(*uint8)(p) = uint8(v) + }), nil +} + +func compileUint16(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newUintDecoder(typ, structName, fieldName, func(p unsafe.Pointer, v uint64) { + *(*uint16)(p) = uint16(v) + }), nil +} + +func compileUint32(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newUintDecoder(typ, structName, fieldName, func(p unsafe.Pointer, v uint64) { + *(*uint32)(p) = uint32(v) + }), nil +} + +func compileUint64(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newUintDecoder(typ, structName, fieldName, func(p unsafe.Pointer, v uint64) { + *(*uint64)(p) = v + }), nil +} + +func compileFloat32(structName, fieldName string) (Decoder, error) { + return newFloatDecoder(structName, fieldName, func(p unsafe.Pointer, v float64) { + *(*float32)(p) = float32(v) + }), nil +} + +func compileFloat64(structName, fieldName string) (Decoder, error) { + return newFloatDecoder(structName, fieldName, func(p unsafe.Pointer, v float64) { + *(*float64)(p) = v + }), nil +} + +func compileString(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + if typ == runtime.Type2RType(jsonNumberType) { + return newNumberDecoder(structName, fieldName, func(p unsafe.Pointer, v json.Number) { + *(*json.Number)(p) = v + }), nil + } + return newStringDecoder(structName, fieldName), nil +} + +func compileBool(structName, fieldName string) (Decoder, error) { + return newBoolDecoder(structName, fieldName), nil +} + +func compileBytes(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newBytesDecoder(typ, structName, fieldName), nil +} + +func compileSlice(typ *runtime.Type, structName, fieldName string, structTypeToDecoder map[uintptr]Decoder) (Decoder, error) { + elem := typ.Elem() + decoder, err := compile(elem, structName, fieldName, structTypeToDecoder) + if err != nil { + return nil, err + } + return newSliceDecoder(decoder, elem, elem.Size(), structName, fieldName), nil +} + +func compileArray(typ *runtime.Type, structName, fieldName string, structTypeToDecoder map[uintptr]Decoder) (Decoder, error) { + elem := typ.Elem() + decoder, err := compile(elem, structName, fieldName, structTypeToDecoder) + if err != nil { + return nil, err + } + return newArrayDecoder(decoder, elem, typ.Len(), structName, fieldName), nil +} + +func compileMap(typ *runtime.Type, structName, fieldName string, structTypeToDecoder map[uintptr]Decoder) (Decoder, error) { + keyDec, err := compileMapKey(typ.Key(), structName, fieldName, structTypeToDecoder) + if err != nil { + return nil, err + } + valueDec, err := compile(typ.Elem(), structName, fieldName, structTypeToDecoder) + if err != nil { + return nil, err + } + return newMapDecoder(typ, typ.Key(), keyDec, typ.Elem(), valueDec, structName, fieldName), nil +} + +func compileInterface(typ *runtime.Type, structName, fieldName string) (Decoder, error) { + return newInterfaceDecoder(typ, structName, fieldName), nil +} + +func compileFunc(typ *runtime.Type, strutName, fieldName string) (Decoder, error) { + return newFuncDecoder(typ, strutName, fieldName), nil +} + +func typeToStructTags(typ *runtime.Type) runtime.StructTags { + tags := runtime.StructTags{} + fieldNum := typ.NumField() + for i := 0; i < fieldNum; i++ { + field := typ.Field(i) + if runtime.IsIgnoredStructField(field) { + continue + } + tags = append(tags, runtime.StructTagFromField(field)) + } + return tags +} + +func compileStruct(typ *runtime.Type, structName, fieldName string, structTypeToDecoder map[uintptr]Decoder) (Decoder, error) { + fieldNum := typ.NumField() + fieldMap := map[string]*structFieldSet{} + typeptr := uintptr(unsafe.Pointer(typ)) + if dec, exists := structTypeToDecoder[typeptr]; exists { + return dec, nil + } + structDec := newStructDecoder(structName, fieldName, fieldMap) + structTypeToDecoder[typeptr] = structDec + structName = typ.Name() + tags := typeToStructTags(typ) + allFields := []*structFieldSet{} + for i := 0; i < fieldNum; i++ { + field := typ.Field(i) + if runtime.IsIgnoredStructField(field) { + continue + } + isUnexportedField := unicode.IsLower([]rune(field.Name)[0]) + tag := runtime.StructTagFromField(field) + dec, err := compile(runtime.Type2RType(field.Type), structName, field.Name, structTypeToDecoder) + if err != nil { + return nil, err + } + if field.Anonymous && !tag.IsTaggedKey { + if stDec, ok := dec.(*structDecoder); ok { + if runtime.Type2RType(field.Type) == typ { + // recursive definition + continue + } + for k, v := range stDec.fieldMap { + if tags.ExistsKey(k) { + continue + } + fieldSet := &structFieldSet{ + dec: v.dec, + offset: field.Offset + v.offset, + isTaggedKey: v.isTaggedKey, + key: k, + keyLen: int64(len(k)), + } + allFields = append(allFields, fieldSet) + } + } else if pdec, ok := dec.(*ptrDecoder); ok { + contentDec := pdec.contentDecoder() + if pdec.typ == typ { + // recursive definition + continue + } + var fieldSetErr error + if isUnexportedField { + fieldSetErr = fmt.Errorf( + "json: cannot set embedded pointer to unexported struct: %v", + field.Type.Elem(), + ) + } + if dec, ok := contentDec.(*structDecoder); ok { + for k, v := range dec.fieldMap { + if tags.ExistsKey(k) { + continue + } + fieldSet := &structFieldSet{ + dec: newAnonymousFieldDecoder(pdec.typ, v.offset, v.dec), + offset: field.Offset, + isTaggedKey: v.isTaggedKey, + key: k, + keyLen: int64(len(k)), + err: fieldSetErr, + } + allFields = append(allFields, fieldSet) + } + } else { + fieldSet := &structFieldSet{ + dec: pdec, + offset: field.Offset, + isTaggedKey: tag.IsTaggedKey, + key: field.Name, + keyLen: int64(len(field.Name)), + } + allFields = append(allFields, fieldSet) + } + } else { + fieldSet := &structFieldSet{ + dec: dec, + offset: field.Offset, + isTaggedKey: tag.IsTaggedKey, + key: field.Name, + keyLen: int64(len(field.Name)), + } + allFields = append(allFields, fieldSet) + } + } else { + if tag.IsString && isStringTagSupportedType(runtime.Type2RType(field.Type)) { + dec = newWrappedStringDecoder(runtime.Type2RType(field.Type), dec, structName, field.Name) + } + var key string + if tag.Key != "" { + key = tag.Key + } else { + key = field.Name + } + fieldSet := &structFieldSet{ + dec: dec, + offset: field.Offset, + isTaggedKey: tag.IsTaggedKey, + key: key, + keyLen: int64(len(key)), + } + allFields = append(allFields, fieldSet) + } + } + for _, set := range filterDuplicatedFields(allFields) { + fieldMap[set.key] = set + lower := strings.ToLower(set.key) + if _, exists := fieldMap[lower]; !exists { + // first win + fieldMap[lower] = set + } + } + delete(structTypeToDecoder, typeptr) + structDec.tryOptimize() + return structDec, nil +} + +func filterDuplicatedFields(allFields []*structFieldSet) []*structFieldSet { + fieldMap := map[string][]*structFieldSet{} + for _, field := range allFields { + fieldMap[field.key] = append(fieldMap[field.key], field) + } + duplicatedFieldMap := map[string]struct{}{} + for k, sets := range fieldMap { + sets = filterFieldSets(sets) + if len(sets) != 1 { + duplicatedFieldMap[k] = struct{}{} + } + } + + filtered := make([]*structFieldSet, 0, len(allFields)) + for _, field := range allFields { + if _, exists := duplicatedFieldMap[field.key]; exists { + continue + } + filtered = append(filtered, field) + } + return filtered +} + +func filterFieldSets(sets []*structFieldSet) []*structFieldSet { + if len(sets) == 1 { + return sets + } + filtered := make([]*structFieldSet, 0, len(sets)) + for _, set := range sets { + if set.isTaggedKey { + filtered = append(filtered, set) + } + } + return filtered +} + +func implementsUnmarshalJSONType(typ *runtime.Type) bool { + return typ.Implements(unmarshalJSONType) || typ.Implements(unmarshalJSONContextType) +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/compile_norace.go b/vendor/github.com/goccy/go-json/internal/decoder/compile_norace.go new file mode 100644 index 000000000..eb7e2b134 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/compile_norace.go @@ -0,0 +1,29 @@ +//go:build !race +// +build !race + +package decoder + +import ( + "unsafe" + + "github.com/goccy/go-json/internal/runtime" +) + +func CompileToGetDecoder(typ *runtime.Type) (Decoder, error) { + typeptr := uintptr(unsafe.Pointer(typ)) + if typeptr > typeAddr.MaxTypeAddr { + return compileToGetDecoderSlowPath(typeptr, typ) + } + + index := (typeptr - typeAddr.BaseTypeAddr) >> typeAddr.AddrShift + if dec := cachedDecoder[index]; dec != nil { + return dec, nil + } + + dec, err := compileHead(typ, map[uintptr]Decoder{}) + if err != nil { + return nil, err + } + cachedDecoder[index] = dec + return dec, nil +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/compile_race.go b/vendor/github.com/goccy/go-json/internal/decoder/compile_race.go new file mode 100644 index 000000000..49cdda4a1 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/compile_race.go @@ -0,0 +1,37 @@ +//go:build race +// +build race + +package decoder + +import ( + "sync" + "unsafe" + + "github.com/goccy/go-json/internal/runtime" +) + +var decMu sync.RWMutex + +func CompileToGetDecoder(typ *runtime.Type) (Decoder, error) { + typeptr := uintptr(unsafe.Pointer(typ)) + if typeptr > typeAddr.MaxTypeAddr { + return compileToGetDecoderSlowPath(typeptr, typ) + } + + index := (typeptr - typeAddr.BaseTypeAddr) >> typeAddr.AddrShift + decMu.RLock() + if dec := cachedDecoder[index]; dec != nil { + decMu.RUnlock() + return dec, nil + } + decMu.RUnlock() + + dec, err := compileHead(typ, map[uintptr]Decoder{}) + if err != nil { + return nil, err + } + decMu.Lock() + cachedDecoder[index] = dec + decMu.Unlock() + return dec, nil +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/context.go b/vendor/github.com/goccy/go-json/internal/decoder/context.go new file mode 100644 index 000000000..cb2ffdafd --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/context.go @@ -0,0 +1,254 @@ +package decoder + +import ( + "sync" + "unsafe" + + "github.com/goccy/go-json/internal/errors" +) + +type RuntimeContext struct { + Buf []byte + Option *Option +} + +var ( + runtimeContextPool = sync.Pool{ + New: func() interface{} { + return &RuntimeContext{ + Option: &Option{}, + } + }, + } +) + +func TakeRuntimeContext() *RuntimeContext { + return runtimeContextPool.Get().(*RuntimeContext) +} + +func ReleaseRuntimeContext(ctx *RuntimeContext) { + runtimeContextPool.Put(ctx) +} + +var ( + isWhiteSpace = [256]bool{} +) + +func init() { + isWhiteSpace[' '] = true + isWhiteSpace['\n'] = true + isWhiteSpace['\t'] = true + isWhiteSpace['\r'] = true +} + +func char(ptr unsafe.Pointer, offset int64) byte { + return *(*byte)(unsafe.Pointer(uintptr(ptr) + uintptr(offset))) +} + +func skipWhiteSpace(buf []byte, cursor int64) int64 { + for isWhiteSpace[buf[cursor]] { + cursor++ + } + return cursor +} + +func skipObject(buf []byte, cursor, depth int64) (int64, error) { + braceCount := 1 + for { + switch buf[cursor] { + case '{': + braceCount++ + depth++ + if depth > maxDecodeNestingDepth { + return 0, errors.ErrExceededMaxDepth(buf[cursor], cursor) + } + case '}': + depth-- + braceCount-- + if braceCount == 0 { + return cursor + 1, nil + } + case '[': + depth++ + if depth > maxDecodeNestingDepth { + return 0, errors.ErrExceededMaxDepth(buf[cursor], cursor) + } + case ']': + depth-- + case '"': + for { + cursor++ + switch buf[cursor] { + case '\\': + cursor++ + if buf[cursor] == nul { + return 0, errors.ErrUnexpectedEndOfJSON("string of object", cursor) + } + case '"': + goto SWITCH_OUT + case nul: + return 0, errors.ErrUnexpectedEndOfJSON("string of object", cursor) + } + } + case nul: + return 0, errors.ErrUnexpectedEndOfJSON("object of object", cursor) + } + SWITCH_OUT: + cursor++ + } +} + +func skipArray(buf []byte, cursor, depth int64) (int64, error) { + bracketCount := 1 + for { + switch buf[cursor] { + case '[': + bracketCount++ + depth++ + if depth > maxDecodeNestingDepth { + return 0, errors.ErrExceededMaxDepth(buf[cursor], cursor) + } + case ']': + bracketCount-- + depth-- + if bracketCount == 0 { + return cursor + 1, nil + } + case '{': + depth++ + if depth > maxDecodeNestingDepth { + return 0, errors.ErrExceededMaxDepth(buf[cursor], cursor) + } + case '}': + depth-- + case '"': + for { + cursor++ + switch buf[cursor] { + case '\\': + cursor++ + if buf[cursor] == nul { + return 0, errors.ErrUnexpectedEndOfJSON("string of object", cursor) + } + case '"': + goto SWITCH_OUT + case nul: + return 0, errors.ErrUnexpectedEndOfJSON("string of object", cursor) + } + } + case nul: + return 0, errors.ErrUnexpectedEndOfJSON("array of object", cursor) + } + SWITCH_OUT: + cursor++ + } +} + +func skipValue(buf []byte, cursor, depth int64) (int64, error) { + for { + switch buf[cursor] { + case ' ', '\t', '\n', '\r': + cursor++ + continue + case '{': + return skipObject(buf, cursor+1, depth+1) + case '[': + return skipArray(buf, cursor+1, depth+1) + case '"': + for { + cursor++ + switch buf[cursor] { + case '\\': + cursor++ + if buf[cursor] == nul { + return 0, errors.ErrUnexpectedEndOfJSON("string of object", cursor) + } + case '"': + return cursor + 1, nil + case nul: + return 0, errors.ErrUnexpectedEndOfJSON("string of object", cursor) + } + } + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + for { + cursor++ + if floatTable[buf[cursor]] { + continue + } + break + } + return cursor, nil + case 't': + if err := validateTrue(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + return cursor, nil + case 'f': + if err := validateFalse(buf, cursor); err != nil { + return 0, err + } + cursor += 5 + return cursor, nil + case 'n': + if err := validateNull(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + return cursor, nil + default: + return cursor, errors.ErrUnexpectedEndOfJSON("null", cursor) + } + } +} + +func validateTrue(buf []byte, cursor int64) error { + if cursor+3 >= int64(len(buf)) { + return errors.ErrUnexpectedEndOfJSON("true", cursor) + } + if buf[cursor+1] != 'r' { + return errors.ErrInvalidCharacter(buf[cursor+1], "true", cursor) + } + if buf[cursor+2] != 'u' { + return errors.ErrInvalidCharacter(buf[cursor+2], "true", cursor) + } + if buf[cursor+3] != 'e' { + return errors.ErrInvalidCharacter(buf[cursor+3], "true", cursor) + } + return nil +} + +func validateFalse(buf []byte, cursor int64) error { + if cursor+4 >= int64(len(buf)) { + return errors.ErrUnexpectedEndOfJSON("false", cursor) + } + if buf[cursor+1] != 'a' { + return errors.ErrInvalidCharacter(buf[cursor+1], "false", cursor) + } + if buf[cursor+2] != 'l' { + return errors.ErrInvalidCharacter(buf[cursor+2], "false", cursor) + } + if buf[cursor+3] != 's' { + return errors.ErrInvalidCharacter(buf[cursor+3], "false", cursor) + } + if buf[cursor+4] != 'e' { + return errors.ErrInvalidCharacter(buf[cursor+4], "false", cursor) + } + return nil +} + +func validateNull(buf []byte, cursor int64) error { + if cursor+3 >= int64(len(buf)) { + return errors.ErrUnexpectedEndOfJSON("null", cursor) + } + if buf[cursor+1] != 'u' { + return errors.ErrInvalidCharacter(buf[cursor+1], "null", cursor) + } + if buf[cursor+2] != 'l' { + return errors.ErrInvalidCharacter(buf[cursor+2], "null", cursor) + } + if buf[cursor+3] != 'l' { + return errors.ErrInvalidCharacter(buf[cursor+3], "null", cursor) + } + return nil +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/float.go b/vendor/github.com/goccy/go-json/internal/decoder/float.go new file mode 100644 index 000000000..9b2eb8b35 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/float.go @@ -0,0 +1,170 @@ +package decoder + +import ( + "strconv" + "unsafe" + + "github.com/goccy/go-json/internal/errors" +) + +type floatDecoder struct { + op func(unsafe.Pointer, float64) + structName string + fieldName string +} + +func newFloatDecoder(structName, fieldName string, op func(unsafe.Pointer, float64)) *floatDecoder { + return &floatDecoder{op: op, structName: structName, fieldName: fieldName} +} + +var ( + floatTable = [256]bool{ + '0': true, + '1': true, + '2': true, + '3': true, + '4': true, + '5': true, + '6': true, + '7': true, + '8': true, + '9': true, + '.': true, + 'e': true, + 'E': true, + '+': true, + '-': true, + } + + validEndNumberChar = [256]bool{ + nul: true, + ' ': true, + '\t': true, + '\r': true, + '\n': true, + ',': true, + ':': true, + '}': true, + ']': true, + } +) + +func floatBytes(s *Stream) []byte { + start := s.cursor + for { + s.cursor++ + if floatTable[s.char()] { + continue + } else if s.char() == nul { + if s.read() { + s.cursor-- // for retry current character + continue + } + } + break + } + return s.buf[start:s.cursor] +} + +func (d *floatDecoder) decodeStreamByte(s *Stream) ([]byte, error) { + for { + switch s.char() { + case ' ', '\n', '\t', '\r': + s.cursor++ + continue + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return floatBytes(s), nil + case 'n': + if err := nullBytes(s); err != nil { + return nil, err + } + return nil, nil + case nul: + if s.read() { + continue + } + goto ERROR + default: + goto ERROR + } + } +ERROR: + return nil, errors.ErrUnexpectedEndOfJSON("float", s.totalOffset()) +} + +func (d *floatDecoder) decodeByte(buf []byte, cursor int64) ([]byte, int64, error) { + for { + switch buf[cursor] { + case ' ', '\n', '\t', '\r': + cursor++ + continue + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + start := cursor + cursor++ + for floatTable[buf[cursor]] { + cursor++ + } + num := buf[start:cursor] + return num, cursor, nil + case 'n': + if err := validateNull(buf, cursor); err != nil { + return nil, 0, err + } + cursor += 4 + return nil, cursor, nil + default: + return nil, 0, errors.ErrUnexpectedEndOfJSON("float", cursor) + } + } +} + +func (d *floatDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + bytes, err := d.decodeStreamByte(s) + if err != nil { + return err + } + if bytes == nil { + return nil + } + str := *(*string)(unsafe.Pointer(&bytes)) + f64, err := strconv.ParseFloat(str, 64) + if err != nil { + return errors.ErrSyntax(err.Error(), s.totalOffset()) + } + d.op(p, f64) + return nil +} + +func (d *floatDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + bytes, c, err := d.decodeByte(buf, cursor) + if err != nil { + return 0, err + } + if bytes == nil { + return c, nil + } + cursor = c + if !validEndNumberChar[buf[cursor]] { + return 0, errors.ErrUnexpectedEndOfJSON("float", cursor) + } + s := *(*string)(unsafe.Pointer(&bytes)) + f64, err := strconv.ParseFloat(s, 64) + if err != nil { + return 0, errors.ErrSyntax(err.Error(), cursor) + } + d.op(p, f64) + return cursor, nil +} + +func (d *floatDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + buf := ctx.Buf + bytes, c, err := d.decodeByte(buf, cursor) + if err != nil { + return nil, 0, err + } + if bytes == nil { + return [][]byte{nullbytes}, c, nil + } + return [][]byte{bytes}, c, nil +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/func.go b/vendor/github.com/goccy/go-json/internal/decoder/func.go new file mode 100644 index 000000000..4cc12ca81 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/func.go @@ -0,0 +1,146 @@ +package decoder + +import ( + "bytes" + "fmt" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type funcDecoder struct { + typ *runtime.Type + structName string + fieldName string +} + +func newFuncDecoder(typ *runtime.Type, structName, fieldName string) *funcDecoder { + fnDecoder := &funcDecoder{typ, structName, fieldName} + return fnDecoder +} + +func (d *funcDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + s.skipWhiteSpace() + start := s.cursor + if err := s.skipValue(depth); err != nil { + return err + } + src := s.buf[start:s.cursor] + if len(src) > 0 { + switch src[0] { + case '"': + return &errors.UnmarshalTypeError{ + Value: "string", + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + } + case '[': + return &errors.UnmarshalTypeError{ + Value: "array", + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + } + case '{': + return &errors.UnmarshalTypeError{ + Value: "object", + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + } + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return &errors.UnmarshalTypeError{ + Value: "number", + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + } + case 'n': + if err := nullBytes(s); err != nil { + return err + } + *(*unsafe.Pointer)(p) = nil + return nil + case 't': + if err := trueBytes(s); err == nil { + return &errors.UnmarshalTypeError{ + Value: "boolean", + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + } + } + case 'f': + if err := falseBytes(s); err == nil { + return &errors.UnmarshalTypeError{ + Value: "boolean", + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + } + } + } + } + return errors.ErrInvalidBeginningOfValue(s.buf[s.cursor], s.totalOffset()) +} + +func (d *funcDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + cursor = skipWhiteSpace(buf, cursor) + start := cursor + end, err := skipValue(buf, cursor, depth) + if err != nil { + return 0, err + } + src := buf[start:end] + if len(src) > 0 { + switch src[0] { + case '"': + return 0, &errors.UnmarshalTypeError{ + Value: "string", + Type: runtime.RType2Type(d.typ), + Offset: start, + } + case '[': + return 0, &errors.UnmarshalTypeError{ + Value: "array", + Type: runtime.RType2Type(d.typ), + Offset: start, + } + case '{': + return 0, &errors.UnmarshalTypeError{ + Value: "object", + Type: runtime.RType2Type(d.typ), + Offset: start, + } + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return 0, &errors.UnmarshalTypeError{ + Value: "number", + Type: runtime.RType2Type(d.typ), + Offset: start, + } + case 'n': + if bytes.Equal(src, nullbytes) { + *(*unsafe.Pointer)(p) = nil + return end, nil + } + case 't': + if err := validateTrue(buf, start); err == nil { + return 0, &errors.UnmarshalTypeError{ + Value: "boolean", + Type: runtime.RType2Type(d.typ), + Offset: start, + } + } + case 'f': + if err := validateFalse(buf, start); err == nil { + return 0, &errors.UnmarshalTypeError{ + Value: "boolean", + Type: runtime.RType2Type(d.typ), + Offset: start, + } + } + } + } + return cursor, errors.ErrInvalidBeginningOfValue(buf[cursor], cursor) +} + +func (d *funcDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: func decoder does not support decode path") +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/int.go b/vendor/github.com/goccy/go-json/internal/decoder/int.go new file mode 100644 index 000000000..1a7f08199 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/int.go @@ -0,0 +1,246 @@ +package decoder + +import ( + "fmt" + "reflect" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type intDecoder struct { + typ *runtime.Type + kind reflect.Kind + op func(unsafe.Pointer, int64) + structName string + fieldName string +} + +func newIntDecoder(typ *runtime.Type, structName, fieldName string, op func(unsafe.Pointer, int64)) *intDecoder { + return &intDecoder{ + typ: typ, + kind: typ.Kind(), + op: op, + structName: structName, + fieldName: fieldName, + } +} + +func (d *intDecoder) typeError(buf []byte, offset int64) *errors.UnmarshalTypeError { + return &errors.UnmarshalTypeError{ + Value: fmt.Sprintf("number %s", string(buf)), + Type: runtime.RType2Type(d.typ), + Struct: d.structName, + Field: d.fieldName, + Offset: offset, + } +} + +var ( + pow10i64 = [...]int64{ + 1e00, 1e01, 1e02, 1e03, 1e04, 1e05, 1e06, 1e07, 1e08, 1e09, + 1e10, 1e11, 1e12, 1e13, 1e14, 1e15, 1e16, 1e17, 1e18, + } + pow10i64Len = len(pow10i64) +) + +func (d *intDecoder) parseInt(b []byte) (int64, error) { + isNegative := false + if b[0] == '-' { + b = b[1:] + isNegative = true + } + maxDigit := len(b) + if maxDigit > pow10i64Len { + return 0, fmt.Errorf("invalid length of number") + } + sum := int64(0) + for i := 0; i < maxDigit; i++ { + c := int64(b[i]) - 48 + digitValue := pow10i64[maxDigit-i-1] + sum += c * digitValue + } + if isNegative { + return -1 * sum, nil + } + return sum, nil +} + +var ( + numTable = [256]bool{ + '0': true, + '1': true, + '2': true, + '3': true, + '4': true, + '5': true, + '6': true, + '7': true, + '8': true, + '9': true, + } +) + +var ( + numZeroBuf = []byte{'0'} +) + +func (d *intDecoder) decodeStreamByte(s *Stream) ([]byte, error) { + for { + switch s.char() { + case ' ', '\n', '\t', '\r': + s.cursor++ + continue + case '-': + start := s.cursor + for { + s.cursor++ + if numTable[s.char()] { + continue + } else if s.char() == nul { + if s.read() { + s.cursor-- // for retry current character + continue + } + } + break + } + num := s.buf[start:s.cursor] + if len(num) < 2 { + goto ERROR + } + return num, nil + case '0': + s.cursor++ + return numZeroBuf, nil + case '1', '2', '3', '4', '5', '6', '7', '8', '9': + start := s.cursor + for { + s.cursor++ + if numTable[s.char()] { + continue + } else if s.char() == nul { + if s.read() { + s.cursor-- // for retry current character + continue + } + } + break + } + num := s.buf[start:s.cursor] + return num, nil + case 'n': + if err := nullBytes(s); err != nil { + return nil, err + } + return nil, nil + case nul: + if s.read() { + continue + } + goto ERROR + default: + return nil, d.typeError([]byte{s.char()}, s.totalOffset()) + } + } +ERROR: + return nil, errors.ErrUnexpectedEndOfJSON("number(integer)", s.totalOffset()) +} + +func (d *intDecoder) decodeByte(buf []byte, cursor int64) ([]byte, int64, error) { + b := (*sliceHeader)(unsafe.Pointer(&buf)).data + for { + switch char(b, cursor) { + case ' ', '\n', '\t', '\r': + cursor++ + continue + case '0': + cursor++ + return numZeroBuf, cursor, nil + case '-', '1', '2', '3', '4', '5', '6', '7', '8', '9': + start := cursor + cursor++ + for numTable[char(b, cursor)] { + cursor++ + } + num := buf[start:cursor] + return num, cursor, nil + case 'n': + if err := validateNull(buf, cursor); err != nil { + return nil, 0, err + } + cursor += 4 + return nil, cursor, nil + default: + return nil, 0, d.typeError([]byte{char(b, cursor)}, cursor) + } + } +} + +func (d *intDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + bytes, err := d.decodeStreamByte(s) + if err != nil { + return err + } + if bytes == nil { + return nil + } + i64, err := d.parseInt(bytes) + if err != nil { + return d.typeError(bytes, s.totalOffset()) + } + switch d.kind { + case reflect.Int8: + if i64 < -1*(1<<7) || (1<<7) <= i64 { + return d.typeError(bytes, s.totalOffset()) + } + case reflect.Int16: + if i64 < -1*(1<<15) || (1<<15) <= i64 { + return d.typeError(bytes, s.totalOffset()) + } + case reflect.Int32: + if i64 < -1*(1<<31) || (1<<31) <= i64 { + return d.typeError(bytes, s.totalOffset()) + } + } + d.op(p, i64) + s.reset() + return nil +} + +func (d *intDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + bytes, c, err := d.decodeByte(ctx.Buf, cursor) + if err != nil { + return 0, err + } + if bytes == nil { + return c, nil + } + cursor = c + + i64, err := d.parseInt(bytes) + if err != nil { + return 0, d.typeError(bytes, cursor) + } + switch d.kind { + case reflect.Int8: + if i64 < -1*(1<<7) || (1<<7) <= i64 { + return 0, d.typeError(bytes, cursor) + } + case reflect.Int16: + if i64 < -1*(1<<15) || (1<<15) <= i64 { + return 0, d.typeError(bytes, cursor) + } + case reflect.Int32: + if i64 < -1*(1<<31) || (1<<31) <= i64 { + return 0, d.typeError(bytes, cursor) + } + } + d.op(p, i64) + return cursor, nil +} + +func (d *intDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: int decoder does not support decode path") +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/interface.go b/vendor/github.com/goccy/go-json/internal/decoder/interface.go new file mode 100644 index 000000000..45c69ab8c --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/interface.go @@ -0,0 +1,528 @@ +package decoder + +import ( + "bytes" + "encoding" + "encoding/json" + "reflect" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type interfaceDecoder struct { + typ *runtime.Type + structName string + fieldName string + sliceDecoder *sliceDecoder + mapDecoder *mapDecoder + floatDecoder *floatDecoder + numberDecoder *numberDecoder + stringDecoder *stringDecoder +} + +func newEmptyInterfaceDecoder(structName, fieldName string) *interfaceDecoder { + ifaceDecoder := &interfaceDecoder{ + typ: emptyInterfaceType, + structName: structName, + fieldName: fieldName, + floatDecoder: newFloatDecoder(structName, fieldName, func(p unsafe.Pointer, v float64) { + *(*interface{})(p) = v + }), + numberDecoder: newNumberDecoder(structName, fieldName, func(p unsafe.Pointer, v json.Number) { + *(*interface{})(p) = v + }), + stringDecoder: newStringDecoder(structName, fieldName), + } + ifaceDecoder.sliceDecoder = newSliceDecoder( + ifaceDecoder, + emptyInterfaceType, + emptyInterfaceType.Size(), + structName, fieldName, + ) + ifaceDecoder.mapDecoder = newMapDecoder( + interfaceMapType, + stringType, + ifaceDecoder.stringDecoder, + interfaceMapType.Elem(), + ifaceDecoder, + structName, + fieldName, + ) + return ifaceDecoder +} + +func newInterfaceDecoder(typ *runtime.Type, structName, fieldName string) *interfaceDecoder { + emptyIfaceDecoder := newEmptyInterfaceDecoder(structName, fieldName) + stringDecoder := newStringDecoder(structName, fieldName) + return &interfaceDecoder{ + typ: typ, + structName: structName, + fieldName: fieldName, + sliceDecoder: newSliceDecoder( + emptyIfaceDecoder, + emptyInterfaceType, + emptyInterfaceType.Size(), + structName, fieldName, + ), + mapDecoder: newMapDecoder( + interfaceMapType, + stringType, + stringDecoder, + interfaceMapType.Elem(), + emptyIfaceDecoder, + structName, + fieldName, + ), + floatDecoder: newFloatDecoder(structName, fieldName, func(p unsafe.Pointer, v float64) { + *(*interface{})(p) = v + }), + numberDecoder: newNumberDecoder(structName, fieldName, func(p unsafe.Pointer, v json.Number) { + *(*interface{})(p) = v + }), + stringDecoder: stringDecoder, + } +} + +func (d *interfaceDecoder) numDecoder(s *Stream) Decoder { + if s.UseNumber { + return d.numberDecoder + } + return d.floatDecoder +} + +var ( + emptyInterfaceType = runtime.Type2RType(reflect.TypeOf((*interface{})(nil)).Elem()) + EmptyInterfaceType = emptyInterfaceType + interfaceMapType = runtime.Type2RType( + reflect.TypeOf((*map[string]interface{})(nil)).Elem(), + ) + stringType = runtime.Type2RType( + reflect.TypeOf(""), + ) +) + +func decodeStreamUnmarshaler(s *Stream, depth int64, unmarshaler json.Unmarshaler) error { + start := s.cursor + if err := s.skipValue(depth); err != nil { + return err + } + src := s.buf[start:s.cursor] + dst := make([]byte, len(src)) + copy(dst, src) + + if err := unmarshaler.UnmarshalJSON(dst); err != nil { + return err + } + return nil +} + +func decodeStreamUnmarshalerContext(s *Stream, depth int64, unmarshaler unmarshalerContext) error { + start := s.cursor + if err := s.skipValue(depth); err != nil { + return err + } + src := s.buf[start:s.cursor] + dst := make([]byte, len(src)) + copy(dst, src) + + if err := unmarshaler.UnmarshalJSON(s.Option.Context, dst); err != nil { + return err + } + return nil +} + +func decodeUnmarshaler(buf []byte, cursor, depth int64, unmarshaler json.Unmarshaler) (int64, error) { + cursor = skipWhiteSpace(buf, cursor) + start := cursor + end, err := skipValue(buf, cursor, depth) + if err != nil { + return 0, err + } + src := buf[start:end] + dst := make([]byte, len(src)) + copy(dst, src) + + if err := unmarshaler.UnmarshalJSON(dst); err != nil { + return 0, err + } + return end, nil +} + +func decodeUnmarshalerContext(ctx *RuntimeContext, buf []byte, cursor, depth int64, unmarshaler unmarshalerContext) (int64, error) { + cursor = skipWhiteSpace(buf, cursor) + start := cursor + end, err := skipValue(buf, cursor, depth) + if err != nil { + return 0, err + } + src := buf[start:end] + dst := make([]byte, len(src)) + copy(dst, src) + + if err := unmarshaler.UnmarshalJSON(ctx.Option.Context, dst); err != nil { + return 0, err + } + return end, nil +} + +func decodeStreamTextUnmarshaler(s *Stream, depth int64, unmarshaler encoding.TextUnmarshaler, p unsafe.Pointer) error { + start := s.cursor + if err := s.skipValue(depth); err != nil { + return err + } + src := s.buf[start:s.cursor] + if bytes.Equal(src, nullbytes) { + *(*unsafe.Pointer)(p) = nil + return nil + } + + dst := make([]byte, len(src)) + copy(dst, src) + + if err := unmarshaler.UnmarshalText(dst); err != nil { + return err + } + return nil +} + +func decodeTextUnmarshaler(buf []byte, cursor, depth int64, unmarshaler encoding.TextUnmarshaler, p unsafe.Pointer) (int64, error) { + cursor = skipWhiteSpace(buf, cursor) + start := cursor + end, err := skipValue(buf, cursor, depth) + if err != nil { + return 0, err + } + src := buf[start:end] + if bytes.Equal(src, nullbytes) { + *(*unsafe.Pointer)(p) = nil + return end, nil + } + if s, ok := unquoteBytes(src); ok { + src = s + } + if err := unmarshaler.UnmarshalText(src); err != nil { + return 0, err + } + return end, nil +} + +func (d *interfaceDecoder) decodeStreamEmptyInterface(s *Stream, depth int64, p unsafe.Pointer) error { + c := s.skipWhiteSpace() + for { + switch c { + case '{': + var v map[string]interface{} + ptr := unsafe.Pointer(&v) + if err := d.mapDecoder.DecodeStream(s, depth, ptr); err != nil { + return err + } + *(*interface{})(p) = v + return nil + case '[': + var v []interface{} + ptr := unsafe.Pointer(&v) + if err := d.sliceDecoder.DecodeStream(s, depth, ptr); err != nil { + return err + } + *(*interface{})(p) = v + return nil + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return d.numDecoder(s).DecodeStream(s, depth, p) + case '"': + s.cursor++ + start := s.cursor + for { + switch s.char() { + case '\\': + if _, err := decodeEscapeString(s, nil); err != nil { + return err + } + case '"': + literal := s.buf[start:s.cursor] + s.cursor++ + *(*interface{})(p) = string(literal) + return nil + case nul: + if s.read() { + continue + } + return errors.ErrUnexpectedEndOfJSON("string", s.totalOffset()) + } + s.cursor++ + } + case 't': + if err := trueBytes(s); err != nil { + return err + } + **(**interface{})(unsafe.Pointer(&p)) = true + return nil + case 'f': + if err := falseBytes(s); err != nil { + return err + } + **(**interface{})(unsafe.Pointer(&p)) = false + return nil + case 'n': + if err := nullBytes(s); err != nil { + return err + } + *(*interface{})(p) = nil + return nil + case nul: + if s.read() { + c = s.char() + continue + } + } + break + } + return errors.ErrInvalidBeginningOfValue(c, s.totalOffset()) +} + +type emptyInterface struct { + typ *runtime.Type + ptr unsafe.Pointer +} + +func (d *interfaceDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + runtimeInterfaceValue := *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: d.typ, + ptr: p, + })) + rv := reflect.ValueOf(runtimeInterfaceValue) + if rv.NumMethod() > 0 && rv.CanInterface() { + if u, ok := rv.Interface().(unmarshalerContext); ok { + return decodeStreamUnmarshalerContext(s, depth, u) + } + if u, ok := rv.Interface().(json.Unmarshaler); ok { + return decodeStreamUnmarshaler(s, depth, u) + } + if u, ok := rv.Interface().(encoding.TextUnmarshaler); ok { + return decodeStreamTextUnmarshaler(s, depth, u, p) + } + if s.skipWhiteSpace() == 'n' { + if err := nullBytes(s); err != nil { + return err + } + *(*interface{})(p) = nil + return nil + } + return d.errUnmarshalType(rv.Type(), s.totalOffset()) + } + iface := rv.Interface() + ifaceHeader := (*emptyInterface)(unsafe.Pointer(&iface)) + typ := ifaceHeader.typ + if ifaceHeader.ptr == nil || d.typ == typ || typ == nil { + // concrete type is empty interface + return d.decodeStreamEmptyInterface(s, depth, p) + } + if typ.Kind() == reflect.Ptr && typ.Elem() == d.typ || typ.Kind() != reflect.Ptr { + return d.decodeStreamEmptyInterface(s, depth, p) + } + if s.skipWhiteSpace() == 'n' { + if err := nullBytes(s); err != nil { + return err + } + *(*interface{})(p) = nil + return nil + } + decoder, err := CompileToGetDecoder(typ) + if err != nil { + return err + } + return decoder.DecodeStream(s, depth, ifaceHeader.ptr) +} + +func (d *interfaceDecoder) errUnmarshalType(typ reflect.Type, offset int64) *errors.UnmarshalTypeError { + return &errors.UnmarshalTypeError{ + Value: typ.String(), + Type: typ, + Offset: offset, + Struct: d.structName, + Field: d.fieldName, + } +} + +func (d *interfaceDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + runtimeInterfaceValue := *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: d.typ, + ptr: p, + })) + rv := reflect.ValueOf(runtimeInterfaceValue) + if rv.NumMethod() > 0 && rv.CanInterface() { + if u, ok := rv.Interface().(unmarshalerContext); ok { + return decodeUnmarshalerContext(ctx, buf, cursor, depth, u) + } + if u, ok := rv.Interface().(json.Unmarshaler); ok { + return decodeUnmarshaler(buf, cursor, depth, u) + } + if u, ok := rv.Interface().(encoding.TextUnmarshaler); ok { + return decodeTextUnmarshaler(buf, cursor, depth, u, p) + } + cursor = skipWhiteSpace(buf, cursor) + if buf[cursor] == 'n' { + if err := validateNull(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + **(**interface{})(unsafe.Pointer(&p)) = nil + return cursor, nil + } + return 0, d.errUnmarshalType(rv.Type(), cursor) + } + + iface := rv.Interface() + ifaceHeader := (*emptyInterface)(unsafe.Pointer(&iface)) + typ := ifaceHeader.typ + if ifaceHeader.ptr == nil || d.typ == typ || typ == nil { + // concrete type is empty interface + return d.decodeEmptyInterface(ctx, cursor, depth, p) + } + if typ.Kind() == reflect.Ptr && typ.Elem() == d.typ || typ.Kind() != reflect.Ptr { + return d.decodeEmptyInterface(ctx, cursor, depth, p) + } + cursor = skipWhiteSpace(buf, cursor) + if buf[cursor] == 'n' { + if err := validateNull(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + **(**interface{})(unsafe.Pointer(&p)) = nil + return cursor, nil + } + decoder, err := CompileToGetDecoder(typ) + if err != nil { + return 0, err + } + return decoder.Decode(ctx, cursor, depth, ifaceHeader.ptr) +} + +func (d *interfaceDecoder) decodeEmptyInterface(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + cursor = skipWhiteSpace(buf, cursor) + switch buf[cursor] { + case '{': + var v map[string]interface{} + ptr := unsafe.Pointer(&v) + cursor, err := d.mapDecoder.Decode(ctx, cursor, depth, ptr) + if err != nil { + return 0, err + } + **(**interface{})(unsafe.Pointer(&p)) = v + return cursor, nil + case '[': + var v []interface{} + ptr := unsafe.Pointer(&v) + cursor, err := d.sliceDecoder.Decode(ctx, cursor, depth, ptr) + if err != nil { + return 0, err + } + **(**interface{})(unsafe.Pointer(&p)) = v + return cursor, nil + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return d.floatDecoder.Decode(ctx, cursor, depth, p) + case '"': + var v string + ptr := unsafe.Pointer(&v) + cursor, err := d.stringDecoder.Decode(ctx, cursor, depth, ptr) + if err != nil { + return 0, err + } + **(**interface{})(unsafe.Pointer(&p)) = v + return cursor, nil + case 't': + if err := validateTrue(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + **(**interface{})(unsafe.Pointer(&p)) = true + return cursor, nil + case 'f': + if err := validateFalse(buf, cursor); err != nil { + return 0, err + } + cursor += 5 + **(**interface{})(unsafe.Pointer(&p)) = false + return cursor, nil + case 'n': + if err := validateNull(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + **(**interface{})(unsafe.Pointer(&p)) = nil + return cursor, nil + } + return cursor, errors.ErrInvalidBeginningOfValue(buf[cursor], cursor) +} + +func NewPathDecoder() Decoder { + ifaceDecoder := &interfaceDecoder{ + typ: emptyInterfaceType, + structName: "", + fieldName: "", + floatDecoder: newFloatDecoder("", "", func(p unsafe.Pointer, v float64) { + *(*interface{})(p) = v + }), + numberDecoder: newNumberDecoder("", "", func(p unsafe.Pointer, v json.Number) { + *(*interface{})(p) = v + }), + stringDecoder: newStringDecoder("", ""), + } + ifaceDecoder.sliceDecoder = newSliceDecoder( + ifaceDecoder, + emptyInterfaceType, + emptyInterfaceType.Size(), + "", "", + ) + ifaceDecoder.mapDecoder = newMapDecoder( + interfaceMapType, + stringType, + ifaceDecoder.stringDecoder, + interfaceMapType.Elem(), + ifaceDecoder, + "", "", + ) + return ifaceDecoder +} + +var ( + truebytes = []byte("true") + falsebytes = []byte("false") +) + +func (d *interfaceDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + buf := ctx.Buf + cursor = skipWhiteSpace(buf, cursor) + switch buf[cursor] { + case '{': + return d.mapDecoder.DecodePath(ctx, cursor, depth) + case '[': + return d.sliceDecoder.DecodePath(ctx, cursor, depth) + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return d.floatDecoder.DecodePath(ctx, cursor, depth) + case '"': + return d.stringDecoder.DecodePath(ctx, cursor, depth) + case 't': + if err := validateTrue(buf, cursor); err != nil { + return nil, 0, err + } + cursor += 4 + return [][]byte{truebytes}, cursor, nil + case 'f': + if err := validateFalse(buf, cursor); err != nil { + return nil, 0, err + } + cursor += 5 + return [][]byte{falsebytes}, cursor, nil + case 'n': + if err := validateNull(buf, cursor); err != nil { + return nil, 0, err + } + cursor += 4 + return [][]byte{nullbytes}, cursor, nil + } + return nil, cursor, errors.ErrInvalidBeginningOfValue(buf[cursor], cursor) +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/invalid.go b/vendor/github.com/goccy/go-json/internal/decoder/invalid.go new file mode 100644 index 000000000..4c9721b09 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/invalid.go @@ -0,0 +1,55 @@ +package decoder + +import ( + "reflect" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type invalidDecoder struct { + typ *runtime.Type + kind reflect.Kind + structName string + fieldName string +} + +func newInvalidDecoder(typ *runtime.Type, structName, fieldName string) *invalidDecoder { + return &invalidDecoder{ + typ: typ, + kind: typ.Kind(), + structName: structName, + fieldName: fieldName, + } +} + +func (d *invalidDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + return &errors.UnmarshalTypeError{ + Value: "object", + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + Struct: d.structName, + Field: d.fieldName, + } +} + +func (d *invalidDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + return 0, &errors.UnmarshalTypeError{ + Value: "object", + Type: runtime.RType2Type(d.typ), + Offset: cursor, + Struct: d.structName, + Field: d.fieldName, + } +} + +func (d *invalidDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, &errors.UnmarshalTypeError{ + Value: "object", + Type: runtime.RType2Type(d.typ), + Offset: cursor, + Struct: d.structName, + Field: d.fieldName, + } +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/map.go b/vendor/github.com/goccy/go-json/internal/decoder/map.go new file mode 100644 index 000000000..07a9caea6 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/map.go @@ -0,0 +1,280 @@ +package decoder + +import ( + "reflect" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type mapDecoder struct { + mapType *runtime.Type + keyType *runtime.Type + valueType *runtime.Type + canUseAssignFaststrType bool + keyDecoder Decoder + valueDecoder Decoder + structName string + fieldName string +} + +func newMapDecoder(mapType *runtime.Type, keyType *runtime.Type, keyDec Decoder, valueType *runtime.Type, valueDec Decoder, structName, fieldName string) *mapDecoder { + return &mapDecoder{ + mapType: mapType, + keyDecoder: keyDec, + keyType: keyType, + canUseAssignFaststrType: canUseAssignFaststrType(keyType, valueType), + valueType: valueType, + valueDecoder: valueDec, + structName: structName, + fieldName: fieldName, + } +} + +const ( + mapMaxElemSize = 128 +) + +// See detail: https://github.com/goccy/go-json/pull/283 +func canUseAssignFaststrType(key *runtime.Type, value *runtime.Type) bool { + indirectElem := value.Size() > mapMaxElemSize + if indirectElem { + return false + } + return key.Kind() == reflect.String +} + +//go:linkname makemap reflect.makemap +func makemap(*runtime.Type, int) unsafe.Pointer + +//nolint:golint +//go:linkname mapassign_faststr runtime.mapassign_faststr +//go:noescape +func mapassign_faststr(t *runtime.Type, m unsafe.Pointer, s string) unsafe.Pointer + +//go:linkname mapassign reflect.mapassign +//go:noescape +func mapassign(t *runtime.Type, m unsafe.Pointer, k, v unsafe.Pointer) + +func (d *mapDecoder) mapassign(t *runtime.Type, m, k, v unsafe.Pointer) { + if d.canUseAssignFaststrType { + mapV := mapassign_faststr(t, m, *(*string)(k)) + typedmemmove(d.valueType, mapV, v) + } else { + mapassign(t, m, k, v) + } +} + +func (d *mapDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + depth++ + if depth > maxDecodeNestingDepth { + return errors.ErrExceededMaxDepth(s.char(), s.cursor) + } + + switch s.skipWhiteSpace() { + case 'n': + if err := nullBytes(s); err != nil { + return err + } + **(**unsafe.Pointer)(unsafe.Pointer(&p)) = nil + return nil + case '{': + default: + return errors.ErrExpected("{ character for map value", s.totalOffset()) + } + mapValue := *(*unsafe.Pointer)(p) + if mapValue == nil { + mapValue = makemap(d.mapType, 0) + } + s.cursor++ + if s.skipWhiteSpace() == '}' { + *(*unsafe.Pointer)(p) = mapValue + s.cursor++ + return nil + } + for { + k := unsafe_New(d.keyType) + if err := d.keyDecoder.DecodeStream(s, depth, k); err != nil { + return err + } + s.skipWhiteSpace() + if !s.equalChar(':') { + return errors.ErrExpected("colon after object key", s.totalOffset()) + } + s.cursor++ + v := unsafe_New(d.valueType) + if err := d.valueDecoder.DecodeStream(s, depth, v); err != nil { + return err + } + d.mapassign(d.mapType, mapValue, k, v) + s.skipWhiteSpace() + if s.equalChar('}') { + **(**unsafe.Pointer)(unsafe.Pointer(&p)) = mapValue + s.cursor++ + return nil + } + if !s.equalChar(',') { + return errors.ErrExpected("comma after object value", s.totalOffset()) + } + s.cursor++ + } +} + +func (d *mapDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + depth++ + if depth > maxDecodeNestingDepth { + return 0, errors.ErrExceededMaxDepth(buf[cursor], cursor) + } + + cursor = skipWhiteSpace(buf, cursor) + buflen := int64(len(buf)) + if buflen < 2 { + return 0, errors.ErrExpected("{} for map", cursor) + } + switch buf[cursor] { + case 'n': + if err := validateNull(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + **(**unsafe.Pointer)(unsafe.Pointer(&p)) = nil + return cursor, nil + case '{': + default: + return 0, errors.ErrExpected("{ character for map value", cursor) + } + cursor++ + cursor = skipWhiteSpace(buf, cursor) + mapValue := *(*unsafe.Pointer)(p) + if mapValue == nil { + mapValue = makemap(d.mapType, 0) + } + if buf[cursor] == '}' { + **(**unsafe.Pointer)(unsafe.Pointer(&p)) = mapValue + cursor++ + return cursor, nil + } + for { + k := unsafe_New(d.keyType) + keyCursor, err := d.keyDecoder.Decode(ctx, cursor, depth, k) + if err != nil { + return 0, err + } + cursor = skipWhiteSpace(buf, keyCursor) + if buf[cursor] != ':' { + return 0, errors.ErrExpected("colon after object key", cursor) + } + cursor++ + v := unsafe_New(d.valueType) + valueCursor, err := d.valueDecoder.Decode(ctx, cursor, depth, v) + if err != nil { + return 0, err + } + d.mapassign(d.mapType, mapValue, k, v) + cursor = skipWhiteSpace(buf, valueCursor) + if buf[cursor] == '}' { + **(**unsafe.Pointer)(unsafe.Pointer(&p)) = mapValue + cursor++ + return cursor, nil + } + if buf[cursor] != ',' { + return 0, errors.ErrExpected("comma after object value", cursor) + } + cursor++ + } +} + +func (d *mapDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + buf := ctx.Buf + depth++ + if depth > maxDecodeNestingDepth { + return nil, 0, errors.ErrExceededMaxDepth(buf[cursor], cursor) + } + + cursor = skipWhiteSpace(buf, cursor) + buflen := int64(len(buf)) + if buflen < 2 { + return nil, 0, errors.ErrExpected("{} for map", cursor) + } + switch buf[cursor] { + case 'n': + if err := validateNull(buf, cursor); err != nil { + return nil, 0, err + } + cursor += 4 + return [][]byte{nullbytes}, cursor, nil + case '{': + default: + return nil, 0, errors.ErrExpected("{ character for map value", cursor) + } + cursor++ + cursor = skipWhiteSpace(buf, cursor) + if buf[cursor] == '}' { + cursor++ + return nil, cursor, nil + } + keyDecoder, ok := d.keyDecoder.(*stringDecoder) + if !ok { + return nil, 0, &errors.UnmarshalTypeError{ + Value: "string", + Type: reflect.TypeOf(""), + Offset: cursor, + Struct: d.structName, + Field: d.fieldName, + } + } + ret := [][]byte{} + for { + key, keyCursor, err := keyDecoder.decodeByte(buf, cursor) + if err != nil { + return nil, 0, err + } + cursor = skipWhiteSpace(buf, keyCursor) + if buf[cursor] != ':' { + return nil, 0, errors.ErrExpected("colon after object key", cursor) + } + cursor++ + child, found, err := ctx.Option.Path.Field(string(key)) + if err != nil { + return nil, 0, err + } + if found { + if child != nil { + oldPath := ctx.Option.Path.node + ctx.Option.Path.node = child + paths, c, err := d.valueDecoder.DecodePath(ctx, cursor, depth) + if err != nil { + return nil, 0, err + } + ctx.Option.Path.node = oldPath + ret = append(ret, paths...) + cursor = c + } else { + start := cursor + end, err := skipValue(buf, cursor, depth) + if err != nil { + return nil, 0, err + } + ret = append(ret, buf[start:end]) + cursor = end + } + } else { + c, err := skipValue(buf, cursor, depth) + if err != nil { + return nil, 0, err + } + cursor = c + } + cursor = skipWhiteSpace(buf, cursor) + if buf[cursor] == '}' { + cursor++ + return ret, cursor, nil + } + if buf[cursor] != ',' { + return nil, 0, errors.ErrExpected("comma after object value", cursor) + } + cursor++ + } +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/number.go b/vendor/github.com/goccy/go-json/internal/decoder/number.go new file mode 100644 index 000000000..10e5435e6 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/number.go @@ -0,0 +1,123 @@ +package decoder + +import ( + "encoding/json" + "strconv" + "unsafe" + + "github.com/goccy/go-json/internal/errors" +) + +type numberDecoder struct { + stringDecoder *stringDecoder + op func(unsafe.Pointer, json.Number) + structName string + fieldName string +} + +func newNumberDecoder(structName, fieldName string, op func(unsafe.Pointer, json.Number)) *numberDecoder { + return &numberDecoder{ + stringDecoder: newStringDecoder(structName, fieldName), + op: op, + structName: structName, + fieldName: fieldName, + } +} + +func (d *numberDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + bytes, err := d.decodeStreamByte(s) + if err != nil { + return err + } + if _, err := strconv.ParseFloat(*(*string)(unsafe.Pointer(&bytes)), 64); err != nil { + return errors.ErrSyntax(err.Error(), s.totalOffset()) + } + d.op(p, json.Number(string(bytes))) + s.reset() + return nil +} + +func (d *numberDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + bytes, c, err := d.decodeByte(ctx.Buf, cursor) + if err != nil { + return 0, err + } + if _, err := strconv.ParseFloat(*(*string)(unsafe.Pointer(&bytes)), 64); err != nil { + return 0, errors.ErrSyntax(err.Error(), c) + } + cursor = c + s := *(*string)(unsafe.Pointer(&bytes)) + d.op(p, json.Number(s)) + return cursor, nil +} + +func (d *numberDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + bytes, c, err := d.decodeByte(ctx.Buf, cursor) + if err != nil { + return nil, 0, err + } + if bytes == nil { + return [][]byte{nullbytes}, c, nil + } + return [][]byte{bytes}, c, nil +} + +func (d *numberDecoder) decodeStreamByte(s *Stream) ([]byte, error) { + start := s.cursor + for { + switch s.char() { + case ' ', '\n', '\t', '\r': + s.cursor++ + continue + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return floatBytes(s), nil + case 'n': + if err := nullBytes(s); err != nil { + return nil, err + } + return nil, nil + case '"': + return d.stringDecoder.decodeStreamByte(s) + case nul: + if s.read() { + continue + } + goto ERROR + default: + goto ERROR + } + } +ERROR: + if s.cursor == start { + return nil, errors.ErrInvalidBeginningOfValue(s.char(), s.totalOffset()) + } + return nil, errors.ErrUnexpectedEndOfJSON("json.Number", s.totalOffset()) +} + +func (d *numberDecoder) decodeByte(buf []byte, cursor int64) ([]byte, int64, error) { + for { + switch buf[cursor] { + case ' ', '\n', '\t', '\r': + cursor++ + continue + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + start := cursor + cursor++ + for floatTable[buf[cursor]] { + cursor++ + } + num := buf[start:cursor] + return num, cursor, nil + case 'n': + if err := validateNull(buf, cursor); err != nil { + return nil, 0, err + } + cursor += 4 + return nil, cursor, nil + case '"': + return d.stringDecoder.decodeByte(buf, cursor) + default: + return nil, 0, errors.ErrUnexpectedEndOfJSON("json.Number", cursor) + } + } +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/option.go b/vendor/github.com/goccy/go-json/internal/decoder/option.go new file mode 100644 index 000000000..502f772eb --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/option.go @@ -0,0 +1,17 @@ +package decoder + +import "context" + +type OptionFlags uint8 + +const ( + FirstWinOption OptionFlags = 1 << iota + ContextOption + PathOption +) + +type Option struct { + Flags OptionFlags + Context context.Context + Path *Path +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/path.go b/vendor/github.com/goccy/go-json/internal/decoder/path.go new file mode 100644 index 000000000..a15ff69e3 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/path.go @@ -0,0 +1,670 @@ +package decoder + +import ( + "fmt" + "reflect" + "strconv" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type PathString string + +func (s PathString) Build() (*Path, error) { + builder := new(PathBuilder) + return builder.Build([]rune(s)) +} + +type PathBuilder struct { + root PathNode + node PathNode + singleQuotePathSelector bool + doubleQuotePathSelector bool +} + +func (b *PathBuilder) Build(buf []rune) (*Path, error) { + node, err := b.build(buf) + if err != nil { + return nil, err + } + return &Path{ + node: node, + RootSelectorOnly: node == nil, + SingleQuotePathSelector: b.singleQuotePathSelector, + DoubleQuotePathSelector: b.doubleQuotePathSelector, + }, nil +} + +func (b *PathBuilder) build(buf []rune) (PathNode, error) { + if len(buf) == 0 { + return nil, errors.ErrEmptyPath() + } + if buf[0] != '$' { + return nil, errors.ErrInvalidPath("JSON Path must start with a $ character") + } + if len(buf) == 1 { + return nil, nil + } + buf = buf[1:] + offset, err := b.buildNext(buf) + if err != nil { + return nil, err + } + if len(buf) > offset { + return nil, errors.ErrInvalidPath("remain invalid path %q", buf[offset:]) + } + return b.root, nil +} + +func (b *PathBuilder) buildNextCharIfExists(buf []rune, cursor int) (int, error) { + if len(buf) > cursor { + offset, err := b.buildNext(buf[cursor:]) + if err != nil { + return 0, err + } + return cursor + 1 + offset, nil + } + return cursor, nil +} + +func (b *PathBuilder) buildNext(buf []rune) (int, error) { + switch buf[0] { + case '.': + if len(buf) == 1 { + return 0, errors.ErrInvalidPath("JSON Path ends with dot character") + } + offset, err := b.buildSelector(buf[1:]) + if err != nil { + return 0, err + } + return offset + 1, nil + case '[': + if len(buf) == 1 { + return 0, errors.ErrInvalidPath("JSON Path ends with left bracket character") + } + offset, err := b.buildIndex(buf[1:]) + if err != nil { + return 0, err + } + return offset + 1, nil + default: + return 0, errors.ErrInvalidPath("expect dot or left bracket character. but found %c character", buf[0]) + } +} + +func (b *PathBuilder) buildSelector(buf []rune) (int, error) { + switch buf[0] { + case '.': + if len(buf) == 1 { + return 0, errors.ErrInvalidPath("JSON Path ends with double dot character") + } + offset, err := b.buildPathRecursive(buf[1:]) + if err != nil { + return 0, err + } + return 1 + offset, nil + case '[', ']', '$', '*': + return 0, errors.ErrInvalidPath("found invalid path character %c after dot", buf[0]) + } + for cursor := 0; cursor < len(buf); cursor++ { + switch buf[cursor] { + case '$', '*', ']': + return 0, errors.ErrInvalidPath("found %c character in field selector context", buf[cursor]) + case '.': + if cursor+1 >= len(buf) { + return 0, errors.ErrInvalidPath("JSON Path ends with dot character") + } + selector := buf[:cursor] + b.addSelectorNode(string(selector)) + offset, err := b.buildSelector(buf[cursor+1:]) + if err != nil { + return 0, err + } + return cursor + 1 + offset, nil + case '[': + if cursor+1 >= len(buf) { + return 0, errors.ErrInvalidPath("JSON Path ends with left bracket character") + } + selector := buf[:cursor] + b.addSelectorNode(string(selector)) + offset, err := b.buildIndex(buf[cursor+1:]) + if err != nil { + return 0, err + } + return cursor + 1 + offset, nil + case '"': + if cursor+1 >= len(buf) { + return 0, errors.ErrInvalidPath("JSON Path ends with double quote character") + } + offset, err := b.buildQuoteSelector(buf[cursor+1:], DoubleQuotePathSelector) + if err != nil { + return 0, err + } + return cursor + 1 + offset, nil + } + } + b.addSelectorNode(string(buf)) + return len(buf), nil +} + +func (b *PathBuilder) buildQuoteSelector(buf []rune, sel QuotePathSelector) (int, error) { + switch buf[0] { + case '[', ']', '$', '.', '*', '\'', '"': + return 0, errors.ErrInvalidPath("found invalid path character %c after quote", buf[0]) + } + for cursor := 0; cursor < len(buf); cursor++ { + switch buf[cursor] { + case '\'': + if sel != SingleQuotePathSelector { + return 0, errors.ErrInvalidPath("found double quote character in field selector with single quote context") + } + if len(buf) <= cursor+1 { + return 0, errors.ErrInvalidPath("JSON Path ends with single quote character in field selector context") + } + if buf[cursor+1] != ']' { + return 0, errors.ErrInvalidPath("expect right bracket for field selector with single quote but found %c", buf[cursor+1]) + } + selector := buf[:cursor] + b.addSelectorNode(string(selector)) + b.singleQuotePathSelector = true + return b.buildNextCharIfExists(buf, cursor+2) + case '"': + if sel != DoubleQuotePathSelector { + return 0, errors.ErrInvalidPath("found single quote character in field selector with double quote context") + } + selector := buf[:cursor] + b.addSelectorNode(string(selector)) + b.doubleQuotePathSelector = true + return b.buildNextCharIfExists(buf, cursor+1) + } + } + return 0, errors.ErrInvalidPath("couldn't find quote character in selector quote path context") +} + +func (b *PathBuilder) buildPathRecursive(buf []rune) (int, error) { + switch buf[0] { + case '.', '[', ']', '$', '*': + return 0, errors.ErrInvalidPath("found invalid path character %c after double dot", buf[0]) + } + for cursor := 0; cursor < len(buf); cursor++ { + switch buf[cursor] { + case '$', '*', ']': + return 0, errors.ErrInvalidPath("found %c character in field selector context", buf[cursor]) + case '.': + if cursor+1 >= len(buf) { + return 0, errors.ErrInvalidPath("JSON Path ends with dot character") + } + selector := buf[:cursor] + b.addRecursiveNode(string(selector)) + offset, err := b.buildSelector(buf[cursor+1:]) + if err != nil { + return 0, err + } + return cursor + 1 + offset, nil + case '[': + if cursor+1 >= len(buf) { + return 0, errors.ErrInvalidPath("JSON Path ends with left bracket character") + } + selector := buf[:cursor] + b.addRecursiveNode(string(selector)) + offset, err := b.buildIndex(buf[cursor+1:]) + if err != nil { + return 0, err + } + return cursor + 1 + offset, nil + } + } + b.addRecursiveNode(string(buf)) + return len(buf), nil +} + +func (b *PathBuilder) buildIndex(buf []rune) (int, error) { + switch buf[0] { + case '.', '[', ']', '$': + return 0, errors.ErrInvalidPath("found invalid path character %c after left bracket", buf[0]) + case '\'': + if len(buf) == 1 { + return 0, errors.ErrInvalidPath("JSON Path ends with single quote character") + } + offset, err := b.buildQuoteSelector(buf[1:], SingleQuotePathSelector) + if err != nil { + return 0, err + } + return 1 + offset, nil + case '*': + if len(buf) == 1 { + return 0, errors.ErrInvalidPath("JSON Path ends with star character") + } + if buf[1] != ']' { + return 0, errors.ErrInvalidPath("expect right bracket character for index all path but found %c character", buf[1]) + } + b.addIndexAllNode() + offset := len("*]") + if len(buf) > 2 { + buildOffset, err := b.buildNext(buf[2:]) + if err != nil { + return 0, err + } + return offset + buildOffset, nil + } + return offset, nil + } + + for cursor := 0; cursor < len(buf); cursor++ { + switch buf[cursor] { + case ']': + index, err := strconv.ParseInt(string(buf[:cursor]), 10, 64) + if err != nil { + return 0, errors.ErrInvalidPath("%q is unexpected index path", buf[:cursor]) + } + b.addIndexNode(int(index)) + return b.buildNextCharIfExists(buf, cursor+1) + } + } + return 0, errors.ErrInvalidPath("couldn't find right bracket character in index path context") +} + +func (b *PathBuilder) addIndexAllNode() { + node := newPathIndexAllNode() + if b.root == nil { + b.root = node + b.node = node + } else { + b.node = b.node.chain(node) + } +} + +func (b *PathBuilder) addRecursiveNode(selector string) { + node := newPathRecursiveNode(selector) + if b.root == nil { + b.root = node + b.node = node + } else { + b.node = b.node.chain(node) + } +} + +func (b *PathBuilder) addSelectorNode(name string) { + node := newPathSelectorNode(name) + if b.root == nil { + b.root = node + b.node = node + } else { + b.node = b.node.chain(node) + } +} + +func (b *PathBuilder) addIndexNode(idx int) { + node := newPathIndexNode(idx) + if b.root == nil { + b.root = node + b.node = node + } else { + b.node = b.node.chain(node) + } +} + +type QuotePathSelector int + +const ( + SingleQuotePathSelector QuotePathSelector = 1 + DoubleQuotePathSelector QuotePathSelector = 2 +) + +type Path struct { + node PathNode + RootSelectorOnly bool + SingleQuotePathSelector bool + DoubleQuotePathSelector bool +} + +func (p *Path) Field(sel string) (PathNode, bool, error) { + if p.node == nil { + return nil, false, nil + } + return p.node.Field(sel) +} + +func (p *Path) Get(src, dst reflect.Value) error { + if p.node == nil { + return nil + } + return p.node.Get(src, dst) +} + +func (p *Path) String() string { + if p.node == nil { + return "$" + } + return p.node.String() +} + +type PathNode interface { + fmt.Stringer + Index(idx int) (PathNode, bool, error) + Field(fieldName string) (PathNode, bool, error) + Get(src, dst reflect.Value) error + chain(PathNode) PathNode + target() bool + single() bool +} + +type BasePathNode struct { + child PathNode +} + +func (n *BasePathNode) chain(node PathNode) PathNode { + n.child = node + return node +} + +func (n *BasePathNode) target() bool { + return n.child == nil +} + +func (n *BasePathNode) single() bool { + return true +} + +type PathSelectorNode struct { + *BasePathNode + selector string +} + +func newPathSelectorNode(selector string) *PathSelectorNode { + return &PathSelectorNode{ + BasePathNode: &BasePathNode{}, + selector: selector, + } +} + +func (n *PathSelectorNode) Index(idx int) (PathNode, bool, error) { + return nil, false, &errors.PathError{} +} + +func (n *PathSelectorNode) Field(fieldName string) (PathNode, bool, error) { + if n.selector == fieldName { + return n.child, true, nil + } + return nil, false, nil +} + +func (n *PathSelectorNode) Get(src, dst reflect.Value) error { + switch src.Type().Kind() { + case reflect.Map: + iter := src.MapRange() + for iter.Next() { + key, ok := iter.Key().Interface().(string) + if !ok { + return fmt.Errorf("invalid map key type %T", src.Type().Key()) + } + child, found, err := n.Field(key) + if err != nil { + return err + } + if found { + if child != nil { + return child.Get(iter.Value(), dst) + } + return AssignValue(iter.Value(), dst) + } + } + case reflect.Struct: + typ := src.Type() + for i := 0; i < typ.Len(); i++ { + tag := runtime.StructTagFromField(typ.Field(i)) + child, found, err := n.Field(tag.Key) + if err != nil { + return err + } + if found { + if child != nil { + return child.Get(src.Field(i), dst) + } + return AssignValue(src.Field(i), dst) + } + } + case reflect.Ptr: + return n.Get(src.Elem(), dst) + case reflect.Interface: + return n.Get(reflect.ValueOf(src.Interface()), dst) + case reflect.Float64, reflect.String, reflect.Bool: + return AssignValue(src, dst) + } + return fmt.Errorf("failed to get %s value from %s", n.selector, src.Type()) +} + +func (n *PathSelectorNode) String() string { + s := fmt.Sprintf(".%s", n.selector) + if n.child != nil { + s += n.child.String() + } + return s +} + +type PathIndexNode struct { + *BasePathNode + selector int +} + +func newPathIndexNode(selector int) *PathIndexNode { + return &PathIndexNode{ + BasePathNode: &BasePathNode{}, + selector: selector, + } +} + +func (n *PathIndexNode) Index(idx int) (PathNode, bool, error) { + if n.selector == idx { + return n.child, true, nil + } + return nil, false, nil +} + +func (n *PathIndexNode) Field(fieldName string) (PathNode, bool, error) { + return nil, false, &errors.PathError{} +} + +func (n *PathIndexNode) Get(src, dst reflect.Value) error { + switch src.Type().Kind() { + case reflect.Array, reflect.Slice: + if src.Len() > n.selector { + if n.child != nil { + return n.child.Get(src.Index(n.selector), dst) + } + return AssignValue(src.Index(n.selector), dst) + } + case reflect.Ptr: + return n.Get(src.Elem(), dst) + case reflect.Interface: + return n.Get(reflect.ValueOf(src.Interface()), dst) + } + return fmt.Errorf("failed to get [%d] value from %s", n.selector, src.Type()) +} + +func (n *PathIndexNode) String() string { + s := fmt.Sprintf("[%d]", n.selector) + if n.child != nil { + s += n.child.String() + } + return s +} + +type PathIndexAllNode struct { + *BasePathNode +} + +func newPathIndexAllNode() *PathIndexAllNode { + return &PathIndexAllNode{ + BasePathNode: &BasePathNode{}, + } +} + +func (n *PathIndexAllNode) Index(idx int) (PathNode, bool, error) { + return n.child, true, nil +} + +func (n *PathIndexAllNode) Field(fieldName string) (PathNode, bool, error) { + return nil, false, &errors.PathError{} +} + +func (n *PathIndexAllNode) Get(src, dst reflect.Value) error { + switch src.Type().Kind() { + case reflect.Array, reflect.Slice: + var arr []interface{} + for i := 0; i < src.Len(); i++ { + var v interface{} + rv := reflect.ValueOf(&v) + if n.child != nil { + if err := n.child.Get(src.Index(i), rv); err != nil { + return err + } + } else { + if err := AssignValue(src.Index(i), rv); err != nil { + return err + } + } + arr = append(arr, v) + } + if err := AssignValue(reflect.ValueOf(arr), dst); err != nil { + return err + } + return nil + case reflect.Ptr: + return n.Get(src.Elem(), dst) + case reflect.Interface: + return n.Get(reflect.ValueOf(src.Interface()), dst) + } + return fmt.Errorf("failed to get all value from %s", src.Type()) +} + +func (n *PathIndexAllNode) String() string { + s := "[*]" + if n.child != nil { + s += n.child.String() + } + return s +} + +type PathRecursiveNode struct { + *BasePathNode + selector string +} + +func newPathRecursiveNode(selector string) *PathRecursiveNode { + node := newPathSelectorNode(selector) + return &PathRecursiveNode{ + BasePathNode: &BasePathNode{ + child: node, + }, + selector: selector, + } +} + +func (n *PathRecursiveNode) Field(fieldName string) (PathNode, bool, error) { + if n.selector == fieldName { + return n.child, true, nil + } + return nil, false, nil +} + +func (n *PathRecursiveNode) Index(_ int) (PathNode, bool, error) { + return n, true, nil +} + +func valueToSliceValue(v interface{}) []interface{} { + rv := reflect.ValueOf(v) + ret := []interface{}{} + if rv.Type().Kind() == reflect.Slice || rv.Type().Kind() == reflect.Array { + for i := 0; i < rv.Len(); i++ { + ret = append(ret, rv.Index(i).Interface()) + } + return ret + } + return []interface{}{v} +} + +func (n *PathRecursiveNode) Get(src, dst reflect.Value) error { + if n.child == nil { + return fmt.Errorf("failed to get by recursive path ..%s", n.selector) + } + var arr []interface{} + switch src.Type().Kind() { + case reflect.Map: + iter := src.MapRange() + for iter.Next() { + key, ok := iter.Key().Interface().(string) + if !ok { + return fmt.Errorf("invalid map key type %T", src.Type().Key()) + } + child, found, err := n.Field(key) + if err != nil { + return err + } + if found { + var v interface{} + rv := reflect.ValueOf(&v) + _ = child.Get(iter.Value(), rv) + arr = append(arr, valueToSliceValue(v)...) + } else { + var v interface{} + rv := reflect.ValueOf(&v) + _ = n.Get(iter.Value(), rv) + if v != nil { + arr = append(arr, valueToSliceValue(v)...) + } + } + } + _ = AssignValue(reflect.ValueOf(arr), dst) + return nil + case reflect.Struct: + typ := src.Type() + for i := 0; i < typ.Len(); i++ { + tag := runtime.StructTagFromField(typ.Field(i)) + child, found, err := n.Field(tag.Key) + if err != nil { + return err + } + if found { + var v interface{} + rv := reflect.ValueOf(&v) + _ = child.Get(src.Field(i), rv) + arr = append(arr, valueToSliceValue(v)...) + } else { + var v interface{} + rv := reflect.ValueOf(&v) + _ = n.Get(src.Field(i), rv) + if v != nil { + arr = append(arr, valueToSliceValue(v)...) + } + } + } + _ = AssignValue(reflect.ValueOf(arr), dst) + return nil + case reflect.Array, reflect.Slice: + for i := 0; i < src.Len(); i++ { + var v interface{} + rv := reflect.ValueOf(&v) + _ = n.Get(src.Index(i), rv) + if v != nil { + arr = append(arr, valueToSliceValue(v)...) + } + } + _ = AssignValue(reflect.ValueOf(arr), dst) + return nil + case reflect.Ptr: + return n.Get(src.Elem(), dst) + case reflect.Interface: + return n.Get(reflect.ValueOf(src.Interface()), dst) + } + return fmt.Errorf("failed to get %s value from %s", n.selector, src.Type()) +} + +func (n *PathRecursiveNode) String() string { + s := fmt.Sprintf("..%s", n.selector) + if n.child != nil { + s += n.child.String() + } + return s +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/ptr.go b/vendor/github.com/goccy/go-json/internal/decoder/ptr.go new file mode 100644 index 000000000..de12e105c --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/ptr.go @@ -0,0 +1,96 @@ +package decoder + +import ( + "fmt" + "unsafe" + + "github.com/goccy/go-json/internal/runtime" +) + +type ptrDecoder struct { + dec Decoder + typ *runtime.Type + structName string + fieldName string +} + +func newPtrDecoder(dec Decoder, typ *runtime.Type, structName, fieldName string) *ptrDecoder { + return &ptrDecoder{ + dec: dec, + typ: typ, + structName: structName, + fieldName: fieldName, + } +} + +func (d *ptrDecoder) contentDecoder() Decoder { + dec, ok := d.dec.(*ptrDecoder) + if !ok { + return d.dec + } + return dec.contentDecoder() +} + +//nolint:golint +//go:linkname unsafe_New reflect.unsafe_New +func unsafe_New(*runtime.Type) unsafe.Pointer + +func UnsafeNew(t *runtime.Type) unsafe.Pointer { + return unsafe_New(t) +} + +func (d *ptrDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + if s.skipWhiteSpace() == nul { + s.read() + } + if s.char() == 'n' { + if err := nullBytes(s); err != nil { + return err + } + *(*unsafe.Pointer)(p) = nil + return nil + } + var newptr unsafe.Pointer + if *(*unsafe.Pointer)(p) == nil { + newptr = unsafe_New(d.typ) + *(*unsafe.Pointer)(p) = newptr + } else { + newptr = *(*unsafe.Pointer)(p) + } + if err := d.dec.DecodeStream(s, depth, newptr); err != nil { + return err + } + return nil +} + +func (d *ptrDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + cursor = skipWhiteSpace(buf, cursor) + if buf[cursor] == 'n' { + if err := validateNull(buf, cursor); err != nil { + return 0, err + } + if p != nil { + *(*unsafe.Pointer)(p) = nil + } + cursor += 4 + return cursor, nil + } + var newptr unsafe.Pointer + if *(*unsafe.Pointer)(p) == nil { + newptr = unsafe_New(d.typ) + *(*unsafe.Pointer)(p) = newptr + } else { + newptr = *(*unsafe.Pointer)(p) + } + c, err := d.dec.Decode(ctx, cursor, depth, newptr) + if err != nil { + return 0, err + } + cursor = c + return cursor, nil +} + +func (d *ptrDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: ptr decoder does not support decode path") +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/slice.go b/vendor/github.com/goccy/go-json/internal/decoder/slice.go new file mode 100644 index 000000000..30a23e4b5 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/slice.go @@ -0,0 +1,380 @@ +package decoder + +import ( + "reflect" + "sync" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +var ( + sliceType = runtime.Type2RType( + reflect.TypeOf((*sliceHeader)(nil)).Elem(), + ) + nilSlice = unsafe.Pointer(&sliceHeader{}) +) + +type sliceDecoder struct { + elemType *runtime.Type + isElemPointerType bool + valueDecoder Decoder + size uintptr + arrayPool sync.Pool + structName string + fieldName string +} + +// If use reflect.SliceHeader, data type is uintptr. +// In this case, Go compiler cannot trace reference created by newArray(). +// So, define using unsafe.Pointer as data type +type sliceHeader struct { + data unsafe.Pointer + len int + cap int +} + +const ( + defaultSliceCapacity = 2 +) + +func newSliceDecoder(dec Decoder, elemType *runtime.Type, size uintptr, structName, fieldName string) *sliceDecoder { + return &sliceDecoder{ + valueDecoder: dec, + elemType: elemType, + isElemPointerType: elemType.Kind() == reflect.Ptr || elemType.Kind() == reflect.Map, + size: size, + arrayPool: sync.Pool{ + New: func() interface{} { + return &sliceHeader{ + data: newArray(elemType, defaultSliceCapacity), + len: 0, + cap: defaultSliceCapacity, + } + }, + }, + structName: structName, + fieldName: fieldName, + } +} + +func (d *sliceDecoder) newSlice(src *sliceHeader) *sliceHeader { + slice := d.arrayPool.Get().(*sliceHeader) + if src.len > 0 { + // copy original elem + if slice.cap < src.cap { + data := newArray(d.elemType, src.cap) + slice = &sliceHeader{data: data, len: src.len, cap: src.cap} + } else { + slice.len = src.len + } + copySlice(d.elemType, *slice, *src) + } else { + slice.len = 0 + } + return slice +} + +func (d *sliceDecoder) releaseSlice(p *sliceHeader) { + d.arrayPool.Put(p) +} + +//go:linkname copySlice reflect.typedslicecopy +func copySlice(elemType *runtime.Type, dst, src sliceHeader) int + +//go:linkname newArray reflect.unsafe_NewArray +func newArray(*runtime.Type, int) unsafe.Pointer + +//go:linkname typedmemmove reflect.typedmemmove +func typedmemmove(t *runtime.Type, dst, src unsafe.Pointer) + +func (d *sliceDecoder) errNumber(offset int64) *errors.UnmarshalTypeError { + return &errors.UnmarshalTypeError{ + Value: "number", + Type: reflect.SliceOf(runtime.RType2Type(d.elemType)), + Struct: d.structName, + Field: d.fieldName, + Offset: offset, + } +} + +func (d *sliceDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + depth++ + if depth > maxDecodeNestingDepth { + return errors.ErrExceededMaxDepth(s.char(), s.cursor) + } + + for { + switch s.char() { + case ' ', '\n', '\t', '\r': + s.cursor++ + continue + case 'n': + if err := nullBytes(s); err != nil { + return err + } + typedmemmove(sliceType, p, nilSlice) + return nil + case '[': + s.cursor++ + if s.skipWhiteSpace() == ']' { + dst := (*sliceHeader)(p) + if dst.data == nil { + dst.data = newArray(d.elemType, 0) + } else { + dst.len = 0 + } + s.cursor++ + return nil + } + idx := 0 + slice := d.newSlice((*sliceHeader)(p)) + srcLen := slice.len + capacity := slice.cap + data := slice.data + for { + if capacity <= idx { + src := sliceHeader{data: data, len: idx, cap: capacity} + capacity *= 2 + data = newArray(d.elemType, capacity) + dst := sliceHeader{data: data, len: idx, cap: capacity} + copySlice(d.elemType, dst, src) + } + ep := unsafe.Pointer(uintptr(data) + uintptr(idx)*d.size) + + // if srcLen is greater than idx, keep the original reference + if srcLen <= idx { + if d.isElemPointerType { + **(**unsafe.Pointer)(unsafe.Pointer(&ep)) = nil // initialize elem pointer + } else { + // assign new element to the slice + typedmemmove(d.elemType, ep, unsafe_New(d.elemType)) + } + } + + if err := d.valueDecoder.DecodeStream(s, depth, ep); err != nil { + return err + } + s.skipWhiteSpace() + RETRY: + switch s.char() { + case ']': + slice.cap = capacity + slice.len = idx + 1 + slice.data = data + dst := (*sliceHeader)(p) + dst.len = idx + 1 + if dst.len > dst.cap { + dst.data = newArray(d.elemType, dst.len) + dst.cap = dst.len + } + copySlice(d.elemType, *dst, *slice) + d.releaseSlice(slice) + s.cursor++ + return nil + case ',': + idx++ + case nul: + if s.read() { + goto RETRY + } + slice.cap = capacity + slice.data = data + d.releaseSlice(slice) + goto ERROR + default: + slice.cap = capacity + slice.data = data + d.releaseSlice(slice) + goto ERROR + } + s.cursor++ + } + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return d.errNumber(s.totalOffset()) + case nul: + if s.read() { + continue + } + goto ERROR + default: + goto ERROR + } + } +ERROR: + return errors.ErrUnexpectedEndOfJSON("slice", s.totalOffset()) +} + +func (d *sliceDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + depth++ + if depth > maxDecodeNestingDepth { + return 0, errors.ErrExceededMaxDepth(buf[cursor], cursor) + } + + for { + switch buf[cursor] { + case ' ', '\n', '\t', '\r': + cursor++ + continue + case 'n': + if err := validateNull(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + typedmemmove(sliceType, p, nilSlice) + return cursor, nil + case '[': + cursor++ + cursor = skipWhiteSpace(buf, cursor) + if buf[cursor] == ']' { + dst := (*sliceHeader)(p) + if dst.data == nil { + dst.data = newArray(d.elemType, 0) + } else { + dst.len = 0 + } + cursor++ + return cursor, nil + } + idx := 0 + slice := d.newSlice((*sliceHeader)(p)) + srcLen := slice.len + capacity := slice.cap + data := slice.data + for { + if capacity <= idx { + src := sliceHeader{data: data, len: idx, cap: capacity} + capacity *= 2 + data = newArray(d.elemType, capacity) + dst := sliceHeader{data: data, len: idx, cap: capacity} + copySlice(d.elemType, dst, src) + } + ep := unsafe.Pointer(uintptr(data) + uintptr(idx)*d.size) + // if srcLen is greater than idx, keep the original reference + if srcLen <= idx { + if d.isElemPointerType { + **(**unsafe.Pointer)(unsafe.Pointer(&ep)) = nil // initialize elem pointer + } else { + // assign new element to the slice + typedmemmove(d.elemType, ep, unsafe_New(d.elemType)) + } + } + c, err := d.valueDecoder.Decode(ctx, cursor, depth, ep) + if err != nil { + return 0, err + } + cursor = c + cursor = skipWhiteSpace(buf, cursor) + switch buf[cursor] { + case ']': + slice.cap = capacity + slice.len = idx + 1 + slice.data = data + dst := (*sliceHeader)(p) + dst.len = idx + 1 + if dst.len > dst.cap { + dst.data = newArray(d.elemType, dst.len) + dst.cap = dst.len + } + copySlice(d.elemType, *dst, *slice) + d.releaseSlice(slice) + cursor++ + return cursor, nil + case ',': + idx++ + default: + slice.cap = capacity + slice.data = data + d.releaseSlice(slice) + return 0, errors.ErrInvalidCharacter(buf[cursor], "slice", cursor) + } + cursor++ + } + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return 0, d.errNumber(cursor) + default: + return 0, errors.ErrUnexpectedEndOfJSON("slice", cursor) + } + } +} + +func (d *sliceDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + buf := ctx.Buf + depth++ + if depth > maxDecodeNestingDepth { + return nil, 0, errors.ErrExceededMaxDepth(buf[cursor], cursor) + } + + ret := [][]byte{} + for { + switch buf[cursor] { + case ' ', '\n', '\t', '\r': + cursor++ + continue + case 'n': + if err := validateNull(buf, cursor); err != nil { + return nil, 0, err + } + cursor += 4 + return [][]byte{nullbytes}, cursor, nil + case '[': + cursor++ + cursor = skipWhiteSpace(buf, cursor) + if buf[cursor] == ']' { + cursor++ + return ret, cursor, nil + } + idx := 0 + for { + child, found, err := ctx.Option.Path.node.Index(idx) + if err != nil { + return nil, 0, err + } + if found { + if child != nil { + oldPath := ctx.Option.Path.node + ctx.Option.Path.node = child + paths, c, err := d.valueDecoder.DecodePath(ctx, cursor, depth) + if err != nil { + return nil, 0, err + } + ctx.Option.Path.node = oldPath + ret = append(ret, paths...) + cursor = c + } else { + start := cursor + end, err := skipValue(buf, cursor, depth) + if err != nil { + return nil, 0, err + } + ret = append(ret, buf[start:end]) + cursor = end + } + } else { + c, err := skipValue(buf, cursor, depth) + if err != nil { + return nil, 0, err + } + cursor = c + } + cursor = skipWhiteSpace(buf, cursor) + switch buf[cursor] { + case ']': + cursor++ + return ret, cursor, nil + case ',': + idx++ + default: + return nil, 0, errors.ErrInvalidCharacter(buf[cursor], "slice", cursor) + } + cursor++ + } + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return nil, 0, d.errNumber(cursor) + default: + return nil, 0, errors.ErrUnexpectedEndOfJSON("slice", cursor) + } + } +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/stream.go b/vendor/github.com/goccy/go-json/internal/decoder/stream.go new file mode 100644 index 000000000..a383f7259 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/stream.go @@ -0,0 +1,556 @@ +package decoder + +import ( + "bytes" + "encoding/json" + "io" + "strconv" + "unsafe" + + "github.com/goccy/go-json/internal/errors" +) + +const ( + initBufSize = 512 +) + +type Stream struct { + buf []byte + bufSize int64 + length int64 + r io.Reader + offset int64 + cursor int64 + filledBuffer bool + allRead bool + UseNumber bool + DisallowUnknownFields bool + Option *Option +} + +func NewStream(r io.Reader) *Stream { + return &Stream{ + r: r, + bufSize: initBufSize, + buf: make([]byte, initBufSize), + Option: &Option{}, + } +} + +func (s *Stream) TotalOffset() int64 { + return s.totalOffset() +} + +func (s *Stream) Buffered() io.Reader { + buflen := int64(len(s.buf)) + for i := s.cursor; i < buflen; i++ { + if s.buf[i] == nul { + return bytes.NewReader(s.buf[s.cursor:i]) + } + } + return bytes.NewReader(s.buf[s.cursor:]) +} + +func (s *Stream) PrepareForDecode() error { + for { + switch s.char() { + case ' ', '\t', '\r', '\n': + s.cursor++ + continue + case ',', ':': + s.cursor++ + return nil + case nul: + if s.read() { + continue + } + return io.EOF + } + break + } + return nil +} + +func (s *Stream) totalOffset() int64 { + return s.offset + s.cursor +} + +func (s *Stream) char() byte { + return s.buf[s.cursor] +} + +func (s *Stream) equalChar(c byte) bool { + cur := s.buf[s.cursor] + if cur == nul { + s.read() + cur = s.buf[s.cursor] + } + return cur == c +} + +func (s *Stream) stat() ([]byte, int64, unsafe.Pointer) { + return s.buf, s.cursor, (*sliceHeader)(unsafe.Pointer(&s.buf)).data +} + +func (s *Stream) bufptr() unsafe.Pointer { + return (*sliceHeader)(unsafe.Pointer(&s.buf)).data +} + +func (s *Stream) statForRetry() ([]byte, int64, unsafe.Pointer) { + s.cursor-- // for retry ( because caller progress cursor position in each loop ) + return s.buf, s.cursor, (*sliceHeader)(unsafe.Pointer(&s.buf)).data +} + +func (s *Stream) Reset() { + s.reset() + s.bufSize = int64(len(s.buf)) +} + +func (s *Stream) More() bool { + for { + switch s.char() { + case ' ', '\n', '\r', '\t': + s.cursor++ + continue + case '}', ']': + return false + case nul: + if s.read() { + continue + } + return false + } + break + } + return true +} + +func (s *Stream) Token() (interface{}, error) { + for { + c := s.char() + switch c { + case ' ', '\n', '\r', '\t': + s.cursor++ + case '{', '[', ']', '}': + s.cursor++ + return json.Delim(c), nil + case ',', ':': + s.cursor++ + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + bytes := floatBytes(s) + str := *(*string)(unsafe.Pointer(&bytes)) + if s.UseNumber { + return json.Number(str), nil + } + f64, err := strconv.ParseFloat(str, 64) + if err != nil { + return nil, err + } + return f64, nil + case '"': + bytes, err := stringBytes(s) + if err != nil { + return nil, err + } + return string(bytes), nil + case 't': + if err := trueBytes(s); err != nil { + return nil, err + } + return true, nil + case 'f': + if err := falseBytes(s); err != nil { + return nil, err + } + return false, nil + case 'n': + if err := nullBytes(s); err != nil { + return nil, err + } + return nil, nil + case nul: + if s.read() { + continue + } + goto END + default: + return nil, errors.ErrInvalidCharacter(s.char(), "token", s.totalOffset()) + } + } +END: + return nil, io.EOF +} + +func (s *Stream) reset() { + s.offset += s.cursor + s.buf = s.buf[s.cursor:] + s.length -= s.cursor + s.cursor = 0 +} + +func (s *Stream) readBuf() []byte { + if s.filledBuffer { + s.bufSize *= 2 + remainBuf := s.buf + s.buf = make([]byte, s.bufSize) + copy(s.buf, remainBuf) + } + remainLen := s.length - s.cursor + remainNotNulCharNum := int64(0) + for i := int64(0); i < remainLen; i++ { + if s.buf[s.cursor+i] == nul { + break + } + remainNotNulCharNum++ + } + s.length = s.cursor + remainNotNulCharNum + return s.buf[s.cursor+remainNotNulCharNum:] +} + +func (s *Stream) read() bool { + if s.allRead { + return false + } + buf := s.readBuf() + last := len(buf) - 1 + buf[last] = nul + n, err := s.r.Read(buf[:last]) + s.length += int64(n) + if n == last { + s.filledBuffer = true + } else { + s.filledBuffer = false + } + if err == io.EOF { + s.allRead = true + } else if err != nil { + return false + } + return true +} + +func (s *Stream) skipWhiteSpace() byte { + p := s.bufptr() +LOOP: + c := char(p, s.cursor) + switch c { + case ' ', '\n', '\t', '\r': + s.cursor++ + goto LOOP + case nul: + if s.read() { + p = s.bufptr() + goto LOOP + } + } + return c +} + +func (s *Stream) skipObject(depth int64) error { + braceCount := 1 + _, cursor, p := s.stat() + for { + switch char(p, cursor) { + case '{': + braceCount++ + depth++ + if depth > maxDecodeNestingDepth { + return errors.ErrExceededMaxDepth(s.char(), s.cursor) + } + case '}': + braceCount-- + depth-- + if braceCount == 0 { + s.cursor = cursor + 1 + return nil + } + case '[': + depth++ + if depth > maxDecodeNestingDepth { + return errors.ErrExceededMaxDepth(s.char(), s.cursor) + } + case ']': + depth-- + case '"': + for { + cursor++ + switch char(p, cursor) { + case '\\': + cursor++ + if char(p, cursor) == nul { + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + return errors.ErrUnexpectedEndOfJSON("string of object", cursor) + } + case '"': + goto SWITCH_OUT + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.statForRetry() + continue + } + return errors.ErrUnexpectedEndOfJSON("string of object", cursor) + } + } + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + return errors.ErrUnexpectedEndOfJSON("object of object", cursor) + } + SWITCH_OUT: + cursor++ + } +} + +func (s *Stream) skipArray(depth int64) error { + bracketCount := 1 + _, cursor, p := s.stat() + for { + switch char(p, cursor) { + case '[': + bracketCount++ + depth++ + if depth > maxDecodeNestingDepth { + return errors.ErrExceededMaxDepth(s.char(), s.cursor) + } + case ']': + bracketCount-- + depth-- + if bracketCount == 0 { + s.cursor = cursor + 1 + return nil + } + case '{': + depth++ + if depth > maxDecodeNestingDepth { + return errors.ErrExceededMaxDepth(s.char(), s.cursor) + } + case '}': + depth-- + case '"': + for { + cursor++ + switch char(p, cursor) { + case '\\': + cursor++ + if char(p, cursor) == nul { + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + return errors.ErrUnexpectedEndOfJSON("string of object", cursor) + } + case '"': + goto SWITCH_OUT + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.statForRetry() + continue + } + return errors.ErrUnexpectedEndOfJSON("string of object", cursor) + } + } + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + return errors.ErrUnexpectedEndOfJSON("array of object", cursor) + } + SWITCH_OUT: + cursor++ + } +} + +func (s *Stream) skipValue(depth int64) error { + _, cursor, p := s.stat() + for { + switch char(p, cursor) { + case ' ', '\n', '\t', '\r': + cursor++ + continue + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + return errors.ErrUnexpectedEndOfJSON("value of object", s.totalOffset()) + case '{': + s.cursor = cursor + 1 + return s.skipObject(depth + 1) + case '[': + s.cursor = cursor + 1 + return s.skipArray(depth + 1) + case '"': + for { + cursor++ + switch char(p, cursor) { + case '\\': + cursor++ + if char(p, cursor) == nul { + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + return errors.ErrUnexpectedEndOfJSON("value of string", s.totalOffset()) + } + case '"': + s.cursor = cursor + 1 + return nil + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.statForRetry() + continue + } + return errors.ErrUnexpectedEndOfJSON("value of string", s.totalOffset()) + } + } + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + for { + cursor++ + c := char(p, cursor) + if floatTable[c] { + continue + } else if c == nul { + if s.read() { + _, cursor, p = s.stat() + continue + } + } + s.cursor = cursor + return nil + } + case 't': + s.cursor = cursor + if err := trueBytes(s); err != nil { + return err + } + return nil + case 'f': + s.cursor = cursor + if err := falseBytes(s); err != nil { + return err + } + return nil + case 'n': + s.cursor = cursor + if err := nullBytes(s); err != nil { + return err + } + return nil + } + cursor++ + } +} + +func nullBytes(s *Stream) error { + // current cursor's character is 'n' + s.cursor++ + if s.char() != 'u' { + if err := retryReadNull(s); err != nil { + return err + } + } + s.cursor++ + if s.char() != 'l' { + if err := retryReadNull(s); err != nil { + return err + } + } + s.cursor++ + if s.char() != 'l' { + if err := retryReadNull(s); err != nil { + return err + } + } + s.cursor++ + return nil +} + +func retryReadNull(s *Stream) error { + if s.char() == nul && s.read() { + return nil + } + return errors.ErrInvalidCharacter(s.char(), "null", s.totalOffset()) +} + +func trueBytes(s *Stream) error { + // current cursor's character is 't' + s.cursor++ + if s.char() != 'r' { + if err := retryReadTrue(s); err != nil { + return err + } + } + s.cursor++ + if s.char() != 'u' { + if err := retryReadTrue(s); err != nil { + return err + } + } + s.cursor++ + if s.char() != 'e' { + if err := retryReadTrue(s); err != nil { + return err + } + } + s.cursor++ + return nil +} + +func retryReadTrue(s *Stream) error { + if s.char() == nul && s.read() { + return nil + } + return errors.ErrInvalidCharacter(s.char(), "bool(true)", s.totalOffset()) +} + +func falseBytes(s *Stream) error { + // current cursor's character is 'f' + s.cursor++ + if s.char() != 'a' { + if err := retryReadFalse(s); err != nil { + return err + } + } + s.cursor++ + if s.char() != 'l' { + if err := retryReadFalse(s); err != nil { + return err + } + } + s.cursor++ + if s.char() != 's' { + if err := retryReadFalse(s); err != nil { + return err + } + } + s.cursor++ + if s.char() != 'e' { + if err := retryReadFalse(s); err != nil { + return err + } + } + s.cursor++ + return nil +} + +func retryReadFalse(s *Stream) error { + if s.char() == nul && s.read() { + return nil + } + return errors.ErrInvalidCharacter(s.char(), "bool(false)", s.totalOffset()) +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/string.go b/vendor/github.com/goccy/go-json/internal/decoder/string.go new file mode 100644 index 000000000..32602c908 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/string.go @@ -0,0 +1,452 @@ +package decoder + +import ( + "bytes" + "fmt" + "reflect" + "unicode" + "unicode/utf16" + "unicode/utf8" + "unsafe" + + "github.com/goccy/go-json/internal/errors" +) + +type stringDecoder struct { + structName string + fieldName string +} + +func newStringDecoder(structName, fieldName string) *stringDecoder { + return &stringDecoder{ + structName: structName, + fieldName: fieldName, + } +} + +func (d *stringDecoder) errUnmarshalType(typeName string, offset int64) *errors.UnmarshalTypeError { + return &errors.UnmarshalTypeError{ + Value: typeName, + Type: reflect.TypeOf(""), + Offset: offset, + Struct: d.structName, + Field: d.fieldName, + } +} + +func (d *stringDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + bytes, err := d.decodeStreamByte(s) + if err != nil { + return err + } + if bytes == nil { + return nil + } + **(**string)(unsafe.Pointer(&p)) = *(*string)(unsafe.Pointer(&bytes)) + s.reset() + return nil +} + +func (d *stringDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + bytes, c, err := d.decodeByte(ctx.Buf, cursor) + if err != nil { + return 0, err + } + if bytes == nil { + return c, nil + } + cursor = c + **(**string)(unsafe.Pointer(&p)) = *(*string)(unsafe.Pointer(&bytes)) + return cursor, nil +} + +func (d *stringDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + bytes, c, err := d.decodeByte(ctx.Buf, cursor) + if err != nil { + return nil, 0, err + } + if bytes == nil { + return [][]byte{nullbytes}, c, nil + } + return [][]byte{bytes}, c, nil +} + +var ( + hexToInt = [256]int{ + '0': 0, + '1': 1, + '2': 2, + '3': 3, + '4': 4, + '5': 5, + '6': 6, + '7': 7, + '8': 8, + '9': 9, + 'A': 10, + 'B': 11, + 'C': 12, + 'D': 13, + 'E': 14, + 'F': 15, + 'a': 10, + 'b': 11, + 'c': 12, + 'd': 13, + 'e': 14, + 'f': 15, + } +) + +func unicodeToRune(code []byte) rune { + var r rune + for i := 0; i < len(code); i++ { + r = r*16 + rune(hexToInt[code[i]]) + } + return r +} + +func readAtLeast(s *Stream, n int64, p *unsafe.Pointer) bool { + for s.cursor+n >= s.length { + if !s.read() { + return false + } + *p = s.bufptr() + } + return true +} + +func decodeUnicodeRune(s *Stream, p unsafe.Pointer) (rune, int64, unsafe.Pointer, error) { + const defaultOffset = 5 + const surrogateOffset = 11 + + if !readAtLeast(s, defaultOffset, &p) { + return rune(0), 0, nil, errors.ErrInvalidCharacter(s.char(), "escaped string", s.totalOffset()) + } + + r := unicodeToRune(s.buf[s.cursor+1 : s.cursor+defaultOffset]) + if utf16.IsSurrogate(r) { + if !readAtLeast(s, surrogateOffset, &p) { + return unicode.ReplacementChar, defaultOffset, p, nil + } + if s.buf[s.cursor+defaultOffset] != '\\' || s.buf[s.cursor+defaultOffset+1] != 'u' { + return unicode.ReplacementChar, defaultOffset, p, nil + } + r2 := unicodeToRune(s.buf[s.cursor+defaultOffset+2 : s.cursor+surrogateOffset]) + if r := utf16.DecodeRune(r, r2); r != unicode.ReplacementChar { + return r, surrogateOffset, p, nil + } + } + return r, defaultOffset, p, nil +} + +func decodeUnicode(s *Stream, p unsafe.Pointer) (unsafe.Pointer, error) { + const backSlashAndULen = 2 // length of \u + + r, offset, pp, err := decodeUnicodeRune(s, p) + if err != nil { + return nil, err + } + unicode := []byte(string(r)) + unicodeLen := int64(len(unicode)) + s.buf = append(append(s.buf[:s.cursor-1], unicode...), s.buf[s.cursor+offset:]...) + unicodeOrgLen := offset - 1 + s.length = s.length - (backSlashAndULen + (unicodeOrgLen - unicodeLen)) + s.cursor = s.cursor - backSlashAndULen + unicodeLen + return pp, nil +} + +func decodeEscapeString(s *Stream, p unsafe.Pointer) (unsafe.Pointer, error) { + s.cursor++ +RETRY: + switch s.buf[s.cursor] { + case '"': + s.buf[s.cursor] = '"' + case '\\': + s.buf[s.cursor] = '\\' + case '/': + s.buf[s.cursor] = '/' + case 'b': + s.buf[s.cursor] = '\b' + case 'f': + s.buf[s.cursor] = '\f' + case 'n': + s.buf[s.cursor] = '\n' + case 'r': + s.buf[s.cursor] = '\r' + case 't': + s.buf[s.cursor] = '\t' + case 'u': + return decodeUnicode(s, p) + case nul: + if !s.read() { + return nil, errors.ErrInvalidCharacter(s.char(), "escaped string", s.totalOffset()) + } + p = s.bufptr() + goto RETRY + default: + return nil, errors.ErrUnexpectedEndOfJSON("string", s.totalOffset()) + } + s.buf = append(s.buf[:s.cursor-1], s.buf[s.cursor:]...) + s.length-- + s.cursor-- + p = s.bufptr() + return p, nil +} + +var ( + runeErrBytes = []byte(string(utf8.RuneError)) + runeErrBytesLen = int64(len(runeErrBytes)) +) + +func stringBytes(s *Stream) ([]byte, error) { + _, cursor, p := s.stat() + cursor++ // skip double quote char + start := cursor + for { + switch char(p, cursor) { + case '\\': + s.cursor = cursor + pp, err := decodeEscapeString(s, p) + if err != nil { + return nil, err + } + p = pp + cursor = s.cursor + case '"': + literal := s.buf[start:cursor] + cursor++ + s.cursor = cursor + return literal, nil + case + // 0x00 is nul, 0x5c is '\\', 0x22 is '"' . + 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F, // 0x00-0x0F + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F, // 0x10-0x1F + 0x20, 0x21 /*0x22,*/, 0x23, 0x24, 0x25, 0x26, 0x27, 0x28, 0x29, 0x2A, 0x2B, 0x2C, 0x2D, 0x2E, 0x2F, // 0x20-0x2F + 0x30, 0x31, 0x32, 0x33, 0x34, 0x35, 0x36, 0x37, 0x38, 0x39, 0x3A, 0x3B, 0x3C, 0x3D, 0x3E, 0x3F, // 0x30-0x3F + 0x40, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47, 0x48, 0x49, 0x4A, 0x4B, 0x4C, 0x4D, 0x4E, 0x4F, // 0x40-0x4F + 0x50, 0x51, 0x52, 0x53, 0x54, 0x55, 0x56, 0x57, 0x58, 0x59, 0x5A, 0x5B /*0x5C,*/, 0x5D, 0x5E, 0x5F, // 0x50-0x5F + 0x60, 0x61, 0x62, 0x63, 0x64, 0x65, 0x66, 0x67, 0x68, 0x69, 0x6A, 0x6B, 0x6C, 0x6D, 0x6E, 0x6F, // 0x60-0x6F + 0x70, 0x71, 0x72, 0x73, 0x74, 0x75, 0x76, 0x77, 0x78, 0x79, 0x7A, 0x7B, 0x7C, 0x7D, 0x7E, 0x7F: // 0x70-0x7F + // character is ASCII. skip to next char + case + 0x80, 0x81, 0x82, 0x83, 0x84, 0x85, 0x86, 0x87, 0x88, 0x89, 0x8A, 0x8B, 0x8C, 0x8D, 0x8E, 0x8F, // 0x80-0x8F + 0x90, 0x91, 0x92, 0x93, 0x94, 0x95, 0x96, 0x97, 0x98, 0x99, 0x9A, 0x9B, 0x9C, 0x9D, 0x9E, 0x9F, // 0x90-0x9F + 0xA0, 0xA1, 0xA2, 0xA3, 0xA4, 0xA5, 0xA6, 0xA7, 0xA8, 0xA9, 0xAA, 0xAB, 0xAC, 0xAD, 0xAE, 0xAF, // 0xA0-0xAF + 0xB0, 0xB1, 0xB2, 0xB3, 0xB4, 0xB5, 0xB6, 0xB7, 0xB8, 0xB9, 0xBA, 0xBB, 0xBC, 0xBD, 0xBE, 0xBF, // 0xB0-0xBF + 0xC0, 0xC1, // 0xC0-0xC1 + 0xF5, 0xF6, 0xF7, 0xF8, 0xF9, 0xFA, 0xFB, 0xFC, 0xFD, 0xFE, 0xFF: // 0xF5-0xFE + // character is invalid + s.buf = append(append(append([]byte{}, s.buf[:cursor]...), runeErrBytes...), s.buf[cursor+1:]...) + _, _, p = s.stat() + cursor += runeErrBytesLen + s.length += runeErrBytesLen + continue + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + goto ERROR + case 0xEF: + // RuneError is {0xEF, 0xBF, 0xBD} + if s.buf[cursor+1] == 0xBF && s.buf[cursor+2] == 0xBD { + // found RuneError: skip + cursor += 2 + break + } + fallthrough + default: + // multi bytes character + if !utf8.FullRune(s.buf[cursor : len(s.buf)-1]) { + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + goto ERROR + } + r, size := utf8.DecodeRune(s.buf[cursor:]) + if r == utf8.RuneError { + s.buf = append(append(append([]byte{}, s.buf[:cursor]...), runeErrBytes...), s.buf[cursor+1:]...) + cursor += runeErrBytesLen + s.length += runeErrBytesLen + _, _, p = s.stat() + } else { + cursor += int64(size) + } + continue + } + cursor++ + } +ERROR: + return nil, errors.ErrUnexpectedEndOfJSON("string", s.totalOffset()) +} + +func (d *stringDecoder) decodeStreamByte(s *Stream) ([]byte, error) { + for { + switch s.char() { + case ' ', '\n', '\t', '\r': + s.cursor++ + continue + case '[': + return nil, d.errUnmarshalType("array", s.totalOffset()) + case '{': + return nil, d.errUnmarshalType("object", s.totalOffset()) + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return nil, d.errUnmarshalType("number", s.totalOffset()) + case '"': + return stringBytes(s) + case 'n': + if err := nullBytes(s); err != nil { + return nil, err + } + return nil, nil + case nul: + if s.read() { + continue + } + } + break + } + return nil, errors.ErrInvalidBeginningOfValue(s.char(), s.totalOffset()) +} + +func (d *stringDecoder) decodeByte(buf []byte, cursor int64) ([]byte, int64, error) { + for { + switch buf[cursor] { + case ' ', '\n', '\t', '\r': + cursor++ + case '[': + return nil, 0, d.errUnmarshalType("array", cursor) + case '{': + return nil, 0, d.errUnmarshalType("object", cursor) + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return nil, 0, d.errUnmarshalType("number", cursor) + case '"': + cursor++ + start := cursor + b := (*sliceHeader)(unsafe.Pointer(&buf)).data + escaped := 0 + for { + switch char(b, cursor) { + case '\\': + escaped++ + cursor++ + switch char(b, cursor) { + case '"', '\\', '/', 'b', 'f', 'n', 'r', 't': + cursor++ + case 'u': + buflen := int64(len(buf)) + if cursor+5 >= buflen { + return nil, 0, errors.ErrUnexpectedEndOfJSON("escaped string", cursor) + } + for i := int64(1); i <= 4; i++ { + c := char(b, cursor+i) + if !(('0' <= c && c <= '9') || ('a' <= c && c <= 'f') || ('A' <= c && c <= 'F')) { + return nil, 0, errors.ErrSyntax(fmt.Sprintf("json: invalid character %c in \\u hexadecimal character escape", c), cursor+i) + } + } + cursor += 5 + default: + return nil, 0, errors.ErrUnexpectedEndOfJSON("escaped string", cursor) + } + continue + case '"': + literal := buf[start:cursor] + if escaped > 0 { + literal = literal[:unescapeString(literal)] + } + cursor++ + return literal, cursor, nil + case nul: + return nil, 0, errors.ErrUnexpectedEndOfJSON("string", cursor) + } + cursor++ + } + case 'n': + if err := validateNull(buf, cursor); err != nil { + return nil, 0, err + } + cursor += 4 + return nil, cursor, nil + default: + return nil, 0, errors.ErrInvalidBeginningOfValue(buf[cursor], cursor) + } + } +} + +var unescapeMap = [256]byte{ + '"': '"', + '\\': '\\', + '/': '/', + 'b': '\b', + 'f': '\f', + 'n': '\n', + 'r': '\r', + 't': '\t', +} + +func unsafeAdd(ptr unsafe.Pointer, offset int) unsafe.Pointer { + return unsafe.Pointer(uintptr(ptr) + uintptr(offset)) +} + +func unescapeString(buf []byte) int { + p := (*sliceHeader)(unsafe.Pointer(&buf)).data + end := unsafeAdd(p, len(buf)) + src := unsafeAdd(p, bytes.IndexByte(buf, '\\')) + dst := src + for src != end { + c := char(src, 0) + if c == '\\' { + escapeChar := char(src, 1) + if escapeChar != 'u' { + *(*byte)(dst) = unescapeMap[escapeChar] + src = unsafeAdd(src, 2) + dst = unsafeAdd(dst, 1) + } else { + v1 := hexToInt[char(src, 2)] + v2 := hexToInt[char(src, 3)] + v3 := hexToInt[char(src, 4)] + v4 := hexToInt[char(src, 5)] + code := rune((v1 << 12) | (v2 << 8) | (v3 << 4) | v4) + if code >= 0xd800 && code < 0xdc00 && uintptr(unsafeAdd(src, 11)) < uintptr(end) { + if char(src, 6) == '\\' && char(src, 7) == 'u' { + v1 := hexToInt[char(src, 8)] + v2 := hexToInt[char(src, 9)] + v3 := hexToInt[char(src, 10)] + v4 := hexToInt[char(src, 11)] + lo := rune((v1 << 12) | (v2 << 8) | (v3 << 4) | v4) + if lo >= 0xdc00 && lo < 0xe000 { + code = (code-0xd800)<<10 | (lo - 0xdc00) + 0x10000 + src = unsafeAdd(src, 6) + } + } + } + var b [utf8.UTFMax]byte + n := utf8.EncodeRune(b[:], code) + switch n { + case 4: + *(*byte)(unsafeAdd(dst, 3)) = b[3] + fallthrough + case 3: + *(*byte)(unsafeAdd(dst, 2)) = b[2] + fallthrough + case 2: + *(*byte)(unsafeAdd(dst, 1)) = b[1] + fallthrough + case 1: + *(*byte)(unsafeAdd(dst, 0)) = b[0] + } + src = unsafeAdd(src, 6) + dst = unsafeAdd(dst, n) + } + } else { + *(*byte)(dst) = c + src = unsafeAdd(src, 1) + dst = unsafeAdd(dst, 1) + } + } + return int(uintptr(dst) - uintptr(p)) +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/struct.go b/vendor/github.com/goccy/go-json/internal/decoder/struct.go new file mode 100644 index 000000000..313da153b --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/struct.go @@ -0,0 +1,845 @@ +package decoder + +import ( + "fmt" + "math" + "math/bits" + "sort" + "strings" + "unicode" + "unicode/utf16" + "unsafe" + + "github.com/goccy/go-json/internal/errors" +) + +type structFieldSet struct { + dec Decoder + offset uintptr + isTaggedKey bool + fieldIdx int + key string + keyLen int64 + err error +} + +type structDecoder struct { + fieldMap map[string]*structFieldSet + fieldUniqueNameNum int + stringDecoder *stringDecoder + structName string + fieldName string + isTriedOptimize bool + keyBitmapUint8 [][256]uint8 + keyBitmapUint16 [][256]uint16 + sortedFieldSets []*structFieldSet + keyDecoder func(*structDecoder, []byte, int64) (int64, *structFieldSet, error) + keyStreamDecoder func(*structDecoder, *Stream) (*structFieldSet, string, error) +} + +var ( + largeToSmallTable [256]byte +) + +func init() { + for i := 0; i < 256; i++ { + c := i + if 'A' <= c && c <= 'Z' { + c += 'a' - 'A' + } + largeToSmallTable[i] = byte(c) + } +} + +func toASCIILower(s string) string { + b := []byte(s) + for i := range b { + b[i] = largeToSmallTable[b[i]] + } + return string(b) +} + +func newStructDecoder(structName, fieldName string, fieldMap map[string]*structFieldSet) *structDecoder { + return &structDecoder{ + fieldMap: fieldMap, + stringDecoder: newStringDecoder(structName, fieldName), + structName: structName, + fieldName: fieldName, + keyDecoder: decodeKey, + keyStreamDecoder: decodeKeyStream, + } +} + +const ( + allowOptimizeMaxKeyLen = 64 + allowOptimizeMaxFieldLen = 16 +) + +func (d *structDecoder) tryOptimize() { + fieldUniqueNameMap := map[string]int{} + fieldIdx := -1 + for k, v := range d.fieldMap { + lower := strings.ToLower(k) + idx, exists := fieldUniqueNameMap[lower] + if exists { + v.fieldIdx = idx + } else { + fieldIdx++ + v.fieldIdx = fieldIdx + } + fieldUniqueNameMap[lower] = fieldIdx + } + d.fieldUniqueNameNum = len(fieldUniqueNameMap) + + if d.isTriedOptimize { + return + } + fieldMap := map[string]*structFieldSet{} + conflicted := map[string]struct{}{} + for k, v := range d.fieldMap { + key := strings.ToLower(k) + if key != k { + if key != toASCIILower(k) { + d.isTriedOptimize = true + return + } + // already exists same key (e.g. Hello and HELLO has same lower case key + if _, exists := conflicted[key]; exists { + d.isTriedOptimize = true + return + } + conflicted[key] = struct{}{} + } + if field, exists := fieldMap[key]; exists { + if field != v { + d.isTriedOptimize = true + return + } + } + fieldMap[key] = v + } + + if len(fieldMap) > allowOptimizeMaxFieldLen { + d.isTriedOptimize = true + return + } + + var maxKeyLen int + sortedKeys := []string{} + for key := range fieldMap { + keyLen := len(key) + if keyLen > allowOptimizeMaxKeyLen { + d.isTriedOptimize = true + return + } + if maxKeyLen < keyLen { + maxKeyLen = keyLen + } + sortedKeys = append(sortedKeys, key) + } + sort.Strings(sortedKeys) + + // By allocating one extra capacity than `maxKeyLen`, + // it is possible to avoid the process of comparing the index of the key with the length of the bitmap each time. + bitmapLen := maxKeyLen + 1 + if len(sortedKeys) <= 8 { + keyBitmap := make([][256]uint8, bitmapLen) + for i, key := range sortedKeys { + for j := 0; j < len(key); j++ { + c := key[j] + keyBitmap[j][c] |= (1 << uint(i)) + } + d.sortedFieldSets = append(d.sortedFieldSets, fieldMap[key]) + } + d.keyBitmapUint8 = keyBitmap + d.keyDecoder = decodeKeyByBitmapUint8 + d.keyStreamDecoder = decodeKeyByBitmapUint8Stream + } else { + keyBitmap := make([][256]uint16, bitmapLen) + for i, key := range sortedKeys { + for j := 0; j < len(key); j++ { + c := key[j] + keyBitmap[j][c] |= (1 << uint(i)) + } + d.sortedFieldSets = append(d.sortedFieldSets, fieldMap[key]) + } + d.keyBitmapUint16 = keyBitmap + d.keyDecoder = decodeKeyByBitmapUint16 + d.keyStreamDecoder = decodeKeyByBitmapUint16Stream + } +} + +// decode from '\uXXXX' +func decodeKeyCharByUnicodeRune(buf []byte, cursor int64) ([]byte, int64, error) { + const defaultOffset = 4 + const surrogateOffset = 6 + + if cursor+defaultOffset >= int64(len(buf)) { + return nil, 0, errors.ErrUnexpectedEndOfJSON("escaped string", cursor) + } + + r := unicodeToRune(buf[cursor : cursor+defaultOffset]) + if utf16.IsSurrogate(r) { + cursor += defaultOffset + if cursor+surrogateOffset >= int64(len(buf)) || buf[cursor] != '\\' || buf[cursor+1] != 'u' { + return []byte(string(unicode.ReplacementChar)), cursor + defaultOffset - 1, nil + } + cursor += 2 + r2 := unicodeToRune(buf[cursor : cursor+defaultOffset]) + if r := utf16.DecodeRune(r, r2); r != unicode.ReplacementChar { + return []byte(string(r)), cursor + defaultOffset - 1, nil + } + } + return []byte(string(r)), cursor + defaultOffset - 1, nil +} + +func decodeKeyCharByEscapedChar(buf []byte, cursor int64) ([]byte, int64, error) { + c := buf[cursor] + cursor++ + switch c { + case '"': + return []byte{'"'}, cursor, nil + case '\\': + return []byte{'\\'}, cursor, nil + case '/': + return []byte{'/'}, cursor, nil + case 'b': + return []byte{'\b'}, cursor, nil + case 'f': + return []byte{'\f'}, cursor, nil + case 'n': + return []byte{'\n'}, cursor, nil + case 'r': + return []byte{'\r'}, cursor, nil + case 't': + return []byte{'\t'}, cursor, nil + case 'u': + return decodeKeyCharByUnicodeRune(buf, cursor) + } + return nil, cursor, nil +} + +func decodeKeyByBitmapUint8(d *structDecoder, buf []byte, cursor int64) (int64, *structFieldSet, error) { + var ( + curBit uint8 = math.MaxUint8 + ) + b := (*sliceHeader)(unsafe.Pointer(&buf)).data + for { + switch char(b, cursor) { + case ' ', '\n', '\t', '\r': + cursor++ + case '"': + cursor++ + c := char(b, cursor) + switch c { + case '"': + cursor++ + return cursor, nil, nil + case nul: + return 0, nil, errors.ErrUnexpectedEndOfJSON("string", cursor) + } + keyIdx := 0 + bitmap := d.keyBitmapUint8 + start := cursor + for { + c := char(b, cursor) + switch c { + case '"': + fieldSetIndex := bits.TrailingZeros8(curBit) + field := d.sortedFieldSets[fieldSetIndex] + keyLen := cursor - start + cursor++ + if keyLen < field.keyLen { + // early match + return cursor, nil, nil + } + return cursor, field, nil + case nul: + return 0, nil, errors.ErrUnexpectedEndOfJSON("string", cursor) + case '\\': + cursor++ + chars, nextCursor, err := decodeKeyCharByEscapedChar(buf, cursor) + if err != nil { + return 0, nil, err + } + for _, c := range chars { + curBit &= bitmap[keyIdx][largeToSmallTable[c]] + if curBit == 0 { + return decodeKeyNotFound(b, cursor) + } + keyIdx++ + } + cursor = nextCursor + default: + curBit &= bitmap[keyIdx][largeToSmallTable[c]] + if curBit == 0 { + return decodeKeyNotFound(b, cursor) + } + keyIdx++ + } + cursor++ + } + default: + return cursor, nil, errors.ErrInvalidBeginningOfValue(char(b, cursor), cursor) + } + } +} + +func decodeKeyByBitmapUint16(d *structDecoder, buf []byte, cursor int64) (int64, *structFieldSet, error) { + var ( + curBit uint16 = math.MaxUint16 + ) + b := (*sliceHeader)(unsafe.Pointer(&buf)).data + for { + switch char(b, cursor) { + case ' ', '\n', '\t', '\r': + cursor++ + case '"': + cursor++ + c := char(b, cursor) + switch c { + case '"': + cursor++ + return cursor, nil, nil + case nul: + return 0, nil, errors.ErrUnexpectedEndOfJSON("string", cursor) + } + keyIdx := 0 + bitmap := d.keyBitmapUint16 + start := cursor + for { + c := char(b, cursor) + switch c { + case '"': + fieldSetIndex := bits.TrailingZeros16(curBit) + field := d.sortedFieldSets[fieldSetIndex] + keyLen := cursor - start + cursor++ + if keyLen < field.keyLen { + // early match + return cursor, nil, nil + } + return cursor, field, nil + case nul: + return 0, nil, errors.ErrUnexpectedEndOfJSON("string", cursor) + case '\\': + cursor++ + chars, nextCursor, err := decodeKeyCharByEscapedChar(buf, cursor) + if err != nil { + return 0, nil, err + } + for _, c := range chars { + curBit &= bitmap[keyIdx][largeToSmallTable[c]] + if curBit == 0 { + return decodeKeyNotFound(b, cursor) + } + keyIdx++ + } + cursor = nextCursor + default: + curBit &= bitmap[keyIdx][largeToSmallTable[c]] + if curBit == 0 { + return decodeKeyNotFound(b, cursor) + } + keyIdx++ + } + cursor++ + } + default: + return cursor, nil, errors.ErrInvalidBeginningOfValue(char(b, cursor), cursor) + } + } +} + +func decodeKeyNotFound(b unsafe.Pointer, cursor int64) (int64, *structFieldSet, error) { + for { + cursor++ + switch char(b, cursor) { + case '"': + cursor++ + return cursor, nil, nil + case '\\': + cursor++ + if char(b, cursor) == nul { + return 0, nil, errors.ErrUnexpectedEndOfJSON("string", cursor) + } + case nul: + return 0, nil, errors.ErrUnexpectedEndOfJSON("string", cursor) + } + } +} + +func decodeKey(d *structDecoder, buf []byte, cursor int64) (int64, *structFieldSet, error) { + key, c, err := d.stringDecoder.decodeByte(buf, cursor) + if err != nil { + return 0, nil, err + } + cursor = c + k := *(*string)(unsafe.Pointer(&key)) + field, exists := d.fieldMap[k] + if !exists { + return cursor, nil, nil + } + return cursor, field, nil +} + +func decodeKeyByBitmapUint8Stream(d *structDecoder, s *Stream) (*structFieldSet, string, error) { + var ( + curBit uint8 = math.MaxUint8 + ) + _, cursor, p := s.stat() + for { + switch char(p, cursor) { + case ' ', '\n', '\t', '\r': + cursor++ + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + return nil, "", errors.ErrInvalidBeginningOfValue(char(p, cursor), s.totalOffset()) + case '"': + cursor++ + FIRST_CHAR: + start := cursor + switch char(p, cursor) { + case '"': + cursor++ + s.cursor = cursor + return nil, "", nil + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + goto FIRST_CHAR + } + return nil, "", errors.ErrUnexpectedEndOfJSON("string", s.totalOffset()) + } + keyIdx := 0 + bitmap := d.keyBitmapUint8 + for { + c := char(p, cursor) + switch c { + case '"': + fieldSetIndex := bits.TrailingZeros8(curBit) + field := d.sortedFieldSets[fieldSetIndex] + keyLen := cursor - start + cursor++ + s.cursor = cursor + if keyLen < field.keyLen { + // early match + return nil, field.key, nil + } + return field, field.key, nil + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + return nil, "", errors.ErrUnexpectedEndOfJSON("string", s.totalOffset()) + case '\\': + s.cursor = cursor + 1 // skip '\' char + chars, err := decodeKeyCharByEscapeCharStream(s) + if err != nil { + return nil, "", err + } + cursor = s.cursor + for _, c := range chars { + curBit &= bitmap[keyIdx][largeToSmallTable[c]] + if curBit == 0 { + s.cursor = cursor + return decodeKeyNotFoundStream(s, start) + } + keyIdx++ + } + default: + curBit &= bitmap[keyIdx][largeToSmallTable[c]] + if curBit == 0 { + s.cursor = cursor + return decodeKeyNotFoundStream(s, start) + } + keyIdx++ + } + cursor++ + } + default: + return nil, "", errors.ErrInvalidBeginningOfValue(char(p, cursor), s.totalOffset()) + } + } +} + +func decodeKeyByBitmapUint16Stream(d *structDecoder, s *Stream) (*structFieldSet, string, error) { + var ( + curBit uint16 = math.MaxUint16 + ) + _, cursor, p := s.stat() + for { + switch char(p, cursor) { + case ' ', '\n', '\t', '\r': + cursor++ + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + return nil, "", errors.ErrInvalidBeginningOfValue(char(p, cursor), s.totalOffset()) + case '"': + cursor++ + FIRST_CHAR: + start := cursor + switch char(p, cursor) { + case '"': + cursor++ + s.cursor = cursor + return nil, "", nil + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + goto FIRST_CHAR + } + return nil, "", errors.ErrUnexpectedEndOfJSON("string", s.totalOffset()) + } + keyIdx := 0 + bitmap := d.keyBitmapUint16 + for { + c := char(p, cursor) + switch c { + case '"': + fieldSetIndex := bits.TrailingZeros16(curBit) + field := d.sortedFieldSets[fieldSetIndex] + keyLen := cursor - start + cursor++ + s.cursor = cursor + if keyLen < field.keyLen { + // early match + return nil, field.key, nil + } + return field, field.key, nil + case nul: + s.cursor = cursor + if s.read() { + _, cursor, p = s.stat() + continue + } + return nil, "", errors.ErrUnexpectedEndOfJSON("string", s.totalOffset()) + case '\\': + s.cursor = cursor + 1 // skip '\' char + chars, err := decodeKeyCharByEscapeCharStream(s) + if err != nil { + return nil, "", err + } + cursor = s.cursor + for _, c := range chars { + curBit &= bitmap[keyIdx][largeToSmallTable[c]] + if curBit == 0 { + s.cursor = cursor + return decodeKeyNotFoundStream(s, start) + } + keyIdx++ + } + default: + curBit &= bitmap[keyIdx][largeToSmallTable[c]] + if curBit == 0 { + s.cursor = cursor + return decodeKeyNotFoundStream(s, start) + } + keyIdx++ + } + cursor++ + } + default: + return nil, "", errors.ErrInvalidBeginningOfValue(char(p, cursor), s.totalOffset()) + } + } +} + +// decode from '\uXXXX' +func decodeKeyCharByUnicodeRuneStream(s *Stream) ([]byte, error) { + const defaultOffset = 4 + const surrogateOffset = 6 + + if s.cursor+defaultOffset >= s.length { + if !s.read() { + return nil, errors.ErrInvalidCharacter(s.char(), "escaped unicode char", s.totalOffset()) + } + } + + r := unicodeToRune(s.buf[s.cursor : s.cursor+defaultOffset]) + if utf16.IsSurrogate(r) { + s.cursor += defaultOffset + if s.cursor+surrogateOffset >= s.length { + s.read() + } + if s.cursor+surrogateOffset >= s.length || s.buf[s.cursor] != '\\' || s.buf[s.cursor+1] != 'u' { + s.cursor += defaultOffset - 1 + return []byte(string(unicode.ReplacementChar)), nil + } + r2 := unicodeToRune(s.buf[s.cursor+defaultOffset+2 : s.cursor+surrogateOffset]) + if r := utf16.DecodeRune(r, r2); r != unicode.ReplacementChar { + s.cursor += defaultOffset - 1 + return []byte(string(r)), nil + } + } + s.cursor += defaultOffset - 1 + return []byte(string(r)), nil +} + +func decodeKeyCharByEscapeCharStream(s *Stream) ([]byte, error) { + c := s.buf[s.cursor] + s.cursor++ +RETRY: + switch c { + case '"': + return []byte{'"'}, nil + case '\\': + return []byte{'\\'}, nil + case '/': + return []byte{'/'}, nil + case 'b': + return []byte{'\b'}, nil + case 'f': + return []byte{'\f'}, nil + case 'n': + return []byte{'\n'}, nil + case 'r': + return []byte{'\r'}, nil + case 't': + return []byte{'\t'}, nil + case 'u': + return decodeKeyCharByUnicodeRuneStream(s) + case nul: + if !s.read() { + return nil, errors.ErrInvalidCharacter(s.char(), "escaped char", s.totalOffset()) + } + goto RETRY + default: + return nil, errors.ErrUnexpectedEndOfJSON("struct field", s.totalOffset()) + } +} + +func decodeKeyNotFoundStream(s *Stream, start int64) (*structFieldSet, string, error) { + buf, cursor, p := s.stat() + for { + cursor++ + switch char(p, cursor) { + case '"': + b := buf[start:cursor] + key := *(*string)(unsafe.Pointer(&b)) + cursor++ + s.cursor = cursor + return nil, key, nil + case '\\': + cursor++ + if char(p, cursor) == nul { + s.cursor = cursor + if !s.read() { + return nil, "", errors.ErrUnexpectedEndOfJSON("string", s.totalOffset()) + } + buf, cursor, p = s.statForRetry() + } + case nul: + s.cursor = cursor + if !s.read() { + return nil, "", errors.ErrUnexpectedEndOfJSON("string", s.totalOffset()) + } + buf, cursor, p = s.statForRetry() + } + } +} + +func decodeKeyStream(d *structDecoder, s *Stream) (*structFieldSet, string, error) { + key, err := d.stringDecoder.decodeStreamByte(s) + if err != nil { + return nil, "", err + } + k := *(*string)(unsafe.Pointer(&key)) + return d.fieldMap[k], k, nil +} + +func (d *structDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + depth++ + if depth > maxDecodeNestingDepth { + return errors.ErrExceededMaxDepth(s.char(), s.cursor) + } + + c := s.skipWhiteSpace() + switch c { + case 'n': + if err := nullBytes(s); err != nil { + return err + } + return nil + default: + if s.char() != '{' { + return errors.ErrInvalidBeginningOfValue(s.char(), s.totalOffset()) + } + } + s.cursor++ + if s.skipWhiteSpace() == '}' { + s.cursor++ + return nil + } + var ( + seenFields map[int]struct{} + seenFieldNum int + ) + firstWin := (s.Option.Flags & FirstWinOption) != 0 + if firstWin { + seenFields = make(map[int]struct{}, d.fieldUniqueNameNum) + } + for { + s.reset() + field, key, err := d.keyStreamDecoder(d, s) + if err != nil { + return err + } + if s.skipWhiteSpace() != ':' { + return errors.ErrExpected("colon after object key", s.totalOffset()) + } + s.cursor++ + if field != nil { + if field.err != nil { + return field.err + } + if firstWin { + if _, exists := seenFields[field.fieldIdx]; exists { + if err := s.skipValue(depth); err != nil { + return err + } + } else { + if err := field.dec.DecodeStream(s, depth, unsafe.Pointer(uintptr(p)+field.offset)); err != nil { + return err + } + seenFieldNum++ + if d.fieldUniqueNameNum <= seenFieldNum { + return s.skipObject(depth) + } + seenFields[field.fieldIdx] = struct{}{} + } + } else { + if err := field.dec.DecodeStream(s, depth, unsafe.Pointer(uintptr(p)+field.offset)); err != nil { + return err + } + } + } else if s.DisallowUnknownFields { + return fmt.Errorf("json: unknown field %q", key) + } else { + if err := s.skipValue(depth); err != nil { + return err + } + } + c := s.skipWhiteSpace() + if c == '}' { + s.cursor++ + return nil + } + if c != ',' { + return errors.ErrExpected("comma after object element", s.totalOffset()) + } + s.cursor++ + } +} + +func (d *structDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + depth++ + if depth > maxDecodeNestingDepth { + return 0, errors.ErrExceededMaxDepth(buf[cursor], cursor) + } + buflen := int64(len(buf)) + cursor = skipWhiteSpace(buf, cursor) + b := (*sliceHeader)(unsafe.Pointer(&buf)).data + switch char(b, cursor) { + case 'n': + if err := validateNull(buf, cursor); err != nil { + return 0, err + } + cursor += 4 + return cursor, nil + case '{': + default: + return 0, errors.ErrInvalidBeginningOfValue(char(b, cursor), cursor) + } + cursor++ + cursor = skipWhiteSpace(buf, cursor) + if buf[cursor] == '}' { + cursor++ + return cursor, nil + } + var ( + seenFields map[int]struct{} + seenFieldNum int + ) + firstWin := (ctx.Option.Flags & FirstWinOption) != 0 + if firstWin { + seenFields = make(map[int]struct{}, d.fieldUniqueNameNum) + } + for { + c, field, err := d.keyDecoder(d, buf, cursor) + if err != nil { + return 0, err + } + cursor = skipWhiteSpace(buf, c) + if char(b, cursor) != ':' { + return 0, errors.ErrExpected("colon after object key", cursor) + } + cursor++ + if cursor >= buflen { + return 0, errors.ErrExpected("object value after colon", cursor) + } + if field != nil { + if field.err != nil { + return 0, field.err + } + if firstWin { + if _, exists := seenFields[field.fieldIdx]; exists { + c, err := skipValue(buf, cursor, depth) + if err != nil { + return 0, err + } + cursor = c + } else { + c, err := field.dec.Decode(ctx, cursor, depth, unsafe.Pointer(uintptr(p)+field.offset)) + if err != nil { + return 0, err + } + cursor = c + seenFieldNum++ + if d.fieldUniqueNameNum <= seenFieldNum { + return skipObject(buf, cursor, depth) + } + seenFields[field.fieldIdx] = struct{}{} + } + } else { + c, err := field.dec.Decode(ctx, cursor, depth, unsafe.Pointer(uintptr(p)+field.offset)) + if err != nil { + return 0, err + } + cursor = c + } + } else { + c, err := skipValue(buf, cursor, depth) + if err != nil { + return 0, err + } + cursor = c + } + cursor = skipWhiteSpace(buf, cursor) + if char(b, cursor) == '}' { + cursor++ + return cursor, nil + } + if char(b, cursor) != ',' { + return 0, errors.ErrExpected("comma after object element", cursor) + } + cursor++ + } +} + +func (d *structDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: struct decoder does not support decode path") +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/type.go b/vendor/github.com/goccy/go-json/internal/decoder/type.go new file mode 100644 index 000000000..beaf3ab86 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/type.go @@ -0,0 +1,30 @@ +package decoder + +import ( + "context" + "encoding" + "encoding/json" + "reflect" + "unsafe" +) + +type Decoder interface { + Decode(*RuntimeContext, int64, int64, unsafe.Pointer) (int64, error) + DecodePath(*RuntimeContext, int64, int64) ([][]byte, int64, error) + DecodeStream(*Stream, int64, unsafe.Pointer) error +} + +const ( + nul = '\000' + maxDecodeNestingDepth = 10000 +) + +type unmarshalerContext interface { + UnmarshalJSON(context.Context, []byte) error +} + +var ( + unmarshalJSONType = reflect.TypeOf((*json.Unmarshaler)(nil)).Elem() + unmarshalJSONContextType = reflect.TypeOf((*unmarshalerContext)(nil)).Elem() + unmarshalTextType = reflect.TypeOf((*encoding.TextUnmarshaler)(nil)).Elem() +) diff --git a/vendor/github.com/goccy/go-json/internal/decoder/uint.go b/vendor/github.com/goccy/go-json/internal/decoder/uint.go new file mode 100644 index 000000000..4131731b8 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/uint.go @@ -0,0 +1,194 @@ +package decoder + +import ( + "fmt" + "reflect" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type uintDecoder struct { + typ *runtime.Type + kind reflect.Kind + op func(unsafe.Pointer, uint64) + structName string + fieldName string +} + +func newUintDecoder(typ *runtime.Type, structName, fieldName string, op func(unsafe.Pointer, uint64)) *uintDecoder { + return &uintDecoder{ + typ: typ, + kind: typ.Kind(), + op: op, + structName: structName, + fieldName: fieldName, + } +} + +func (d *uintDecoder) typeError(buf []byte, offset int64) *errors.UnmarshalTypeError { + return &errors.UnmarshalTypeError{ + Value: fmt.Sprintf("number %s", string(buf)), + Type: runtime.RType2Type(d.typ), + Offset: offset, + } +} + +var ( + pow10u64 = [...]uint64{ + 1e00, 1e01, 1e02, 1e03, 1e04, 1e05, 1e06, 1e07, 1e08, 1e09, + 1e10, 1e11, 1e12, 1e13, 1e14, 1e15, 1e16, 1e17, 1e18, 1e19, + } + pow10u64Len = len(pow10u64) +) + +func (d *uintDecoder) parseUint(b []byte) (uint64, error) { + maxDigit := len(b) + if maxDigit > pow10u64Len { + return 0, fmt.Errorf("invalid length of number") + } + sum := uint64(0) + for i := 0; i < maxDigit; i++ { + c := uint64(b[i]) - 48 + digitValue := pow10u64[maxDigit-i-1] + sum += c * digitValue + } + return sum, nil +} + +func (d *uintDecoder) decodeStreamByte(s *Stream) ([]byte, error) { + for { + switch s.char() { + case ' ', '\n', '\t', '\r': + s.cursor++ + continue + case '0': + s.cursor++ + return numZeroBuf, nil + case '1', '2', '3', '4', '5', '6', '7', '8', '9': + start := s.cursor + for { + s.cursor++ + if numTable[s.char()] { + continue + } else if s.char() == nul { + if s.read() { + s.cursor-- // for retry current character + continue + } + } + break + } + num := s.buf[start:s.cursor] + return num, nil + case 'n': + if err := nullBytes(s); err != nil { + return nil, err + } + return nil, nil + case nul: + if s.read() { + continue + } + default: + return nil, d.typeError([]byte{s.char()}, s.totalOffset()) + } + break + } + return nil, errors.ErrUnexpectedEndOfJSON("number(unsigned integer)", s.totalOffset()) +} + +func (d *uintDecoder) decodeByte(buf []byte, cursor int64) ([]byte, int64, error) { + for { + switch buf[cursor] { + case ' ', '\n', '\t', '\r': + cursor++ + continue + case '0': + cursor++ + return numZeroBuf, cursor, nil + case '1', '2', '3', '4', '5', '6', '7', '8', '9': + start := cursor + cursor++ + for numTable[buf[cursor]] { + cursor++ + } + num := buf[start:cursor] + return num, cursor, nil + case 'n': + if err := validateNull(buf, cursor); err != nil { + return nil, 0, err + } + cursor += 4 + return nil, cursor, nil + default: + return nil, 0, d.typeError([]byte{buf[cursor]}, cursor) + } + } +} + +func (d *uintDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + bytes, err := d.decodeStreamByte(s) + if err != nil { + return err + } + if bytes == nil { + return nil + } + u64, err := d.parseUint(bytes) + if err != nil { + return d.typeError(bytes, s.totalOffset()) + } + switch d.kind { + case reflect.Uint8: + if (1 << 8) <= u64 { + return d.typeError(bytes, s.totalOffset()) + } + case reflect.Uint16: + if (1 << 16) <= u64 { + return d.typeError(bytes, s.totalOffset()) + } + case reflect.Uint32: + if (1 << 32) <= u64 { + return d.typeError(bytes, s.totalOffset()) + } + } + d.op(p, u64) + return nil +} + +func (d *uintDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + bytes, c, err := d.decodeByte(ctx.Buf, cursor) + if err != nil { + return 0, err + } + if bytes == nil { + return c, nil + } + cursor = c + u64, err := d.parseUint(bytes) + if err != nil { + return 0, d.typeError(bytes, cursor) + } + switch d.kind { + case reflect.Uint8: + if (1 << 8) <= u64 { + return 0, d.typeError(bytes, cursor) + } + case reflect.Uint16: + if (1 << 16) <= u64 { + return 0, d.typeError(bytes, cursor) + } + case reflect.Uint32: + if (1 << 32) <= u64 { + return 0, d.typeError(bytes, cursor) + } + } + d.op(p, u64) + return cursor, nil +} + +func (d *uintDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: uint decoder does not support decode path") +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/unmarshal_json.go b/vendor/github.com/goccy/go-json/internal/decoder/unmarshal_json.go new file mode 100644 index 000000000..4cd6dbd57 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/unmarshal_json.go @@ -0,0 +1,104 @@ +package decoder + +import ( + "context" + "encoding/json" + "fmt" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type unmarshalJSONDecoder struct { + typ *runtime.Type + structName string + fieldName string +} + +func newUnmarshalJSONDecoder(typ *runtime.Type, structName, fieldName string) *unmarshalJSONDecoder { + return &unmarshalJSONDecoder{ + typ: typ, + structName: structName, + fieldName: fieldName, + } +} + +func (d *unmarshalJSONDecoder) annotateError(cursor int64, err error) { + switch e := err.(type) { + case *errors.UnmarshalTypeError: + e.Struct = d.structName + e.Field = d.fieldName + case *errors.SyntaxError: + e.Offset = cursor + } +} + +func (d *unmarshalJSONDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + s.skipWhiteSpace() + start := s.cursor + if err := s.skipValue(depth); err != nil { + return err + } + src := s.buf[start:s.cursor] + dst := make([]byte, len(src)) + copy(dst, src) + + v := *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: d.typ, + ptr: p, + })) + switch v := v.(type) { + case unmarshalerContext: + var ctx context.Context + if (s.Option.Flags & ContextOption) != 0 { + ctx = s.Option.Context + } else { + ctx = context.Background() + } + if err := v.UnmarshalJSON(ctx, dst); err != nil { + d.annotateError(s.cursor, err) + return err + } + case json.Unmarshaler: + if err := v.UnmarshalJSON(dst); err != nil { + d.annotateError(s.cursor, err) + return err + } + } + return nil +} + +func (d *unmarshalJSONDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + cursor = skipWhiteSpace(buf, cursor) + start := cursor + end, err := skipValue(buf, cursor, depth) + if err != nil { + return 0, err + } + src := buf[start:end] + dst := make([]byte, len(src)) + copy(dst, src) + + v := *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: d.typ, + ptr: p, + })) + if (ctx.Option.Flags & ContextOption) != 0 { + if err := v.(unmarshalerContext).UnmarshalJSON(ctx.Option.Context, dst); err != nil { + d.annotateError(cursor, err) + return 0, err + } + } else { + if err := v.(json.Unmarshaler).UnmarshalJSON(dst); err != nil { + d.annotateError(cursor, err) + return 0, err + } + } + return end, nil +} + +func (d *unmarshalJSONDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: unmarshal json decoder does not support decode path") +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/unmarshal_text.go b/vendor/github.com/goccy/go-json/internal/decoder/unmarshal_text.go new file mode 100644 index 000000000..6d37993f0 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/unmarshal_text.go @@ -0,0 +1,285 @@ +package decoder + +import ( + "bytes" + "encoding" + "fmt" + "unicode" + "unicode/utf16" + "unicode/utf8" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type unmarshalTextDecoder struct { + typ *runtime.Type + structName string + fieldName string +} + +func newUnmarshalTextDecoder(typ *runtime.Type, structName, fieldName string) *unmarshalTextDecoder { + return &unmarshalTextDecoder{ + typ: typ, + structName: structName, + fieldName: fieldName, + } +} + +func (d *unmarshalTextDecoder) annotateError(cursor int64, err error) { + switch e := err.(type) { + case *errors.UnmarshalTypeError: + e.Struct = d.structName + e.Field = d.fieldName + case *errors.SyntaxError: + e.Offset = cursor + } +} + +var ( + nullbytes = []byte(`null`) +) + +func (d *unmarshalTextDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + s.skipWhiteSpace() + start := s.cursor + if err := s.skipValue(depth); err != nil { + return err + } + src := s.buf[start:s.cursor] + if len(src) > 0 { + switch src[0] { + case '[': + return &errors.UnmarshalTypeError{ + Value: "array", + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + } + case '{': + return &errors.UnmarshalTypeError{ + Value: "object", + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + } + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return &errors.UnmarshalTypeError{ + Value: "number", + Type: runtime.RType2Type(d.typ), + Offset: s.totalOffset(), + } + case 'n': + if bytes.Equal(src, nullbytes) { + *(*unsafe.Pointer)(p) = nil + return nil + } + } + } + dst := make([]byte, len(src)) + copy(dst, src) + + if b, ok := unquoteBytes(dst); ok { + dst = b + } + v := *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: d.typ, + ptr: p, + })) + if err := v.(encoding.TextUnmarshaler).UnmarshalText(dst); err != nil { + d.annotateError(s.cursor, err) + return err + } + return nil +} + +func (d *unmarshalTextDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + buf := ctx.Buf + cursor = skipWhiteSpace(buf, cursor) + start := cursor + end, err := skipValue(buf, cursor, depth) + if err != nil { + return 0, err + } + src := buf[start:end] + if len(src) > 0 { + switch src[0] { + case '[': + return 0, &errors.UnmarshalTypeError{ + Value: "array", + Type: runtime.RType2Type(d.typ), + Offset: start, + } + case '{': + return 0, &errors.UnmarshalTypeError{ + Value: "object", + Type: runtime.RType2Type(d.typ), + Offset: start, + } + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return 0, &errors.UnmarshalTypeError{ + Value: "number", + Type: runtime.RType2Type(d.typ), + Offset: start, + } + case 'n': + if bytes.Equal(src, nullbytes) { + *(*unsafe.Pointer)(p) = nil + return end, nil + } + } + } + + if s, ok := unquoteBytes(src); ok { + src = s + } + v := *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: d.typ, + ptr: *(*unsafe.Pointer)(unsafe.Pointer(&p)), + })) + if err := v.(encoding.TextUnmarshaler).UnmarshalText(src); err != nil { + d.annotateError(cursor, err) + return 0, err + } + return end, nil +} + +func (d *unmarshalTextDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: unmarshal text decoder does not support decode path") +} + +func unquoteBytes(s []byte) (t []byte, ok bool) { + length := len(s) + if length < 2 || s[0] != '"' || s[length-1] != '"' { + return + } + s = s[1 : length-1] + length -= 2 + + // Check for unusual characters. If there are none, + // then no unquoting is needed, so return a slice of the + // original bytes. + r := 0 + for r < length { + c := s[r] + if c == '\\' || c == '"' || c < ' ' { + break + } + if c < utf8.RuneSelf { + r++ + continue + } + rr, size := utf8.DecodeRune(s[r:]) + if rr == utf8.RuneError && size == 1 { + break + } + r += size + } + if r == length { + return s, true + } + + b := make([]byte, length+2*utf8.UTFMax) + w := copy(b, s[0:r]) + for r < length { + // Out of room? Can only happen if s is full of + // malformed UTF-8 and we're replacing each + // byte with RuneError. + if w >= len(b)-2*utf8.UTFMax { + nb := make([]byte, (len(b)+utf8.UTFMax)*2) + copy(nb, b[0:w]) + b = nb + } + switch c := s[r]; { + case c == '\\': + r++ + if r >= length { + return + } + switch s[r] { + default: + return + case '"', '\\', '/', '\'': + b[w] = s[r] + r++ + w++ + case 'b': + b[w] = '\b' + r++ + w++ + case 'f': + b[w] = '\f' + r++ + w++ + case 'n': + b[w] = '\n' + r++ + w++ + case 'r': + b[w] = '\r' + r++ + w++ + case 't': + b[w] = '\t' + r++ + w++ + case 'u': + r-- + rr := getu4(s[r:]) + if rr < 0 { + return + } + r += 6 + if utf16.IsSurrogate(rr) { + rr1 := getu4(s[r:]) + if dec := utf16.DecodeRune(rr, rr1); dec != unicode.ReplacementChar { + // A valid pair; consume. + r += 6 + w += utf8.EncodeRune(b[w:], dec) + break + } + // Invalid surrogate; fall back to replacement rune. + rr = unicode.ReplacementChar + } + w += utf8.EncodeRune(b[w:], rr) + } + + // Quote, control characters are invalid. + case c == '"', c < ' ': + return + + // ASCII + case c < utf8.RuneSelf: + b[w] = c + r++ + w++ + + // Coerce to well-formed UTF-8. + default: + rr, size := utf8.DecodeRune(s[r:]) + r += size + w += utf8.EncodeRune(b[w:], rr) + } + } + return b[0:w], true +} + +func getu4(s []byte) rune { + if len(s) < 6 || s[0] != '\\' || s[1] != 'u' { + return -1 + } + var r rune + for _, c := range s[2:6] { + switch { + case '0' <= c && c <= '9': + c = c - '0' + case 'a' <= c && c <= 'f': + c = c - 'a' + 10 + case 'A' <= c && c <= 'F': + c = c - 'A' + 10 + default: + return -1 + } + r = r*16 + rune(c) + } + return r +} diff --git a/vendor/github.com/goccy/go-json/internal/decoder/wrapped_string.go b/vendor/github.com/goccy/go-json/internal/decoder/wrapped_string.go new file mode 100644 index 000000000..0c4e2e6ea --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/decoder/wrapped_string.go @@ -0,0 +1,73 @@ +package decoder + +import ( + "fmt" + "reflect" + "unsafe" + + "github.com/goccy/go-json/internal/runtime" +) + +type wrappedStringDecoder struct { + typ *runtime.Type + dec Decoder + stringDecoder *stringDecoder + structName string + fieldName string + isPtrType bool +} + +func newWrappedStringDecoder(typ *runtime.Type, dec Decoder, structName, fieldName string) *wrappedStringDecoder { + return &wrappedStringDecoder{ + typ: typ, + dec: dec, + stringDecoder: newStringDecoder(structName, fieldName), + structName: structName, + fieldName: fieldName, + isPtrType: typ.Kind() == reflect.Ptr, + } +} + +func (d *wrappedStringDecoder) DecodeStream(s *Stream, depth int64, p unsafe.Pointer) error { + bytes, err := d.stringDecoder.decodeStreamByte(s) + if err != nil { + return err + } + if bytes == nil { + if d.isPtrType { + *(*unsafe.Pointer)(p) = nil + } + return nil + } + b := make([]byte, len(bytes)+1) + copy(b, bytes) + if _, err := d.dec.Decode(&RuntimeContext{Buf: b}, 0, depth, p); err != nil { + return err + } + return nil +} + +func (d *wrappedStringDecoder) Decode(ctx *RuntimeContext, cursor, depth int64, p unsafe.Pointer) (int64, error) { + bytes, c, err := d.stringDecoder.decodeByte(ctx.Buf, cursor) + if err != nil { + return 0, err + } + if bytes == nil { + if d.isPtrType { + *(*unsafe.Pointer)(p) = nil + } + return c, nil + } + bytes = append(bytes, nul) + oldBuf := ctx.Buf + ctx.Buf = bytes + if _, err := d.dec.Decode(ctx, 0, depth, p); err != nil { + return 0, err + } + ctx.Buf = oldBuf + return c, nil +} + +func (d *wrappedStringDecoder) DecodePath(ctx *RuntimeContext, cursor, depth int64) ([][]byte, int64, error) { + return nil, 0, fmt.Errorf("json: wrapped string decoder does not support decode path") +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/code.go b/vendor/github.com/goccy/go-json/internal/encoder/code.go new file mode 100644 index 000000000..5b08faefc --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/code.go @@ -0,0 +1,1023 @@ +package encoder + +import ( + "fmt" + "reflect" + "unsafe" + + "github.com/goccy/go-json/internal/runtime" +) + +type Code interface { + Kind() CodeKind + ToOpcode(*compileContext) Opcodes + Filter(*FieldQuery) Code +} + +type AnonymousCode interface { + ToAnonymousOpcode(*compileContext) Opcodes +} + +type Opcodes []*Opcode + +func (o Opcodes) First() *Opcode { + if len(o) == 0 { + return nil + } + return o[0] +} + +func (o Opcodes) Last() *Opcode { + if len(o) == 0 { + return nil + } + return o[len(o)-1] +} + +func (o Opcodes) Add(codes ...*Opcode) Opcodes { + return append(o, codes...) +} + +type CodeKind int + +const ( + CodeKindInterface CodeKind = iota + CodeKindPtr + CodeKindInt + CodeKindUint + CodeKindFloat + CodeKindString + CodeKindBool + CodeKindStruct + CodeKindMap + CodeKindSlice + CodeKindArray + CodeKindBytes + CodeKindMarshalJSON + CodeKindMarshalText + CodeKindRecursive +) + +type IntCode struct { + typ *runtime.Type + bitSize uint8 + isString bool + isPtr bool +} + +func (c *IntCode) Kind() CodeKind { + return CodeKindInt +} + +func (c *IntCode) ToOpcode(ctx *compileContext) Opcodes { + var code *Opcode + switch { + case c.isPtr: + code = newOpCode(ctx, c.typ, OpIntPtr) + case c.isString: + code = newOpCode(ctx, c.typ, OpIntString) + default: + code = newOpCode(ctx, c.typ, OpInt) + } + code.NumBitSize = c.bitSize + ctx.incIndex() + return Opcodes{code} +} + +func (c *IntCode) Filter(_ *FieldQuery) Code { + return c +} + +type UintCode struct { + typ *runtime.Type + bitSize uint8 + isString bool + isPtr bool +} + +func (c *UintCode) Kind() CodeKind { + return CodeKindUint +} + +func (c *UintCode) ToOpcode(ctx *compileContext) Opcodes { + var code *Opcode + switch { + case c.isPtr: + code = newOpCode(ctx, c.typ, OpUintPtr) + case c.isString: + code = newOpCode(ctx, c.typ, OpUintString) + default: + code = newOpCode(ctx, c.typ, OpUint) + } + code.NumBitSize = c.bitSize + ctx.incIndex() + return Opcodes{code} +} + +func (c *UintCode) Filter(_ *FieldQuery) Code { + return c +} + +type FloatCode struct { + typ *runtime.Type + bitSize uint8 + isPtr bool +} + +func (c *FloatCode) Kind() CodeKind { + return CodeKindFloat +} + +func (c *FloatCode) ToOpcode(ctx *compileContext) Opcodes { + var code *Opcode + switch { + case c.isPtr: + switch c.bitSize { + case 32: + code = newOpCode(ctx, c.typ, OpFloat32Ptr) + default: + code = newOpCode(ctx, c.typ, OpFloat64Ptr) + } + default: + switch c.bitSize { + case 32: + code = newOpCode(ctx, c.typ, OpFloat32) + default: + code = newOpCode(ctx, c.typ, OpFloat64) + } + } + ctx.incIndex() + return Opcodes{code} +} + +func (c *FloatCode) Filter(_ *FieldQuery) Code { + return c +} + +type StringCode struct { + typ *runtime.Type + isPtr bool +} + +func (c *StringCode) Kind() CodeKind { + return CodeKindString +} + +func (c *StringCode) ToOpcode(ctx *compileContext) Opcodes { + isJSONNumberType := c.typ == runtime.Type2RType(jsonNumberType) + var code *Opcode + if c.isPtr { + if isJSONNumberType { + code = newOpCode(ctx, c.typ, OpNumberPtr) + } else { + code = newOpCode(ctx, c.typ, OpStringPtr) + } + } else { + if isJSONNumberType { + code = newOpCode(ctx, c.typ, OpNumber) + } else { + code = newOpCode(ctx, c.typ, OpString) + } + } + ctx.incIndex() + return Opcodes{code} +} + +func (c *StringCode) Filter(_ *FieldQuery) Code { + return c +} + +type BoolCode struct { + typ *runtime.Type + isPtr bool +} + +func (c *BoolCode) Kind() CodeKind { + return CodeKindBool +} + +func (c *BoolCode) ToOpcode(ctx *compileContext) Opcodes { + var code *Opcode + switch { + case c.isPtr: + code = newOpCode(ctx, c.typ, OpBoolPtr) + default: + code = newOpCode(ctx, c.typ, OpBool) + } + ctx.incIndex() + return Opcodes{code} +} + +func (c *BoolCode) Filter(_ *FieldQuery) Code { + return c +} + +type BytesCode struct { + typ *runtime.Type + isPtr bool +} + +func (c *BytesCode) Kind() CodeKind { + return CodeKindBytes +} + +func (c *BytesCode) ToOpcode(ctx *compileContext) Opcodes { + var code *Opcode + switch { + case c.isPtr: + code = newOpCode(ctx, c.typ, OpBytesPtr) + default: + code = newOpCode(ctx, c.typ, OpBytes) + } + ctx.incIndex() + return Opcodes{code} +} + +func (c *BytesCode) Filter(_ *FieldQuery) Code { + return c +} + +type SliceCode struct { + typ *runtime.Type + value Code +} + +func (c *SliceCode) Kind() CodeKind { + return CodeKindSlice +} + +func (c *SliceCode) ToOpcode(ctx *compileContext) Opcodes { + // header => opcode => elem => end + // ^ | + // |________| + size := c.typ.Elem().Size() + header := newSliceHeaderCode(ctx, c.typ) + ctx.incIndex() + + ctx.incIndent() + codes := c.value.ToOpcode(ctx) + ctx.decIndent() + + codes.First().Flags |= IndirectFlags + elemCode := newSliceElemCode(ctx, c.typ.Elem(), header, size) + ctx.incIndex() + end := newOpCode(ctx, c.typ, OpSliceEnd) + ctx.incIndex() + header.End = end + header.Next = codes.First() + codes.Last().Next = elemCode + elemCode.Next = codes.First() + elemCode.End = end + return Opcodes{header}.Add(codes...).Add(elemCode).Add(end) +} + +func (c *SliceCode) Filter(_ *FieldQuery) Code { + return c +} + +type ArrayCode struct { + typ *runtime.Type + value Code +} + +func (c *ArrayCode) Kind() CodeKind { + return CodeKindArray +} + +func (c *ArrayCode) ToOpcode(ctx *compileContext) Opcodes { + // header => opcode => elem => end + // ^ | + // |________| + elem := c.typ.Elem() + alen := c.typ.Len() + size := elem.Size() + + header := newArrayHeaderCode(ctx, c.typ, alen) + ctx.incIndex() + + ctx.incIndent() + codes := c.value.ToOpcode(ctx) + ctx.decIndent() + + codes.First().Flags |= IndirectFlags + + elemCode := newArrayElemCode(ctx, elem, header, alen, size) + ctx.incIndex() + + end := newOpCode(ctx, c.typ, OpArrayEnd) + ctx.incIndex() + + header.End = end + header.Next = codes.First() + codes.Last().Next = elemCode + elemCode.Next = codes.First() + elemCode.End = end + + return Opcodes{header}.Add(codes...).Add(elemCode).Add(end) +} + +func (c *ArrayCode) Filter(_ *FieldQuery) Code { + return c +} + +type MapCode struct { + typ *runtime.Type + key Code + value Code +} + +func (c *MapCode) Kind() CodeKind { + return CodeKindMap +} + +func (c *MapCode) ToOpcode(ctx *compileContext) Opcodes { + // header => code => value => code => key => code => value => code => end + // ^ | + // |_______________________| + header := newMapHeaderCode(ctx, c.typ) + ctx.incIndex() + + keyCodes := c.key.ToOpcode(ctx) + + value := newMapValueCode(ctx, c.typ.Elem(), header) + ctx.incIndex() + + ctx.incIndent() + valueCodes := c.value.ToOpcode(ctx) + ctx.decIndent() + + valueCodes.First().Flags |= IndirectFlags + + key := newMapKeyCode(ctx, c.typ.Key(), header) + ctx.incIndex() + + end := newMapEndCode(ctx, c.typ, header) + ctx.incIndex() + + header.Next = keyCodes.First() + keyCodes.Last().Next = value + value.Next = valueCodes.First() + valueCodes.Last().Next = key + key.Next = keyCodes.First() + + header.End = end + key.End = end + value.End = end + return Opcodes{header}.Add(keyCodes...).Add(value).Add(valueCodes...).Add(key).Add(end) +} + +func (c *MapCode) Filter(_ *FieldQuery) Code { + return c +} + +type StructCode struct { + typ *runtime.Type + fields []*StructFieldCode + isPtr bool + disableIndirectConversion bool + isIndirect bool + isRecursive bool +} + +func (c *StructCode) Kind() CodeKind { + return CodeKindStruct +} + +func (c *StructCode) lastFieldCode(field *StructFieldCode, firstField *Opcode) *Opcode { + if isEmbeddedStruct(field) { + return c.lastAnonymousFieldCode(firstField) + } + lastField := firstField + for lastField.NextField != nil { + lastField = lastField.NextField + } + return lastField +} + +func (c *StructCode) lastAnonymousFieldCode(firstField *Opcode) *Opcode { + // firstField is special StructHead operation for anonymous structure. + // So, StructHead's next operation is truly struct head operation. + for firstField.Op == OpStructHead || firstField.Op == OpStructField { + firstField = firstField.Next + } + lastField := firstField + for lastField.NextField != nil { + lastField = lastField.NextField + } + return lastField +} + +func (c *StructCode) ToOpcode(ctx *compileContext) Opcodes { + // header => code => structField => code => end + // ^ | + // |__________| + if c.isRecursive { + recursive := newRecursiveCode(ctx, c.typ, &CompiledCode{}) + recursive.Type = c.typ + ctx.incIndex() + *ctx.recursiveCodes = append(*ctx.recursiveCodes, recursive) + return Opcodes{recursive} + } + codes := Opcodes{} + var prevField *Opcode + ctx.incIndent() + for idx, field := range c.fields { + isFirstField := idx == 0 + isEndField := idx == len(c.fields)-1 + fieldCodes := field.ToOpcode(ctx, isFirstField, isEndField) + for _, code := range fieldCodes { + if c.isIndirect { + code.Flags |= IndirectFlags + } + } + firstField := fieldCodes.First() + if len(codes) > 0 { + codes.Last().Next = firstField + firstField.Idx = codes.First().Idx + } + if prevField != nil { + prevField.NextField = firstField + } + if isEndField { + endField := fieldCodes.Last() + if len(codes) > 0 { + codes.First().End = endField + } else { + firstField.End = endField + } + codes = codes.Add(fieldCodes...) + break + } + prevField = c.lastFieldCode(field, firstField) + codes = codes.Add(fieldCodes...) + } + if len(codes) == 0 { + head := &Opcode{ + Op: OpStructHead, + Idx: opcodeOffset(ctx.ptrIndex), + Type: c.typ, + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + } + ctx.incOpcodeIndex() + end := &Opcode{ + Op: OpStructEnd, + Idx: opcodeOffset(ctx.ptrIndex), + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + } + head.NextField = end + head.Next = end + head.End = end + codes = codes.Add(head, end) + ctx.incIndex() + } + ctx.decIndent() + ctx.structTypeToCodes[uintptr(unsafe.Pointer(c.typ))] = codes + return codes +} + +func (c *StructCode) ToAnonymousOpcode(ctx *compileContext) Opcodes { + // header => code => structField => code => end + // ^ | + // |__________| + if c.isRecursive { + recursive := newRecursiveCode(ctx, c.typ, &CompiledCode{}) + recursive.Type = c.typ + ctx.incIndex() + *ctx.recursiveCodes = append(*ctx.recursiveCodes, recursive) + return Opcodes{recursive} + } + codes := Opcodes{} + var prevField *Opcode + for idx, field := range c.fields { + isFirstField := idx == 0 + isEndField := idx == len(c.fields)-1 + fieldCodes := field.ToAnonymousOpcode(ctx, isFirstField, isEndField) + for _, code := range fieldCodes { + if c.isIndirect { + code.Flags |= IndirectFlags + } + } + firstField := fieldCodes.First() + if len(codes) > 0 { + codes.Last().Next = firstField + firstField.Idx = codes.First().Idx + } + if prevField != nil { + prevField.NextField = firstField + } + if isEndField { + lastField := fieldCodes.Last() + if len(codes) > 0 { + codes.First().End = lastField + } else { + firstField.End = lastField + } + } + prevField = firstField + codes = codes.Add(fieldCodes...) + } + return codes +} + +func (c *StructCode) removeFieldsByTags(tags runtime.StructTags) { + fields := make([]*StructFieldCode, 0, len(c.fields)) + for _, field := range c.fields { + if field.isAnonymous { + structCode := field.getAnonymousStruct() + if structCode != nil && !structCode.isRecursive { + structCode.removeFieldsByTags(tags) + if len(structCode.fields) > 0 { + fields = append(fields, field) + } + continue + } + } + if tags.ExistsKey(field.key) { + continue + } + fields = append(fields, field) + } + c.fields = fields +} + +func (c *StructCode) enableIndirect() { + if c.isIndirect { + return + } + c.isIndirect = true + if len(c.fields) == 0 { + return + } + structCode := c.fields[0].getStruct() + if structCode == nil { + return + } + structCode.enableIndirect() +} + +func (c *StructCode) Filter(query *FieldQuery) Code { + fieldMap := map[string]*FieldQuery{} + for _, field := range query.Fields { + fieldMap[field.Name] = field + } + fields := make([]*StructFieldCode, 0, len(c.fields)) + for _, field := range c.fields { + query, exists := fieldMap[field.key] + if !exists { + continue + } + fieldCode := &StructFieldCode{ + typ: field.typ, + key: field.key, + tag: field.tag, + value: field.value, + offset: field.offset, + isAnonymous: field.isAnonymous, + isTaggedKey: field.isTaggedKey, + isNilableType: field.isNilableType, + isNilCheck: field.isNilCheck, + isAddrForMarshaler: field.isAddrForMarshaler, + isNextOpPtrType: field.isNextOpPtrType, + } + if len(query.Fields) > 0 { + fieldCode.value = fieldCode.value.Filter(query) + } + fields = append(fields, fieldCode) + } + return &StructCode{ + typ: c.typ, + fields: fields, + isPtr: c.isPtr, + disableIndirectConversion: c.disableIndirectConversion, + isIndirect: c.isIndirect, + isRecursive: c.isRecursive, + } +} + +type StructFieldCode struct { + typ *runtime.Type + key string + tag *runtime.StructTag + value Code + offset uintptr + isAnonymous bool + isTaggedKey bool + isNilableType bool + isNilCheck bool + isAddrForMarshaler bool + isNextOpPtrType bool + isMarshalerContext bool +} + +func (c *StructFieldCode) getStruct() *StructCode { + value := c.value + ptr, ok := value.(*PtrCode) + if ok { + value = ptr.value + } + structCode, ok := value.(*StructCode) + if ok { + return structCode + } + return nil +} + +func (c *StructFieldCode) getAnonymousStruct() *StructCode { + if !c.isAnonymous { + return nil + } + return c.getStruct() +} + +func optimizeStructHeader(code *Opcode, tag *runtime.StructTag) OpType { + headType := code.ToHeaderType(tag.IsString) + if tag.IsOmitEmpty { + headType = headType.HeadToOmitEmptyHead() + } + return headType +} + +func optimizeStructField(code *Opcode, tag *runtime.StructTag) OpType { + fieldType := code.ToFieldType(tag.IsString) + if tag.IsOmitEmpty { + fieldType = fieldType.FieldToOmitEmptyField() + } + return fieldType +} + +func (c *StructFieldCode) headerOpcodes(ctx *compileContext, field *Opcode, valueCodes Opcodes) Opcodes { + value := valueCodes.First() + op := optimizeStructHeader(value, c.tag) + field.Op = op + if value.Flags&MarshalerContextFlags != 0 { + field.Flags |= MarshalerContextFlags + } + field.NumBitSize = value.NumBitSize + field.PtrNum = value.PtrNum + field.FieldQuery = value.FieldQuery + fieldCodes := Opcodes{field} + if op.IsMultipleOpHead() { + field.Next = value + fieldCodes = fieldCodes.Add(valueCodes...) + } else { + ctx.decIndex() + } + return fieldCodes +} + +func (c *StructFieldCode) fieldOpcodes(ctx *compileContext, field *Opcode, valueCodes Opcodes) Opcodes { + value := valueCodes.First() + op := optimizeStructField(value, c.tag) + field.Op = op + if value.Flags&MarshalerContextFlags != 0 { + field.Flags |= MarshalerContextFlags + } + field.NumBitSize = value.NumBitSize + field.PtrNum = value.PtrNum + field.FieldQuery = value.FieldQuery + + fieldCodes := Opcodes{field} + if op.IsMultipleOpField() { + field.Next = value + fieldCodes = fieldCodes.Add(valueCodes...) + } else { + ctx.decIndex() + } + return fieldCodes +} + +func (c *StructFieldCode) addStructEndCode(ctx *compileContext, codes Opcodes) Opcodes { + end := &Opcode{ + Op: OpStructEnd, + Idx: opcodeOffset(ctx.ptrIndex), + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + } + codes.Last().Next = end + code := codes.First() + for code.Op == OpStructField || code.Op == OpStructHead { + code = code.Next + } + for code.NextField != nil { + code = code.NextField + } + code.NextField = end + + codes = codes.Add(end) + ctx.incOpcodeIndex() + return codes +} + +func (c *StructFieldCode) structKey(ctx *compileContext) string { + if ctx.escapeKey { + rctx := &RuntimeContext{Option: &Option{Flag: HTMLEscapeOption}} + return fmt.Sprintf(`%s:`, string(AppendString(rctx, []byte{}, c.key))) + } + return fmt.Sprintf(`"%s":`, c.key) +} + +func (c *StructFieldCode) flags() OpFlags { + var flags OpFlags + if c.isTaggedKey { + flags |= IsTaggedKeyFlags + } + if c.isNilableType { + flags |= IsNilableTypeFlags + } + if c.isNilCheck { + flags |= NilCheckFlags + } + if c.isAddrForMarshaler { + flags |= AddrForMarshalerFlags + } + if c.isNextOpPtrType { + flags |= IsNextOpPtrTypeFlags + } + if c.isAnonymous { + flags |= AnonymousKeyFlags + } + if c.isMarshalerContext { + flags |= MarshalerContextFlags + } + return flags +} + +func (c *StructFieldCode) toValueOpcodes(ctx *compileContext) Opcodes { + if c.isAnonymous { + anonymCode, ok := c.value.(AnonymousCode) + if ok { + return anonymCode.ToAnonymousOpcode(ctx) + } + } + return c.value.ToOpcode(ctx) +} + +func (c *StructFieldCode) ToOpcode(ctx *compileContext, isFirstField, isEndField bool) Opcodes { + field := &Opcode{ + Idx: opcodeOffset(ctx.ptrIndex), + Flags: c.flags(), + Key: c.structKey(ctx), + Offset: uint32(c.offset), + Type: c.typ, + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + DisplayKey: c.key, + } + ctx.incIndex() + valueCodes := c.toValueOpcodes(ctx) + if isFirstField { + codes := c.headerOpcodes(ctx, field, valueCodes) + if isEndField { + codes = c.addStructEndCode(ctx, codes) + } + return codes + } + codes := c.fieldOpcodes(ctx, field, valueCodes) + if isEndField { + if isEnableStructEndOptimization(c.value) { + field.Op = field.Op.FieldToEnd() + } else { + codes = c.addStructEndCode(ctx, codes) + } + } + return codes +} + +func (c *StructFieldCode) ToAnonymousOpcode(ctx *compileContext, isFirstField, isEndField bool) Opcodes { + field := &Opcode{ + Idx: opcodeOffset(ctx.ptrIndex), + Flags: c.flags() | AnonymousHeadFlags, + Key: c.structKey(ctx), + Offset: uint32(c.offset), + Type: c.typ, + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + DisplayKey: c.key, + } + ctx.incIndex() + valueCodes := c.toValueOpcodes(ctx) + if isFirstField { + return c.headerOpcodes(ctx, field, valueCodes) + } + return c.fieldOpcodes(ctx, field, valueCodes) +} + +func isEnableStructEndOptimization(value Code) bool { + switch value.Kind() { + case CodeKindInt, + CodeKindUint, + CodeKindFloat, + CodeKindString, + CodeKindBool, + CodeKindBytes: + return true + case CodeKindPtr: + return isEnableStructEndOptimization(value.(*PtrCode).value) + default: + return false + } +} + +type InterfaceCode struct { + typ *runtime.Type + fieldQuery *FieldQuery + isPtr bool +} + +func (c *InterfaceCode) Kind() CodeKind { + return CodeKindInterface +} + +func (c *InterfaceCode) ToOpcode(ctx *compileContext) Opcodes { + var code *Opcode + switch { + case c.isPtr: + code = newOpCode(ctx, c.typ, OpInterfacePtr) + default: + code = newOpCode(ctx, c.typ, OpInterface) + } + code.FieldQuery = c.fieldQuery + if c.typ.NumMethod() > 0 { + code.Flags |= NonEmptyInterfaceFlags + } + ctx.incIndex() + return Opcodes{code} +} + +func (c *InterfaceCode) Filter(query *FieldQuery) Code { + return &InterfaceCode{ + typ: c.typ, + fieldQuery: query, + isPtr: c.isPtr, + } +} + +type MarshalJSONCode struct { + typ *runtime.Type + fieldQuery *FieldQuery + isAddrForMarshaler bool + isNilableType bool + isMarshalerContext bool +} + +func (c *MarshalJSONCode) Kind() CodeKind { + return CodeKindMarshalJSON +} + +func (c *MarshalJSONCode) ToOpcode(ctx *compileContext) Opcodes { + code := newOpCode(ctx, c.typ, OpMarshalJSON) + code.FieldQuery = c.fieldQuery + if c.isAddrForMarshaler { + code.Flags |= AddrForMarshalerFlags + } + if c.isMarshalerContext { + code.Flags |= MarshalerContextFlags + } + if c.isNilableType { + code.Flags |= IsNilableTypeFlags + } else { + code.Flags &= ^IsNilableTypeFlags + } + ctx.incIndex() + return Opcodes{code} +} + +func (c *MarshalJSONCode) Filter(query *FieldQuery) Code { + return &MarshalJSONCode{ + typ: c.typ, + fieldQuery: query, + isAddrForMarshaler: c.isAddrForMarshaler, + isNilableType: c.isNilableType, + isMarshalerContext: c.isMarshalerContext, + } +} + +type MarshalTextCode struct { + typ *runtime.Type + fieldQuery *FieldQuery + isAddrForMarshaler bool + isNilableType bool +} + +func (c *MarshalTextCode) Kind() CodeKind { + return CodeKindMarshalText +} + +func (c *MarshalTextCode) ToOpcode(ctx *compileContext) Opcodes { + code := newOpCode(ctx, c.typ, OpMarshalText) + code.FieldQuery = c.fieldQuery + if c.isAddrForMarshaler { + code.Flags |= AddrForMarshalerFlags + } + if c.isNilableType { + code.Flags |= IsNilableTypeFlags + } else { + code.Flags &= ^IsNilableTypeFlags + } + ctx.incIndex() + return Opcodes{code} +} + +func (c *MarshalTextCode) Filter(query *FieldQuery) Code { + return &MarshalTextCode{ + typ: c.typ, + fieldQuery: query, + isAddrForMarshaler: c.isAddrForMarshaler, + isNilableType: c.isNilableType, + } +} + +type PtrCode struct { + typ *runtime.Type + value Code + ptrNum uint8 +} + +func (c *PtrCode) Kind() CodeKind { + return CodeKindPtr +} + +func (c *PtrCode) ToOpcode(ctx *compileContext) Opcodes { + codes := c.value.ToOpcode(ctx) + codes.First().Op = convertPtrOp(codes.First()) + codes.First().PtrNum = c.ptrNum + return codes +} + +func (c *PtrCode) ToAnonymousOpcode(ctx *compileContext) Opcodes { + var codes Opcodes + anonymCode, ok := c.value.(AnonymousCode) + if ok { + codes = anonymCode.ToAnonymousOpcode(ctx) + } else { + codes = c.value.ToOpcode(ctx) + } + codes.First().Op = convertPtrOp(codes.First()) + codes.First().PtrNum = c.ptrNum + return codes +} + +func (c *PtrCode) Filter(query *FieldQuery) Code { + return &PtrCode{ + typ: c.typ, + value: c.value.Filter(query), + ptrNum: c.ptrNum, + } +} + +func convertPtrOp(code *Opcode) OpType { + ptrHeadOp := code.Op.HeadToPtrHead() + if code.Op != ptrHeadOp { + if code.PtrNum > 0 { + // ptr field and ptr head + code.PtrNum-- + } + return ptrHeadOp + } + switch code.Op { + case OpInt: + return OpIntPtr + case OpUint: + return OpUintPtr + case OpFloat32: + return OpFloat32Ptr + case OpFloat64: + return OpFloat64Ptr + case OpString: + return OpStringPtr + case OpBool: + return OpBoolPtr + case OpBytes: + return OpBytesPtr + case OpNumber: + return OpNumberPtr + case OpArray: + return OpArrayPtr + case OpSlice: + return OpSlicePtr + case OpMap: + return OpMapPtr + case OpMarshalJSON: + return OpMarshalJSONPtr + case OpMarshalText: + return OpMarshalTextPtr + case OpInterface: + return OpInterfacePtr + case OpRecursive: + return OpRecursivePtr + } + return code.Op +} + +func isEmbeddedStruct(field *StructFieldCode) bool { + if !field.isAnonymous { + return false + } + t := field.typ + if t.Kind() == reflect.Ptr { + t = t.Elem() + } + return t.Kind() == reflect.Struct +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/compact.go b/vendor/github.com/goccy/go-json/internal/encoder/compact.go new file mode 100644 index 000000000..0eb9545d8 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/compact.go @@ -0,0 +1,286 @@ +package encoder + +import ( + "bytes" + "fmt" + "strconv" + "unsafe" + + "github.com/goccy/go-json/internal/errors" +) + +var ( + isWhiteSpace = [256]bool{ + ' ': true, + '\n': true, + '\t': true, + '\r': true, + } + isHTMLEscapeChar = [256]bool{ + '<': true, + '>': true, + '&': true, + } + nul = byte('\000') +) + +func Compact(buf *bytes.Buffer, src []byte, escape bool) error { + if len(src) == 0 { + return errors.ErrUnexpectedEndOfJSON("", 0) + } + buf.Grow(len(src)) + dst := buf.Bytes() + + ctx := TakeRuntimeContext() + ctxBuf := ctx.Buf[:0] + ctxBuf = append(append(ctxBuf, src...), nul) + ctx.Buf = ctxBuf + + if err := compactAndWrite(buf, dst, ctxBuf, escape); err != nil { + ReleaseRuntimeContext(ctx) + return err + } + ReleaseRuntimeContext(ctx) + return nil +} + +func compactAndWrite(buf *bytes.Buffer, dst []byte, src []byte, escape bool) error { + dst, err := compact(dst, src, escape) + if err != nil { + return err + } + if _, err := buf.Write(dst); err != nil { + return err + } + return nil +} + +func compact(dst, src []byte, escape bool) ([]byte, error) { + buf, cursor, err := compactValue(dst, src, 0, escape) + if err != nil { + return nil, err + } + if err := validateEndBuf(src, cursor); err != nil { + return nil, err + } + return buf, nil +} + +func validateEndBuf(src []byte, cursor int64) error { + for { + switch src[cursor] { + case ' ', '\t', '\n', '\r': + cursor++ + continue + case nul: + return nil + } + return errors.ErrSyntax( + fmt.Sprintf("invalid character '%c' after top-level value", src[cursor]), + cursor+1, + ) + } +} + +func skipWhiteSpace(buf []byte, cursor int64) int64 { +LOOP: + if isWhiteSpace[buf[cursor]] { + cursor++ + goto LOOP + } + return cursor +} + +func compactValue(dst, src []byte, cursor int64, escape bool) ([]byte, int64, error) { + for { + switch src[cursor] { + case ' ', '\t', '\n', '\r': + cursor++ + continue + case '{': + return compactObject(dst, src, cursor, escape) + case '}': + return nil, 0, errors.ErrSyntax("unexpected character '}'", cursor) + case '[': + return compactArray(dst, src, cursor, escape) + case ']': + return nil, 0, errors.ErrSyntax("unexpected character ']'", cursor) + case '"': + return compactString(dst, src, cursor, escape) + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return compactNumber(dst, src, cursor) + case 't': + return compactTrue(dst, src, cursor) + case 'f': + return compactFalse(dst, src, cursor) + case 'n': + return compactNull(dst, src, cursor) + default: + return nil, 0, errors.ErrSyntax(fmt.Sprintf("unexpected character '%c'", src[cursor]), cursor) + } + } +} + +func compactObject(dst, src []byte, cursor int64, escape bool) ([]byte, int64, error) { + if src[cursor] == '{' { + dst = append(dst, '{') + } else { + return nil, 0, errors.ErrExpected("expected { character for object value", cursor) + } + cursor = skipWhiteSpace(src, cursor+1) + if src[cursor] == '}' { + dst = append(dst, '}') + return dst, cursor + 1, nil + } + var err error + for { + cursor = skipWhiteSpace(src, cursor) + dst, cursor, err = compactString(dst, src, cursor, escape) + if err != nil { + return nil, 0, err + } + cursor = skipWhiteSpace(src, cursor) + if src[cursor] != ':' { + return nil, 0, errors.ErrExpected("colon after object key", cursor) + } + dst = append(dst, ':') + dst, cursor, err = compactValue(dst, src, cursor+1, escape) + if err != nil { + return nil, 0, err + } + cursor = skipWhiteSpace(src, cursor) + switch src[cursor] { + case '}': + dst = append(dst, '}') + cursor++ + return dst, cursor, nil + case ',': + dst = append(dst, ',') + default: + return nil, 0, errors.ErrExpected("comma after object value", cursor) + } + cursor++ + } +} + +func compactArray(dst, src []byte, cursor int64, escape bool) ([]byte, int64, error) { + if src[cursor] == '[' { + dst = append(dst, '[') + } else { + return nil, 0, errors.ErrExpected("expected [ character for array value", cursor) + } + cursor = skipWhiteSpace(src, cursor+1) + if src[cursor] == ']' { + dst = append(dst, ']') + return dst, cursor + 1, nil + } + var err error + for { + dst, cursor, err = compactValue(dst, src, cursor, escape) + if err != nil { + return nil, 0, err + } + cursor = skipWhiteSpace(src, cursor) + switch src[cursor] { + case ']': + dst = append(dst, ']') + cursor++ + return dst, cursor, nil + case ',': + dst = append(dst, ',') + default: + return nil, 0, errors.ErrExpected("comma after array value", cursor) + } + cursor++ + } +} + +func compactString(dst, src []byte, cursor int64, escape bool) ([]byte, int64, error) { + if src[cursor] != '"' { + return nil, 0, errors.ErrInvalidCharacter(src[cursor], "string", cursor) + } + start := cursor + for { + cursor++ + c := src[cursor] + if escape { + if isHTMLEscapeChar[c] { + dst = append(dst, src[start:cursor]...) + dst = append(dst, `\u00`...) + dst = append(dst, hex[c>>4], hex[c&0xF]) + start = cursor + 1 + } else if c == 0xE2 && cursor+2 < int64(len(src)) && src[cursor+1] == 0x80 && src[cursor+2]&^1 == 0xA8 { + dst = append(dst, src[start:cursor]...) + dst = append(dst, `\u202`...) + dst = append(dst, hex[src[cursor+2]&0xF]) + cursor += 2 + start = cursor + 3 + } + } + switch c { + case '\\': + cursor++ + if src[cursor] == nul { + return nil, 0, errors.ErrUnexpectedEndOfJSON("string", int64(len(src))) + } + case '"': + cursor++ + return append(dst, src[start:cursor]...), cursor, nil + case nul: + return nil, 0, errors.ErrUnexpectedEndOfJSON("string", int64(len(src))) + } + } +} + +func compactNumber(dst, src []byte, cursor int64) ([]byte, int64, error) { + start := cursor + for { + cursor++ + if floatTable[src[cursor]] { + continue + } + break + } + num := src[start:cursor] + if _, err := strconv.ParseFloat(*(*string)(unsafe.Pointer(&num)), 64); err != nil { + return nil, 0, err + } + dst = append(dst, num...) + return dst, cursor, nil +} + +func compactTrue(dst, src []byte, cursor int64) ([]byte, int64, error) { + if cursor+3 >= int64(len(src)) { + return nil, 0, errors.ErrUnexpectedEndOfJSON("true", cursor) + } + if !bytes.Equal(src[cursor:cursor+4], []byte(`true`)) { + return nil, 0, errors.ErrInvalidCharacter(src[cursor], "true", cursor) + } + dst = append(dst, "true"...) + cursor += 4 + return dst, cursor, nil +} + +func compactFalse(dst, src []byte, cursor int64) ([]byte, int64, error) { + if cursor+4 >= int64(len(src)) { + return nil, 0, errors.ErrUnexpectedEndOfJSON("false", cursor) + } + if !bytes.Equal(src[cursor:cursor+5], []byte(`false`)) { + return nil, 0, errors.ErrInvalidCharacter(src[cursor], "false", cursor) + } + dst = append(dst, "false"...) + cursor += 5 + return dst, cursor, nil +} + +func compactNull(dst, src []byte, cursor int64) ([]byte, int64, error) { + if cursor+3 >= int64(len(src)) { + return nil, 0, errors.ErrUnexpectedEndOfJSON("null", cursor) + } + if !bytes.Equal(src[cursor:cursor+4], []byte(`null`)) { + return nil, 0, errors.ErrInvalidCharacter(src[cursor], "null", cursor) + } + dst = append(dst, "null"...) + cursor += 4 + return dst, cursor, nil +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/compiler.go b/vendor/github.com/goccy/go-json/internal/encoder/compiler.go new file mode 100644 index 000000000..3ae39ba8c --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/compiler.go @@ -0,0 +1,935 @@ +package encoder + +import ( + "context" + "encoding" + "encoding/json" + "reflect" + "sync/atomic" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +type marshalerContext interface { + MarshalJSON(context.Context) ([]byte, error) +} + +var ( + marshalJSONType = reflect.TypeOf((*json.Marshaler)(nil)).Elem() + marshalJSONContextType = reflect.TypeOf((*marshalerContext)(nil)).Elem() + marshalTextType = reflect.TypeOf((*encoding.TextMarshaler)(nil)).Elem() + jsonNumberType = reflect.TypeOf(json.Number("")) + cachedOpcodeSets []*OpcodeSet + cachedOpcodeMap unsafe.Pointer // map[uintptr]*OpcodeSet + typeAddr *runtime.TypeAddr +) + +func init() { + typeAddr = runtime.AnalyzeTypeAddr() + if typeAddr == nil { + typeAddr = &runtime.TypeAddr{} + } + cachedOpcodeSets = make([]*OpcodeSet, typeAddr.AddrRange>>typeAddr.AddrShift+1) +} + +func loadOpcodeMap() map[uintptr]*OpcodeSet { + p := atomic.LoadPointer(&cachedOpcodeMap) + return *(*map[uintptr]*OpcodeSet)(unsafe.Pointer(&p)) +} + +func storeOpcodeSet(typ uintptr, set *OpcodeSet, m map[uintptr]*OpcodeSet) { + newOpcodeMap := make(map[uintptr]*OpcodeSet, len(m)+1) + newOpcodeMap[typ] = set + + for k, v := range m { + newOpcodeMap[k] = v + } + + atomic.StorePointer(&cachedOpcodeMap, *(*unsafe.Pointer)(unsafe.Pointer(&newOpcodeMap))) +} + +func compileToGetCodeSetSlowPath(typeptr uintptr) (*OpcodeSet, error) { + opcodeMap := loadOpcodeMap() + if codeSet, exists := opcodeMap[typeptr]; exists { + return codeSet, nil + } + codeSet, err := newCompiler().compile(typeptr) + if err != nil { + return nil, err + } + storeOpcodeSet(typeptr, codeSet, opcodeMap) + return codeSet, nil +} + +func getFilteredCodeSetIfNeeded(ctx *RuntimeContext, codeSet *OpcodeSet) (*OpcodeSet, error) { + if (ctx.Option.Flag & ContextOption) == 0 { + return codeSet, nil + } + query := FieldQueryFromContext(ctx.Option.Context) + if query == nil { + return codeSet, nil + } + ctx.Option.Flag |= FieldQueryOption + cacheCodeSet := codeSet.getQueryCache(query.Hash()) + if cacheCodeSet != nil { + return cacheCodeSet, nil + } + queryCodeSet, err := newCompiler().codeToOpcodeSet(codeSet.Type, codeSet.Code.Filter(query)) + if err != nil { + return nil, err + } + codeSet.setQueryCache(query.Hash(), queryCodeSet) + return queryCodeSet, nil +} + +type Compiler struct { + structTypeToCode map[uintptr]*StructCode +} + +func newCompiler() *Compiler { + return &Compiler{ + structTypeToCode: map[uintptr]*StructCode{}, + } +} + +func (c *Compiler) compile(typeptr uintptr) (*OpcodeSet, error) { + // noescape trick for header.typ ( reflect.*rtype ) + typ := *(**runtime.Type)(unsafe.Pointer(&typeptr)) + code, err := c.typeToCode(typ) + if err != nil { + return nil, err + } + return c.codeToOpcodeSet(typ, code) +} + +func (c *Compiler) codeToOpcodeSet(typ *runtime.Type, code Code) (*OpcodeSet, error) { + noescapeKeyCode := c.codeToOpcode(&compileContext{ + structTypeToCodes: map[uintptr]Opcodes{}, + recursiveCodes: &Opcodes{}, + }, typ, code) + if err := noescapeKeyCode.Validate(); err != nil { + return nil, err + } + escapeKeyCode := c.codeToOpcode(&compileContext{ + structTypeToCodes: map[uintptr]Opcodes{}, + recursiveCodes: &Opcodes{}, + escapeKey: true, + }, typ, code) + noescapeKeyCode = copyOpcode(noescapeKeyCode) + escapeKeyCode = copyOpcode(escapeKeyCode) + setTotalLengthToInterfaceOp(noescapeKeyCode) + setTotalLengthToInterfaceOp(escapeKeyCode) + interfaceNoescapeKeyCode := copyToInterfaceOpcode(noescapeKeyCode) + interfaceEscapeKeyCode := copyToInterfaceOpcode(escapeKeyCode) + codeLength := noescapeKeyCode.TotalLength() + return &OpcodeSet{ + Type: typ, + NoescapeKeyCode: noescapeKeyCode, + EscapeKeyCode: escapeKeyCode, + InterfaceNoescapeKeyCode: interfaceNoescapeKeyCode, + InterfaceEscapeKeyCode: interfaceEscapeKeyCode, + CodeLength: codeLength, + EndCode: ToEndCode(interfaceNoescapeKeyCode), + Code: code, + QueryCache: map[string]*OpcodeSet{}, + }, nil +} + +func (c *Compiler) typeToCode(typ *runtime.Type) (Code, error) { + switch { + case c.implementsMarshalJSON(typ): + return c.marshalJSONCode(typ) + case c.implementsMarshalText(typ): + return c.marshalTextCode(typ) + } + + isPtr := false + orgType := typ + if typ.Kind() == reflect.Ptr { + typ = typ.Elem() + isPtr = true + } + switch { + case c.implementsMarshalJSON(typ): + return c.marshalJSONCode(orgType) + case c.implementsMarshalText(typ): + return c.marshalTextCode(orgType) + } + switch typ.Kind() { + case reflect.Slice: + elem := typ.Elem() + if elem.Kind() == reflect.Uint8 { + p := runtime.PtrTo(elem) + if !c.implementsMarshalJSONType(p) && !p.Implements(marshalTextType) { + return c.bytesCode(typ, isPtr) + } + } + return c.sliceCode(typ) + case reflect.Map: + if isPtr { + return c.ptrCode(runtime.PtrTo(typ)) + } + return c.mapCode(typ) + case reflect.Struct: + return c.structCode(typ, isPtr) + case reflect.Int: + return c.intCode(typ, isPtr) + case reflect.Int8: + return c.int8Code(typ, isPtr) + case reflect.Int16: + return c.int16Code(typ, isPtr) + case reflect.Int32: + return c.int32Code(typ, isPtr) + case reflect.Int64: + return c.int64Code(typ, isPtr) + case reflect.Uint, reflect.Uintptr: + return c.uintCode(typ, isPtr) + case reflect.Uint8: + return c.uint8Code(typ, isPtr) + case reflect.Uint16: + return c.uint16Code(typ, isPtr) + case reflect.Uint32: + return c.uint32Code(typ, isPtr) + case reflect.Uint64: + return c.uint64Code(typ, isPtr) + case reflect.Float32: + return c.float32Code(typ, isPtr) + case reflect.Float64: + return c.float64Code(typ, isPtr) + case reflect.String: + return c.stringCode(typ, isPtr) + case reflect.Bool: + return c.boolCode(typ, isPtr) + case reflect.Interface: + return c.interfaceCode(typ, isPtr) + default: + if isPtr && typ.Implements(marshalTextType) { + typ = orgType + } + return c.typeToCodeWithPtr(typ, isPtr) + } +} + +func (c *Compiler) typeToCodeWithPtr(typ *runtime.Type, isPtr bool) (Code, error) { + switch { + case c.implementsMarshalJSON(typ): + return c.marshalJSONCode(typ) + case c.implementsMarshalText(typ): + return c.marshalTextCode(typ) + } + switch typ.Kind() { + case reflect.Ptr: + return c.ptrCode(typ) + case reflect.Slice: + elem := typ.Elem() + if elem.Kind() == reflect.Uint8 { + p := runtime.PtrTo(elem) + if !c.implementsMarshalJSONType(p) && !p.Implements(marshalTextType) { + return c.bytesCode(typ, false) + } + } + return c.sliceCode(typ) + case reflect.Array: + return c.arrayCode(typ) + case reflect.Map: + return c.mapCode(typ) + case reflect.Struct: + return c.structCode(typ, isPtr) + case reflect.Interface: + return c.interfaceCode(typ, false) + case reflect.Int: + return c.intCode(typ, false) + case reflect.Int8: + return c.int8Code(typ, false) + case reflect.Int16: + return c.int16Code(typ, false) + case reflect.Int32: + return c.int32Code(typ, false) + case reflect.Int64: + return c.int64Code(typ, false) + case reflect.Uint: + return c.uintCode(typ, false) + case reflect.Uint8: + return c.uint8Code(typ, false) + case reflect.Uint16: + return c.uint16Code(typ, false) + case reflect.Uint32: + return c.uint32Code(typ, false) + case reflect.Uint64: + return c.uint64Code(typ, false) + case reflect.Uintptr: + return c.uintCode(typ, false) + case reflect.Float32: + return c.float32Code(typ, false) + case reflect.Float64: + return c.float64Code(typ, false) + case reflect.String: + return c.stringCode(typ, false) + case reflect.Bool: + return c.boolCode(typ, false) + } + return nil, &errors.UnsupportedTypeError{Type: runtime.RType2Type(typ)} +} + +const intSize = 32 << (^uint(0) >> 63) + +//nolint:unparam +func (c *Compiler) intCode(typ *runtime.Type, isPtr bool) (*IntCode, error) { + return &IntCode{typ: typ, bitSize: intSize, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) int8Code(typ *runtime.Type, isPtr bool) (*IntCode, error) { + return &IntCode{typ: typ, bitSize: 8, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) int16Code(typ *runtime.Type, isPtr bool) (*IntCode, error) { + return &IntCode{typ: typ, bitSize: 16, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) int32Code(typ *runtime.Type, isPtr bool) (*IntCode, error) { + return &IntCode{typ: typ, bitSize: 32, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) int64Code(typ *runtime.Type, isPtr bool) (*IntCode, error) { + return &IntCode{typ: typ, bitSize: 64, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) uintCode(typ *runtime.Type, isPtr bool) (*UintCode, error) { + return &UintCode{typ: typ, bitSize: intSize, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) uint8Code(typ *runtime.Type, isPtr bool) (*UintCode, error) { + return &UintCode{typ: typ, bitSize: 8, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) uint16Code(typ *runtime.Type, isPtr bool) (*UintCode, error) { + return &UintCode{typ: typ, bitSize: 16, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) uint32Code(typ *runtime.Type, isPtr bool) (*UintCode, error) { + return &UintCode{typ: typ, bitSize: 32, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) uint64Code(typ *runtime.Type, isPtr bool) (*UintCode, error) { + return &UintCode{typ: typ, bitSize: 64, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) float32Code(typ *runtime.Type, isPtr bool) (*FloatCode, error) { + return &FloatCode{typ: typ, bitSize: 32, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) float64Code(typ *runtime.Type, isPtr bool) (*FloatCode, error) { + return &FloatCode{typ: typ, bitSize: 64, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) stringCode(typ *runtime.Type, isPtr bool) (*StringCode, error) { + return &StringCode{typ: typ, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) boolCode(typ *runtime.Type, isPtr bool) (*BoolCode, error) { + return &BoolCode{typ: typ, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) intStringCode(typ *runtime.Type) (*IntCode, error) { + return &IntCode{typ: typ, bitSize: intSize, isString: true}, nil +} + +//nolint:unparam +func (c *Compiler) int8StringCode(typ *runtime.Type) (*IntCode, error) { + return &IntCode{typ: typ, bitSize: 8, isString: true}, nil +} + +//nolint:unparam +func (c *Compiler) int16StringCode(typ *runtime.Type) (*IntCode, error) { + return &IntCode{typ: typ, bitSize: 16, isString: true}, nil +} + +//nolint:unparam +func (c *Compiler) int32StringCode(typ *runtime.Type) (*IntCode, error) { + return &IntCode{typ: typ, bitSize: 32, isString: true}, nil +} + +//nolint:unparam +func (c *Compiler) int64StringCode(typ *runtime.Type) (*IntCode, error) { + return &IntCode{typ: typ, bitSize: 64, isString: true}, nil +} + +//nolint:unparam +func (c *Compiler) uintStringCode(typ *runtime.Type) (*UintCode, error) { + return &UintCode{typ: typ, bitSize: intSize, isString: true}, nil +} + +//nolint:unparam +func (c *Compiler) uint8StringCode(typ *runtime.Type) (*UintCode, error) { + return &UintCode{typ: typ, bitSize: 8, isString: true}, nil +} + +//nolint:unparam +func (c *Compiler) uint16StringCode(typ *runtime.Type) (*UintCode, error) { + return &UintCode{typ: typ, bitSize: 16, isString: true}, nil +} + +//nolint:unparam +func (c *Compiler) uint32StringCode(typ *runtime.Type) (*UintCode, error) { + return &UintCode{typ: typ, bitSize: 32, isString: true}, nil +} + +//nolint:unparam +func (c *Compiler) uint64StringCode(typ *runtime.Type) (*UintCode, error) { + return &UintCode{typ: typ, bitSize: 64, isString: true}, nil +} + +//nolint:unparam +func (c *Compiler) bytesCode(typ *runtime.Type, isPtr bool) (*BytesCode, error) { + return &BytesCode{typ: typ, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) interfaceCode(typ *runtime.Type, isPtr bool) (*InterfaceCode, error) { + return &InterfaceCode{typ: typ, isPtr: isPtr}, nil +} + +//nolint:unparam +func (c *Compiler) marshalJSONCode(typ *runtime.Type) (*MarshalJSONCode, error) { + return &MarshalJSONCode{ + typ: typ, + isAddrForMarshaler: c.isPtrMarshalJSONType(typ), + isNilableType: c.isNilableType(typ), + isMarshalerContext: typ.Implements(marshalJSONContextType) || runtime.PtrTo(typ).Implements(marshalJSONContextType), + }, nil +} + +//nolint:unparam +func (c *Compiler) marshalTextCode(typ *runtime.Type) (*MarshalTextCode, error) { + return &MarshalTextCode{ + typ: typ, + isAddrForMarshaler: c.isPtrMarshalTextType(typ), + isNilableType: c.isNilableType(typ), + }, nil +} + +func (c *Compiler) ptrCode(typ *runtime.Type) (*PtrCode, error) { + code, err := c.typeToCodeWithPtr(typ.Elem(), true) + if err != nil { + return nil, err + } + ptr, ok := code.(*PtrCode) + if ok { + return &PtrCode{typ: typ, value: ptr.value, ptrNum: ptr.ptrNum + 1}, nil + } + return &PtrCode{typ: typ, value: code, ptrNum: 1}, nil +} + +func (c *Compiler) sliceCode(typ *runtime.Type) (*SliceCode, error) { + elem := typ.Elem() + code, err := c.listElemCode(elem) + if err != nil { + return nil, err + } + if code.Kind() == CodeKindStruct { + structCode := code.(*StructCode) + structCode.enableIndirect() + } + return &SliceCode{typ: typ, value: code}, nil +} + +func (c *Compiler) arrayCode(typ *runtime.Type) (*ArrayCode, error) { + elem := typ.Elem() + code, err := c.listElemCode(elem) + if err != nil { + return nil, err + } + if code.Kind() == CodeKindStruct { + structCode := code.(*StructCode) + structCode.enableIndirect() + } + return &ArrayCode{typ: typ, value: code}, nil +} + +func (c *Compiler) mapCode(typ *runtime.Type) (*MapCode, error) { + keyCode, err := c.mapKeyCode(typ.Key()) + if err != nil { + return nil, err + } + valueCode, err := c.mapValueCode(typ.Elem()) + if err != nil { + return nil, err + } + if valueCode.Kind() == CodeKindStruct { + structCode := valueCode.(*StructCode) + structCode.enableIndirect() + } + return &MapCode{typ: typ, key: keyCode, value: valueCode}, nil +} + +func (c *Compiler) listElemCode(typ *runtime.Type) (Code, error) { + switch { + case c.isPtrMarshalJSONType(typ): + return c.marshalJSONCode(typ) + case !typ.Implements(marshalTextType) && runtime.PtrTo(typ).Implements(marshalTextType): + return c.marshalTextCode(typ) + case typ.Kind() == reflect.Map: + return c.ptrCode(runtime.PtrTo(typ)) + default: + // isPtr was originally used to indicate whether the type of top level is pointer. + // However, since the slice/array element is a specification that can get the pointer address, explicitly set isPtr to true. + // See here for related issues: https://github.com/goccy/go-json/issues/370 + code, err := c.typeToCodeWithPtr(typ, true) + if err != nil { + return nil, err + } + ptr, ok := code.(*PtrCode) + if ok { + if ptr.value.Kind() == CodeKindMap { + ptr.ptrNum++ + } + } + return code, nil + } +} + +func (c *Compiler) mapKeyCode(typ *runtime.Type) (Code, error) { + switch { + case c.implementsMarshalText(typ): + return c.marshalTextCode(typ) + } + switch typ.Kind() { + case reflect.Ptr: + return c.ptrCode(typ) + case reflect.String: + return c.stringCode(typ, false) + case reflect.Int: + return c.intStringCode(typ) + case reflect.Int8: + return c.int8StringCode(typ) + case reflect.Int16: + return c.int16StringCode(typ) + case reflect.Int32: + return c.int32StringCode(typ) + case reflect.Int64: + return c.int64StringCode(typ) + case reflect.Uint: + return c.uintStringCode(typ) + case reflect.Uint8: + return c.uint8StringCode(typ) + case reflect.Uint16: + return c.uint16StringCode(typ) + case reflect.Uint32: + return c.uint32StringCode(typ) + case reflect.Uint64: + return c.uint64StringCode(typ) + case reflect.Uintptr: + return c.uintStringCode(typ) + } + return nil, &errors.UnsupportedTypeError{Type: runtime.RType2Type(typ)} +} + +func (c *Compiler) mapValueCode(typ *runtime.Type) (Code, error) { + switch typ.Kind() { + case reflect.Map: + return c.ptrCode(runtime.PtrTo(typ)) + default: + code, err := c.typeToCodeWithPtr(typ, false) + if err != nil { + return nil, err + } + ptr, ok := code.(*PtrCode) + if ok { + if ptr.value.Kind() == CodeKindMap { + ptr.ptrNum++ + } + } + return code, nil + } +} + +func (c *Compiler) structCode(typ *runtime.Type, isPtr bool) (*StructCode, error) { + typeptr := uintptr(unsafe.Pointer(typ)) + if code, exists := c.structTypeToCode[typeptr]; exists { + derefCode := *code + derefCode.isRecursive = true + return &derefCode, nil + } + indirect := runtime.IfaceIndir(typ) + code := &StructCode{typ: typ, isPtr: isPtr, isIndirect: indirect} + c.structTypeToCode[typeptr] = code + + fieldNum := typ.NumField() + tags := c.typeToStructTags(typ) + fields := []*StructFieldCode{} + for i, tag := range tags { + isOnlyOneFirstField := i == 0 && fieldNum == 1 + field, err := c.structFieldCode(code, tag, isPtr, isOnlyOneFirstField) + if err != nil { + return nil, err + } + if field.isAnonymous { + structCode := field.getAnonymousStruct() + if structCode != nil { + structCode.removeFieldsByTags(tags) + if c.isAssignableIndirect(field, isPtr) { + if indirect { + structCode.isIndirect = true + } else { + structCode.isIndirect = false + } + } + } + } else { + structCode := field.getStruct() + if structCode != nil { + if indirect { + // if parent is indirect type, set child indirect property to true + structCode.isIndirect = true + } else { + // if parent is not indirect type, set child indirect property to false. + // but if parent's indirect is false and isPtr is true, then indirect must be true. + // Do this only if indirectConversion is enabled at the end of compileStruct. + structCode.isIndirect = false + } + } + } + fields = append(fields, field) + } + fieldMap := c.getFieldMap(fields) + duplicatedFieldMap := c.getDuplicatedFieldMap(fieldMap) + code.fields = c.filteredDuplicatedFields(fields, duplicatedFieldMap) + if !code.disableIndirectConversion && !indirect && isPtr { + code.enableIndirect() + } + delete(c.structTypeToCode, typeptr) + return code, nil +} + +func toElemType(t *runtime.Type) *runtime.Type { + for t.Kind() == reflect.Ptr { + t = t.Elem() + } + return t +} + +func (c *Compiler) structFieldCode(structCode *StructCode, tag *runtime.StructTag, isPtr, isOnlyOneFirstField bool) (*StructFieldCode, error) { + field := tag.Field + fieldType := runtime.Type2RType(field.Type) + isIndirectSpecialCase := isPtr && isOnlyOneFirstField + fieldCode := &StructFieldCode{ + typ: fieldType, + key: tag.Key, + tag: tag, + offset: field.Offset, + isAnonymous: field.Anonymous && !tag.IsTaggedKey && toElemType(fieldType).Kind() == reflect.Struct, + isTaggedKey: tag.IsTaggedKey, + isNilableType: c.isNilableType(fieldType), + isNilCheck: true, + } + switch { + case c.isMovePointerPositionFromHeadToFirstMarshalJSONFieldCase(fieldType, isIndirectSpecialCase): + code, err := c.marshalJSONCode(fieldType) + if err != nil { + return nil, err + } + fieldCode.value = code + fieldCode.isAddrForMarshaler = true + fieldCode.isNilCheck = false + structCode.isIndirect = false + structCode.disableIndirectConversion = true + case c.isMovePointerPositionFromHeadToFirstMarshalTextFieldCase(fieldType, isIndirectSpecialCase): + code, err := c.marshalTextCode(fieldType) + if err != nil { + return nil, err + } + fieldCode.value = code + fieldCode.isAddrForMarshaler = true + fieldCode.isNilCheck = false + structCode.isIndirect = false + structCode.disableIndirectConversion = true + case isPtr && c.isPtrMarshalJSONType(fieldType): + // *struct{ field T } + // func (*T) MarshalJSON() ([]byte, error) + code, err := c.marshalJSONCode(fieldType) + if err != nil { + return nil, err + } + fieldCode.value = code + fieldCode.isAddrForMarshaler = true + fieldCode.isNilCheck = false + case isPtr && c.isPtrMarshalTextType(fieldType): + // *struct{ field T } + // func (*T) MarshalText() ([]byte, error) + code, err := c.marshalTextCode(fieldType) + if err != nil { + return nil, err + } + fieldCode.value = code + fieldCode.isAddrForMarshaler = true + fieldCode.isNilCheck = false + default: + code, err := c.typeToCodeWithPtr(fieldType, isPtr) + if err != nil { + return nil, err + } + switch code.Kind() { + case CodeKindPtr, CodeKindInterface: + fieldCode.isNextOpPtrType = true + } + fieldCode.value = code + } + return fieldCode, nil +} + +func (c *Compiler) isAssignableIndirect(fieldCode *StructFieldCode, isPtr bool) bool { + if isPtr { + return false + } + codeType := fieldCode.value.Kind() + if codeType == CodeKindMarshalJSON { + return false + } + if codeType == CodeKindMarshalText { + return false + } + return true +} + +func (c *Compiler) getFieldMap(fields []*StructFieldCode) map[string][]*StructFieldCode { + fieldMap := map[string][]*StructFieldCode{} + for _, field := range fields { + if field.isAnonymous { + for k, v := range c.getAnonymousFieldMap(field) { + fieldMap[k] = append(fieldMap[k], v...) + } + continue + } + fieldMap[field.key] = append(fieldMap[field.key], field) + } + return fieldMap +} + +func (c *Compiler) getAnonymousFieldMap(field *StructFieldCode) map[string][]*StructFieldCode { + fieldMap := map[string][]*StructFieldCode{} + structCode := field.getAnonymousStruct() + if structCode == nil || structCode.isRecursive { + fieldMap[field.key] = append(fieldMap[field.key], field) + return fieldMap + } + for k, v := range c.getFieldMapFromAnonymousParent(structCode.fields) { + fieldMap[k] = append(fieldMap[k], v...) + } + return fieldMap +} + +func (c *Compiler) getFieldMapFromAnonymousParent(fields []*StructFieldCode) map[string][]*StructFieldCode { + fieldMap := map[string][]*StructFieldCode{} + for _, field := range fields { + if field.isAnonymous { + for k, v := range c.getAnonymousFieldMap(field) { + // Do not handle tagged key when embedding more than once + for _, vv := range v { + vv.isTaggedKey = false + } + fieldMap[k] = append(fieldMap[k], v...) + } + continue + } + fieldMap[field.key] = append(fieldMap[field.key], field) + } + return fieldMap +} + +func (c *Compiler) getDuplicatedFieldMap(fieldMap map[string][]*StructFieldCode) map[*StructFieldCode]struct{} { + duplicatedFieldMap := map[*StructFieldCode]struct{}{} + for _, fields := range fieldMap { + if len(fields) == 1 { + continue + } + if c.isTaggedKeyOnly(fields) { + for _, field := range fields { + if field.isTaggedKey { + continue + } + duplicatedFieldMap[field] = struct{}{} + } + } else { + for _, field := range fields { + duplicatedFieldMap[field] = struct{}{} + } + } + } + return duplicatedFieldMap +} + +func (c *Compiler) filteredDuplicatedFields(fields []*StructFieldCode, duplicatedFieldMap map[*StructFieldCode]struct{}) []*StructFieldCode { + filteredFields := make([]*StructFieldCode, 0, len(fields)) + for _, field := range fields { + if field.isAnonymous { + structCode := field.getAnonymousStruct() + if structCode != nil && !structCode.isRecursive { + structCode.fields = c.filteredDuplicatedFields(structCode.fields, duplicatedFieldMap) + if len(structCode.fields) > 0 { + filteredFields = append(filteredFields, field) + } + continue + } + } + if _, exists := duplicatedFieldMap[field]; exists { + continue + } + filteredFields = append(filteredFields, field) + } + return filteredFields +} + +func (c *Compiler) isTaggedKeyOnly(fields []*StructFieldCode) bool { + var taggedKeyFieldCount int + for _, field := range fields { + if field.isTaggedKey { + taggedKeyFieldCount++ + } + } + return taggedKeyFieldCount == 1 +} + +func (c *Compiler) typeToStructTags(typ *runtime.Type) runtime.StructTags { + tags := runtime.StructTags{} + fieldNum := typ.NumField() + for i := 0; i < fieldNum; i++ { + field := typ.Field(i) + if runtime.IsIgnoredStructField(field) { + continue + } + tags = append(tags, runtime.StructTagFromField(field)) + } + return tags +} + +// *struct{ field T } => struct { field *T } +// func (*T) MarshalJSON() ([]byte, error) +func (c *Compiler) isMovePointerPositionFromHeadToFirstMarshalJSONFieldCase(typ *runtime.Type, isIndirectSpecialCase bool) bool { + return isIndirectSpecialCase && !c.isNilableType(typ) && c.isPtrMarshalJSONType(typ) +} + +// *struct{ field T } => struct { field *T } +// func (*T) MarshalText() ([]byte, error) +func (c *Compiler) isMovePointerPositionFromHeadToFirstMarshalTextFieldCase(typ *runtime.Type, isIndirectSpecialCase bool) bool { + return isIndirectSpecialCase && !c.isNilableType(typ) && c.isPtrMarshalTextType(typ) +} + +func (c *Compiler) implementsMarshalJSON(typ *runtime.Type) bool { + if !c.implementsMarshalJSONType(typ) { + return false + } + if typ.Kind() != reflect.Ptr { + return true + } + // type kind is reflect.Ptr + if !c.implementsMarshalJSONType(typ.Elem()) { + return true + } + // needs to dereference + return false +} + +func (c *Compiler) implementsMarshalText(typ *runtime.Type) bool { + if !typ.Implements(marshalTextType) { + return false + } + if typ.Kind() != reflect.Ptr { + return true + } + // type kind is reflect.Ptr + if !typ.Elem().Implements(marshalTextType) { + return true + } + // needs to dereference + return false +} + +func (c *Compiler) isNilableType(typ *runtime.Type) bool { + if !runtime.IfaceIndir(typ) { + return true + } + switch typ.Kind() { + case reflect.Ptr: + return true + case reflect.Map: + return true + case reflect.Func: + return true + default: + return false + } +} + +func (c *Compiler) implementsMarshalJSONType(typ *runtime.Type) bool { + return typ.Implements(marshalJSONType) || typ.Implements(marshalJSONContextType) +} + +func (c *Compiler) isPtrMarshalJSONType(typ *runtime.Type) bool { + return !c.implementsMarshalJSONType(typ) && c.implementsMarshalJSONType(runtime.PtrTo(typ)) +} + +func (c *Compiler) isPtrMarshalTextType(typ *runtime.Type) bool { + return !typ.Implements(marshalTextType) && runtime.PtrTo(typ).Implements(marshalTextType) +} + +func (c *Compiler) codeToOpcode(ctx *compileContext, typ *runtime.Type, code Code) *Opcode { + codes := code.ToOpcode(ctx) + codes.Last().Next = newEndOp(ctx, typ) + c.linkRecursiveCode(ctx) + return codes.First() +} + +func (c *Compiler) linkRecursiveCode(ctx *compileContext) { + recursiveCodes := map[uintptr]*CompiledCode{} + for _, recursive := range *ctx.recursiveCodes { + typeptr := uintptr(unsafe.Pointer(recursive.Type)) + codes := ctx.structTypeToCodes[typeptr] + if recursiveCode, ok := recursiveCodes[typeptr]; ok { + *recursive.Jmp = *recursiveCode + continue + } + + code := copyOpcode(codes.First()) + code.Op = code.Op.PtrHeadToHead() + lastCode := newEndOp(&compileContext{}, recursive.Type) + lastCode.Op = OpRecursiveEnd + + // OpRecursiveEnd must set before call TotalLength + code.End.Next = lastCode + + totalLength := code.TotalLength() + + // Idx, ElemIdx, Length must set after call TotalLength + lastCode.Idx = uint32((totalLength + 1) * uintptrSize) + lastCode.ElemIdx = lastCode.Idx + uintptrSize + lastCode.Length = lastCode.Idx + 2*uintptrSize + + // extend length to alloc slot for elemIdx + length + curTotalLength := uintptr(recursive.TotalLength()) + 3 + nextTotalLength := uintptr(totalLength) + 3 + + compiled := recursive.Jmp + compiled.Code = code + compiled.CurLen = curTotalLength + compiled.NextLen = nextTotalLength + compiled.Linked = true + + recursiveCodes[typeptr] = compiled + } +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/compiler_norace.go b/vendor/github.com/goccy/go-json/internal/encoder/compiler_norace.go new file mode 100644 index 000000000..20c93cbf7 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/compiler_norace.go @@ -0,0 +1,32 @@ +//go:build !race +// +build !race + +package encoder + +func CompileToGetCodeSet(ctx *RuntimeContext, typeptr uintptr) (*OpcodeSet, error) { + if typeptr > typeAddr.MaxTypeAddr || typeptr < typeAddr.BaseTypeAddr { + codeSet, err := compileToGetCodeSetSlowPath(typeptr) + if err != nil { + return nil, err + } + return getFilteredCodeSetIfNeeded(ctx, codeSet) + } + index := (typeptr - typeAddr.BaseTypeAddr) >> typeAddr.AddrShift + if codeSet := cachedOpcodeSets[index]; codeSet != nil { + filtered, err := getFilteredCodeSetIfNeeded(ctx, codeSet) + if err != nil { + return nil, err + } + return filtered, nil + } + codeSet, err := newCompiler().compile(typeptr) + if err != nil { + return nil, err + } + filtered, err := getFilteredCodeSetIfNeeded(ctx, codeSet) + if err != nil { + return nil, err + } + cachedOpcodeSets[index] = codeSet + return filtered, nil +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/compiler_race.go b/vendor/github.com/goccy/go-json/internal/encoder/compiler_race.go new file mode 100644 index 000000000..13ba23fdf --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/compiler_race.go @@ -0,0 +1,45 @@ +//go:build race +// +build race + +package encoder + +import ( + "sync" +) + +var setsMu sync.RWMutex + +func CompileToGetCodeSet(ctx *RuntimeContext, typeptr uintptr) (*OpcodeSet, error) { + if typeptr > typeAddr.MaxTypeAddr || typeptr < typeAddr.BaseTypeAddr { + codeSet, err := compileToGetCodeSetSlowPath(typeptr) + if err != nil { + return nil, err + } + return getFilteredCodeSetIfNeeded(ctx, codeSet) + } + index := (typeptr - typeAddr.BaseTypeAddr) >> typeAddr.AddrShift + setsMu.RLock() + if codeSet := cachedOpcodeSets[index]; codeSet != nil { + filtered, err := getFilteredCodeSetIfNeeded(ctx, codeSet) + if err != nil { + setsMu.RUnlock() + return nil, err + } + setsMu.RUnlock() + return filtered, nil + } + setsMu.RUnlock() + + codeSet, err := newCompiler().compile(typeptr) + if err != nil { + return nil, err + } + filtered, err := getFilteredCodeSetIfNeeded(ctx, codeSet) + if err != nil { + return nil, err + } + setsMu.Lock() + cachedOpcodeSets[index] = codeSet + setsMu.Unlock() + return filtered, nil +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/context.go b/vendor/github.com/goccy/go-json/internal/encoder/context.go new file mode 100644 index 000000000..3833d0c86 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/context.go @@ -0,0 +1,105 @@ +package encoder + +import ( + "context" + "sync" + "unsafe" + + "github.com/goccy/go-json/internal/runtime" +) + +type compileContext struct { + opcodeIndex uint32 + ptrIndex int + indent uint32 + escapeKey bool + structTypeToCodes map[uintptr]Opcodes + recursiveCodes *Opcodes +} + +func (c *compileContext) incIndent() { + c.indent++ +} + +func (c *compileContext) decIndent() { + c.indent-- +} + +func (c *compileContext) incIndex() { + c.incOpcodeIndex() + c.incPtrIndex() +} + +func (c *compileContext) decIndex() { + c.decOpcodeIndex() + c.decPtrIndex() +} + +func (c *compileContext) incOpcodeIndex() { + c.opcodeIndex++ +} + +func (c *compileContext) decOpcodeIndex() { + c.opcodeIndex-- +} + +func (c *compileContext) incPtrIndex() { + c.ptrIndex++ +} + +func (c *compileContext) decPtrIndex() { + c.ptrIndex-- +} + +const ( + bufSize = 1024 +) + +var ( + runtimeContextPool = sync.Pool{ + New: func() interface{} { + return &RuntimeContext{ + Buf: make([]byte, 0, bufSize), + Ptrs: make([]uintptr, 128), + KeepRefs: make([]unsafe.Pointer, 0, 8), + Option: &Option{}, + } + }, + } +) + +type RuntimeContext struct { + Context context.Context + Buf []byte + MarshalBuf []byte + Ptrs []uintptr + KeepRefs []unsafe.Pointer + SeenPtr []uintptr + BaseIndent uint32 + Prefix []byte + IndentStr []byte + Option *Option +} + +func (c *RuntimeContext) Init(p uintptr, codelen int) { + if len(c.Ptrs) < codelen { + c.Ptrs = make([]uintptr, codelen) + } + c.Ptrs[0] = p + c.KeepRefs = c.KeepRefs[:0] + c.SeenPtr = c.SeenPtr[:0] + c.BaseIndent = 0 +} + +func (c *RuntimeContext) Ptr() uintptr { + header := (*runtime.SliceHeader)(unsafe.Pointer(&c.Ptrs)) + return uintptr(header.Data) +} + +func TakeRuntimeContext() *RuntimeContext { + return runtimeContextPool.Get().(*RuntimeContext) +} + +func ReleaseRuntimeContext(ctx *RuntimeContext) { + runtimeContextPool.Put(ctx) +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/decode_rune.go b/vendor/github.com/goccy/go-json/internal/encoder/decode_rune.go new file mode 100644 index 000000000..35c959d48 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/decode_rune.go @@ -0,0 +1,126 @@ +package encoder + +import "unicode/utf8" + +const ( + // The default lowest and highest continuation byte. + locb = 128 //0b10000000 + hicb = 191 //0b10111111 + + // These names of these constants are chosen to give nice alignment in the + // table below. The first nibble is an index into acceptRanges or F for + // special one-byte cases. The second nibble is the Rune length or the + // Status for the special one-byte case. + xx = 0xF1 // invalid: size 1 + as = 0xF0 // ASCII: size 1 + s1 = 0x02 // accept 0, size 2 + s2 = 0x13 // accept 1, size 3 + s3 = 0x03 // accept 0, size 3 + s4 = 0x23 // accept 2, size 3 + s5 = 0x34 // accept 3, size 4 + s6 = 0x04 // accept 0, size 4 + s7 = 0x44 // accept 4, size 4 +) + +// first is information about the first byte in a UTF-8 sequence. +var first = [256]uint8{ + // 1 2 3 4 5 6 7 8 9 A B C D E F + as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, // 0x00-0x0F + as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, // 0x10-0x1F + as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, // 0x20-0x2F + as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, // 0x30-0x3F + as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, // 0x40-0x4F + as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, // 0x50-0x5F + as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, // 0x60-0x6F + as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, as, // 0x70-0x7F + // 1 2 3 4 5 6 7 8 9 A B C D E F + xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, // 0x80-0x8F + xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, // 0x90-0x9F + xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, // 0xA0-0xAF + xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, // 0xB0-0xBF + xx, xx, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, // 0xC0-0xCF + s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, s1, // 0xD0-0xDF + s2, s3, s3, s3, s3, s3, s3, s3, s3, s3, s3, s3, s3, s4, s3, s3, // 0xE0-0xEF + s5, s6, s6, s6, s7, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, xx, // 0xF0-0xFF +} + +const ( + lineSep = byte(168) //'\u2028' + paragraphSep = byte(169) //'\u2029' +) + +type decodeRuneState int + +const ( + validUTF8State decodeRuneState = iota + runeErrorState + lineSepState + paragraphSepState +) + +func decodeRuneInString(s string) (decodeRuneState, int) { + n := len(s) + s0 := s[0] + x := first[s0] + if x >= as { + // The following code simulates an additional check for x == xx and + // handling the ASCII and invalid cases accordingly. This mask-and-or + // approach prevents an additional branch. + mask := rune(x) << 31 >> 31 // Create 0x0000 or 0xFFFF. + if rune(s[0])&^mask|utf8.RuneError&mask == utf8.RuneError { + return runeErrorState, 1 + } + return validUTF8State, 1 + } + sz := int(x & 7) + if n < sz { + return runeErrorState, 1 + } + s1 := s[1] + switch x >> 4 { + case 0: + if s1 < locb || hicb < s1 { + return runeErrorState, 1 + } + case 1: + if s1 < 0xA0 || hicb < s1 { + return runeErrorState, 1 + } + case 2: + if s1 < locb || 0x9F < s1 { + return runeErrorState, 1 + } + case 3: + if s1 < 0x90 || hicb < s1 { + return runeErrorState, 1 + } + case 4: + if s1 < locb || 0x8F < s1 { + return runeErrorState, 1 + } + } + if sz <= 2 { + return validUTF8State, 2 + } + s2 := s[2] + if s2 < locb || hicb < s2 { + return runeErrorState, 1 + } + if sz <= 3 { + // separator character prefixes: [2]byte{226, 128} + if s0 == 226 && s1 == 128 { + switch s2 { + case lineSep: + return lineSepState, 3 + case paragraphSep: + return paragraphSepState, 3 + } + } + return validUTF8State, 3 + } + s3 := s[3] + if s3 < locb || hicb < s3 { + return runeErrorState, 1 + } + return validUTF8State, 4 +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/encoder.go b/vendor/github.com/goccy/go-json/internal/encoder/encoder.go new file mode 100644 index 000000000..14eb6a0d6 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/encoder.go @@ -0,0 +1,596 @@ +package encoder + +import ( + "bytes" + "encoding" + "encoding/base64" + "encoding/json" + "fmt" + "math" + "reflect" + "strconv" + "strings" + "sync" + "unsafe" + + "github.com/goccy/go-json/internal/errors" + "github.com/goccy/go-json/internal/runtime" +) + +func (t OpType) IsMultipleOpHead() bool { + switch t { + case OpStructHead: + return true + case OpStructHeadSlice: + return true + case OpStructHeadArray: + return true + case OpStructHeadMap: + return true + case OpStructHeadStruct: + return true + case OpStructHeadOmitEmpty: + return true + case OpStructHeadOmitEmptySlice: + return true + case OpStructHeadOmitEmptyArray: + return true + case OpStructHeadOmitEmptyMap: + return true + case OpStructHeadOmitEmptyStruct: + return true + case OpStructHeadSlicePtr: + return true + case OpStructHeadOmitEmptySlicePtr: + return true + case OpStructHeadArrayPtr: + return true + case OpStructHeadOmitEmptyArrayPtr: + return true + case OpStructHeadMapPtr: + return true + case OpStructHeadOmitEmptyMapPtr: + return true + } + return false +} + +func (t OpType) IsMultipleOpField() bool { + switch t { + case OpStructField: + return true + case OpStructFieldSlice: + return true + case OpStructFieldArray: + return true + case OpStructFieldMap: + return true + case OpStructFieldStruct: + return true + case OpStructFieldOmitEmpty: + return true + case OpStructFieldOmitEmptySlice: + return true + case OpStructFieldOmitEmptyArray: + return true + case OpStructFieldOmitEmptyMap: + return true + case OpStructFieldOmitEmptyStruct: + return true + case OpStructFieldSlicePtr: + return true + case OpStructFieldOmitEmptySlicePtr: + return true + case OpStructFieldArrayPtr: + return true + case OpStructFieldOmitEmptyArrayPtr: + return true + case OpStructFieldMapPtr: + return true + case OpStructFieldOmitEmptyMapPtr: + return true + } + return false +} + +type OpcodeSet struct { + Type *runtime.Type + NoescapeKeyCode *Opcode + EscapeKeyCode *Opcode + InterfaceNoescapeKeyCode *Opcode + InterfaceEscapeKeyCode *Opcode + CodeLength int + EndCode *Opcode + Code Code + QueryCache map[string]*OpcodeSet + cacheMu sync.RWMutex +} + +func (s *OpcodeSet) getQueryCache(hash string) *OpcodeSet { + s.cacheMu.RLock() + codeSet := s.QueryCache[hash] + s.cacheMu.RUnlock() + return codeSet +} + +func (s *OpcodeSet) setQueryCache(hash string, codeSet *OpcodeSet) { + s.cacheMu.Lock() + s.QueryCache[hash] = codeSet + s.cacheMu.Unlock() +} + +type CompiledCode struct { + Code *Opcode + Linked bool // whether recursive code already have linked + CurLen uintptr + NextLen uintptr +} + +const StartDetectingCyclesAfter = 1000 + +func Load(base uintptr, idx uintptr) uintptr { + addr := base + idx + return **(**uintptr)(unsafe.Pointer(&addr)) +} + +func Store(base uintptr, idx uintptr, p uintptr) { + addr := base + idx + **(**uintptr)(unsafe.Pointer(&addr)) = p +} + +func LoadNPtr(base uintptr, idx uintptr, ptrNum int) uintptr { + addr := base + idx + p := **(**uintptr)(unsafe.Pointer(&addr)) + if p == 0 { + return 0 + } + return PtrToPtr(p) + /* + for i := 0; i < ptrNum; i++ { + if p == 0 { + return p + } + p = PtrToPtr(p) + } + return p + */ +} + +func PtrToUint64(p uintptr) uint64 { return **(**uint64)(unsafe.Pointer(&p)) } +func PtrToFloat32(p uintptr) float32 { return **(**float32)(unsafe.Pointer(&p)) } +func PtrToFloat64(p uintptr) float64 { return **(**float64)(unsafe.Pointer(&p)) } +func PtrToBool(p uintptr) bool { return **(**bool)(unsafe.Pointer(&p)) } +func PtrToBytes(p uintptr) []byte { return **(**[]byte)(unsafe.Pointer(&p)) } +func PtrToNumber(p uintptr) json.Number { return **(**json.Number)(unsafe.Pointer(&p)) } +func PtrToString(p uintptr) string { return **(**string)(unsafe.Pointer(&p)) } +func PtrToSlice(p uintptr) *runtime.SliceHeader { return *(**runtime.SliceHeader)(unsafe.Pointer(&p)) } +func PtrToPtr(p uintptr) uintptr { + return uintptr(**(**unsafe.Pointer)(unsafe.Pointer(&p))) +} +func PtrToNPtr(p uintptr, ptrNum int) uintptr { + for i := 0; i < ptrNum; i++ { + if p == 0 { + return 0 + } + p = PtrToPtr(p) + } + return p +} + +func PtrToUnsafePtr(p uintptr) unsafe.Pointer { + return *(*unsafe.Pointer)(unsafe.Pointer(&p)) +} +func PtrToInterface(code *Opcode, p uintptr) interface{} { + return *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: code.Type, + ptr: *(*unsafe.Pointer)(unsafe.Pointer(&p)), + })) +} + +func ErrUnsupportedValue(code *Opcode, ptr uintptr) *errors.UnsupportedValueError { + v := *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: code.Type, + ptr: *(*unsafe.Pointer)(unsafe.Pointer(&ptr)), + })) + return &errors.UnsupportedValueError{ + Value: reflect.ValueOf(v), + Str: fmt.Sprintf("encountered a cycle via %s", code.Type), + } +} + +func ErrUnsupportedFloat(v float64) *errors.UnsupportedValueError { + return &errors.UnsupportedValueError{ + Value: reflect.ValueOf(v), + Str: strconv.FormatFloat(v, 'g', -1, 64), + } +} + +func ErrMarshalerWithCode(code *Opcode, err error) *errors.MarshalerError { + return &errors.MarshalerError{ + Type: runtime.RType2Type(code.Type), + Err: err, + } +} + +type emptyInterface struct { + typ *runtime.Type + ptr unsafe.Pointer +} + +type MapItem struct { + Key []byte + Value []byte +} + +type Mapslice struct { + Items []MapItem +} + +func (m *Mapslice) Len() int { + return len(m.Items) +} + +func (m *Mapslice) Less(i, j int) bool { + return bytes.Compare(m.Items[i].Key, m.Items[j].Key) < 0 +} + +func (m *Mapslice) Swap(i, j int) { + m.Items[i], m.Items[j] = m.Items[j], m.Items[i] +} + +//nolint:structcheck,unused +type mapIter struct { + key unsafe.Pointer + elem unsafe.Pointer + t unsafe.Pointer + h unsafe.Pointer + buckets unsafe.Pointer + bptr unsafe.Pointer + overflow unsafe.Pointer + oldoverflow unsafe.Pointer + startBucket uintptr + offset uint8 + wrapped bool + B uint8 + i uint8 + bucket uintptr + checkBucket uintptr +} + +type MapContext struct { + Start int + First int + Idx int + Slice *Mapslice + Buf []byte + Len int + Iter mapIter +} + +var mapContextPool = sync.Pool{ + New: func() interface{} { + return &MapContext{ + Slice: &Mapslice{}, + } + }, +} + +func NewMapContext(mapLen int, unorderedMap bool) *MapContext { + ctx := mapContextPool.Get().(*MapContext) + if !unorderedMap { + if len(ctx.Slice.Items) < mapLen { + ctx.Slice.Items = make([]MapItem, mapLen) + } else { + ctx.Slice.Items = ctx.Slice.Items[:mapLen] + } + } + ctx.Buf = ctx.Buf[:0] + ctx.Iter = mapIter{} + ctx.Idx = 0 + ctx.Len = mapLen + return ctx +} + +func ReleaseMapContext(c *MapContext) { + mapContextPool.Put(c) +} + +//go:linkname MapIterInit runtime.mapiterinit +//go:noescape +func MapIterInit(mapType *runtime.Type, m unsafe.Pointer, it *mapIter) + +//go:linkname MapIterKey reflect.mapiterkey +//go:noescape +func MapIterKey(it *mapIter) unsafe.Pointer + +//go:linkname MapIterNext reflect.mapiternext +//go:noescape +func MapIterNext(it *mapIter) + +//go:linkname MapLen reflect.maplen +//go:noescape +func MapLen(m unsafe.Pointer) int + +func AppendByteSlice(_ *RuntimeContext, b []byte, src []byte) []byte { + if src == nil { + return append(b, `null`...) + } + encodedLen := base64.StdEncoding.EncodedLen(len(src)) + b = append(b, '"') + pos := len(b) + remainLen := cap(b[pos:]) + var buf []byte + if remainLen > encodedLen { + buf = b[pos : pos+encodedLen] + } else { + buf = make([]byte, encodedLen) + } + base64.StdEncoding.Encode(buf, src) + return append(append(b, buf...), '"') +} + +func AppendFloat32(_ *RuntimeContext, b []byte, v float32) []byte { + f64 := float64(v) + abs := math.Abs(f64) + fmt := byte('f') + // Note: Must use float32 comparisons for underlying float32 value to get precise cutoffs right. + if abs != 0 { + f32 := float32(abs) + if f32 < 1e-6 || f32 >= 1e21 { + fmt = 'e' + } + } + return strconv.AppendFloat(b, f64, fmt, -1, 32) +} + +func AppendFloat64(_ *RuntimeContext, b []byte, v float64) []byte { + abs := math.Abs(v) + fmt := byte('f') + // Note: Must use float32 comparisons for underlying float32 value to get precise cutoffs right. + if abs != 0 { + if abs < 1e-6 || abs >= 1e21 { + fmt = 'e' + } + } + return strconv.AppendFloat(b, v, fmt, -1, 64) +} + +func AppendBool(_ *RuntimeContext, b []byte, v bool) []byte { + if v { + return append(b, "true"...) + } + return append(b, "false"...) +} + +var ( + floatTable = [256]bool{ + '0': true, + '1': true, + '2': true, + '3': true, + '4': true, + '5': true, + '6': true, + '7': true, + '8': true, + '9': true, + '.': true, + 'e': true, + 'E': true, + '+': true, + '-': true, + } +) + +func AppendNumber(_ *RuntimeContext, b []byte, n json.Number) ([]byte, error) { + if len(n) == 0 { + return append(b, '0'), nil + } + for i := 0; i < len(n); i++ { + if !floatTable[n[i]] { + return nil, fmt.Errorf("json: invalid number literal %q", n) + } + } + b = append(b, n...) + return b, nil +} + +func AppendMarshalJSON(ctx *RuntimeContext, code *Opcode, b []byte, v interface{}) ([]byte, error) { + rv := reflect.ValueOf(v) // convert by dynamic interface type + if (code.Flags & AddrForMarshalerFlags) != 0 { + if rv.CanAddr() { + rv = rv.Addr() + } else { + newV := reflect.New(rv.Type()) + newV.Elem().Set(rv) + rv = newV + } + } + v = rv.Interface() + var bb []byte + if (code.Flags & MarshalerContextFlags) != 0 { + marshaler, ok := v.(marshalerContext) + if !ok { + return AppendNull(ctx, b), nil + } + stdctx := ctx.Option.Context + if ctx.Option.Flag&FieldQueryOption != 0 { + stdctx = SetFieldQueryToContext(stdctx, code.FieldQuery) + } + b, err := marshaler.MarshalJSON(stdctx) + if err != nil { + return nil, &errors.MarshalerError{Type: reflect.TypeOf(v), Err: err} + } + bb = b + } else { + marshaler, ok := v.(json.Marshaler) + if !ok { + return AppendNull(ctx, b), nil + } + b, err := marshaler.MarshalJSON() + if err != nil { + return nil, &errors.MarshalerError{Type: reflect.TypeOf(v), Err: err} + } + bb = b + } + marshalBuf := ctx.MarshalBuf[:0] + marshalBuf = append(append(marshalBuf, bb...), nul) + compactedBuf, err := compact(b, marshalBuf, (ctx.Option.Flag&HTMLEscapeOption) != 0) + if err != nil { + return nil, &errors.MarshalerError{Type: reflect.TypeOf(v), Err: err} + } + ctx.MarshalBuf = marshalBuf + return compactedBuf, nil +} + +func AppendMarshalJSONIndent(ctx *RuntimeContext, code *Opcode, b []byte, v interface{}) ([]byte, error) { + rv := reflect.ValueOf(v) // convert by dynamic interface type + if (code.Flags & AddrForMarshalerFlags) != 0 { + if rv.CanAddr() { + rv = rv.Addr() + } else { + newV := reflect.New(rv.Type()) + newV.Elem().Set(rv) + rv = newV + } + } + v = rv.Interface() + var bb []byte + if (code.Flags & MarshalerContextFlags) != 0 { + marshaler, ok := v.(marshalerContext) + if !ok { + return AppendNull(ctx, b), nil + } + b, err := marshaler.MarshalJSON(ctx.Option.Context) + if err != nil { + return nil, &errors.MarshalerError{Type: reflect.TypeOf(v), Err: err} + } + bb = b + } else { + marshaler, ok := v.(json.Marshaler) + if !ok { + return AppendNull(ctx, b), nil + } + b, err := marshaler.MarshalJSON() + if err != nil { + return nil, &errors.MarshalerError{Type: reflect.TypeOf(v), Err: err} + } + bb = b + } + marshalBuf := ctx.MarshalBuf[:0] + marshalBuf = append(append(marshalBuf, bb...), nul) + indentedBuf, err := doIndent( + b, + marshalBuf, + string(ctx.Prefix)+strings.Repeat(string(ctx.IndentStr), int(ctx.BaseIndent+code.Indent)), + string(ctx.IndentStr), + (ctx.Option.Flag&HTMLEscapeOption) != 0, + ) + if err != nil { + return nil, &errors.MarshalerError{Type: reflect.TypeOf(v), Err: err} + } + ctx.MarshalBuf = marshalBuf + return indentedBuf, nil +} + +func AppendMarshalText(ctx *RuntimeContext, code *Opcode, b []byte, v interface{}) ([]byte, error) { + rv := reflect.ValueOf(v) // convert by dynamic interface type + if (code.Flags & AddrForMarshalerFlags) != 0 { + if rv.CanAddr() { + rv = rv.Addr() + } else { + newV := reflect.New(rv.Type()) + newV.Elem().Set(rv) + rv = newV + } + } + v = rv.Interface() + marshaler, ok := v.(encoding.TextMarshaler) + if !ok { + return AppendNull(ctx, b), nil + } + bytes, err := marshaler.MarshalText() + if err != nil { + return nil, &errors.MarshalerError{Type: reflect.TypeOf(v), Err: err} + } + return AppendString(ctx, b, *(*string)(unsafe.Pointer(&bytes))), nil +} + +func AppendMarshalTextIndent(ctx *RuntimeContext, code *Opcode, b []byte, v interface{}) ([]byte, error) { + rv := reflect.ValueOf(v) // convert by dynamic interface type + if (code.Flags & AddrForMarshalerFlags) != 0 { + if rv.CanAddr() { + rv = rv.Addr() + } else { + newV := reflect.New(rv.Type()) + newV.Elem().Set(rv) + rv = newV + } + } + v = rv.Interface() + marshaler, ok := v.(encoding.TextMarshaler) + if !ok { + return AppendNull(ctx, b), nil + } + bytes, err := marshaler.MarshalText() + if err != nil { + return nil, &errors.MarshalerError{Type: reflect.TypeOf(v), Err: err} + } + return AppendString(ctx, b, *(*string)(unsafe.Pointer(&bytes))), nil +} + +func AppendNull(_ *RuntimeContext, b []byte) []byte { + return append(b, "null"...) +} + +func AppendComma(_ *RuntimeContext, b []byte) []byte { + return append(b, ',') +} + +func AppendCommaIndent(_ *RuntimeContext, b []byte) []byte { + return append(b, ',', '\n') +} + +func AppendStructEnd(_ *RuntimeContext, b []byte) []byte { + return append(b, '}', ',') +} + +func AppendStructEndIndent(ctx *RuntimeContext, code *Opcode, b []byte) []byte { + b = append(b, '\n') + b = append(b, ctx.Prefix...) + indentNum := ctx.BaseIndent + code.Indent - 1 + for i := uint32(0); i < indentNum; i++ { + b = append(b, ctx.IndentStr...) + } + return append(b, '}', ',', '\n') +} + +func AppendIndent(ctx *RuntimeContext, b []byte, indent uint32) []byte { + b = append(b, ctx.Prefix...) + indentNum := ctx.BaseIndent + indent + for i := uint32(0); i < indentNum; i++ { + b = append(b, ctx.IndentStr...) + } + return b +} + +func IsNilForMarshaler(v interface{}) bool { + rv := reflect.ValueOf(v) + switch rv.Kind() { + case reflect.Bool: + return !rv.Bool() + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + return rv.Int() == 0 + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + return rv.Uint() == 0 + case reflect.Float32, reflect.Float64: + return math.Float64bits(rv.Float()) == 0 + case reflect.Interface, reflect.Map, reflect.Ptr, reflect.Func: + return rv.IsNil() + case reflect.Slice: + return rv.IsNil() || rv.Len() == 0 + case reflect.String: + return rv.Len() == 0 + } + return false +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/indent.go b/vendor/github.com/goccy/go-json/internal/encoder/indent.go new file mode 100644 index 000000000..dfe04b5e3 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/indent.go @@ -0,0 +1,211 @@ +package encoder + +import ( + "bytes" + "fmt" + + "github.com/goccy/go-json/internal/errors" +) + +func takeIndentSrcRuntimeContext(src []byte) (*RuntimeContext, []byte) { + ctx := TakeRuntimeContext() + buf := ctx.Buf[:0] + buf = append(append(buf, src...), nul) + ctx.Buf = buf + return ctx, buf +} + +func Indent(buf *bytes.Buffer, src []byte, prefix, indentStr string) error { + if len(src) == 0 { + return errors.ErrUnexpectedEndOfJSON("", 0) + } + + srcCtx, srcBuf := takeIndentSrcRuntimeContext(src) + dstCtx := TakeRuntimeContext() + dst := dstCtx.Buf[:0] + + dst, err := indentAndWrite(buf, dst, srcBuf, prefix, indentStr) + if err != nil { + ReleaseRuntimeContext(srcCtx) + ReleaseRuntimeContext(dstCtx) + return err + } + dstCtx.Buf = dst + ReleaseRuntimeContext(srcCtx) + ReleaseRuntimeContext(dstCtx) + return nil +} + +func indentAndWrite(buf *bytes.Buffer, dst []byte, src []byte, prefix, indentStr string) ([]byte, error) { + dst, err := doIndent(dst, src, prefix, indentStr, false) + if err != nil { + return nil, err + } + if _, err := buf.Write(dst); err != nil { + return nil, err + } + return dst, nil +} + +func doIndent(dst, src []byte, prefix, indentStr string, escape bool) ([]byte, error) { + buf, cursor, err := indentValue(dst, src, 0, 0, []byte(prefix), []byte(indentStr), escape) + if err != nil { + return nil, err + } + if err := validateEndBuf(src, cursor); err != nil { + return nil, err + } + return buf, nil +} + +func indentValue( + dst []byte, + src []byte, + indentNum int, + cursor int64, + prefix []byte, + indentBytes []byte, + escape bool) ([]byte, int64, error) { + for { + switch src[cursor] { + case ' ', '\t', '\n', '\r': + cursor++ + continue + case '{': + return indentObject(dst, src, indentNum, cursor, prefix, indentBytes, escape) + case '}': + return nil, 0, errors.ErrSyntax("unexpected character '}'", cursor) + case '[': + return indentArray(dst, src, indentNum, cursor, prefix, indentBytes, escape) + case ']': + return nil, 0, errors.ErrSyntax("unexpected character ']'", cursor) + case '"': + return compactString(dst, src, cursor, escape) + case '-', '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': + return compactNumber(dst, src, cursor) + case 't': + return compactTrue(dst, src, cursor) + case 'f': + return compactFalse(dst, src, cursor) + case 'n': + return compactNull(dst, src, cursor) + default: + return nil, 0, errors.ErrSyntax(fmt.Sprintf("unexpected character '%c'", src[cursor]), cursor) + } + } +} + +func indentObject( + dst []byte, + src []byte, + indentNum int, + cursor int64, + prefix []byte, + indentBytes []byte, + escape bool) ([]byte, int64, error) { + if src[cursor] == '{' { + dst = append(dst, '{') + } else { + return nil, 0, errors.ErrExpected("expected { character for object value", cursor) + } + cursor = skipWhiteSpace(src, cursor+1) + if src[cursor] == '}' { + dst = append(dst, '}') + return dst, cursor + 1, nil + } + indentNum++ + var err error + for { + dst = append(append(dst, '\n'), prefix...) + for i := 0; i < indentNum; i++ { + dst = append(dst, indentBytes...) + } + cursor = skipWhiteSpace(src, cursor) + dst, cursor, err = compactString(dst, src, cursor, escape) + if err != nil { + return nil, 0, err + } + cursor = skipWhiteSpace(src, cursor) + if src[cursor] != ':' { + return nil, 0, errors.ErrSyntax( + fmt.Sprintf("invalid character '%c' after object key", src[cursor]), + cursor+1, + ) + } + dst = append(dst, ':', ' ') + dst, cursor, err = indentValue(dst, src, indentNum, cursor+1, prefix, indentBytes, escape) + if err != nil { + return nil, 0, err + } + cursor = skipWhiteSpace(src, cursor) + switch src[cursor] { + case '}': + dst = append(append(dst, '\n'), prefix...) + for i := 0; i < indentNum-1; i++ { + dst = append(dst, indentBytes...) + } + dst = append(dst, '}') + cursor++ + return dst, cursor, nil + case ',': + dst = append(dst, ',') + default: + return nil, 0, errors.ErrSyntax( + fmt.Sprintf("invalid character '%c' after object key:value pair", src[cursor]), + cursor+1, + ) + } + cursor++ + } +} + +func indentArray( + dst []byte, + src []byte, + indentNum int, + cursor int64, + prefix []byte, + indentBytes []byte, + escape bool) ([]byte, int64, error) { + if src[cursor] == '[' { + dst = append(dst, '[') + } else { + return nil, 0, errors.ErrExpected("expected [ character for array value", cursor) + } + cursor = skipWhiteSpace(src, cursor+1) + if src[cursor] == ']' { + dst = append(dst, ']') + return dst, cursor + 1, nil + } + indentNum++ + var err error + for { + dst = append(append(dst, '\n'), prefix...) + for i := 0; i < indentNum; i++ { + dst = append(dst, indentBytes...) + } + dst, cursor, err = indentValue(dst, src, indentNum, cursor, prefix, indentBytes, escape) + if err != nil { + return nil, 0, err + } + cursor = skipWhiteSpace(src, cursor) + switch src[cursor] { + case ']': + dst = append(append(dst, '\n'), prefix...) + for i := 0; i < indentNum-1; i++ { + dst = append(dst, indentBytes...) + } + dst = append(dst, ']') + cursor++ + return dst, cursor, nil + case ',': + dst = append(dst, ',') + default: + return nil, 0, errors.ErrSyntax( + fmt.Sprintf("invalid character '%c' after array value", src[cursor]), + cursor+1, + ) + } + cursor++ + } +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/int.go b/vendor/github.com/goccy/go-json/internal/encoder/int.go new file mode 100644 index 000000000..85f079609 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/int.go @@ -0,0 +1,152 @@ +package encoder + +import ( + "unsafe" +) + +var endianness int + +func init() { + var b [2]byte + *(*uint16)(unsafe.Pointer(&b)) = uint16(0xABCD) + + switch b[0] { + case 0xCD: + endianness = 0 // LE + case 0xAB: + endianness = 1 // BE + default: + panic("could not determine endianness") + } +} + +// "00010203...96979899" cast to []uint16 +var intLELookup = [100]uint16{ + 0x3030, 0x3130, 0x3230, 0x3330, 0x3430, 0x3530, 0x3630, 0x3730, 0x3830, 0x3930, + 0x3031, 0x3131, 0x3231, 0x3331, 0x3431, 0x3531, 0x3631, 0x3731, 0x3831, 0x3931, + 0x3032, 0x3132, 0x3232, 0x3332, 0x3432, 0x3532, 0x3632, 0x3732, 0x3832, 0x3932, + 0x3033, 0x3133, 0x3233, 0x3333, 0x3433, 0x3533, 0x3633, 0x3733, 0x3833, 0x3933, + 0x3034, 0x3134, 0x3234, 0x3334, 0x3434, 0x3534, 0x3634, 0x3734, 0x3834, 0x3934, + 0x3035, 0x3135, 0x3235, 0x3335, 0x3435, 0x3535, 0x3635, 0x3735, 0x3835, 0x3935, + 0x3036, 0x3136, 0x3236, 0x3336, 0x3436, 0x3536, 0x3636, 0x3736, 0x3836, 0x3936, + 0x3037, 0x3137, 0x3237, 0x3337, 0x3437, 0x3537, 0x3637, 0x3737, 0x3837, 0x3937, + 0x3038, 0x3138, 0x3238, 0x3338, 0x3438, 0x3538, 0x3638, 0x3738, 0x3838, 0x3938, + 0x3039, 0x3139, 0x3239, 0x3339, 0x3439, 0x3539, 0x3639, 0x3739, 0x3839, 0x3939, +} + +var intBELookup = [100]uint16{ + 0x3030, 0x3031, 0x3032, 0x3033, 0x3034, 0x3035, 0x3036, 0x3037, 0x3038, 0x3039, + 0x3130, 0x3131, 0x3132, 0x3133, 0x3134, 0x3135, 0x3136, 0x3137, 0x3138, 0x3139, + 0x3230, 0x3231, 0x3232, 0x3233, 0x3234, 0x3235, 0x3236, 0x3237, 0x3238, 0x3239, + 0x3330, 0x3331, 0x3332, 0x3333, 0x3334, 0x3335, 0x3336, 0x3337, 0x3338, 0x3339, + 0x3430, 0x3431, 0x3432, 0x3433, 0x3434, 0x3435, 0x3436, 0x3437, 0x3438, 0x3439, + 0x3530, 0x3531, 0x3532, 0x3533, 0x3534, 0x3535, 0x3536, 0x3537, 0x3538, 0x3539, + 0x3630, 0x3631, 0x3632, 0x3633, 0x3634, 0x3635, 0x3636, 0x3637, 0x3638, 0x3639, + 0x3730, 0x3731, 0x3732, 0x3733, 0x3734, 0x3735, 0x3736, 0x3737, 0x3738, 0x3739, + 0x3830, 0x3831, 0x3832, 0x3833, 0x3834, 0x3835, 0x3836, 0x3837, 0x3838, 0x3839, + 0x3930, 0x3931, 0x3932, 0x3933, 0x3934, 0x3935, 0x3936, 0x3937, 0x3938, 0x3939, +} + +var intLookup = [2]*[100]uint16{&intLELookup, &intBELookup} + +func numMask(numBitSize uint8) uint64 { + return 1<>(code.NumBitSize-1))&1 == 1 + if !negative { + if n < 10 { + return append(out, byte(n+'0')) + } else if n < 100 { + u := intLELookup[n] + return append(out, byte(u), byte(u>>8)) + } + } else { + n = -n & mask + } + + lookup := intLookup[endianness] + + var b [22]byte + u := (*[11]uint16)(unsafe.Pointer(&b)) + i := 11 + + for n >= 100 { + j := n % 100 + n /= 100 + i-- + u[i] = lookup[j] + } + + i-- + u[i] = lookup[n] + + i *= 2 // convert to byte index + if n < 10 { + i++ // remove leading zero + } + if negative { + i-- + b[i] = '-' + } + + return append(out, b[i:]...) +} + +func AppendUint(_ *RuntimeContext, out []byte, p uintptr, code *Opcode) []byte { + var u64 uint64 + switch code.NumBitSize { + case 8: + u64 = (uint64)(**(**uint8)(unsafe.Pointer(&p))) + case 16: + u64 = (uint64)(**(**uint16)(unsafe.Pointer(&p))) + case 32: + u64 = (uint64)(**(**uint32)(unsafe.Pointer(&p))) + case 64: + u64 = **(**uint64)(unsafe.Pointer(&p)) + } + mask := numMask(code.NumBitSize) + n := u64 & mask + if n < 10 { + return append(out, byte(n+'0')) + } else if n < 100 { + u := intLELookup[n] + return append(out, byte(u), byte(u>>8)) + } + + lookup := intLookup[endianness] + + var b [22]byte + u := (*[11]uint16)(unsafe.Pointer(&b)) + i := 11 + + for n >= 100 { + j := n % 100 + n /= 100 + i-- + u[i] = lookup[j] + } + + i-- + u[i] = lookup[n] + + i *= 2 // convert to byte index + if n < 10 { + i++ // remove leading zero + } + return append(out, b[i:]...) +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/map112.go b/vendor/github.com/goccy/go-json/internal/encoder/map112.go new file mode 100644 index 000000000..e96ffadf7 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/map112.go @@ -0,0 +1,9 @@ +//go:build !go1.13 +// +build !go1.13 + +package encoder + +import "unsafe" + +//go:linkname MapIterValue reflect.mapitervalue +func MapIterValue(it *mapIter) unsafe.Pointer diff --git a/vendor/github.com/goccy/go-json/internal/encoder/map113.go b/vendor/github.com/goccy/go-json/internal/encoder/map113.go new file mode 100644 index 000000000..9b69dcc36 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/map113.go @@ -0,0 +1,9 @@ +//go:build go1.13 +// +build go1.13 + +package encoder + +import "unsafe" + +//go:linkname MapIterValue reflect.mapiterelem +func MapIterValue(it *mapIter) unsafe.Pointer diff --git a/vendor/github.com/goccy/go-json/internal/encoder/opcode.go b/vendor/github.com/goccy/go-json/internal/encoder/opcode.go new file mode 100644 index 000000000..df22f5542 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/opcode.go @@ -0,0 +1,752 @@ +package encoder + +import ( + "bytes" + "fmt" + "sort" + "strings" + "unsafe" + + "github.com/goccy/go-json/internal/runtime" +) + +const uintptrSize = 4 << (^uintptr(0) >> 63) + +type OpFlags uint16 + +const ( + AnonymousHeadFlags OpFlags = 1 << 0 + AnonymousKeyFlags OpFlags = 1 << 1 + IndirectFlags OpFlags = 1 << 2 + IsTaggedKeyFlags OpFlags = 1 << 3 + NilCheckFlags OpFlags = 1 << 4 + AddrForMarshalerFlags OpFlags = 1 << 5 + IsNextOpPtrTypeFlags OpFlags = 1 << 6 + IsNilableTypeFlags OpFlags = 1 << 7 + MarshalerContextFlags OpFlags = 1 << 8 + NonEmptyInterfaceFlags OpFlags = 1 << 9 +) + +type Opcode struct { + Op OpType // operation type + Idx uint32 // offset to access ptr + Next *Opcode // next opcode + End *Opcode // array/slice/struct/map end + NextField *Opcode // next struct field + Key string // struct field key + Offset uint32 // offset size from struct header + PtrNum uint8 // pointer number: e.g. double pointer is 2. + NumBitSize uint8 + Flags OpFlags + + Type *runtime.Type // go type + Jmp *CompiledCode // for recursive call + FieldQuery *FieldQuery // field query for Interface / MarshalJSON / MarshalText + ElemIdx uint32 // offset to access array/slice elem + Length uint32 // offset to access slice length or array length + Indent uint32 // indent number + Size uint32 // array/slice elem size + DisplayIdx uint32 // opcode index + DisplayKey string // key text to display +} + +func (c *Opcode) Validate() error { + var prevIdx uint32 + for code := c; !code.IsEnd(); { + if prevIdx != 0 { + if code.DisplayIdx != prevIdx+1 { + return fmt.Errorf( + "invalid index. previous display index is %d but next is %d. dump = %s", + prevIdx, code.DisplayIdx, c.Dump(), + ) + } + } + prevIdx = code.DisplayIdx + code = code.IterNext() + } + return nil +} + +func (c *Opcode) IterNext() *Opcode { + if c == nil { + return nil + } + switch c.Op.CodeType() { + case CodeArrayElem, CodeSliceElem, CodeMapKey: + return c.End + default: + return c.Next + } +} + +func (c *Opcode) IsEnd() bool { + if c == nil { + return true + } + return c.Op == OpEnd || c.Op == OpInterfaceEnd || c.Op == OpRecursiveEnd +} + +func (c *Opcode) MaxIdx() uint32 { + max := uint32(0) + for _, value := range []uint32{ + c.Idx, + c.ElemIdx, + c.Length, + c.Size, + } { + if max < value { + max = value + } + } + return max +} + +func (c *Opcode) ToHeaderType(isString bool) OpType { + switch c.Op { + case OpInt: + if isString { + return OpStructHeadIntString + } + return OpStructHeadInt + case OpIntPtr: + if isString { + return OpStructHeadIntPtrString + } + return OpStructHeadIntPtr + case OpUint: + if isString { + return OpStructHeadUintString + } + return OpStructHeadUint + case OpUintPtr: + if isString { + return OpStructHeadUintPtrString + } + return OpStructHeadUintPtr + case OpFloat32: + if isString { + return OpStructHeadFloat32String + } + return OpStructHeadFloat32 + case OpFloat32Ptr: + if isString { + return OpStructHeadFloat32PtrString + } + return OpStructHeadFloat32Ptr + case OpFloat64: + if isString { + return OpStructHeadFloat64String + } + return OpStructHeadFloat64 + case OpFloat64Ptr: + if isString { + return OpStructHeadFloat64PtrString + } + return OpStructHeadFloat64Ptr + case OpString: + if isString { + return OpStructHeadStringString + } + return OpStructHeadString + case OpStringPtr: + if isString { + return OpStructHeadStringPtrString + } + return OpStructHeadStringPtr + case OpNumber: + if isString { + return OpStructHeadNumberString + } + return OpStructHeadNumber + case OpNumberPtr: + if isString { + return OpStructHeadNumberPtrString + } + return OpStructHeadNumberPtr + case OpBool: + if isString { + return OpStructHeadBoolString + } + return OpStructHeadBool + case OpBoolPtr: + if isString { + return OpStructHeadBoolPtrString + } + return OpStructHeadBoolPtr + case OpBytes: + return OpStructHeadBytes + case OpBytesPtr: + return OpStructHeadBytesPtr + case OpMap: + return OpStructHeadMap + case OpMapPtr: + c.Op = OpMap + return OpStructHeadMapPtr + case OpArray: + return OpStructHeadArray + case OpArrayPtr: + c.Op = OpArray + return OpStructHeadArrayPtr + case OpSlice: + return OpStructHeadSlice + case OpSlicePtr: + c.Op = OpSlice + return OpStructHeadSlicePtr + case OpMarshalJSON: + return OpStructHeadMarshalJSON + case OpMarshalJSONPtr: + return OpStructHeadMarshalJSONPtr + case OpMarshalText: + return OpStructHeadMarshalText + case OpMarshalTextPtr: + return OpStructHeadMarshalTextPtr + } + return OpStructHead +} + +func (c *Opcode) ToFieldType(isString bool) OpType { + switch c.Op { + case OpInt: + if isString { + return OpStructFieldIntString + } + return OpStructFieldInt + case OpIntPtr: + if isString { + return OpStructFieldIntPtrString + } + return OpStructFieldIntPtr + case OpUint: + if isString { + return OpStructFieldUintString + } + return OpStructFieldUint + case OpUintPtr: + if isString { + return OpStructFieldUintPtrString + } + return OpStructFieldUintPtr + case OpFloat32: + if isString { + return OpStructFieldFloat32String + } + return OpStructFieldFloat32 + case OpFloat32Ptr: + if isString { + return OpStructFieldFloat32PtrString + } + return OpStructFieldFloat32Ptr + case OpFloat64: + if isString { + return OpStructFieldFloat64String + } + return OpStructFieldFloat64 + case OpFloat64Ptr: + if isString { + return OpStructFieldFloat64PtrString + } + return OpStructFieldFloat64Ptr + case OpString: + if isString { + return OpStructFieldStringString + } + return OpStructFieldString + case OpStringPtr: + if isString { + return OpStructFieldStringPtrString + } + return OpStructFieldStringPtr + case OpNumber: + if isString { + return OpStructFieldNumberString + } + return OpStructFieldNumber + case OpNumberPtr: + if isString { + return OpStructFieldNumberPtrString + } + return OpStructFieldNumberPtr + case OpBool: + if isString { + return OpStructFieldBoolString + } + return OpStructFieldBool + case OpBoolPtr: + if isString { + return OpStructFieldBoolPtrString + } + return OpStructFieldBoolPtr + case OpBytes: + return OpStructFieldBytes + case OpBytesPtr: + return OpStructFieldBytesPtr + case OpMap: + return OpStructFieldMap + case OpMapPtr: + c.Op = OpMap + return OpStructFieldMapPtr + case OpArray: + return OpStructFieldArray + case OpArrayPtr: + c.Op = OpArray + return OpStructFieldArrayPtr + case OpSlice: + return OpStructFieldSlice + case OpSlicePtr: + c.Op = OpSlice + return OpStructFieldSlicePtr + case OpMarshalJSON: + return OpStructFieldMarshalJSON + case OpMarshalJSONPtr: + return OpStructFieldMarshalJSONPtr + case OpMarshalText: + return OpStructFieldMarshalText + case OpMarshalTextPtr: + return OpStructFieldMarshalTextPtr + } + return OpStructField +} + +func newOpCode(ctx *compileContext, typ *runtime.Type, op OpType) *Opcode { + return newOpCodeWithNext(ctx, typ, op, newEndOp(ctx, typ)) +} + +func opcodeOffset(idx int) uint32 { + return uint32(idx) * uintptrSize +} + +func getCodeAddrByIdx(head *Opcode, idx uint32) *Opcode { + addr := uintptr(unsafe.Pointer(head)) + uintptr(idx)*unsafe.Sizeof(Opcode{}) + return *(**Opcode)(unsafe.Pointer(&addr)) +} + +func copyOpcode(code *Opcode) *Opcode { + codeNum := ToEndCode(code).DisplayIdx + 1 + codeSlice := make([]Opcode, codeNum) + head := (*Opcode)((*runtime.SliceHeader)(unsafe.Pointer(&codeSlice)).Data) + ptr := head + c := code + for { + *ptr = Opcode{ + Op: c.Op, + Key: c.Key, + PtrNum: c.PtrNum, + NumBitSize: c.NumBitSize, + Flags: c.Flags, + Idx: c.Idx, + Offset: c.Offset, + Type: c.Type, + FieldQuery: c.FieldQuery, + DisplayIdx: c.DisplayIdx, + DisplayKey: c.DisplayKey, + ElemIdx: c.ElemIdx, + Length: c.Length, + Size: c.Size, + Indent: c.Indent, + Jmp: c.Jmp, + } + if c.End != nil { + ptr.End = getCodeAddrByIdx(head, c.End.DisplayIdx) + } + if c.NextField != nil { + ptr.NextField = getCodeAddrByIdx(head, c.NextField.DisplayIdx) + } + if c.Next != nil { + ptr.Next = getCodeAddrByIdx(head, c.Next.DisplayIdx) + } + if c.IsEnd() { + break + } + ptr = getCodeAddrByIdx(head, c.DisplayIdx+1) + c = c.IterNext() + } + return head +} + +func setTotalLengthToInterfaceOp(code *Opcode) { + for c := code; !c.IsEnd(); { + if c.Op == OpInterface || c.Op == OpInterfacePtr { + c.Length = uint32(code.TotalLength()) + } + c = c.IterNext() + } +} + +func ToEndCode(code *Opcode) *Opcode { + c := code + for !c.IsEnd() { + c = c.IterNext() + } + return c +} + +func copyToInterfaceOpcode(code *Opcode) *Opcode { + copied := copyOpcode(code) + c := copied + c = ToEndCode(c) + c.Idx += uintptrSize + c.ElemIdx = c.Idx + uintptrSize + c.Length = c.Idx + 2*uintptrSize + c.Op = OpInterfaceEnd + return copied +} + +func newOpCodeWithNext(ctx *compileContext, typ *runtime.Type, op OpType, next *Opcode) *Opcode { + return &Opcode{ + Op: op, + Idx: opcodeOffset(ctx.ptrIndex), + Next: next, + Type: typ, + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + } +} + +func newEndOp(ctx *compileContext, typ *runtime.Type) *Opcode { + return newOpCodeWithNext(ctx, typ, OpEnd, nil) +} + +func (c *Opcode) TotalLength() int { + var idx int + code := c + for !code.IsEnd() { + maxIdx := int(code.MaxIdx() / uintptrSize) + if idx < maxIdx { + idx = maxIdx + } + if code.Op == OpRecursiveEnd { + break + } + code = code.IterNext() + } + maxIdx := int(code.MaxIdx() / uintptrSize) + if idx < maxIdx { + idx = maxIdx + } + return idx + 1 +} + +func (c *Opcode) dumpHead(code *Opcode) string { + var length uint32 + if code.Op.CodeType() == CodeArrayHead { + length = code.Length + } else { + length = code.Length / uintptrSize + } + return fmt.Sprintf( + `[%03d]%s%s ([idx:%d][elemIdx:%d][length:%d])`, + code.DisplayIdx, + strings.Repeat("-", int(code.Indent)), + code.Op, + code.Idx/uintptrSize, + code.ElemIdx/uintptrSize, + length, + ) +} + +func (c *Opcode) dumpMapHead(code *Opcode) string { + return fmt.Sprintf( + `[%03d]%s%s ([idx:%d])`, + code.DisplayIdx, + strings.Repeat("-", int(code.Indent)), + code.Op, + code.Idx/uintptrSize, + ) +} + +func (c *Opcode) dumpMapEnd(code *Opcode) string { + return fmt.Sprintf( + `[%03d]%s%s ([idx:%d])`, + code.DisplayIdx, + strings.Repeat("-", int(code.Indent)), + code.Op, + code.Idx/uintptrSize, + ) +} + +func (c *Opcode) dumpElem(code *Opcode) string { + var length uint32 + if code.Op.CodeType() == CodeArrayElem { + length = code.Length + } else { + length = code.Length / uintptrSize + } + return fmt.Sprintf( + `[%03d]%s%s ([idx:%d][elemIdx:%d][length:%d][size:%d])`, + code.DisplayIdx, + strings.Repeat("-", int(code.Indent)), + code.Op, + code.Idx/uintptrSize, + code.ElemIdx/uintptrSize, + length, + code.Size, + ) +} + +func (c *Opcode) dumpField(code *Opcode) string { + return fmt.Sprintf( + `[%03d]%s%s ([idx:%d][key:%s][offset:%d])`, + code.DisplayIdx, + strings.Repeat("-", int(code.Indent)), + code.Op, + code.Idx/uintptrSize, + code.DisplayKey, + code.Offset, + ) +} + +func (c *Opcode) dumpKey(code *Opcode) string { + return fmt.Sprintf( + `[%03d]%s%s ([idx:%d])`, + code.DisplayIdx, + strings.Repeat("-", int(code.Indent)), + code.Op, + code.Idx/uintptrSize, + ) +} + +func (c *Opcode) dumpValue(code *Opcode) string { + return fmt.Sprintf( + `[%03d]%s%s ([idx:%d])`, + code.DisplayIdx, + strings.Repeat("-", int(code.Indent)), + code.Op, + code.Idx/uintptrSize, + ) +} + +func (c *Opcode) Dump() string { + codes := []string{} + for code := c; !code.IsEnd(); { + switch code.Op.CodeType() { + case CodeSliceHead: + codes = append(codes, c.dumpHead(code)) + code = code.Next + case CodeMapHead: + codes = append(codes, c.dumpMapHead(code)) + code = code.Next + case CodeArrayElem, CodeSliceElem: + codes = append(codes, c.dumpElem(code)) + code = code.End + case CodeMapKey: + codes = append(codes, c.dumpKey(code)) + code = code.End + case CodeMapValue: + codes = append(codes, c.dumpValue(code)) + code = code.Next + case CodeMapEnd: + codes = append(codes, c.dumpMapEnd(code)) + code = code.Next + case CodeStructField: + codes = append(codes, c.dumpField(code)) + code = code.Next + case CodeStructEnd: + codes = append(codes, c.dumpField(code)) + code = code.Next + default: + codes = append(codes, fmt.Sprintf( + "[%03d]%s%s ([idx:%d])", + code.DisplayIdx, + strings.Repeat("-", int(code.Indent)), + code.Op, + code.Idx/uintptrSize, + )) + code = code.Next + } + } + return strings.Join(codes, "\n") +} + +func (c *Opcode) DumpDOT() string { + type edge struct { + from, to *Opcode + label string + weight int + } + var edges []edge + + b := &bytes.Buffer{} + fmt.Fprintf(b, "digraph \"%p\" {\n", c.Type) + fmt.Fprintln(b, "mclimit=1.5;\nrankdir=TD;\nordering=out;\nnode[shape=box];") + for code := c; !code.IsEnd(); { + label := code.Op.String() + fmt.Fprintf(b, "\"%p\" [label=%q];\n", code, label) + if p := code.Next; p != nil { + edges = append(edges, edge{ + from: code, + to: p, + label: "Next", + weight: 10, + }) + } + if p := code.NextField; p != nil { + edges = append(edges, edge{ + from: code, + to: p, + label: "NextField", + weight: 2, + }) + } + if p := code.End; p != nil { + edges = append(edges, edge{ + from: code, + to: p, + label: "End", + weight: 1, + }) + } + if p := code.Jmp; p != nil { + edges = append(edges, edge{ + from: code, + to: p.Code, + label: "Jmp", + weight: 1, + }) + } + + switch code.Op.CodeType() { + case CodeSliceHead: + code = code.Next + case CodeMapHead: + code = code.Next + case CodeArrayElem, CodeSliceElem: + code = code.End + case CodeMapKey: + code = code.End + case CodeMapValue: + code = code.Next + case CodeMapEnd: + code = code.Next + case CodeStructField: + code = code.Next + case CodeStructEnd: + code = code.Next + default: + code = code.Next + } + if code.IsEnd() { + fmt.Fprintf(b, "\"%p\" [label=%q];\n", code, code.Op.String()) + } + } + sort.Slice(edges, func(i, j int) bool { + return edges[i].to.DisplayIdx < edges[j].to.DisplayIdx + }) + for _, e := range edges { + fmt.Fprintf(b, "\"%p\" -> \"%p\" [label=%q][weight=%d];\n", e.from, e.to, e.label, e.weight) + } + fmt.Fprint(b, "}") + return b.String() +} + +func newSliceHeaderCode(ctx *compileContext, typ *runtime.Type) *Opcode { + idx := opcodeOffset(ctx.ptrIndex) + ctx.incPtrIndex() + elemIdx := opcodeOffset(ctx.ptrIndex) + ctx.incPtrIndex() + length := opcodeOffset(ctx.ptrIndex) + return &Opcode{ + Op: OpSlice, + Type: typ, + Idx: idx, + DisplayIdx: ctx.opcodeIndex, + ElemIdx: elemIdx, + Length: length, + Indent: ctx.indent, + } +} + +func newSliceElemCode(ctx *compileContext, typ *runtime.Type, head *Opcode, size uintptr) *Opcode { + return &Opcode{ + Op: OpSliceElem, + Type: typ, + Idx: head.Idx, + DisplayIdx: ctx.opcodeIndex, + ElemIdx: head.ElemIdx, + Length: head.Length, + Indent: ctx.indent, + Size: uint32(size), + } +} + +func newArrayHeaderCode(ctx *compileContext, typ *runtime.Type, alen int) *Opcode { + idx := opcodeOffset(ctx.ptrIndex) + ctx.incPtrIndex() + elemIdx := opcodeOffset(ctx.ptrIndex) + return &Opcode{ + Op: OpArray, + Type: typ, + Idx: idx, + DisplayIdx: ctx.opcodeIndex, + ElemIdx: elemIdx, + Indent: ctx.indent, + Length: uint32(alen), + } +} + +func newArrayElemCode(ctx *compileContext, typ *runtime.Type, head *Opcode, length int, size uintptr) *Opcode { + return &Opcode{ + Op: OpArrayElem, + Type: typ, + Idx: head.Idx, + DisplayIdx: ctx.opcodeIndex, + ElemIdx: head.ElemIdx, + Length: uint32(length), + Indent: ctx.indent, + Size: uint32(size), + } +} + +func newMapHeaderCode(ctx *compileContext, typ *runtime.Type) *Opcode { + idx := opcodeOffset(ctx.ptrIndex) + ctx.incPtrIndex() + return &Opcode{ + Op: OpMap, + Type: typ, + Idx: idx, + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + } +} + +func newMapKeyCode(ctx *compileContext, typ *runtime.Type, head *Opcode) *Opcode { + return &Opcode{ + Op: OpMapKey, + Type: typ, + Idx: head.Idx, + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + } +} + +func newMapValueCode(ctx *compileContext, typ *runtime.Type, head *Opcode) *Opcode { + return &Opcode{ + Op: OpMapValue, + Type: typ, + Idx: head.Idx, + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + } +} + +func newMapEndCode(ctx *compileContext, typ *runtime.Type, head *Opcode) *Opcode { + return &Opcode{ + Op: OpMapEnd, + Type: typ, + Idx: head.Idx, + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + Next: newEndOp(ctx, typ), + } +} + +func newRecursiveCode(ctx *compileContext, typ *runtime.Type, jmp *CompiledCode) *Opcode { + return &Opcode{ + Op: OpRecursive, + Type: typ, + Idx: opcodeOffset(ctx.ptrIndex), + Next: newEndOp(ctx, typ), + DisplayIdx: ctx.opcodeIndex, + Indent: ctx.indent, + Jmp: jmp, + } +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/option.go b/vendor/github.com/goccy/go-json/internal/encoder/option.go new file mode 100644 index 000000000..12c58e46c --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/option.go @@ -0,0 +1,48 @@ +package encoder + +import ( + "context" + "io" +) + +type OptionFlag uint8 + +const ( + HTMLEscapeOption OptionFlag = 1 << iota + IndentOption + UnorderedMapOption + DebugOption + ColorizeOption + ContextOption + NormalizeUTF8Option + FieldQueryOption +) + +type Option struct { + Flag OptionFlag + ColorScheme *ColorScheme + Context context.Context + DebugOut io.Writer + DebugDOTOut io.WriteCloser +} + +type EncodeFormat struct { + Header string + Footer string +} + +type EncodeFormatScheme struct { + Int EncodeFormat + Uint EncodeFormat + Float EncodeFormat + Bool EncodeFormat + String EncodeFormat + Binary EncodeFormat + ObjectKey EncodeFormat + Null EncodeFormat +} + +type ( + ColorScheme = EncodeFormatScheme + ColorFormat = EncodeFormat +) diff --git a/vendor/github.com/goccy/go-json/internal/encoder/optype.go b/vendor/github.com/goccy/go-json/internal/encoder/optype.go new file mode 100644 index 000000000..5c1241b47 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/optype.go @@ -0,0 +1,932 @@ +// Code generated by internal/cmd/generator. DO NOT EDIT! +package encoder + +import ( + "strings" +) + +type CodeType int + +const ( + CodeOp CodeType = 0 + CodeArrayHead CodeType = 1 + CodeArrayElem CodeType = 2 + CodeSliceHead CodeType = 3 + CodeSliceElem CodeType = 4 + CodeMapHead CodeType = 5 + CodeMapKey CodeType = 6 + CodeMapValue CodeType = 7 + CodeMapEnd CodeType = 8 + CodeRecursive CodeType = 9 + CodeStructField CodeType = 10 + CodeStructEnd CodeType = 11 +) + +var opTypeStrings = [400]string{ + "End", + "Interface", + "Ptr", + "SliceElem", + "SliceEnd", + "ArrayElem", + "ArrayEnd", + "MapKey", + "MapValue", + "MapEnd", + "Recursive", + "RecursivePtr", + "RecursiveEnd", + "InterfaceEnd", + "Int", + "Uint", + "Float32", + "Float64", + "Bool", + "String", + "Bytes", + "Number", + "Array", + "Map", + "Slice", + "Struct", + "MarshalJSON", + "MarshalText", + "IntString", + "UintString", + "Float32String", + "Float64String", + "BoolString", + "StringString", + "NumberString", + "IntPtr", + "UintPtr", + "Float32Ptr", + "Float64Ptr", + "BoolPtr", + "StringPtr", + "BytesPtr", + "NumberPtr", + "ArrayPtr", + "MapPtr", + "SlicePtr", + "MarshalJSONPtr", + "MarshalTextPtr", + "InterfacePtr", + "IntPtrString", + "UintPtrString", + "Float32PtrString", + "Float64PtrString", + "BoolPtrString", + "StringPtrString", + "NumberPtrString", + "StructHeadInt", + "StructHeadOmitEmptyInt", + "StructPtrHeadInt", + "StructPtrHeadOmitEmptyInt", + "StructHeadUint", + "StructHeadOmitEmptyUint", + "StructPtrHeadUint", + "StructPtrHeadOmitEmptyUint", + "StructHeadFloat32", + "StructHeadOmitEmptyFloat32", + "StructPtrHeadFloat32", + "StructPtrHeadOmitEmptyFloat32", + "StructHeadFloat64", + "StructHeadOmitEmptyFloat64", + "StructPtrHeadFloat64", + "StructPtrHeadOmitEmptyFloat64", + "StructHeadBool", + "StructHeadOmitEmptyBool", + "StructPtrHeadBool", + "StructPtrHeadOmitEmptyBool", + "StructHeadString", + "StructHeadOmitEmptyString", + "StructPtrHeadString", + "StructPtrHeadOmitEmptyString", + "StructHeadBytes", + "StructHeadOmitEmptyBytes", + "StructPtrHeadBytes", + "StructPtrHeadOmitEmptyBytes", + "StructHeadNumber", + "StructHeadOmitEmptyNumber", + "StructPtrHeadNumber", + "StructPtrHeadOmitEmptyNumber", + "StructHeadArray", + "StructHeadOmitEmptyArray", + "StructPtrHeadArray", + "StructPtrHeadOmitEmptyArray", + "StructHeadMap", + "StructHeadOmitEmptyMap", + "StructPtrHeadMap", + "StructPtrHeadOmitEmptyMap", + "StructHeadSlice", + "StructHeadOmitEmptySlice", + "StructPtrHeadSlice", + "StructPtrHeadOmitEmptySlice", + "StructHeadStruct", + "StructHeadOmitEmptyStruct", + "StructPtrHeadStruct", + "StructPtrHeadOmitEmptyStruct", + "StructHeadMarshalJSON", + "StructHeadOmitEmptyMarshalJSON", + "StructPtrHeadMarshalJSON", + "StructPtrHeadOmitEmptyMarshalJSON", + "StructHeadMarshalText", + "StructHeadOmitEmptyMarshalText", + "StructPtrHeadMarshalText", + "StructPtrHeadOmitEmptyMarshalText", + "StructHeadIntString", + "StructHeadOmitEmptyIntString", + "StructPtrHeadIntString", + "StructPtrHeadOmitEmptyIntString", + "StructHeadUintString", + "StructHeadOmitEmptyUintString", + "StructPtrHeadUintString", + "StructPtrHeadOmitEmptyUintString", + "StructHeadFloat32String", + "StructHeadOmitEmptyFloat32String", + "StructPtrHeadFloat32String", + "StructPtrHeadOmitEmptyFloat32String", + "StructHeadFloat64String", + "StructHeadOmitEmptyFloat64String", + "StructPtrHeadFloat64String", + "StructPtrHeadOmitEmptyFloat64String", + "StructHeadBoolString", + "StructHeadOmitEmptyBoolString", + "StructPtrHeadBoolString", + "StructPtrHeadOmitEmptyBoolString", + "StructHeadStringString", + "StructHeadOmitEmptyStringString", + "StructPtrHeadStringString", + "StructPtrHeadOmitEmptyStringString", + "StructHeadNumberString", + "StructHeadOmitEmptyNumberString", + "StructPtrHeadNumberString", + "StructPtrHeadOmitEmptyNumberString", + "StructHeadIntPtr", + "StructHeadOmitEmptyIntPtr", + "StructPtrHeadIntPtr", + "StructPtrHeadOmitEmptyIntPtr", + "StructHeadUintPtr", + "StructHeadOmitEmptyUintPtr", + "StructPtrHeadUintPtr", + "StructPtrHeadOmitEmptyUintPtr", + "StructHeadFloat32Ptr", + "StructHeadOmitEmptyFloat32Ptr", + "StructPtrHeadFloat32Ptr", + "StructPtrHeadOmitEmptyFloat32Ptr", + "StructHeadFloat64Ptr", + "StructHeadOmitEmptyFloat64Ptr", + "StructPtrHeadFloat64Ptr", + "StructPtrHeadOmitEmptyFloat64Ptr", + "StructHeadBoolPtr", + "StructHeadOmitEmptyBoolPtr", + "StructPtrHeadBoolPtr", + "StructPtrHeadOmitEmptyBoolPtr", + "StructHeadStringPtr", + "StructHeadOmitEmptyStringPtr", + "StructPtrHeadStringPtr", + "StructPtrHeadOmitEmptyStringPtr", + "StructHeadBytesPtr", + "StructHeadOmitEmptyBytesPtr", + "StructPtrHeadBytesPtr", + "StructPtrHeadOmitEmptyBytesPtr", + "StructHeadNumberPtr", + "StructHeadOmitEmptyNumberPtr", + "StructPtrHeadNumberPtr", + "StructPtrHeadOmitEmptyNumberPtr", + "StructHeadArrayPtr", + "StructHeadOmitEmptyArrayPtr", + "StructPtrHeadArrayPtr", + "StructPtrHeadOmitEmptyArrayPtr", + "StructHeadMapPtr", + "StructHeadOmitEmptyMapPtr", + "StructPtrHeadMapPtr", + "StructPtrHeadOmitEmptyMapPtr", + "StructHeadSlicePtr", + "StructHeadOmitEmptySlicePtr", + "StructPtrHeadSlicePtr", + "StructPtrHeadOmitEmptySlicePtr", + "StructHeadMarshalJSONPtr", + "StructHeadOmitEmptyMarshalJSONPtr", + "StructPtrHeadMarshalJSONPtr", + "StructPtrHeadOmitEmptyMarshalJSONPtr", + "StructHeadMarshalTextPtr", + "StructHeadOmitEmptyMarshalTextPtr", + "StructPtrHeadMarshalTextPtr", + "StructPtrHeadOmitEmptyMarshalTextPtr", + "StructHeadInterfacePtr", + "StructHeadOmitEmptyInterfacePtr", + "StructPtrHeadInterfacePtr", + "StructPtrHeadOmitEmptyInterfacePtr", + "StructHeadIntPtrString", + "StructHeadOmitEmptyIntPtrString", + "StructPtrHeadIntPtrString", + "StructPtrHeadOmitEmptyIntPtrString", + "StructHeadUintPtrString", + "StructHeadOmitEmptyUintPtrString", + "StructPtrHeadUintPtrString", + "StructPtrHeadOmitEmptyUintPtrString", + "StructHeadFloat32PtrString", + "StructHeadOmitEmptyFloat32PtrString", + "StructPtrHeadFloat32PtrString", + "StructPtrHeadOmitEmptyFloat32PtrString", + "StructHeadFloat64PtrString", + "StructHeadOmitEmptyFloat64PtrString", + "StructPtrHeadFloat64PtrString", + "StructPtrHeadOmitEmptyFloat64PtrString", + "StructHeadBoolPtrString", + "StructHeadOmitEmptyBoolPtrString", + "StructPtrHeadBoolPtrString", + "StructPtrHeadOmitEmptyBoolPtrString", + "StructHeadStringPtrString", + "StructHeadOmitEmptyStringPtrString", + "StructPtrHeadStringPtrString", + "StructPtrHeadOmitEmptyStringPtrString", + "StructHeadNumberPtrString", + "StructHeadOmitEmptyNumberPtrString", + "StructPtrHeadNumberPtrString", + "StructPtrHeadOmitEmptyNumberPtrString", + "StructHead", + "StructHeadOmitEmpty", + "StructPtrHead", + "StructPtrHeadOmitEmpty", + "StructFieldInt", + "StructFieldOmitEmptyInt", + "StructEndInt", + "StructEndOmitEmptyInt", + "StructFieldUint", + "StructFieldOmitEmptyUint", + "StructEndUint", + "StructEndOmitEmptyUint", + "StructFieldFloat32", + "StructFieldOmitEmptyFloat32", + "StructEndFloat32", + "StructEndOmitEmptyFloat32", + "StructFieldFloat64", + "StructFieldOmitEmptyFloat64", + "StructEndFloat64", + "StructEndOmitEmptyFloat64", + "StructFieldBool", + "StructFieldOmitEmptyBool", + "StructEndBool", + "StructEndOmitEmptyBool", + "StructFieldString", + "StructFieldOmitEmptyString", + "StructEndString", + "StructEndOmitEmptyString", + "StructFieldBytes", + "StructFieldOmitEmptyBytes", + "StructEndBytes", + "StructEndOmitEmptyBytes", + "StructFieldNumber", + "StructFieldOmitEmptyNumber", + "StructEndNumber", + "StructEndOmitEmptyNumber", + "StructFieldArray", + "StructFieldOmitEmptyArray", + "StructEndArray", + "StructEndOmitEmptyArray", + "StructFieldMap", + "StructFieldOmitEmptyMap", + "StructEndMap", + "StructEndOmitEmptyMap", + "StructFieldSlice", + "StructFieldOmitEmptySlice", + "StructEndSlice", + "StructEndOmitEmptySlice", + "StructFieldStruct", + "StructFieldOmitEmptyStruct", + "StructEndStruct", + "StructEndOmitEmptyStruct", + "StructFieldMarshalJSON", + "StructFieldOmitEmptyMarshalJSON", + "StructEndMarshalJSON", + "StructEndOmitEmptyMarshalJSON", + "StructFieldMarshalText", + "StructFieldOmitEmptyMarshalText", + "StructEndMarshalText", + "StructEndOmitEmptyMarshalText", + "StructFieldIntString", + "StructFieldOmitEmptyIntString", + "StructEndIntString", + "StructEndOmitEmptyIntString", + "StructFieldUintString", + "StructFieldOmitEmptyUintString", + "StructEndUintString", + "StructEndOmitEmptyUintString", + "StructFieldFloat32String", + "StructFieldOmitEmptyFloat32String", + "StructEndFloat32String", + "StructEndOmitEmptyFloat32String", + "StructFieldFloat64String", + "StructFieldOmitEmptyFloat64String", + "StructEndFloat64String", + "StructEndOmitEmptyFloat64String", + "StructFieldBoolString", + "StructFieldOmitEmptyBoolString", + "StructEndBoolString", + "StructEndOmitEmptyBoolString", + "StructFieldStringString", + "StructFieldOmitEmptyStringString", + "StructEndStringString", + "StructEndOmitEmptyStringString", + "StructFieldNumberString", + "StructFieldOmitEmptyNumberString", + "StructEndNumberString", + "StructEndOmitEmptyNumberString", + "StructFieldIntPtr", + "StructFieldOmitEmptyIntPtr", + "StructEndIntPtr", + "StructEndOmitEmptyIntPtr", + "StructFieldUintPtr", + "StructFieldOmitEmptyUintPtr", + "StructEndUintPtr", + "StructEndOmitEmptyUintPtr", + "StructFieldFloat32Ptr", + "StructFieldOmitEmptyFloat32Ptr", + "StructEndFloat32Ptr", + "StructEndOmitEmptyFloat32Ptr", + "StructFieldFloat64Ptr", + "StructFieldOmitEmptyFloat64Ptr", + "StructEndFloat64Ptr", + "StructEndOmitEmptyFloat64Ptr", + "StructFieldBoolPtr", + "StructFieldOmitEmptyBoolPtr", + "StructEndBoolPtr", + "StructEndOmitEmptyBoolPtr", + "StructFieldStringPtr", + "StructFieldOmitEmptyStringPtr", + "StructEndStringPtr", + "StructEndOmitEmptyStringPtr", + "StructFieldBytesPtr", + "StructFieldOmitEmptyBytesPtr", + "StructEndBytesPtr", + "StructEndOmitEmptyBytesPtr", + "StructFieldNumberPtr", + "StructFieldOmitEmptyNumberPtr", + "StructEndNumberPtr", + "StructEndOmitEmptyNumberPtr", + "StructFieldArrayPtr", + "StructFieldOmitEmptyArrayPtr", + "StructEndArrayPtr", + "StructEndOmitEmptyArrayPtr", + "StructFieldMapPtr", + "StructFieldOmitEmptyMapPtr", + "StructEndMapPtr", + "StructEndOmitEmptyMapPtr", + "StructFieldSlicePtr", + "StructFieldOmitEmptySlicePtr", + "StructEndSlicePtr", + "StructEndOmitEmptySlicePtr", + "StructFieldMarshalJSONPtr", + "StructFieldOmitEmptyMarshalJSONPtr", + "StructEndMarshalJSONPtr", + "StructEndOmitEmptyMarshalJSONPtr", + "StructFieldMarshalTextPtr", + "StructFieldOmitEmptyMarshalTextPtr", + "StructEndMarshalTextPtr", + "StructEndOmitEmptyMarshalTextPtr", + "StructFieldInterfacePtr", + "StructFieldOmitEmptyInterfacePtr", + "StructEndInterfacePtr", + "StructEndOmitEmptyInterfacePtr", + "StructFieldIntPtrString", + "StructFieldOmitEmptyIntPtrString", + "StructEndIntPtrString", + "StructEndOmitEmptyIntPtrString", + "StructFieldUintPtrString", + "StructFieldOmitEmptyUintPtrString", + "StructEndUintPtrString", + "StructEndOmitEmptyUintPtrString", + "StructFieldFloat32PtrString", + "StructFieldOmitEmptyFloat32PtrString", + "StructEndFloat32PtrString", + "StructEndOmitEmptyFloat32PtrString", + "StructFieldFloat64PtrString", + "StructFieldOmitEmptyFloat64PtrString", + "StructEndFloat64PtrString", + "StructEndOmitEmptyFloat64PtrString", + "StructFieldBoolPtrString", + "StructFieldOmitEmptyBoolPtrString", + "StructEndBoolPtrString", + "StructEndOmitEmptyBoolPtrString", + "StructFieldStringPtrString", + "StructFieldOmitEmptyStringPtrString", + "StructEndStringPtrString", + "StructEndOmitEmptyStringPtrString", + "StructFieldNumberPtrString", + "StructFieldOmitEmptyNumberPtrString", + "StructEndNumberPtrString", + "StructEndOmitEmptyNumberPtrString", + "StructField", + "StructFieldOmitEmpty", + "StructEnd", + "StructEndOmitEmpty", +} + +type OpType uint16 + +const ( + OpEnd OpType = 0 + OpInterface OpType = 1 + OpPtr OpType = 2 + OpSliceElem OpType = 3 + OpSliceEnd OpType = 4 + OpArrayElem OpType = 5 + OpArrayEnd OpType = 6 + OpMapKey OpType = 7 + OpMapValue OpType = 8 + OpMapEnd OpType = 9 + OpRecursive OpType = 10 + OpRecursivePtr OpType = 11 + OpRecursiveEnd OpType = 12 + OpInterfaceEnd OpType = 13 + OpInt OpType = 14 + OpUint OpType = 15 + OpFloat32 OpType = 16 + OpFloat64 OpType = 17 + OpBool OpType = 18 + OpString OpType = 19 + OpBytes OpType = 20 + OpNumber OpType = 21 + OpArray OpType = 22 + OpMap OpType = 23 + OpSlice OpType = 24 + OpStruct OpType = 25 + OpMarshalJSON OpType = 26 + OpMarshalText OpType = 27 + OpIntString OpType = 28 + OpUintString OpType = 29 + OpFloat32String OpType = 30 + OpFloat64String OpType = 31 + OpBoolString OpType = 32 + OpStringString OpType = 33 + OpNumberString OpType = 34 + OpIntPtr OpType = 35 + OpUintPtr OpType = 36 + OpFloat32Ptr OpType = 37 + OpFloat64Ptr OpType = 38 + OpBoolPtr OpType = 39 + OpStringPtr OpType = 40 + OpBytesPtr OpType = 41 + OpNumberPtr OpType = 42 + OpArrayPtr OpType = 43 + OpMapPtr OpType = 44 + OpSlicePtr OpType = 45 + OpMarshalJSONPtr OpType = 46 + OpMarshalTextPtr OpType = 47 + OpInterfacePtr OpType = 48 + OpIntPtrString OpType = 49 + OpUintPtrString OpType = 50 + OpFloat32PtrString OpType = 51 + OpFloat64PtrString OpType = 52 + OpBoolPtrString OpType = 53 + OpStringPtrString OpType = 54 + OpNumberPtrString OpType = 55 + OpStructHeadInt OpType = 56 + OpStructHeadOmitEmptyInt OpType = 57 + OpStructPtrHeadInt OpType = 58 + OpStructPtrHeadOmitEmptyInt OpType = 59 + OpStructHeadUint OpType = 60 + OpStructHeadOmitEmptyUint OpType = 61 + OpStructPtrHeadUint OpType = 62 + OpStructPtrHeadOmitEmptyUint OpType = 63 + OpStructHeadFloat32 OpType = 64 + OpStructHeadOmitEmptyFloat32 OpType = 65 + OpStructPtrHeadFloat32 OpType = 66 + OpStructPtrHeadOmitEmptyFloat32 OpType = 67 + OpStructHeadFloat64 OpType = 68 + OpStructHeadOmitEmptyFloat64 OpType = 69 + OpStructPtrHeadFloat64 OpType = 70 + OpStructPtrHeadOmitEmptyFloat64 OpType = 71 + OpStructHeadBool OpType = 72 + OpStructHeadOmitEmptyBool OpType = 73 + OpStructPtrHeadBool OpType = 74 + OpStructPtrHeadOmitEmptyBool OpType = 75 + OpStructHeadString OpType = 76 + OpStructHeadOmitEmptyString OpType = 77 + OpStructPtrHeadString OpType = 78 + OpStructPtrHeadOmitEmptyString OpType = 79 + OpStructHeadBytes OpType = 80 + OpStructHeadOmitEmptyBytes OpType = 81 + OpStructPtrHeadBytes OpType = 82 + OpStructPtrHeadOmitEmptyBytes OpType = 83 + OpStructHeadNumber OpType = 84 + OpStructHeadOmitEmptyNumber OpType = 85 + OpStructPtrHeadNumber OpType = 86 + OpStructPtrHeadOmitEmptyNumber OpType = 87 + OpStructHeadArray OpType = 88 + OpStructHeadOmitEmptyArray OpType = 89 + OpStructPtrHeadArray OpType = 90 + OpStructPtrHeadOmitEmptyArray OpType = 91 + OpStructHeadMap OpType = 92 + OpStructHeadOmitEmptyMap OpType = 93 + OpStructPtrHeadMap OpType = 94 + OpStructPtrHeadOmitEmptyMap OpType = 95 + OpStructHeadSlice OpType = 96 + OpStructHeadOmitEmptySlice OpType = 97 + OpStructPtrHeadSlice OpType = 98 + OpStructPtrHeadOmitEmptySlice OpType = 99 + OpStructHeadStruct OpType = 100 + OpStructHeadOmitEmptyStruct OpType = 101 + OpStructPtrHeadStruct OpType = 102 + OpStructPtrHeadOmitEmptyStruct OpType = 103 + OpStructHeadMarshalJSON OpType = 104 + OpStructHeadOmitEmptyMarshalJSON OpType = 105 + OpStructPtrHeadMarshalJSON OpType = 106 + OpStructPtrHeadOmitEmptyMarshalJSON OpType = 107 + OpStructHeadMarshalText OpType = 108 + OpStructHeadOmitEmptyMarshalText OpType = 109 + OpStructPtrHeadMarshalText OpType = 110 + OpStructPtrHeadOmitEmptyMarshalText OpType = 111 + OpStructHeadIntString OpType = 112 + OpStructHeadOmitEmptyIntString OpType = 113 + OpStructPtrHeadIntString OpType = 114 + OpStructPtrHeadOmitEmptyIntString OpType = 115 + OpStructHeadUintString OpType = 116 + OpStructHeadOmitEmptyUintString OpType = 117 + OpStructPtrHeadUintString OpType = 118 + OpStructPtrHeadOmitEmptyUintString OpType = 119 + OpStructHeadFloat32String OpType = 120 + OpStructHeadOmitEmptyFloat32String OpType = 121 + OpStructPtrHeadFloat32String OpType = 122 + OpStructPtrHeadOmitEmptyFloat32String OpType = 123 + OpStructHeadFloat64String OpType = 124 + OpStructHeadOmitEmptyFloat64String OpType = 125 + OpStructPtrHeadFloat64String OpType = 126 + OpStructPtrHeadOmitEmptyFloat64String OpType = 127 + OpStructHeadBoolString OpType = 128 + OpStructHeadOmitEmptyBoolString OpType = 129 + OpStructPtrHeadBoolString OpType = 130 + OpStructPtrHeadOmitEmptyBoolString OpType = 131 + OpStructHeadStringString OpType = 132 + OpStructHeadOmitEmptyStringString OpType = 133 + OpStructPtrHeadStringString OpType = 134 + OpStructPtrHeadOmitEmptyStringString OpType = 135 + OpStructHeadNumberString OpType = 136 + OpStructHeadOmitEmptyNumberString OpType = 137 + OpStructPtrHeadNumberString OpType = 138 + OpStructPtrHeadOmitEmptyNumberString OpType = 139 + OpStructHeadIntPtr OpType = 140 + OpStructHeadOmitEmptyIntPtr OpType = 141 + OpStructPtrHeadIntPtr OpType = 142 + OpStructPtrHeadOmitEmptyIntPtr OpType = 143 + OpStructHeadUintPtr OpType = 144 + OpStructHeadOmitEmptyUintPtr OpType = 145 + OpStructPtrHeadUintPtr OpType = 146 + OpStructPtrHeadOmitEmptyUintPtr OpType = 147 + OpStructHeadFloat32Ptr OpType = 148 + OpStructHeadOmitEmptyFloat32Ptr OpType = 149 + OpStructPtrHeadFloat32Ptr OpType = 150 + OpStructPtrHeadOmitEmptyFloat32Ptr OpType = 151 + OpStructHeadFloat64Ptr OpType = 152 + OpStructHeadOmitEmptyFloat64Ptr OpType = 153 + OpStructPtrHeadFloat64Ptr OpType = 154 + OpStructPtrHeadOmitEmptyFloat64Ptr OpType = 155 + OpStructHeadBoolPtr OpType = 156 + OpStructHeadOmitEmptyBoolPtr OpType = 157 + OpStructPtrHeadBoolPtr OpType = 158 + OpStructPtrHeadOmitEmptyBoolPtr OpType = 159 + OpStructHeadStringPtr OpType = 160 + OpStructHeadOmitEmptyStringPtr OpType = 161 + OpStructPtrHeadStringPtr OpType = 162 + OpStructPtrHeadOmitEmptyStringPtr OpType = 163 + OpStructHeadBytesPtr OpType = 164 + OpStructHeadOmitEmptyBytesPtr OpType = 165 + OpStructPtrHeadBytesPtr OpType = 166 + OpStructPtrHeadOmitEmptyBytesPtr OpType = 167 + OpStructHeadNumberPtr OpType = 168 + OpStructHeadOmitEmptyNumberPtr OpType = 169 + OpStructPtrHeadNumberPtr OpType = 170 + OpStructPtrHeadOmitEmptyNumberPtr OpType = 171 + OpStructHeadArrayPtr OpType = 172 + OpStructHeadOmitEmptyArrayPtr OpType = 173 + OpStructPtrHeadArrayPtr OpType = 174 + OpStructPtrHeadOmitEmptyArrayPtr OpType = 175 + OpStructHeadMapPtr OpType = 176 + OpStructHeadOmitEmptyMapPtr OpType = 177 + OpStructPtrHeadMapPtr OpType = 178 + OpStructPtrHeadOmitEmptyMapPtr OpType = 179 + OpStructHeadSlicePtr OpType = 180 + OpStructHeadOmitEmptySlicePtr OpType = 181 + OpStructPtrHeadSlicePtr OpType = 182 + OpStructPtrHeadOmitEmptySlicePtr OpType = 183 + OpStructHeadMarshalJSONPtr OpType = 184 + OpStructHeadOmitEmptyMarshalJSONPtr OpType = 185 + OpStructPtrHeadMarshalJSONPtr OpType = 186 + OpStructPtrHeadOmitEmptyMarshalJSONPtr OpType = 187 + OpStructHeadMarshalTextPtr OpType = 188 + OpStructHeadOmitEmptyMarshalTextPtr OpType = 189 + OpStructPtrHeadMarshalTextPtr OpType = 190 + OpStructPtrHeadOmitEmptyMarshalTextPtr OpType = 191 + OpStructHeadInterfacePtr OpType = 192 + OpStructHeadOmitEmptyInterfacePtr OpType = 193 + OpStructPtrHeadInterfacePtr OpType = 194 + OpStructPtrHeadOmitEmptyInterfacePtr OpType = 195 + OpStructHeadIntPtrString OpType = 196 + OpStructHeadOmitEmptyIntPtrString OpType = 197 + OpStructPtrHeadIntPtrString OpType = 198 + OpStructPtrHeadOmitEmptyIntPtrString OpType = 199 + OpStructHeadUintPtrString OpType = 200 + OpStructHeadOmitEmptyUintPtrString OpType = 201 + OpStructPtrHeadUintPtrString OpType = 202 + OpStructPtrHeadOmitEmptyUintPtrString OpType = 203 + OpStructHeadFloat32PtrString OpType = 204 + OpStructHeadOmitEmptyFloat32PtrString OpType = 205 + OpStructPtrHeadFloat32PtrString OpType = 206 + OpStructPtrHeadOmitEmptyFloat32PtrString OpType = 207 + OpStructHeadFloat64PtrString OpType = 208 + OpStructHeadOmitEmptyFloat64PtrString OpType = 209 + OpStructPtrHeadFloat64PtrString OpType = 210 + OpStructPtrHeadOmitEmptyFloat64PtrString OpType = 211 + OpStructHeadBoolPtrString OpType = 212 + OpStructHeadOmitEmptyBoolPtrString OpType = 213 + OpStructPtrHeadBoolPtrString OpType = 214 + OpStructPtrHeadOmitEmptyBoolPtrString OpType = 215 + OpStructHeadStringPtrString OpType = 216 + OpStructHeadOmitEmptyStringPtrString OpType = 217 + OpStructPtrHeadStringPtrString OpType = 218 + OpStructPtrHeadOmitEmptyStringPtrString OpType = 219 + OpStructHeadNumberPtrString OpType = 220 + OpStructHeadOmitEmptyNumberPtrString OpType = 221 + OpStructPtrHeadNumberPtrString OpType = 222 + OpStructPtrHeadOmitEmptyNumberPtrString OpType = 223 + OpStructHead OpType = 224 + OpStructHeadOmitEmpty OpType = 225 + OpStructPtrHead OpType = 226 + OpStructPtrHeadOmitEmpty OpType = 227 + OpStructFieldInt OpType = 228 + OpStructFieldOmitEmptyInt OpType = 229 + OpStructEndInt OpType = 230 + OpStructEndOmitEmptyInt OpType = 231 + OpStructFieldUint OpType = 232 + OpStructFieldOmitEmptyUint OpType = 233 + OpStructEndUint OpType = 234 + OpStructEndOmitEmptyUint OpType = 235 + OpStructFieldFloat32 OpType = 236 + OpStructFieldOmitEmptyFloat32 OpType = 237 + OpStructEndFloat32 OpType = 238 + OpStructEndOmitEmptyFloat32 OpType = 239 + OpStructFieldFloat64 OpType = 240 + OpStructFieldOmitEmptyFloat64 OpType = 241 + OpStructEndFloat64 OpType = 242 + OpStructEndOmitEmptyFloat64 OpType = 243 + OpStructFieldBool OpType = 244 + OpStructFieldOmitEmptyBool OpType = 245 + OpStructEndBool OpType = 246 + OpStructEndOmitEmptyBool OpType = 247 + OpStructFieldString OpType = 248 + OpStructFieldOmitEmptyString OpType = 249 + OpStructEndString OpType = 250 + OpStructEndOmitEmptyString OpType = 251 + OpStructFieldBytes OpType = 252 + OpStructFieldOmitEmptyBytes OpType = 253 + OpStructEndBytes OpType = 254 + OpStructEndOmitEmptyBytes OpType = 255 + OpStructFieldNumber OpType = 256 + OpStructFieldOmitEmptyNumber OpType = 257 + OpStructEndNumber OpType = 258 + OpStructEndOmitEmptyNumber OpType = 259 + OpStructFieldArray OpType = 260 + OpStructFieldOmitEmptyArray OpType = 261 + OpStructEndArray OpType = 262 + OpStructEndOmitEmptyArray OpType = 263 + OpStructFieldMap OpType = 264 + OpStructFieldOmitEmptyMap OpType = 265 + OpStructEndMap OpType = 266 + OpStructEndOmitEmptyMap OpType = 267 + OpStructFieldSlice OpType = 268 + OpStructFieldOmitEmptySlice OpType = 269 + OpStructEndSlice OpType = 270 + OpStructEndOmitEmptySlice OpType = 271 + OpStructFieldStruct OpType = 272 + OpStructFieldOmitEmptyStruct OpType = 273 + OpStructEndStruct OpType = 274 + OpStructEndOmitEmptyStruct OpType = 275 + OpStructFieldMarshalJSON OpType = 276 + OpStructFieldOmitEmptyMarshalJSON OpType = 277 + OpStructEndMarshalJSON OpType = 278 + OpStructEndOmitEmptyMarshalJSON OpType = 279 + OpStructFieldMarshalText OpType = 280 + OpStructFieldOmitEmptyMarshalText OpType = 281 + OpStructEndMarshalText OpType = 282 + OpStructEndOmitEmptyMarshalText OpType = 283 + OpStructFieldIntString OpType = 284 + OpStructFieldOmitEmptyIntString OpType = 285 + OpStructEndIntString OpType = 286 + OpStructEndOmitEmptyIntString OpType = 287 + OpStructFieldUintString OpType = 288 + OpStructFieldOmitEmptyUintString OpType = 289 + OpStructEndUintString OpType = 290 + OpStructEndOmitEmptyUintString OpType = 291 + OpStructFieldFloat32String OpType = 292 + OpStructFieldOmitEmptyFloat32String OpType = 293 + OpStructEndFloat32String OpType = 294 + OpStructEndOmitEmptyFloat32String OpType = 295 + OpStructFieldFloat64String OpType = 296 + OpStructFieldOmitEmptyFloat64String OpType = 297 + OpStructEndFloat64String OpType = 298 + OpStructEndOmitEmptyFloat64String OpType = 299 + OpStructFieldBoolString OpType = 300 + OpStructFieldOmitEmptyBoolString OpType = 301 + OpStructEndBoolString OpType = 302 + OpStructEndOmitEmptyBoolString OpType = 303 + OpStructFieldStringString OpType = 304 + OpStructFieldOmitEmptyStringString OpType = 305 + OpStructEndStringString OpType = 306 + OpStructEndOmitEmptyStringString OpType = 307 + OpStructFieldNumberString OpType = 308 + OpStructFieldOmitEmptyNumberString OpType = 309 + OpStructEndNumberString OpType = 310 + OpStructEndOmitEmptyNumberString OpType = 311 + OpStructFieldIntPtr OpType = 312 + OpStructFieldOmitEmptyIntPtr OpType = 313 + OpStructEndIntPtr OpType = 314 + OpStructEndOmitEmptyIntPtr OpType = 315 + OpStructFieldUintPtr OpType = 316 + OpStructFieldOmitEmptyUintPtr OpType = 317 + OpStructEndUintPtr OpType = 318 + OpStructEndOmitEmptyUintPtr OpType = 319 + OpStructFieldFloat32Ptr OpType = 320 + OpStructFieldOmitEmptyFloat32Ptr OpType = 321 + OpStructEndFloat32Ptr OpType = 322 + OpStructEndOmitEmptyFloat32Ptr OpType = 323 + OpStructFieldFloat64Ptr OpType = 324 + OpStructFieldOmitEmptyFloat64Ptr OpType = 325 + OpStructEndFloat64Ptr OpType = 326 + OpStructEndOmitEmptyFloat64Ptr OpType = 327 + OpStructFieldBoolPtr OpType = 328 + OpStructFieldOmitEmptyBoolPtr OpType = 329 + OpStructEndBoolPtr OpType = 330 + OpStructEndOmitEmptyBoolPtr OpType = 331 + OpStructFieldStringPtr OpType = 332 + OpStructFieldOmitEmptyStringPtr OpType = 333 + OpStructEndStringPtr OpType = 334 + OpStructEndOmitEmptyStringPtr OpType = 335 + OpStructFieldBytesPtr OpType = 336 + OpStructFieldOmitEmptyBytesPtr OpType = 337 + OpStructEndBytesPtr OpType = 338 + OpStructEndOmitEmptyBytesPtr OpType = 339 + OpStructFieldNumberPtr OpType = 340 + OpStructFieldOmitEmptyNumberPtr OpType = 341 + OpStructEndNumberPtr OpType = 342 + OpStructEndOmitEmptyNumberPtr OpType = 343 + OpStructFieldArrayPtr OpType = 344 + OpStructFieldOmitEmptyArrayPtr OpType = 345 + OpStructEndArrayPtr OpType = 346 + OpStructEndOmitEmptyArrayPtr OpType = 347 + OpStructFieldMapPtr OpType = 348 + OpStructFieldOmitEmptyMapPtr OpType = 349 + OpStructEndMapPtr OpType = 350 + OpStructEndOmitEmptyMapPtr OpType = 351 + OpStructFieldSlicePtr OpType = 352 + OpStructFieldOmitEmptySlicePtr OpType = 353 + OpStructEndSlicePtr OpType = 354 + OpStructEndOmitEmptySlicePtr OpType = 355 + OpStructFieldMarshalJSONPtr OpType = 356 + OpStructFieldOmitEmptyMarshalJSONPtr OpType = 357 + OpStructEndMarshalJSONPtr OpType = 358 + OpStructEndOmitEmptyMarshalJSONPtr OpType = 359 + OpStructFieldMarshalTextPtr OpType = 360 + OpStructFieldOmitEmptyMarshalTextPtr OpType = 361 + OpStructEndMarshalTextPtr OpType = 362 + OpStructEndOmitEmptyMarshalTextPtr OpType = 363 + OpStructFieldInterfacePtr OpType = 364 + OpStructFieldOmitEmptyInterfacePtr OpType = 365 + OpStructEndInterfacePtr OpType = 366 + OpStructEndOmitEmptyInterfacePtr OpType = 367 + OpStructFieldIntPtrString OpType = 368 + OpStructFieldOmitEmptyIntPtrString OpType = 369 + OpStructEndIntPtrString OpType = 370 + OpStructEndOmitEmptyIntPtrString OpType = 371 + OpStructFieldUintPtrString OpType = 372 + OpStructFieldOmitEmptyUintPtrString OpType = 373 + OpStructEndUintPtrString OpType = 374 + OpStructEndOmitEmptyUintPtrString OpType = 375 + OpStructFieldFloat32PtrString OpType = 376 + OpStructFieldOmitEmptyFloat32PtrString OpType = 377 + OpStructEndFloat32PtrString OpType = 378 + OpStructEndOmitEmptyFloat32PtrString OpType = 379 + OpStructFieldFloat64PtrString OpType = 380 + OpStructFieldOmitEmptyFloat64PtrString OpType = 381 + OpStructEndFloat64PtrString OpType = 382 + OpStructEndOmitEmptyFloat64PtrString OpType = 383 + OpStructFieldBoolPtrString OpType = 384 + OpStructFieldOmitEmptyBoolPtrString OpType = 385 + OpStructEndBoolPtrString OpType = 386 + OpStructEndOmitEmptyBoolPtrString OpType = 387 + OpStructFieldStringPtrString OpType = 388 + OpStructFieldOmitEmptyStringPtrString OpType = 389 + OpStructEndStringPtrString OpType = 390 + OpStructEndOmitEmptyStringPtrString OpType = 391 + OpStructFieldNumberPtrString OpType = 392 + OpStructFieldOmitEmptyNumberPtrString OpType = 393 + OpStructEndNumberPtrString OpType = 394 + OpStructEndOmitEmptyNumberPtrString OpType = 395 + OpStructField OpType = 396 + OpStructFieldOmitEmpty OpType = 397 + OpStructEnd OpType = 398 + OpStructEndOmitEmpty OpType = 399 +) + +func (t OpType) String() string { + if int(t) >= 400 { + return "" + } + return opTypeStrings[int(t)] +} + +func (t OpType) CodeType() CodeType { + if strings.Contains(t.String(), "Struct") { + if strings.Contains(t.String(), "End") { + return CodeStructEnd + } + return CodeStructField + } + switch t { + case OpArray, OpArrayPtr: + return CodeArrayHead + case OpArrayElem: + return CodeArrayElem + case OpSlice, OpSlicePtr: + return CodeSliceHead + case OpSliceElem: + return CodeSliceElem + case OpMap, OpMapPtr: + return CodeMapHead + case OpMapKey: + return CodeMapKey + case OpMapValue: + return CodeMapValue + case OpMapEnd: + return CodeMapEnd + } + + return CodeOp +} + +func (t OpType) HeadToPtrHead() OpType { + if strings.Index(t.String(), "PtrHead") > 0 { + return t + } + + idx := strings.Index(t.String(), "Head") + if idx == -1 { + return t + } + suffix := "PtrHead" + t.String()[idx+len("Head"):] + + const toPtrOffset = 2 + if strings.Contains(OpType(int(t)+toPtrOffset).String(), suffix) { + return OpType(int(t) + toPtrOffset) + } + return t +} + +func (t OpType) HeadToOmitEmptyHead() OpType { + const toOmitEmptyOffset = 1 + if strings.Contains(OpType(int(t)+toOmitEmptyOffset).String(), "OmitEmpty") { + return OpType(int(t) + toOmitEmptyOffset) + } + + return t +} + +func (t OpType) PtrHeadToHead() OpType { + idx := strings.Index(t.String(), "PtrHead") + if idx == -1 { + return t + } + suffix := t.String()[idx+len("Ptr"):] + + const toPtrOffset = 2 + if strings.Contains(OpType(int(t)-toPtrOffset).String(), suffix) { + return OpType(int(t) - toPtrOffset) + } + return t +} + +func (t OpType) FieldToEnd() OpType { + idx := strings.Index(t.String(), "Field") + if idx == -1 { + return t + } + suffix := t.String()[idx+len("Field"):] + if suffix == "" || suffix == "OmitEmpty" { + return t + } + const toEndOffset = 2 + if strings.Contains(OpType(int(t)+toEndOffset).String(), "End"+suffix) { + return OpType(int(t) + toEndOffset) + } + return t +} + +func (t OpType) FieldToOmitEmptyField() OpType { + const toOmitEmptyOffset = 1 + if strings.Contains(OpType(int(t)+toOmitEmptyOffset).String(), "OmitEmpty") { + return OpType(int(t) + toOmitEmptyOffset) + } + return t +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/query.go b/vendor/github.com/goccy/go-json/internal/encoder/query.go new file mode 100644 index 000000000..1e1850cc1 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/query.go @@ -0,0 +1,135 @@ +package encoder + +import ( + "context" + "fmt" + "reflect" +) + +var ( + Marshal func(interface{}) ([]byte, error) + Unmarshal func([]byte, interface{}) error +) + +type FieldQuery struct { + Name string + Fields []*FieldQuery + hash string +} + +func (q *FieldQuery) Hash() string { + if q.hash != "" { + return q.hash + } + b, _ := Marshal(q) + q.hash = string(b) + return q.hash +} + +func (q *FieldQuery) MarshalJSON() ([]byte, error) { + if q.Name != "" { + if len(q.Fields) > 0 { + return Marshal(map[string][]*FieldQuery{q.Name: q.Fields}) + } + return Marshal(q.Name) + } + return Marshal(q.Fields) +} + +func (q *FieldQuery) QueryString() (FieldQueryString, error) { + b, err := Marshal(q) + if err != nil { + return "", err + } + return FieldQueryString(b), nil +} + +type FieldQueryString string + +func (s FieldQueryString) Build() (*FieldQuery, error) { + var query interface{} + if err := Unmarshal([]byte(s), &query); err != nil { + return nil, err + } + return s.build(reflect.ValueOf(query)) +} + +func (s FieldQueryString) build(v reflect.Value) (*FieldQuery, error) { + switch v.Type().Kind() { + case reflect.String: + return s.buildString(v) + case reflect.Map: + return s.buildMap(v) + case reflect.Slice: + return s.buildSlice(v) + case reflect.Interface: + return s.build(reflect.ValueOf(v.Interface())) + } + return nil, fmt.Errorf("failed to build field query") +} + +func (s FieldQueryString) buildString(v reflect.Value) (*FieldQuery, error) { + b := []byte(v.String()) + switch b[0] { + case '[', '{': + var query interface{} + if err := Unmarshal(b, &query); err != nil { + return nil, err + } + if str, ok := query.(string); ok { + return &FieldQuery{Name: str}, nil + } + return s.build(reflect.ValueOf(query)) + } + return &FieldQuery{Name: string(b)}, nil +} + +func (s FieldQueryString) buildSlice(v reflect.Value) (*FieldQuery, error) { + fields := make([]*FieldQuery, 0, v.Len()) + for i := 0; i < v.Len(); i++ { + def, err := s.build(v.Index(i)) + if err != nil { + return nil, err + } + fields = append(fields, def) + } + return &FieldQuery{Fields: fields}, nil +} + +func (s FieldQueryString) buildMap(v reflect.Value) (*FieldQuery, error) { + keys := v.MapKeys() + if len(keys) != 1 { + return nil, fmt.Errorf("failed to build field query object") + } + key := keys[0] + if key.Type().Kind() != reflect.String { + return nil, fmt.Errorf("failed to build field query. invalid object key type") + } + name := key.String() + def, err := s.build(v.MapIndex(key)) + if err != nil { + return nil, err + } + return &FieldQuery{ + Name: name, + Fields: def.Fields, + }, nil +} + +type queryKey struct{} + +func FieldQueryFromContext(ctx context.Context) *FieldQuery { + query := ctx.Value(queryKey{}) + if query == nil { + return nil + } + q, ok := query.(*FieldQuery) + if !ok { + return nil + } + return q +} + +func SetFieldQueryToContext(ctx context.Context, query *FieldQuery) context.Context { + return context.WithValue(ctx, queryKey{}, query) +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/string.go b/vendor/github.com/goccy/go-json/internal/encoder/string.go new file mode 100644 index 000000000..e4152b27c --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/string.go @@ -0,0 +1,459 @@ +package encoder + +import ( + "math/bits" + "reflect" + "unsafe" +) + +const ( + lsb = 0x0101010101010101 + msb = 0x8080808080808080 +) + +var hex = "0123456789abcdef" + +//nolint:govet +func stringToUint64Slice(s string) []uint64 { + return *(*[]uint64)(unsafe.Pointer(&reflect.SliceHeader{ + Data: ((*reflect.StringHeader)(unsafe.Pointer(&s))).Data, + Len: len(s) / 8, + Cap: len(s) / 8, + })) +} + +func AppendString(ctx *RuntimeContext, buf []byte, s string) []byte { + if ctx.Option.Flag&HTMLEscapeOption != 0 { + if ctx.Option.Flag&NormalizeUTF8Option != 0 { + return appendNormalizedHTMLString(buf, s) + } + return appendHTMLString(buf, s) + } + if ctx.Option.Flag&NormalizeUTF8Option != 0 { + return appendNormalizedString(buf, s) + } + return appendString(buf, s) +} + +func appendNormalizedHTMLString(buf []byte, s string) []byte { + valLen := len(s) + if valLen == 0 { + return append(buf, `""`...) + } + buf = append(buf, '"') + var ( + i, j int + ) + if valLen >= 8 { + chunks := stringToUint64Slice(s) + for _, n := range chunks { + // combine masks before checking for the MSB of each byte. We include + // `n` in the mask to check whether any of the *input* byte MSBs were + // set (i.e. the byte was outside the ASCII range). + mask := n | (n - (lsb * 0x20)) | + ((n ^ (lsb * '"')) - lsb) | + ((n ^ (lsb * '\\')) - lsb) | + ((n ^ (lsb * '<')) - lsb) | + ((n ^ (lsb * '>')) - lsb) | + ((n ^ (lsb * '&')) - lsb) + if (mask & msb) != 0 { + j = bits.TrailingZeros64(mask&msb) / 8 + goto ESCAPE_END + } + } + for i := len(chunks) * 8; i < valLen; i++ { + if needEscapeHTMLNormalizeUTF8[s[i]] { + j = i + goto ESCAPE_END + } + } + // no found any escape characters. + return append(append(buf, s...), '"') + } +ESCAPE_END: + for j < valLen { + c := s[j] + + if !needEscapeHTMLNormalizeUTF8[c] { + // fast path: most of the time, printable ascii characters are used + j++ + continue + } + + switch c { + case '\\', '"': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', c) + i = j + 1 + j = j + 1 + continue + + case '\n': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 'n') + i = j + 1 + j = j + 1 + continue + + case '\r': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 'r') + i = j + 1 + j = j + 1 + continue + + case '\t': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 't') + i = j + 1 + j = j + 1 + continue + + case '<', '>', '&': + buf = append(buf, s[i:j]...) + buf = append(buf, `\u00`...) + buf = append(buf, hex[c>>4], hex[c&0xF]) + i = j + 1 + j = j + 1 + continue + + case 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x0B, 0x0C, 0x0E, 0x0F, // 0x00-0x0F + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F: // 0x10-0x1F + buf = append(buf, s[i:j]...) + buf = append(buf, `\u00`...) + buf = append(buf, hex[c>>4], hex[c&0xF]) + i = j + 1 + j = j + 1 + continue + } + state, size := decodeRuneInString(s[j:]) + switch state { + case runeErrorState: + buf = append(buf, s[i:j]...) + buf = append(buf, `\ufffd`...) + i = j + 1 + j = j + 1 + continue + // U+2028 is LINE SEPARATOR. + // U+2029 is PARAGRAPH SEPARATOR. + // They are both technically valid characters in JSON strings, + // but don't work in JSONP, which has to be evaluated as JavaScript, + // and can lead to security holes there. It is valid JSON to + // escape them, so we do so unconditionally. + // See http://timelessrepo.com/json-isnt-a-javascript-subset for discussion. + case lineSepState: + buf = append(buf, s[i:j]...) + buf = append(buf, `\u2028`...) + i = j + 3 + j = j + 3 + continue + case paragraphSepState: + buf = append(buf, s[i:j]...) + buf = append(buf, `\u2029`...) + i = j + 3 + j = j + 3 + continue + } + j += size + } + + return append(append(buf, s[i:]...), '"') +} + +func appendHTMLString(buf []byte, s string) []byte { + valLen := len(s) + if valLen == 0 { + return append(buf, `""`...) + } + buf = append(buf, '"') + var ( + i, j int + ) + if valLen >= 8 { + chunks := stringToUint64Slice(s) + for _, n := range chunks { + // combine masks before checking for the MSB of each byte. We include + // `n` in the mask to check whether any of the *input* byte MSBs were + // set (i.e. the byte was outside the ASCII range). + mask := n | (n - (lsb * 0x20)) | + ((n ^ (lsb * '"')) - lsb) | + ((n ^ (lsb * '\\')) - lsb) | + ((n ^ (lsb * '<')) - lsb) | + ((n ^ (lsb * '>')) - lsb) | + ((n ^ (lsb * '&')) - lsb) + if (mask & msb) != 0 { + j = bits.TrailingZeros64(mask&msb) / 8 + goto ESCAPE_END + } + } + for i := len(chunks) * 8; i < valLen; i++ { + if needEscapeHTML[s[i]] { + j = i + goto ESCAPE_END + } + } + // no found any escape characters. + return append(append(buf, s...), '"') + } +ESCAPE_END: + for j < valLen { + c := s[j] + + if !needEscapeHTML[c] { + // fast path: most of the time, printable ascii characters are used + j++ + continue + } + + switch c { + case '\\', '"': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', c) + i = j + 1 + j = j + 1 + continue + + case '\n': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 'n') + i = j + 1 + j = j + 1 + continue + + case '\r': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 'r') + i = j + 1 + j = j + 1 + continue + + case '\t': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 't') + i = j + 1 + j = j + 1 + continue + + case '<', '>', '&': + buf = append(buf, s[i:j]...) + buf = append(buf, `\u00`...) + buf = append(buf, hex[c>>4], hex[c&0xF]) + i = j + 1 + j = j + 1 + continue + + case 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x0B, 0x0C, 0x0E, 0x0F, // 0x00-0x0F + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F: // 0x10-0x1F + buf = append(buf, s[i:j]...) + buf = append(buf, `\u00`...) + buf = append(buf, hex[c>>4], hex[c&0xF]) + i = j + 1 + j = j + 1 + continue + } + j++ + } + + return append(append(buf, s[i:]...), '"') +} + +func appendNormalizedString(buf []byte, s string) []byte { + valLen := len(s) + if valLen == 0 { + return append(buf, `""`...) + } + buf = append(buf, '"') + var ( + i, j int + ) + if valLen >= 8 { + chunks := stringToUint64Slice(s) + for _, n := range chunks { + // combine masks before checking for the MSB of each byte. We include + // `n` in the mask to check whether any of the *input* byte MSBs were + // set (i.e. the byte was outside the ASCII range). + mask := n | (n - (lsb * 0x20)) | + ((n ^ (lsb * '"')) - lsb) | + ((n ^ (lsb * '\\')) - lsb) + if (mask & msb) != 0 { + j = bits.TrailingZeros64(mask&msb) / 8 + goto ESCAPE_END + } + } + valLen := len(s) + for i := len(chunks) * 8; i < valLen; i++ { + if needEscapeNormalizeUTF8[s[i]] { + j = i + goto ESCAPE_END + } + } + return append(append(buf, s...), '"') + } +ESCAPE_END: + for j < valLen { + c := s[j] + + if !needEscapeNormalizeUTF8[c] { + // fast path: most of the time, printable ascii characters are used + j++ + continue + } + + switch c { + case '\\', '"': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', c) + i = j + 1 + j = j + 1 + continue + + case '\n': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 'n') + i = j + 1 + j = j + 1 + continue + + case '\r': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 'r') + i = j + 1 + j = j + 1 + continue + + case '\t': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 't') + i = j + 1 + j = j + 1 + continue + + case 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x0B, 0x0C, 0x0E, 0x0F, // 0x00-0x0F + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F: // 0x10-0x1F + buf = append(buf, s[i:j]...) + buf = append(buf, `\u00`...) + buf = append(buf, hex[c>>4], hex[c&0xF]) + i = j + 1 + j = j + 1 + continue + } + + state, size := decodeRuneInString(s[j:]) + switch state { + case runeErrorState: + buf = append(buf, s[i:j]...) + buf = append(buf, `\ufffd`...) + i = j + 1 + j = j + 1 + continue + // U+2028 is LINE SEPARATOR. + // U+2029 is PARAGRAPH SEPARATOR. + // They are both technically valid characters in JSON strings, + // but don't work in JSONP, which has to be evaluated as JavaScript, + // and can lead to security holes there. It is valid JSON to + // escape them, so we do so unconditionally. + // See http://timelessrepo.com/json-isnt-a-javascript-subset for discussion. + case lineSepState: + buf = append(buf, s[i:j]...) + buf = append(buf, `\u2028`...) + i = j + 3 + j = j + 3 + continue + case paragraphSepState: + buf = append(buf, s[i:j]...) + buf = append(buf, `\u2029`...) + i = j + 3 + j = j + 3 + continue + } + j += size + } + + return append(append(buf, s[i:]...), '"') +} + +func appendString(buf []byte, s string) []byte { + valLen := len(s) + if valLen == 0 { + return append(buf, `""`...) + } + buf = append(buf, '"') + var ( + i, j int + ) + if valLen >= 8 { + chunks := stringToUint64Slice(s) + for _, n := range chunks { + // combine masks before checking for the MSB of each byte. We include + // `n` in the mask to check whether any of the *input* byte MSBs were + // set (i.e. the byte was outside the ASCII range). + mask := n | (n - (lsb * 0x20)) | + ((n ^ (lsb * '"')) - lsb) | + ((n ^ (lsb * '\\')) - lsb) + if (mask & msb) != 0 { + j = bits.TrailingZeros64(mask&msb) / 8 + goto ESCAPE_END + } + } + valLen := len(s) + for i := len(chunks) * 8; i < valLen; i++ { + if needEscape[s[i]] { + j = i + goto ESCAPE_END + } + } + return append(append(buf, s...), '"') + } +ESCAPE_END: + for j < valLen { + c := s[j] + + if !needEscape[c] { + // fast path: most of the time, printable ascii characters are used + j++ + continue + } + + switch c { + case '\\', '"': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', c) + i = j + 1 + j = j + 1 + continue + + case '\n': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 'n') + i = j + 1 + j = j + 1 + continue + + case '\r': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 'r') + i = j + 1 + j = j + 1 + continue + + case '\t': + buf = append(buf, s[i:j]...) + buf = append(buf, '\\', 't') + i = j + 1 + j = j + 1 + continue + + case 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x0B, 0x0C, 0x0E, 0x0F, // 0x00-0x0F + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F: // 0x10-0x1F + buf = append(buf, s[i:j]...) + buf = append(buf, `\u00`...) + buf = append(buf, hex[c>>4], hex[c&0xF]) + i = j + 1 + j = j + 1 + continue + } + j++ + } + + return append(append(buf, s[i:]...), '"') +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/string_table.go b/vendor/github.com/goccy/go-json/internal/encoder/string_table.go new file mode 100644 index 000000000..ebe42c92d --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/string_table.go @@ -0,0 +1,415 @@ +package encoder + +var needEscapeHTMLNormalizeUTF8 = [256]bool{ + '"': true, + '&': true, + '<': true, + '>': true, + '\\': true, + 0x00: true, + 0x01: true, + 0x02: true, + 0x03: true, + 0x04: true, + 0x05: true, + 0x06: true, + 0x07: true, + 0x08: true, + 0x09: true, + 0x0a: true, + 0x0b: true, + 0x0c: true, + 0x0d: true, + 0x0e: true, + 0x0f: true, + 0x10: true, + 0x11: true, + 0x12: true, + 0x13: true, + 0x14: true, + 0x15: true, + 0x16: true, + 0x17: true, + 0x18: true, + 0x19: true, + 0x1a: true, + 0x1b: true, + 0x1c: true, + 0x1d: true, + 0x1e: true, + 0x1f: true, + /* 0x20 - 0x7f */ + 0x80: true, + 0x81: true, + 0x82: true, + 0x83: true, + 0x84: true, + 0x85: true, + 0x86: true, + 0x87: true, + 0x88: true, + 0x89: true, + 0x8a: true, + 0x8b: true, + 0x8c: true, + 0x8d: true, + 0x8e: true, + 0x8f: true, + 0x90: true, + 0x91: true, + 0x92: true, + 0x93: true, + 0x94: true, + 0x95: true, + 0x96: true, + 0x97: true, + 0x98: true, + 0x99: true, + 0x9a: true, + 0x9b: true, + 0x9c: true, + 0x9d: true, + 0x9e: true, + 0x9f: true, + 0xa0: true, + 0xa1: true, + 0xa2: true, + 0xa3: true, + 0xa4: true, + 0xa5: true, + 0xa6: true, + 0xa7: true, + 0xa8: true, + 0xa9: true, + 0xaa: true, + 0xab: true, + 0xac: true, + 0xad: true, + 0xae: true, + 0xaf: true, + 0xb0: true, + 0xb1: true, + 0xb2: true, + 0xb3: true, + 0xb4: true, + 0xb5: true, + 0xb6: true, + 0xb7: true, + 0xb8: true, + 0xb9: true, + 0xba: true, + 0xbb: true, + 0xbc: true, + 0xbd: true, + 0xbe: true, + 0xbf: true, + 0xc0: true, + 0xc1: true, + 0xc2: true, + 0xc3: true, + 0xc4: true, + 0xc5: true, + 0xc6: true, + 0xc7: true, + 0xc8: true, + 0xc9: true, + 0xca: true, + 0xcb: true, + 0xcc: true, + 0xcd: true, + 0xce: true, + 0xcf: true, + 0xd0: true, + 0xd1: true, + 0xd2: true, + 0xd3: true, + 0xd4: true, + 0xd5: true, + 0xd6: true, + 0xd7: true, + 0xd8: true, + 0xd9: true, + 0xda: true, + 0xdb: true, + 0xdc: true, + 0xdd: true, + 0xde: true, + 0xdf: true, + 0xe0: true, + 0xe1: true, + 0xe2: true, + 0xe3: true, + 0xe4: true, + 0xe5: true, + 0xe6: true, + 0xe7: true, + 0xe8: true, + 0xe9: true, + 0xea: true, + 0xeb: true, + 0xec: true, + 0xed: true, + 0xee: true, + 0xef: true, + 0xf0: true, + 0xf1: true, + 0xf2: true, + 0xf3: true, + 0xf4: true, + 0xf5: true, + 0xf6: true, + 0xf7: true, + 0xf8: true, + 0xf9: true, + 0xfa: true, + 0xfb: true, + 0xfc: true, + 0xfd: true, + 0xfe: true, + 0xff: true, +} + +var needEscapeNormalizeUTF8 = [256]bool{ + '"': true, + '\\': true, + 0x00: true, + 0x01: true, + 0x02: true, + 0x03: true, + 0x04: true, + 0x05: true, + 0x06: true, + 0x07: true, + 0x08: true, + 0x09: true, + 0x0a: true, + 0x0b: true, + 0x0c: true, + 0x0d: true, + 0x0e: true, + 0x0f: true, + 0x10: true, + 0x11: true, + 0x12: true, + 0x13: true, + 0x14: true, + 0x15: true, + 0x16: true, + 0x17: true, + 0x18: true, + 0x19: true, + 0x1a: true, + 0x1b: true, + 0x1c: true, + 0x1d: true, + 0x1e: true, + 0x1f: true, + /* 0x20 - 0x7f */ + 0x80: true, + 0x81: true, + 0x82: true, + 0x83: true, + 0x84: true, + 0x85: true, + 0x86: true, + 0x87: true, + 0x88: true, + 0x89: true, + 0x8a: true, + 0x8b: true, + 0x8c: true, + 0x8d: true, + 0x8e: true, + 0x8f: true, + 0x90: true, + 0x91: true, + 0x92: true, + 0x93: true, + 0x94: true, + 0x95: true, + 0x96: true, + 0x97: true, + 0x98: true, + 0x99: true, + 0x9a: true, + 0x9b: true, + 0x9c: true, + 0x9d: true, + 0x9e: true, + 0x9f: true, + 0xa0: true, + 0xa1: true, + 0xa2: true, + 0xa3: true, + 0xa4: true, + 0xa5: true, + 0xa6: true, + 0xa7: true, + 0xa8: true, + 0xa9: true, + 0xaa: true, + 0xab: true, + 0xac: true, + 0xad: true, + 0xae: true, + 0xaf: true, + 0xb0: true, + 0xb1: true, + 0xb2: true, + 0xb3: true, + 0xb4: true, + 0xb5: true, + 0xb6: true, + 0xb7: true, + 0xb8: true, + 0xb9: true, + 0xba: true, + 0xbb: true, + 0xbc: true, + 0xbd: true, + 0xbe: true, + 0xbf: true, + 0xc0: true, + 0xc1: true, + 0xc2: true, + 0xc3: true, + 0xc4: true, + 0xc5: true, + 0xc6: true, + 0xc7: true, + 0xc8: true, + 0xc9: true, + 0xca: true, + 0xcb: true, + 0xcc: true, + 0xcd: true, + 0xce: true, + 0xcf: true, + 0xd0: true, + 0xd1: true, + 0xd2: true, + 0xd3: true, + 0xd4: true, + 0xd5: true, + 0xd6: true, + 0xd7: true, + 0xd8: true, + 0xd9: true, + 0xda: true, + 0xdb: true, + 0xdc: true, + 0xdd: true, + 0xde: true, + 0xdf: true, + 0xe0: true, + 0xe1: true, + 0xe2: true, + 0xe3: true, + 0xe4: true, + 0xe5: true, + 0xe6: true, + 0xe7: true, + 0xe8: true, + 0xe9: true, + 0xea: true, + 0xeb: true, + 0xec: true, + 0xed: true, + 0xee: true, + 0xef: true, + 0xf0: true, + 0xf1: true, + 0xf2: true, + 0xf3: true, + 0xf4: true, + 0xf5: true, + 0xf6: true, + 0xf7: true, + 0xf8: true, + 0xf9: true, + 0xfa: true, + 0xfb: true, + 0xfc: true, + 0xfd: true, + 0xfe: true, + 0xff: true, +} + +var needEscapeHTML = [256]bool{ + '"': true, + '&': true, + '<': true, + '>': true, + '\\': true, + 0x00: true, + 0x01: true, + 0x02: true, + 0x03: true, + 0x04: true, + 0x05: true, + 0x06: true, + 0x07: true, + 0x08: true, + 0x09: true, + 0x0a: true, + 0x0b: true, + 0x0c: true, + 0x0d: true, + 0x0e: true, + 0x0f: true, + 0x10: true, + 0x11: true, + 0x12: true, + 0x13: true, + 0x14: true, + 0x15: true, + 0x16: true, + 0x17: true, + 0x18: true, + 0x19: true, + 0x1a: true, + 0x1b: true, + 0x1c: true, + 0x1d: true, + 0x1e: true, + 0x1f: true, + /* 0x20 - 0xff */ +} + +var needEscape = [256]bool{ + '"': true, + '\\': true, + 0x00: true, + 0x01: true, + 0x02: true, + 0x03: true, + 0x04: true, + 0x05: true, + 0x06: true, + 0x07: true, + 0x08: true, + 0x09: true, + 0x0a: true, + 0x0b: true, + 0x0c: true, + 0x0d: true, + 0x0e: true, + 0x0f: true, + 0x10: true, + 0x11: true, + 0x12: true, + 0x13: true, + 0x14: true, + 0x15: true, + 0x16: true, + 0x17: true, + 0x18: true, + 0x19: true, + 0x1a: true, + 0x1b: true, + 0x1c: true, + 0x1d: true, + 0x1e: true, + 0x1f: true, + /* 0x20 - 0xff */ +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm/debug_vm.go b/vendor/github.com/goccy/go-json/internal/encoder/vm/debug_vm.go new file mode 100644 index 000000000..82b6dd47f --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm/debug_vm.go @@ -0,0 +1,41 @@ +package vm + +import ( + "fmt" + "io" + + "github.com/goccy/go-json/internal/encoder" +) + +func DebugRun(ctx *encoder.RuntimeContext, b []byte, codeSet *encoder.OpcodeSet) ([]byte, error) { + defer func() { + var code *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + code = codeSet.EscapeKeyCode + } else { + code = codeSet.NoescapeKeyCode + } + if wc := ctx.Option.DebugDOTOut; wc != nil { + _, _ = io.WriteString(wc, code.DumpDOT()) + wc.Close() + ctx.Option.DebugDOTOut = nil + } + + if err := recover(); err != nil { + w := ctx.Option.DebugOut + fmt.Fprintln(w, "=============[DEBUG]===============") + fmt.Fprintln(w, "* [TYPE]") + fmt.Fprintln(w, codeSet.Type) + fmt.Fprintf(w, "\n") + fmt.Fprintln(w, "* [ALL OPCODE]") + fmt.Fprintln(w, code.Dump()) + fmt.Fprintf(w, "\n") + fmt.Fprintln(w, "* [CONTEXT]") + fmt.Fprintf(w, "%+v\n", ctx) + fmt.Fprintln(w, "===================================") + panic(err) + } + }() + + return Run(ctx, b, codeSet) +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm/hack.go b/vendor/github.com/goccy/go-json/internal/encoder/vm/hack.go new file mode 100644 index 000000000..65252b4a5 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm/hack.go @@ -0,0 +1,9 @@ +package vm + +import ( + // HACK: compile order + // `vm`, `vm_indent`, `vm_color`, `vm_color_indent` packages uses a lot of memory to compile, + // so forcibly make dependencies and avoid compiling in concurrent. + // dependency order: vm => vm_indent => vm_color => vm_color_indent + _ "github.com/goccy/go-json/internal/encoder/vm_indent" +) diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm/util.go b/vendor/github.com/goccy/go-json/internal/encoder/vm/util.go new file mode 100644 index 000000000..86291d7bb --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm/util.go @@ -0,0 +1,207 @@ +package vm + +import ( + "encoding/json" + "fmt" + "unsafe" + + "github.com/goccy/go-json/internal/encoder" + "github.com/goccy/go-json/internal/runtime" +) + +const uintptrSize = 4 << (^uintptr(0) >> 63) + +var ( + appendInt = encoder.AppendInt + appendUint = encoder.AppendUint + appendFloat32 = encoder.AppendFloat32 + appendFloat64 = encoder.AppendFloat64 + appendString = encoder.AppendString + appendByteSlice = encoder.AppendByteSlice + appendNumber = encoder.AppendNumber + errUnsupportedValue = encoder.ErrUnsupportedValue + errUnsupportedFloat = encoder.ErrUnsupportedFloat + mapiterinit = encoder.MapIterInit + mapiterkey = encoder.MapIterKey + mapitervalue = encoder.MapIterValue + mapiternext = encoder.MapIterNext + maplen = encoder.MapLen +) + +type emptyInterface struct { + typ *runtime.Type + ptr unsafe.Pointer +} + +type nonEmptyInterface struct { + itab *struct { + ityp *runtime.Type // static interface type + typ *runtime.Type // dynamic concrete type + // unused fields... + } + ptr unsafe.Pointer +} + +func errUnimplementedOp(op encoder.OpType) error { + return fmt.Errorf("encoder: opcode %s has not been implemented", op) +} + +func load(base uintptr, idx uint32) uintptr { + addr := base + uintptr(idx) + return **(**uintptr)(unsafe.Pointer(&addr)) +} + +func store(base uintptr, idx uint32, p uintptr) { + addr := base + uintptr(idx) + **(**uintptr)(unsafe.Pointer(&addr)) = p +} + +func loadNPtr(base uintptr, idx uint32, ptrNum uint8) uintptr { + addr := base + uintptr(idx) + p := **(**uintptr)(unsafe.Pointer(&addr)) + for i := uint8(0); i < ptrNum; i++ { + if p == 0 { + return 0 + } + p = ptrToPtr(p) + } + return p +} + +func ptrToUint64(p uintptr, bitSize uint8) uint64 { + switch bitSize { + case 8: + return (uint64)(**(**uint8)(unsafe.Pointer(&p))) + case 16: + return (uint64)(**(**uint16)(unsafe.Pointer(&p))) + case 32: + return (uint64)(**(**uint32)(unsafe.Pointer(&p))) + case 64: + return **(**uint64)(unsafe.Pointer(&p)) + } + return 0 +} +func ptrToFloat32(p uintptr) float32 { return **(**float32)(unsafe.Pointer(&p)) } +func ptrToFloat64(p uintptr) float64 { return **(**float64)(unsafe.Pointer(&p)) } +func ptrToBool(p uintptr) bool { return **(**bool)(unsafe.Pointer(&p)) } +func ptrToBytes(p uintptr) []byte { return **(**[]byte)(unsafe.Pointer(&p)) } +func ptrToNumber(p uintptr) json.Number { return **(**json.Number)(unsafe.Pointer(&p)) } +func ptrToString(p uintptr) string { return **(**string)(unsafe.Pointer(&p)) } +func ptrToSlice(p uintptr) *runtime.SliceHeader { return *(**runtime.SliceHeader)(unsafe.Pointer(&p)) } +func ptrToPtr(p uintptr) uintptr { + return uintptr(**(**unsafe.Pointer)(unsafe.Pointer(&p))) +} +func ptrToNPtr(p uintptr, ptrNum uint8) uintptr { + for i := uint8(0); i < ptrNum; i++ { + if p == 0 { + return 0 + } + p = ptrToPtr(p) + } + return p +} + +func ptrToUnsafePtr(p uintptr) unsafe.Pointer { + return *(*unsafe.Pointer)(unsafe.Pointer(&p)) +} +func ptrToInterface(code *encoder.Opcode, p uintptr) interface{} { + return *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: code.Type, + ptr: *(*unsafe.Pointer)(unsafe.Pointer(&p)), + })) +} + +func appendBool(_ *encoder.RuntimeContext, b []byte, v bool) []byte { + if v { + return append(b, "true"...) + } + return append(b, "false"...) +} + +func appendNull(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, "null"...) +} + +func appendComma(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, ',') +} + +func appendNullComma(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, "null,"...) +} + +func appendColon(_ *encoder.RuntimeContext, b []byte) []byte { + last := len(b) - 1 + b[last] = ':' + return b +} + +func appendMapKeyValue(_ *encoder.RuntimeContext, _ *encoder.Opcode, b, key, value []byte) []byte { + b = append(b, key...) + b[len(b)-1] = ':' + return append(b, value...) +} + +func appendMapEnd(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { + b[len(b)-1] = '}' + b = append(b, ',') + return b +} + +func appendMarshalJSON(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte, v interface{}) ([]byte, error) { + return encoder.AppendMarshalJSON(ctx, code, b, v) +} + +func appendMarshalText(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte, v interface{}) ([]byte, error) { + return encoder.AppendMarshalText(ctx, code, b, v) +} + +func appendArrayHead(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { + return append(b, '[') +} + +func appendArrayEnd(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + b[last] = ']' + return append(b, ',') +} + +func appendEmptyArray(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '[', ']', ',') +} + +func appendEmptyObject(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '{', '}', ',') +} + +func appendObjectEnd(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + b[last] = '}' + return append(b, ',') +} + +func appendStructHead(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '{') +} + +func appendStructKey(_ *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + return append(b, code.Key...) +} + +func appendStructEnd(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { + return append(b, '}', ',') +} + +func appendStructEndSkipLast(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + if b[last] == ',' { + b[last] = '}' + return appendComma(ctx, b) + } + return appendStructEnd(ctx, code, b) +} + +func restoreIndent(_ *encoder.RuntimeContext, _ *encoder.Opcode, _ uintptr) {} +func storeIndent(_ uintptr, _ *encoder.Opcode, _ uintptr) {} +func appendMapKeyIndent(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { return b } +func appendArrayElemIndent(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { return b } diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm/vm.go b/vendor/github.com/goccy/go-json/internal/encoder/vm/vm.go new file mode 100644 index 000000000..645d20f9f --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm/vm.go @@ -0,0 +1,4859 @@ +// Code generated by internal/cmd/generator. DO NOT EDIT! +package vm + +import ( + "math" + "reflect" + "sort" + "unsafe" + + "github.com/goccy/go-json/internal/encoder" + "github.com/goccy/go-json/internal/runtime" +) + +func Run(ctx *encoder.RuntimeContext, b []byte, codeSet *encoder.OpcodeSet) ([]byte, error) { + recursiveLevel := 0 + ptrOffset := uintptr(0) + ctxptr := ctx.Ptr() + var code *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + code = codeSet.EscapeKeyCode + } else { + code = codeSet.NoescapeKeyCode + } + + for { + switch code.Op { + default: + return nil, errUnimplementedOp(code.Op) + case encoder.OpPtr: + p := load(ctxptr, code.Idx) + code = code.Next + store(ctxptr, code.Idx, ptrToPtr(p)) + case encoder.OpIntPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpInt: + b = appendInt(ctx, b, load(ctxptr, code.Idx), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpUintPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpUint: + b = appendUint(ctx, b, load(ctxptr, code.Idx), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpIntString: + b = append(b, '"') + b = appendInt(ctx, b, load(ctxptr, code.Idx), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpUintString: + b = append(b, '"') + b = appendUint(ctx, b, load(ctxptr, code.Idx), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpFloat32Ptr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + b = appendComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpFloat32: + b = appendFloat32(ctx, b, ptrToFloat32(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpFloat64Ptr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpFloat64: + v := ptrToFloat64(load(ctxptr, code.Idx)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStringPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpString: + b = appendString(ctx, b, ptrToString(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpBoolPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpBool: + b = appendBool(ctx, b, ptrToBool(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpBytesPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpBytes: + b = appendByteSlice(ctx, b, ptrToBytes(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpNumberPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpNumber: + bb, err := appendNumber(ctx, b, ptrToNumber(load(ctxptr, code.Idx))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpInterfacePtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpInterface: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + if recursiveLevel > encoder.StartDetectingCyclesAfter { + for _, seen := range ctx.SeenPtr { + if p == seen { + return nil, errUnsupportedValue(code, p) + } + } + } + ctx.SeenPtr = append(ctx.SeenPtr, p) + var ( + typ *runtime.Type + ifacePtr unsafe.Pointer + ) + up := ptrToUnsafePtr(p) + if code.Flags&encoder.NonEmptyInterfaceFlags != 0 { + iface := (*nonEmptyInterface)(up) + ifacePtr = iface.ptr + if iface.itab != nil { + typ = iface.itab.typ + } + } else { + iface := (*emptyInterface)(up) + ifacePtr = iface.ptr + typ = iface.typ + } + if ifacePtr == nil { + isDirectedNil := typ != nil && typ.Kind() == reflect.Struct && !runtime.IfaceIndir(typ) + if !isDirectedNil { + b = appendNullComma(ctx, b) + code = code.Next + break + } + } + ctx.KeepRefs = append(ctx.KeepRefs, up) + ifaceCodeSet, err := encoder.CompileToGetCodeSet(ctx, uintptr(unsafe.Pointer(typ))) + if err != nil { + return nil, err + } + + totalLength := uintptr(code.Length) + 3 + nextTotalLength := uintptr(ifaceCodeSet.CodeLength) + 3 + + var c *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + c = ifaceCodeSet.InterfaceEscapeKeyCode + } else { + c = ifaceCodeSet.InterfaceNoescapeKeyCode + } + curlen := uintptr(len(ctx.Ptrs)) + offsetNum := ptrOffset / uintptrSize + oldOffset := ptrOffset + ptrOffset += totalLength * uintptrSize + oldBaseIndent := ctx.BaseIndent + ctx.BaseIndent += code.Indent + + newLen := offsetNum + totalLength + nextTotalLength + if curlen < newLen { + ctx.Ptrs = append(ctx.Ptrs, make([]uintptr, newLen-curlen)...) + } + ctxptr = ctx.Ptr() + ptrOffset // assign new ctxptr + + end := ifaceCodeSet.EndCode + store(ctxptr, c.Idx, uintptr(ifacePtr)) + store(ctxptr, end.Idx, oldOffset) + store(ctxptr, end.ElemIdx, uintptr(unsafe.Pointer(code.Next))) + storeIndent(ctxptr, end, uintptr(oldBaseIndent)) + code = c + recursiveLevel++ + case encoder.OpInterfaceEnd: + recursiveLevel-- + + // restore ctxptr + offset := load(ctxptr, code.Idx) + restoreIndent(ctx, code, ctxptr) + ctx.SeenPtr = ctx.SeenPtr[:len(ctx.SeenPtr)-1] + + codePtr := load(ctxptr, code.ElemIdx) + code = (*encoder.Opcode)(ptrToUnsafePtr(codePtr)) + ctxptr = ctx.Ptr() + offset + ptrOffset = offset + case encoder.OpMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToPtr(p)) + fallthrough + case encoder.OpMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + if (code.Flags&encoder.IsNilableTypeFlags) != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p) + } + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToPtr(p)) + fallthrough + case encoder.OpMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + b = append(b, `""`...) + b = appendComma(ctx, b) + code = code.Next + break + } + if (code.Flags&encoder.IsNilableTypeFlags) != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p) + } + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpSlicePtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpSlice: + p := load(ctxptr, code.Idx) + slice := ptrToSlice(p) + if p == 0 || slice.Data == nil { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.ElemIdx, 0) + store(ctxptr, code.Length, uintptr(slice.Len)) + store(ctxptr, code.Idx, uintptr(slice.Data)) + if slice.Len > 0 { + b = appendArrayHead(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, uintptr(slice.Data)) + } else { + b = appendEmptyArray(ctx, b) + code = code.End.Next + } + case encoder.OpSliceElem: + idx := load(ctxptr, code.ElemIdx) + length := load(ctxptr, code.Length) + idx++ + if idx < length { + b = appendArrayElemIndent(ctx, code, b) + store(ctxptr, code.ElemIdx, idx) + data := load(ctxptr, code.Idx) + size := uintptr(code.Size) + code = code.Next + store(ctxptr, code.Idx, data+idx*size) + } else { + b = appendArrayEnd(ctx, code, b) + code = code.End.Next + } + case encoder.OpArrayPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpArray: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + if code.Length > 0 { + b = appendArrayHead(ctx, code, b) + store(ctxptr, code.ElemIdx, 0) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + b = appendEmptyArray(ctx, b) + code = code.End.Next + } + case encoder.OpArrayElem: + idx := load(ctxptr, code.ElemIdx) + idx++ + if idx < uintptr(code.Length) { + b = appendArrayElemIndent(ctx, code, b) + store(ctxptr, code.ElemIdx, idx) + p := load(ctxptr, code.Idx) + size := uintptr(code.Size) + code = code.Next + store(ctxptr, code.Idx, p+idx*size) + } else { + b = appendArrayEnd(ctx, code, b) + code = code.End.Next + } + case encoder.OpMapPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpMap: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + uptr := ptrToUnsafePtr(p) + mlen := maplen(uptr) + if mlen <= 0 { + b = appendEmptyObject(ctx, b) + code = code.End.Next + break + } + b = appendStructHead(ctx, b) + unorderedMap := (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 + mapCtx := encoder.NewMapContext(mlen, unorderedMap) + mapiterinit(code.Type, uptr, &mapCtx.Iter) + store(ctxptr, code.Idx, uintptr(unsafe.Pointer(mapCtx))) + ctx.KeepRefs = append(ctx.KeepRefs, unsafe.Pointer(mapCtx)) + if unorderedMap { + b = appendMapKeyIndent(ctx, code.Next, b) + } else { + mapCtx.Start = len(b) + mapCtx.First = len(b) + } + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + case encoder.OpMapKey: + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + idx := mapCtx.Idx + idx++ + if (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 { + if idx < mapCtx.Len { + b = appendMapKeyIndent(ctx, code, b) + mapCtx.Idx = int(idx) + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + } else { + b = appendObjectEnd(ctx, code, b) + encoder.ReleaseMapContext(mapCtx) + code = code.End.Next + } + } else { + mapCtx.Slice.Items[mapCtx.Idx].Value = b[mapCtx.Start:len(b)] + if idx < mapCtx.Len { + mapCtx.Idx = int(idx) + mapCtx.Start = len(b) + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + } else { + code = code.End + } + } + case encoder.OpMapValue: + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + if (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 { + b = appendColon(ctx, b) + } else { + mapCtx.Slice.Items[mapCtx.Idx].Key = b[mapCtx.Start:len(b)] + mapCtx.Start = len(b) + } + value := mapitervalue(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(value)) + mapiternext(&mapCtx.Iter) + code = code.Next + case encoder.OpMapEnd: + // this operation only used by sorted map. + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + sort.Sort(mapCtx.Slice) + buf := mapCtx.Buf + for _, item := range mapCtx.Slice.Items { + buf = appendMapKeyValue(ctx, code, buf, item.Key, item.Value) + } + buf = appendMapEnd(ctx, code, buf) + b = b[:mapCtx.First] + b = append(b, buf...) + mapCtx.Buf = buf + encoder.ReleaseMapContext(mapCtx) + code = code.Next + case encoder.OpRecursivePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpRecursive: + ptr := load(ctxptr, code.Idx) + if ptr != 0 { + if recursiveLevel > encoder.StartDetectingCyclesAfter { + for _, seen := range ctx.SeenPtr { + if ptr == seen { + return nil, errUnsupportedValue(code, ptr) + } + } + } + } + ctx.SeenPtr = append(ctx.SeenPtr, ptr) + c := code.Jmp.Code + curlen := uintptr(len(ctx.Ptrs)) + offsetNum := ptrOffset / uintptrSize + oldOffset := ptrOffset + ptrOffset += code.Jmp.CurLen * uintptrSize + oldBaseIndent := ctx.BaseIndent + indentDiffFromTop := c.Indent - 1 + ctx.BaseIndent += code.Indent - indentDiffFromTop + + newLen := offsetNum + code.Jmp.CurLen + code.Jmp.NextLen + if curlen < newLen { + ctx.Ptrs = append(ctx.Ptrs, make([]uintptr, newLen-curlen)...) + } + ctxptr = ctx.Ptr() + ptrOffset // assign new ctxptr + + store(ctxptr, c.Idx, ptr) + store(ctxptr, c.End.Next.Idx, oldOffset) + store(ctxptr, c.End.Next.ElemIdx, uintptr(unsafe.Pointer(code.Next))) + storeIndent(ctxptr, c.End.Next, uintptr(oldBaseIndent)) + code = c + recursiveLevel++ + case encoder.OpRecursiveEnd: + recursiveLevel-- + + // restore ctxptr + restoreIndent(ctx, code, ctxptr) + offset := load(ctxptr, code.Idx) + ctx.SeenPtr = ctx.SeenPtr[:len(ctx.SeenPtr)-1] + + codePtr := load(ctxptr, code.ElemIdx) + code = (*encoder.Opcode)(ptrToUnsafePtr(codePtr)) + ctxptr = ctx.Ptr() + offset + ptrOffset = offset + case encoder.OpStructPtrHead: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHead: + p := load(ctxptr, code.Idx) + if p == 0 && ((code.Flags&encoder.IndirectFlags) != 0 || code.Next.Op == encoder.OpStructEnd) { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if len(code.Key) > 0 { + if (code.Flags&encoder.IsTaggedKeyFlags) != 0 || code.Flags&encoder.AnonymousKeyFlags == 0 { + b = appendStructKey(ctx, code, b) + } + } + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmpty: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmpty: + p := load(ctxptr, code.Idx) + if p == 0 && ((code.Flags&encoder.IndirectFlags) != 0 || code.Next.Op == encoder.OpStructEnd) { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if p == 0 || (ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0) { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadInt: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadInt: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyInt: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyInt: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadIntString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadIntString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyIntString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + u64 := ptrToUint64(p, code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadUint: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadUint: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUint: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyUint: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadUintString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadUintString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyUintString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat32: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat32: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat32(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat32String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat32String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat32(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat64: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat64: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat64String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat64String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNull(ctx, b) + b = appendComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToString(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadStringString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadStringString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p+uintptr(code.Offset))))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyStringString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToString(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBool: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBool: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBool: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBool: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } else { + code = code.NextField + } + case encoder.OpStructPtrHeadBoolString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBoolString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } else { + code = code.NextField + } + case encoder.OpStructPtrHeadBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBytes: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBytes: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBytes: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBytes: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadNumber: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadNumber: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumber: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyNumber: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToNumber(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + } + case encoder.OpStructPtrHeadNumberString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadNumberString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToNumber(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructPtrHeadNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadArray, encoder.OpStructPtrHeadSlice: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadArray, encoder.OpStructHeadSlice: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptyArray: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyArray: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptySlice: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptySlice: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + slice := ptrToSlice(p) + if slice.Len == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadArrayPtr, encoder.OpStructPtrHeadSlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadArrayPtr, encoder.OpStructHeadSlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + } else { + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadOmitEmptyArrayPtr, encoder.OpStructPtrHeadOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyArrayPtr, encoder.OpStructHeadOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMap: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMap: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if p != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p + uintptr(code.Offset)) + } + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptyMap: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMap: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p + uintptr(code.Offset)) + } + if maplen(ptrToUnsafePtr(p)) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + break + } + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + } else { + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + break + } + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 { + code = code.NextField + } else { + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadMarshalJSON { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadOmitEmptyMarshalJSON { + p = ptrToPtr(p) + } + } + iface := ptrToInterface(code, p) + if (code.Flags&encoder.NilCheckFlags) != 0 && encoder.IsNilForMarshaler(iface) { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, iface) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadMarshalText { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadOmitEmptyMarshalText { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructField: + if code.Flags&encoder.IsTaggedKeyFlags != 0 || code.Flags&encoder.AnonymousKeyFlags == 0 { + b = appendStructKey(ctx, code, b) + } + p := load(ctxptr, code.Idx) + uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmpty: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldInt: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyInt: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUint: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUint: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32String: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringString: + p := load(ctxptr, code.Idx) + s := ptrToString(p + uintptr(code.Offset)) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, s))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBool: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBool: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBytes: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBytes: + p := load(ctxptr, code.Idx) + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) > 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldNumber: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumber: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldNumberString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldMarshalJSON: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + break + } + iface := ptrToInterface(code, p) + if (code.Flags&encoder.NilCheckFlags) != 0 && encoder.IsNilForMarshaler(iface) { + code = code.NextField + break + } + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, iface) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldMarshalJSONPtr: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldMarshalText: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + break + } + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldMarshalTextPtr: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldArray: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyArray: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldArrayPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyArrayPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldSlice: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptySlice: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + slice := ptrToSlice(p) + if slice.Len == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldSlicePtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldMap: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyMap: + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 || maplen(ptrToUnsafePtr(p)) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldMapPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldStruct: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyStruct: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructEnd: + b = appendStructEndSkipLast(ctx, code, b) + code = code.Next + case encoder.OpStructEndInt: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyInt: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUint: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUint: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32String: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32Ptr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32PtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64Ptr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + b = appendStructEnd(ctx, code, b) + code = code.Next + break + } + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64PtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + s := ptrToString(p + uintptr(code.Offset)) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, s))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBool: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBool: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBytes: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBytes: + p := load(ctxptr, code.Idx) + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) > 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBytesPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumber: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + code = code.Next + case encoder.OpStructEndOmitEmptyNumber: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpEnd: + goto END + } + } +END: + return b, nil +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_color/debug_vm.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_color/debug_vm.go new file mode 100644 index 000000000..925f61ed8 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_color/debug_vm.go @@ -0,0 +1,35 @@ +package vm_color + +import ( + "fmt" + + "github.com/goccy/go-json/internal/encoder" +) + +func DebugRun(ctx *encoder.RuntimeContext, b []byte, codeSet *encoder.OpcodeSet) ([]byte, error) { + var code *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + code = codeSet.EscapeKeyCode + } else { + code = codeSet.NoescapeKeyCode + } + + defer func() { + if err := recover(); err != nil { + w := ctx.Option.DebugOut + fmt.Fprintln(w, "=============[DEBUG]===============") + fmt.Fprintln(w, "* [TYPE]") + fmt.Fprintln(w, codeSet.Type) + fmt.Fprintf(w, "\n") + fmt.Fprintln(w, "* [ALL OPCODE]") + fmt.Fprintln(w, code.Dump()) + fmt.Fprintf(w, "\n") + fmt.Fprintln(w, "* [CONTEXT]") + fmt.Fprintf(w, "%+v\n", ctx) + fmt.Fprintln(w, "===================================") + panic(err) + } + }() + + return Run(ctx, b, codeSet) +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_color/hack.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_color/hack.go new file mode 100644 index 000000000..12ec56c5b --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_color/hack.go @@ -0,0 +1,9 @@ +package vm_color + +import ( + // HACK: compile order + // `vm`, `vm_indent`, `vm_color`, `vm_color_indent` packages uses a lot of memory to compile, + // so forcibly make dependencies and avoid compiling in concurrent. + // dependency order: vm => vm_indent => vm_color => vm_color_indent + _ "github.com/goccy/go-json/internal/encoder/vm_color_indent" +) diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_color/util.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_color/util.go new file mode 100644 index 000000000..33f29aee4 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_color/util.go @@ -0,0 +1,274 @@ +package vm_color + +import ( + "encoding/json" + "fmt" + "unsafe" + + "github.com/goccy/go-json/internal/encoder" + "github.com/goccy/go-json/internal/runtime" +) + +const uintptrSize = 4 << (^uintptr(0) >> 63) + +var ( + errUnsupportedValue = encoder.ErrUnsupportedValue + errUnsupportedFloat = encoder.ErrUnsupportedFloat + mapiterinit = encoder.MapIterInit + mapiterkey = encoder.MapIterKey + mapitervalue = encoder.MapIterValue + mapiternext = encoder.MapIterNext + maplen = encoder.MapLen +) + +type emptyInterface struct { + typ *runtime.Type + ptr unsafe.Pointer +} + +type nonEmptyInterface struct { + itab *struct { + ityp *runtime.Type // static interface type + typ *runtime.Type // dynamic concrete type + // unused fields... + } + ptr unsafe.Pointer +} + +func errUnimplementedOp(op encoder.OpType) error { + return fmt.Errorf("encoder: opcode %s has not been implemented", op) +} + +func load(base uintptr, idx uint32) uintptr { + addr := base + uintptr(idx) + return **(**uintptr)(unsafe.Pointer(&addr)) +} + +func store(base uintptr, idx uint32, p uintptr) { + addr := base + uintptr(idx) + **(**uintptr)(unsafe.Pointer(&addr)) = p +} + +func loadNPtr(base uintptr, idx uint32, ptrNum uint8) uintptr { + addr := base + uintptr(idx) + p := **(**uintptr)(unsafe.Pointer(&addr)) + for i := uint8(0); i < ptrNum; i++ { + if p == 0 { + return 0 + } + p = ptrToPtr(p) + } + return p +} + +func ptrToUint64(p uintptr, bitSize uint8) uint64 { + switch bitSize { + case 8: + return (uint64)(**(**uint8)(unsafe.Pointer(&p))) + case 16: + return (uint64)(**(**uint16)(unsafe.Pointer(&p))) + case 32: + return (uint64)(**(**uint32)(unsafe.Pointer(&p))) + case 64: + return **(**uint64)(unsafe.Pointer(&p)) + } + return 0 +} +func ptrToFloat32(p uintptr) float32 { return **(**float32)(unsafe.Pointer(&p)) } +func ptrToFloat64(p uintptr) float64 { return **(**float64)(unsafe.Pointer(&p)) } +func ptrToBool(p uintptr) bool { return **(**bool)(unsafe.Pointer(&p)) } +func ptrToBytes(p uintptr) []byte { return **(**[]byte)(unsafe.Pointer(&p)) } +func ptrToNumber(p uintptr) json.Number { return **(**json.Number)(unsafe.Pointer(&p)) } +func ptrToString(p uintptr) string { return **(**string)(unsafe.Pointer(&p)) } +func ptrToSlice(p uintptr) *runtime.SliceHeader { return *(**runtime.SliceHeader)(unsafe.Pointer(&p)) } +func ptrToPtr(p uintptr) uintptr { + return uintptr(**(**unsafe.Pointer)(unsafe.Pointer(&p))) +} +func ptrToNPtr(p uintptr, ptrNum uint8) uintptr { + for i := uint8(0); i < ptrNum; i++ { + if p == 0 { + return 0 + } + p = ptrToPtr(p) + } + return p +} + +func ptrToUnsafePtr(p uintptr) unsafe.Pointer { + return *(*unsafe.Pointer)(unsafe.Pointer(&p)) +} +func ptrToInterface(code *encoder.Opcode, p uintptr) interface{} { + return *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: code.Type, + ptr: *(*unsafe.Pointer)(unsafe.Pointer(&p)), + })) +} + +func appendInt(ctx *encoder.RuntimeContext, b []byte, p uintptr, code *encoder.Opcode) []byte { + format := ctx.Option.ColorScheme.Int + b = append(b, format.Header...) + b = encoder.AppendInt(ctx, b, p, code) + return append(b, format.Footer...) +} + +func appendUint(ctx *encoder.RuntimeContext, b []byte, p uintptr, code *encoder.Opcode) []byte { + format := ctx.Option.ColorScheme.Uint + b = append(b, format.Header...) + b = encoder.AppendUint(ctx, b, p, code) + return append(b, format.Footer...) +} + +func appendFloat32(ctx *encoder.RuntimeContext, b []byte, v float32) []byte { + format := ctx.Option.ColorScheme.Float + b = append(b, format.Header...) + b = encoder.AppendFloat32(ctx, b, v) + return append(b, format.Footer...) +} + +func appendFloat64(ctx *encoder.RuntimeContext, b []byte, v float64) []byte { + format := ctx.Option.ColorScheme.Float + b = append(b, format.Header...) + b = encoder.AppendFloat64(ctx, b, v) + return append(b, format.Footer...) +} + +func appendString(ctx *encoder.RuntimeContext, b []byte, v string) []byte { + format := ctx.Option.ColorScheme.String + b = append(b, format.Header...) + b = encoder.AppendString(ctx, b, v) + return append(b, format.Footer...) +} + +func appendByteSlice(ctx *encoder.RuntimeContext, b []byte, src []byte) []byte { + format := ctx.Option.ColorScheme.Binary + b = append(b, format.Header...) + b = encoder.AppendByteSlice(ctx, b, src) + return append(b, format.Footer...) +} + +func appendNumber(ctx *encoder.RuntimeContext, b []byte, n json.Number) ([]byte, error) { + format := ctx.Option.ColorScheme.Int + b = append(b, format.Header...) + bb, err := encoder.AppendNumber(ctx, b, n) + if err != nil { + return nil, err + } + return append(bb, format.Footer...), nil +} + +func appendBool(ctx *encoder.RuntimeContext, b []byte, v bool) []byte { + format := ctx.Option.ColorScheme.Bool + b = append(b, format.Header...) + if v { + b = append(b, "true"...) + } else { + b = append(b, "false"...) + } + return append(b, format.Footer...) +} + +func appendNull(ctx *encoder.RuntimeContext, b []byte) []byte { + format := ctx.Option.ColorScheme.Null + b = append(b, format.Header...) + b = append(b, "null"...) + return append(b, format.Footer...) +} + +func appendComma(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, ',') +} + +func appendNullComma(ctx *encoder.RuntimeContext, b []byte) []byte { + format := ctx.Option.ColorScheme.Null + b = append(b, format.Header...) + b = append(b, "null"...) + return append(append(b, format.Footer...), ',') +} + +func appendColon(_ *encoder.RuntimeContext, b []byte) []byte { + last := len(b) - 1 + b[last] = ':' + return b +} + +func appendMapKeyValue(_ *encoder.RuntimeContext, _ *encoder.Opcode, b, key, value []byte) []byte { + b = append(b, key[:len(key)-1]...) + b = append(b, ':') + return append(b, value...) +} + +func appendMapEnd(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + b[last] = '}' + b = append(b, ',') + return b +} + +func appendMarshalJSON(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte, v interface{}) ([]byte, error) { + return encoder.AppendMarshalJSON(ctx, code, b, v) +} + +func appendMarshalText(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte, v interface{}) ([]byte, error) { + format := ctx.Option.ColorScheme.String + b = append(b, format.Header...) + bb, err := encoder.AppendMarshalText(ctx, code, b, v) + if err != nil { + return nil, err + } + return append(bb, format.Footer...), nil +} + +func appendArrayHead(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { + return append(b, '[') +} + +func appendArrayEnd(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + b[last] = ']' + return append(b, ',') +} + +func appendEmptyArray(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '[', ']', ',') +} + +func appendEmptyObject(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '{', '}', ',') +} + +func appendObjectEnd(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + b[last] = '}' + return append(b, ',') +} + +func appendStructHead(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '{') +} + +func appendStructKey(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + format := ctx.Option.ColorScheme.ObjectKey + b = append(b, format.Header...) + b = append(b, code.Key[:len(code.Key)-1]...) + b = append(b, format.Footer...) + + return append(b, ':') +} + +func appendStructEnd(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { + return append(b, '}', ',') +} + +func appendStructEndSkipLast(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + if b[last] == ',' { + b[last] = '}' + return appendComma(ctx, b) + } + return appendStructEnd(ctx, code, b) +} + +func restoreIndent(_ *encoder.RuntimeContext, _ *encoder.Opcode, _ uintptr) {} +func storeIndent(_ uintptr, _ *encoder.Opcode, _ uintptr) {} +func appendMapKeyIndent(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { return b } +func appendArrayElemIndent(_ *encoder.RuntimeContext, _ *encoder.Opcode, b []byte) []byte { return b } diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_color/vm.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_color/vm.go new file mode 100644 index 000000000..a63e83e55 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_color/vm.go @@ -0,0 +1,4859 @@ +// Code generated by internal/cmd/generator. DO NOT EDIT! +package vm_color + +import ( + "math" + "reflect" + "sort" + "unsafe" + + "github.com/goccy/go-json/internal/encoder" + "github.com/goccy/go-json/internal/runtime" +) + +func Run(ctx *encoder.RuntimeContext, b []byte, codeSet *encoder.OpcodeSet) ([]byte, error) { + recursiveLevel := 0 + ptrOffset := uintptr(0) + ctxptr := ctx.Ptr() + var code *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + code = codeSet.EscapeKeyCode + } else { + code = codeSet.NoescapeKeyCode + } + + for { + switch code.Op { + default: + return nil, errUnimplementedOp(code.Op) + case encoder.OpPtr: + p := load(ctxptr, code.Idx) + code = code.Next + store(ctxptr, code.Idx, ptrToPtr(p)) + case encoder.OpIntPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpInt: + b = appendInt(ctx, b, load(ctxptr, code.Idx), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpUintPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpUint: + b = appendUint(ctx, b, load(ctxptr, code.Idx), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpIntString: + b = append(b, '"') + b = appendInt(ctx, b, load(ctxptr, code.Idx), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpUintString: + b = append(b, '"') + b = appendUint(ctx, b, load(ctxptr, code.Idx), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpFloat32Ptr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + b = appendComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpFloat32: + b = appendFloat32(ctx, b, ptrToFloat32(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpFloat64Ptr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpFloat64: + v := ptrToFloat64(load(ctxptr, code.Idx)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStringPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpString: + b = appendString(ctx, b, ptrToString(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpBoolPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpBool: + b = appendBool(ctx, b, ptrToBool(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpBytesPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpBytes: + b = appendByteSlice(ctx, b, ptrToBytes(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpNumberPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpNumber: + bb, err := appendNumber(ctx, b, ptrToNumber(load(ctxptr, code.Idx))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpInterfacePtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpInterface: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + if recursiveLevel > encoder.StartDetectingCyclesAfter { + for _, seen := range ctx.SeenPtr { + if p == seen { + return nil, errUnsupportedValue(code, p) + } + } + } + ctx.SeenPtr = append(ctx.SeenPtr, p) + var ( + typ *runtime.Type + ifacePtr unsafe.Pointer + ) + up := ptrToUnsafePtr(p) + if code.Flags&encoder.NonEmptyInterfaceFlags != 0 { + iface := (*nonEmptyInterface)(up) + ifacePtr = iface.ptr + if iface.itab != nil { + typ = iface.itab.typ + } + } else { + iface := (*emptyInterface)(up) + ifacePtr = iface.ptr + typ = iface.typ + } + if ifacePtr == nil { + isDirectedNil := typ != nil && typ.Kind() == reflect.Struct && !runtime.IfaceIndir(typ) + if !isDirectedNil { + b = appendNullComma(ctx, b) + code = code.Next + break + } + } + ctx.KeepRefs = append(ctx.KeepRefs, up) + ifaceCodeSet, err := encoder.CompileToGetCodeSet(ctx, uintptr(unsafe.Pointer(typ))) + if err != nil { + return nil, err + } + + totalLength := uintptr(code.Length) + 3 + nextTotalLength := uintptr(ifaceCodeSet.CodeLength) + 3 + + var c *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + c = ifaceCodeSet.InterfaceEscapeKeyCode + } else { + c = ifaceCodeSet.InterfaceNoescapeKeyCode + } + curlen := uintptr(len(ctx.Ptrs)) + offsetNum := ptrOffset / uintptrSize + oldOffset := ptrOffset + ptrOffset += totalLength * uintptrSize + oldBaseIndent := ctx.BaseIndent + ctx.BaseIndent += code.Indent + + newLen := offsetNum + totalLength + nextTotalLength + if curlen < newLen { + ctx.Ptrs = append(ctx.Ptrs, make([]uintptr, newLen-curlen)...) + } + ctxptr = ctx.Ptr() + ptrOffset // assign new ctxptr + + end := ifaceCodeSet.EndCode + store(ctxptr, c.Idx, uintptr(ifacePtr)) + store(ctxptr, end.Idx, oldOffset) + store(ctxptr, end.ElemIdx, uintptr(unsafe.Pointer(code.Next))) + storeIndent(ctxptr, end, uintptr(oldBaseIndent)) + code = c + recursiveLevel++ + case encoder.OpInterfaceEnd: + recursiveLevel-- + + // restore ctxptr + offset := load(ctxptr, code.Idx) + restoreIndent(ctx, code, ctxptr) + ctx.SeenPtr = ctx.SeenPtr[:len(ctx.SeenPtr)-1] + + codePtr := load(ctxptr, code.ElemIdx) + code = (*encoder.Opcode)(ptrToUnsafePtr(codePtr)) + ctxptr = ctx.Ptr() + offset + ptrOffset = offset + case encoder.OpMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToPtr(p)) + fallthrough + case encoder.OpMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + if (code.Flags&encoder.IsNilableTypeFlags) != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p) + } + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToPtr(p)) + fallthrough + case encoder.OpMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + b = append(b, `""`...) + b = appendComma(ctx, b) + code = code.Next + break + } + if (code.Flags&encoder.IsNilableTypeFlags) != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p) + } + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpSlicePtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpSlice: + p := load(ctxptr, code.Idx) + slice := ptrToSlice(p) + if p == 0 || slice.Data == nil { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.ElemIdx, 0) + store(ctxptr, code.Length, uintptr(slice.Len)) + store(ctxptr, code.Idx, uintptr(slice.Data)) + if slice.Len > 0 { + b = appendArrayHead(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, uintptr(slice.Data)) + } else { + b = appendEmptyArray(ctx, b) + code = code.End.Next + } + case encoder.OpSliceElem: + idx := load(ctxptr, code.ElemIdx) + length := load(ctxptr, code.Length) + idx++ + if idx < length { + b = appendArrayElemIndent(ctx, code, b) + store(ctxptr, code.ElemIdx, idx) + data := load(ctxptr, code.Idx) + size := uintptr(code.Size) + code = code.Next + store(ctxptr, code.Idx, data+idx*size) + } else { + b = appendArrayEnd(ctx, code, b) + code = code.End.Next + } + case encoder.OpArrayPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpArray: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + if code.Length > 0 { + b = appendArrayHead(ctx, code, b) + store(ctxptr, code.ElemIdx, 0) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + b = appendEmptyArray(ctx, b) + code = code.End.Next + } + case encoder.OpArrayElem: + idx := load(ctxptr, code.ElemIdx) + idx++ + if idx < uintptr(code.Length) { + b = appendArrayElemIndent(ctx, code, b) + store(ctxptr, code.ElemIdx, idx) + p := load(ctxptr, code.Idx) + size := uintptr(code.Size) + code = code.Next + store(ctxptr, code.Idx, p+idx*size) + } else { + b = appendArrayEnd(ctx, code, b) + code = code.End.Next + } + case encoder.OpMapPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpMap: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + uptr := ptrToUnsafePtr(p) + mlen := maplen(uptr) + if mlen <= 0 { + b = appendEmptyObject(ctx, b) + code = code.End.Next + break + } + b = appendStructHead(ctx, b) + unorderedMap := (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 + mapCtx := encoder.NewMapContext(mlen, unorderedMap) + mapiterinit(code.Type, uptr, &mapCtx.Iter) + store(ctxptr, code.Idx, uintptr(unsafe.Pointer(mapCtx))) + ctx.KeepRefs = append(ctx.KeepRefs, unsafe.Pointer(mapCtx)) + if unorderedMap { + b = appendMapKeyIndent(ctx, code.Next, b) + } else { + mapCtx.Start = len(b) + mapCtx.First = len(b) + } + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + case encoder.OpMapKey: + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + idx := mapCtx.Idx + idx++ + if (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 { + if idx < mapCtx.Len { + b = appendMapKeyIndent(ctx, code, b) + mapCtx.Idx = int(idx) + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + } else { + b = appendObjectEnd(ctx, code, b) + encoder.ReleaseMapContext(mapCtx) + code = code.End.Next + } + } else { + mapCtx.Slice.Items[mapCtx.Idx].Value = b[mapCtx.Start:len(b)] + if idx < mapCtx.Len { + mapCtx.Idx = int(idx) + mapCtx.Start = len(b) + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + } else { + code = code.End + } + } + case encoder.OpMapValue: + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + if (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 { + b = appendColon(ctx, b) + } else { + mapCtx.Slice.Items[mapCtx.Idx].Key = b[mapCtx.Start:len(b)] + mapCtx.Start = len(b) + } + value := mapitervalue(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(value)) + mapiternext(&mapCtx.Iter) + code = code.Next + case encoder.OpMapEnd: + // this operation only used by sorted map. + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + sort.Sort(mapCtx.Slice) + buf := mapCtx.Buf + for _, item := range mapCtx.Slice.Items { + buf = appendMapKeyValue(ctx, code, buf, item.Key, item.Value) + } + buf = appendMapEnd(ctx, code, buf) + b = b[:mapCtx.First] + b = append(b, buf...) + mapCtx.Buf = buf + encoder.ReleaseMapContext(mapCtx) + code = code.Next + case encoder.OpRecursivePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpRecursive: + ptr := load(ctxptr, code.Idx) + if ptr != 0 { + if recursiveLevel > encoder.StartDetectingCyclesAfter { + for _, seen := range ctx.SeenPtr { + if ptr == seen { + return nil, errUnsupportedValue(code, ptr) + } + } + } + } + ctx.SeenPtr = append(ctx.SeenPtr, ptr) + c := code.Jmp.Code + curlen := uintptr(len(ctx.Ptrs)) + offsetNum := ptrOffset / uintptrSize + oldOffset := ptrOffset + ptrOffset += code.Jmp.CurLen * uintptrSize + oldBaseIndent := ctx.BaseIndent + indentDiffFromTop := c.Indent - 1 + ctx.BaseIndent += code.Indent - indentDiffFromTop + + newLen := offsetNum + code.Jmp.CurLen + code.Jmp.NextLen + if curlen < newLen { + ctx.Ptrs = append(ctx.Ptrs, make([]uintptr, newLen-curlen)...) + } + ctxptr = ctx.Ptr() + ptrOffset // assign new ctxptr + + store(ctxptr, c.Idx, ptr) + store(ctxptr, c.End.Next.Idx, oldOffset) + store(ctxptr, c.End.Next.ElemIdx, uintptr(unsafe.Pointer(code.Next))) + storeIndent(ctxptr, c.End.Next, uintptr(oldBaseIndent)) + code = c + recursiveLevel++ + case encoder.OpRecursiveEnd: + recursiveLevel-- + + // restore ctxptr + restoreIndent(ctx, code, ctxptr) + offset := load(ctxptr, code.Idx) + ctx.SeenPtr = ctx.SeenPtr[:len(ctx.SeenPtr)-1] + + codePtr := load(ctxptr, code.ElemIdx) + code = (*encoder.Opcode)(ptrToUnsafePtr(codePtr)) + ctxptr = ctx.Ptr() + offset + ptrOffset = offset + case encoder.OpStructPtrHead: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHead: + p := load(ctxptr, code.Idx) + if p == 0 && ((code.Flags&encoder.IndirectFlags) != 0 || code.Next.Op == encoder.OpStructEnd) { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if len(code.Key) > 0 { + if (code.Flags&encoder.IsTaggedKeyFlags) != 0 || code.Flags&encoder.AnonymousKeyFlags == 0 { + b = appendStructKey(ctx, code, b) + } + } + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmpty: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmpty: + p := load(ctxptr, code.Idx) + if p == 0 && ((code.Flags&encoder.IndirectFlags) != 0 || code.Next.Op == encoder.OpStructEnd) { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if p == 0 || (ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0) { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadInt: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadInt: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyInt: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyInt: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadIntString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadIntString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyIntString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + u64 := ptrToUint64(p, code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadUint: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadUint: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUint: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyUint: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadUintString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadUintString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyUintString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat32: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat32: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat32(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat32String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat32String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat32(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat64: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat64: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat64String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat64String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNull(ctx, b) + b = appendComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToString(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadStringString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadStringString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p+uintptr(code.Offset))))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyStringString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToString(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBool: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBool: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBool: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBool: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } else { + code = code.NextField + } + case encoder.OpStructPtrHeadBoolString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBoolString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } else { + code = code.NextField + } + case encoder.OpStructPtrHeadBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBytes: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBytes: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBytes: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBytes: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadNumber: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadNumber: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumber: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyNumber: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToNumber(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + } + case encoder.OpStructPtrHeadNumberString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadNumberString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToNumber(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructPtrHeadNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadArray, encoder.OpStructPtrHeadSlice: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadArray, encoder.OpStructHeadSlice: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptyArray: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyArray: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptySlice: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptySlice: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + slice := ptrToSlice(p) + if slice.Len == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadArrayPtr, encoder.OpStructPtrHeadSlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadArrayPtr, encoder.OpStructHeadSlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + } else { + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadOmitEmptyArrayPtr, encoder.OpStructPtrHeadOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyArrayPtr, encoder.OpStructHeadOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMap: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMap: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if p != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p + uintptr(code.Offset)) + } + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptyMap: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMap: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p + uintptr(code.Offset)) + } + if maplen(ptrToUnsafePtr(p)) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + break + } + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + } else { + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + break + } + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 { + code = code.NextField + } else { + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadMarshalJSON { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadOmitEmptyMarshalJSON { + p = ptrToPtr(p) + } + } + iface := ptrToInterface(code, p) + if (code.Flags&encoder.NilCheckFlags) != 0 && encoder.IsNilForMarshaler(iface) { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, iface) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadMarshalText { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadOmitEmptyMarshalText { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructField: + if code.Flags&encoder.IsTaggedKeyFlags != 0 || code.Flags&encoder.AnonymousKeyFlags == 0 { + b = appendStructKey(ctx, code, b) + } + p := load(ctxptr, code.Idx) + uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmpty: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldInt: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyInt: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUint: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUint: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32String: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringString: + p := load(ctxptr, code.Idx) + s := ptrToString(p + uintptr(code.Offset)) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, s))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBool: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBool: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBytes: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBytes: + p := load(ctxptr, code.Idx) + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) > 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldNumber: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumber: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldNumberString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldMarshalJSON: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + break + } + iface := ptrToInterface(code, p) + if (code.Flags&encoder.NilCheckFlags) != 0 && encoder.IsNilForMarshaler(iface) { + code = code.NextField + break + } + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, iface) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldMarshalJSONPtr: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldMarshalText: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + break + } + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldMarshalTextPtr: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldArray: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyArray: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldArrayPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyArrayPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldSlice: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptySlice: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + slice := ptrToSlice(p) + if slice.Len == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldSlicePtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldMap: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyMap: + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 || maplen(ptrToUnsafePtr(p)) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldMapPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldStruct: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyStruct: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructEnd: + b = appendStructEndSkipLast(ctx, code, b) + code = code.Next + case encoder.OpStructEndInt: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyInt: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUint: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUint: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32String: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32Ptr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32PtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64Ptr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + b = appendStructEnd(ctx, code, b) + code = code.Next + break + } + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64PtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + s := ptrToString(p + uintptr(code.Offset)) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, s))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBool: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBool: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBytes: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBytes: + p := load(ctxptr, code.Idx) + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) > 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBytesPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumber: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + code = code.Next + case encoder.OpStructEndOmitEmptyNumber: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpEnd: + goto END + } + } +END: + return b, nil +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_color_indent/debug_vm.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_color_indent/debug_vm.go new file mode 100644 index 000000000..dd4cd489e --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_color_indent/debug_vm.go @@ -0,0 +1,35 @@ +package vm_color_indent + +import ( + "fmt" + + "github.com/goccy/go-json/internal/encoder" +) + +func DebugRun(ctx *encoder.RuntimeContext, b []byte, codeSet *encoder.OpcodeSet) ([]byte, error) { + var code *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + code = codeSet.EscapeKeyCode + } else { + code = codeSet.NoescapeKeyCode + } + + defer func() { + if err := recover(); err != nil { + w := ctx.Option.DebugOut + fmt.Fprintln(w, "=============[DEBUG]===============") + fmt.Fprintln(w, "* [TYPE]") + fmt.Fprintln(w, codeSet.Type) + fmt.Fprintf(w, "\n") + fmt.Fprintln(w, "* [ALL OPCODE]") + fmt.Fprintln(w, code.Dump()) + fmt.Fprintf(w, "\n") + fmt.Fprintln(w, "* [CONTEXT]") + fmt.Fprintf(w, "%+v\n", ctx) + fmt.Fprintln(w, "===================================") + panic(err) + } + }() + + return Run(ctx, b, codeSet) +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_color_indent/util.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_color_indent/util.go new file mode 100644 index 000000000..2395abec9 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_color_indent/util.go @@ -0,0 +1,297 @@ +package vm_color_indent + +import ( + "encoding/json" + "fmt" + "unsafe" + + "github.com/goccy/go-json/internal/encoder" + "github.com/goccy/go-json/internal/runtime" +) + +const uintptrSize = 4 << (^uintptr(0) >> 63) + +var ( + appendIndent = encoder.AppendIndent + appendStructEnd = encoder.AppendStructEndIndent + errUnsupportedValue = encoder.ErrUnsupportedValue + errUnsupportedFloat = encoder.ErrUnsupportedFloat + mapiterinit = encoder.MapIterInit + mapiterkey = encoder.MapIterKey + mapitervalue = encoder.MapIterValue + mapiternext = encoder.MapIterNext + maplen = encoder.MapLen +) + +type emptyInterface struct { + typ *runtime.Type + ptr unsafe.Pointer +} + +type nonEmptyInterface struct { + itab *struct { + ityp *runtime.Type // static interface type + typ *runtime.Type // dynamic concrete type + // unused fields... + } + ptr unsafe.Pointer +} + +func errUnimplementedOp(op encoder.OpType) error { + return fmt.Errorf("encoder (indent): opcode %s has not been implemented", op) +} + +func load(base uintptr, idx uint32) uintptr { + addr := base + uintptr(idx) + return **(**uintptr)(unsafe.Pointer(&addr)) +} + +func store(base uintptr, idx uint32, p uintptr) { + addr := base + uintptr(idx) + **(**uintptr)(unsafe.Pointer(&addr)) = p +} + +func loadNPtr(base uintptr, idx uint32, ptrNum uint8) uintptr { + addr := base + uintptr(idx) + p := **(**uintptr)(unsafe.Pointer(&addr)) + for i := uint8(0); i < ptrNum; i++ { + if p == 0 { + return 0 + } + p = ptrToPtr(p) + } + return p +} + +func ptrToUint64(p uintptr, bitSize uint8) uint64 { + switch bitSize { + case 8: + return (uint64)(**(**uint8)(unsafe.Pointer(&p))) + case 16: + return (uint64)(**(**uint16)(unsafe.Pointer(&p))) + case 32: + return (uint64)(**(**uint32)(unsafe.Pointer(&p))) + case 64: + return **(**uint64)(unsafe.Pointer(&p)) + } + return 0 +} + +func ptrToFloat32(p uintptr) float32 { return **(**float32)(unsafe.Pointer(&p)) } +func ptrToFloat64(p uintptr) float64 { return **(**float64)(unsafe.Pointer(&p)) } +func ptrToBool(p uintptr) bool { return **(**bool)(unsafe.Pointer(&p)) } +func ptrToBytes(p uintptr) []byte { return **(**[]byte)(unsafe.Pointer(&p)) } +func ptrToNumber(p uintptr) json.Number { return **(**json.Number)(unsafe.Pointer(&p)) } +func ptrToString(p uintptr) string { return **(**string)(unsafe.Pointer(&p)) } +func ptrToSlice(p uintptr) *runtime.SliceHeader { return *(**runtime.SliceHeader)(unsafe.Pointer(&p)) } +func ptrToPtr(p uintptr) uintptr { + return uintptr(**(**unsafe.Pointer)(unsafe.Pointer(&p))) +} +func ptrToNPtr(p uintptr, ptrNum uint8) uintptr { + for i := uint8(0); i < ptrNum; i++ { + if p == 0 { + return 0 + } + p = ptrToPtr(p) + } + return p +} + +func ptrToUnsafePtr(p uintptr) unsafe.Pointer { + return *(*unsafe.Pointer)(unsafe.Pointer(&p)) +} +func ptrToInterface(code *encoder.Opcode, p uintptr) interface{} { + return *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: code.Type, + ptr: *(*unsafe.Pointer)(unsafe.Pointer(&p)), + })) +} + +func appendInt(ctx *encoder.RuntimeContext, b []byte, p uintptr, code *encoder.Opcode) []byte { + format := ctx.Option.ColorScheme.Int + b = append(b, format.Header...) + b = encoder.AppendInt(ctx, b, p, code) + return append(b, format.Footer...) +} + +func appendUint(ctx *encoder.RuntimeContext, b []byte, p uintptr, code *encoder.Opcode) []byte { + format := ctx.Option.ColorScheme.Uint + b = append(b, format.Header...) + b = encoder.AppendUint(ctx, b, p, code) + return append(b, format.Footer...) +} + +func appendFloat32(ctx *encoder.RuntimeContext, b []byte, v float32) []byte { + format := ctx.Option.ColorScheme.Float + b = append(b, format.Header...) + b = encoder.AppendFloat32(ctx, b, v) + return append(b, format.Footer...) +} + +func appendFloat64(ctx *encoder.RuntimeContext, b []byte, v float64) []byte { + format := ctx.Option.ColorScheme.Float + b = append(b, format.Header...) + b = encoder.AppendFloat64(ctx, b, v) + return append(b, format.Footer...) +} + +func appendString(ctx *encoder.RuntimeContext, b []byte, v string) []byte { + format := ctx.Option.ColorScheme.String + b = append(b, format.Header...) + b = encoder.AppendString(ctx, b, v) + return append(b, format.Footer...) +} + +func appendByteSlice(ctx *encoder.RuntimeContext, b []byte, src []byte) []byte { + format := ctx.Option.ColorScheme.Binary + b = append(b, format.Header...) + b = encoder.AppendByteSlice(ctx, b, src) + return append(b, format.Footer...) +} + +func appendNumber(ctx *encoder.RuntimeContext, b []byte, n json.Number) ([]byte, error) { + format := ctx.Option.ColorScheme.Int + b = append(b, format.Header...) + bb, err := encoder.AppendNumber(ctx, b, n) + if err != nil { + return nil, err + } + return append(bb, format.Footer...), nil +} + +func appendBool(ctx *encoder.RuntimeContext, b []byte, v bool) []byte { + format := ctx.Option.ColorScheme.Bool + b = append(b, format.Header...) + if v { + b = append(b, "true"...) + } else { + b = append(b, "false"...) + } + return append(b, format.Footer...) +} + +func appendNull(ctx *encoder.RuntimeContext, b []byte) []byte { + format := ctx.Option.ColorScheme.Null + b = append(b, format.Header...) + b = append(b, "null"...) + return append(b, format.Footer...) +} + +func appendComma(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, ',', '\n') +} + +func appendNullComma(ctx *encoder.RuntimeContext, b []byte) []byte { + format := ctx.Option.ColorScheme.Null + b = append(b, format.Header...) + b = append(b, "null"...) + return append(append(b, format.Footer...), ',', '\n') +} + +func appendColon(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b[:len(b)-2], ':', ' ') +} + +func appendMapKeyValue(ctx *encoder.RuntimeContext, code *encoder.Opcode, b, key, value []byte) []byte { + b = appendIndent(ctx, b, code.Indent+1) + b = append(b, key...) + b[len(b)-2] = ':' + b[len(b)-1] = ' ' + return append(b, value...) +} + +func appendMapEnd(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + b = b[:len(b)-2] + b = append(b, '\n') + b = appendIndent(ctx, b, code.Indent) + return append(b, '}', ',', '\n') +} + +func appendArrayHead(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + b = append(b, '[', '\n') + return appendIndent(ctx, b, code.Indent+1) +} + +func appendArrayEnd(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + b = b[:len(b)-2] + b = append(b, '\n') + b = appendIndent(ctx, b, code.Indent) + return append(b, ']', ',', '\n') +} + +func appendEmptyArray(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '[', ']', ',', '\n') +} + +func appendEmptyObject(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '{', '}', ',', '\n') +} + +func appendObjectEnd(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + // replace comma to newline + b[last-1] = '\n' + b = appendIndent(ctx, b[:last], code.Indent) + return append(b, '}', ',', '\n') +} + +func appendMarshalJSON(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte, v interface{}) ([]byte, error) { + return encoder.AppendMarshalJSONIndent(ctx, code, b, v) +} + +func appendMarshalText(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte, v interface{}) ([]byte, error) { + format := ctx.Option.ColorScheme.String + b = append(b, format.Header...) + bb, err := encoder.AppendMarshalTextIndent(ctx, code, b, v) + if err != nil { + return nil, err + } + return append(bb, format.Footer...), nil +} + +func appendStructHead(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '{', '\n') +} + +func appendStructKey(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + b = appendIndent(ctx, b, code.Indent) + + format := ctx.Option.ColorScheme.ObjectKey + b = append(b, format.Header...) + b = append(b, code.Key[:len(code.Key)-1]...) + b = append(b, format.Footer...) + + return append(b, ':', ' ') +} + +func appendStructEndSkipLast(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + if b[last-1] == '{' { + b[last] = '}' + } else { + if b[last] == '\n' { + // to remove ',' and '\n' characters + b = b[:len(b)-2] + } + b = append(b, '\n') + b = appendIndent(ctx, b, code.Indent-1) + b = append(b, '}') + } + return appendComma(ctx, b) +} + +func restoreIndent(ctx *encoder.RuntimeContext, code *encoder.Opcode, ctxptr uintptr) { + ctx.BaseIndent = uint32(load(ctxptr, code.Length)) +} + +func storeIndent(ctxptr uintptr, code *encoder.Opcode, indent uintptr) { + store(ctxptr, code.Length, indent) +} + +func appendArrayElemIndent(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + return appendIndent(ctx, b, code.Indent+1) +} + +func appendMapKeyIndent(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + return appendIndent(ctx, b, code.Indent) +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_color_indent/vm.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_color_indent/vm.go new file mode 100644 index 000000000..3b4e22e5d --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_color_indent/vm.go @@ -0,0 +1,4859 @@ +// Code generated by internal/cmd/generator. DO NOT EDIT! +package vm_color_indent + +import ( + "math" + "reflect" + "sort" + "unsafe" + + "github.com/goccy/go-json/internal/encoder" + "github.com/goccy/go-json/internal/runtime" +) + +func Run(ctx *encoder.RuntimeContext, b []byte, codeSet *encoder.OpcodeSet) ([]byte, error) { + recursiveLevel := 0 + ptrOffset := uintptr(0) + ctxptr := ctx.Ptr() + var code *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + code = codeSet.EscapeKeyCode + } else { + code = codeSet.NoescapeKeyCode + } + + for { + switch code.Op { + default: + return nil, errUnimplementedOp(code.Op) + case encoder.OpPtr: + p := load(ctxptr, code.Idx) + code = code.Next + store(ctxptr, code.Idx, ptrToPtr(p)) + case encoder.OpIntPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpInt: + b = appendInt(ctx, b, load(ctxptr, code.Idx), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpUintPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpUint: + b = appendUint(ctx, b, load(ctxptr, code.Idx), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpIntString: + b = append(b, '"') + b = appendInt(ctx, b, load(ctxptr, code.Idx), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpUintString: + b = append(b, '"') + b = appendUint(ctx, b, load(ctxptr, code.Idx), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpFloat32Ptr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + b = appendComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpFloat32: + b = appendFloat32(ctx, b, ptrToFloat32(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpFloat64Ptr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpFloat64: + v := ptrToFloat64(load(ctxptr, code.Idx)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStringPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpString: + b = appendString(ctx, b, ptrToString(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpBoolPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpBool: + b = appendBool(ctx, b, ptrToBool(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpBytesPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpBytes: + b = appendByteSlice(ctx, b, ptrToBytes(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpNumberPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpNumber: + bb, err := appendNumber(ctx, b, ptrToNumber(load(ctxptr, code.Idx))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpInterfacePtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpInterface: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + if recursiveLevel > encoder.StartDetectingCyclesAfter { + for _, seen := range ctx.SeenPtr { + if p == seen { + return nil, errUnsupportedValue(code, p) + } + } + } + ctx.SeenPtr = append(ctx.SeenPtr, p) + var ( + typ *runtime.Type + ifacePtr unsafe.Pointer + ) + up := ptrToUnsafePtr(p) + if code.Flags&encoder.NonEmptyInterfaceFlags != 0 { + iface := (*nonEmptyInterface)(up) + ifacePtr = iface.ptr + if iface.itab != nil { + typ = iface.itab.typ + } + } else { + iface := (*emptyInterface)(up) + ifacePtr = iface.ptr + typ = iface.typ + } + if ifacePtr == nil { + isDirectedNil := typ != nil && typ.Kind() == reflect.Struct && !runtime.IfaceIndir(typ) + if !isDirectedNil { + b = appendNullComma(ctx, b) + code = code.Next + break + } + } + ctx.KeepRefs = append(ctx.KeepRefs, up) + ifaceCodeSet, err := encoder.CompileToGetCodeSet(ctx, uintptr(unsafe.Pointer(typ))) + if err != nil { + return nil, err + } + + totalLength := uintptr(code.Length) + 3 + nextTotalLength := uintptr(ifaceCodeSet.CodeLength) + 3 + + var c *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + c = ifaceCodeSet.InterfaceEscapeKeyCode + } else { + c = ifaceCodeSet.InterfaceNoescapeKeyCode + } + curlen := uintptr(len(ctx.Ptrs)) + offsetNum := ptrOffset / uintptrSize + oldOffset := ptrOffset + ptrOffset += totalLength * uintptrSize + oldBaseIndent := ctx.BaseIndent + ctx.BaseIndent += code.Indent + + newLen := offsetNum + totalLength + nextTotalLength + if curlen < newLen { + ctx.Ptrs = append(ctx.Ptrs, make([]uintptr, newLen-curlen)...) + } + ctxptr = ctx.Ptr() + ptrOffset // assign new ctxptr + + end := ifaceCodeSet.EndCode + store(ctxptr, c.Idx, uintptr(ifacePtr)) + store(ctxptr, end.Idx, oldOffset) + store(ctxptr, end.ElemIdx, uintptr(unsafe.Pointer(code.Next))) + storeIndent(ctxptr, end, uintptr(oldBaseIndent)) + code = c + recursiveLevel++ + case encoder.OpInterfaceEnd: + recursiveLevel-- + + // restore ctxptr + offset := load(ctxptr, code.Idx) + restoreIndent(ctx, code, ctxptr) + ctx.SeenPtr = ctx.SeenPtr[:len(ctx.SeenPtr)-1] + + codePtr := load(ctxptr, code.ElemIdx) + code = (*encoder.Opcode)(ptrToUnsafePtr(codePtr)) + ctxptr = ctx.Ptr() + offset + ptrOffset = offset + case encoder.OpMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToPtr(p)) + fallthrough + case encoder.OpMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + if (code.Flags&encoder.IsNilableTypeFlags) != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p) + } + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToPtr(p)) + fallthrough + case encoder.OpMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + b = append(b, `""`...) + b = appendComma(ctx, b) + code = code.Next + break + } + if (code.Flags&encoder.IsNilableTypeFlags) != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p) + } + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpSlicePtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpSlice: + p := load(ctxptr, code.Idx) + slice := ptrToSlice(p) + if p == 0 || slice.Data == nil { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.ElemIdx, 0) + store(ctxptr, code.Length, uintptr(slice.Len)) + store(ctxptr, code.Idx, uintptr(slice.Data)) + if slice.Len > 0 { + b = appendArrayHead(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, uintptr(slice.Data)) + } else { + b = appendEmptyArray(ctx, b) + code = code.End.Next + } + case encoder.OpSliceElem: + idx := load(ctxptr, code.ElemIdx) + length := load(ctxptr, code.Length) + idx++ + if idx < length { + b = appendArrayElemIndent(ctx, code, b) + store(ctxptr, code.ElemIdx, idx) + data := load(ctxptr, code.Idx) + size := uintptr(code.Size) + code = code.Next + store(ctxptr, code.Idx, data+idx*size) + } else { + b = appendArrayEnd(ctx, code, b) + code = code.End.Next + } + case encoder.OpArrayPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpArray: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + if code.Length > 0 { + b = appendArrayHead(ctx, code, b) + store(ctxptr, code.ElemIdx, 0) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + b = appendEmptyArray(ctx, b) + code = code.End.Next + } + case encoder.OpArrayElem: + idx := load(ctxptr, code.ElemIdx) + idx++ + if idx < uintptr(code.Length) { + b = appendArrayElemIndent(ctx, code, b) + store(ctxptr, code.ElemIdx, idx) + p := load(ctxptr, code.Idx) + size := uintptr(code.Size) + code = code.Next + store(ctxptr, code.Idx, p+idx*size) + } else { + b = appendArrayEnd(ctx, code, b) + code = code.End.Next + } + case encoder.OpMapPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpMap: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + uptr := ptrToUnsafePtr(p) + mlen := maplen(uptr) + if mlen <= 0 { + b = appendEmptyObject(ctx, b) + code = code.End.Next + break + } + b = appendStructHead(ctx, b) + unorderedMap := (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 + mapCtx := encoder.NewMapContext(mlen, unorderedMap) + mapiterinit(code.Type, uptr, &mapCtx.Iter) + store(ctxptr, code.Idx, uintptr(unsafe.Pointer(mapCtx))) + ctx.KeepRefs = append(ctx.KeepRefs, unsafe.Pointer(mapCtx)) + if unorderedMap { + b = appendMapKeyIndent(ctx, code.Next, b) + } else { + mapCtx.Start = len(b) + mapCtx.First = len(b) + } + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + case encoder.OpMapKey: + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + idx := mapCtx.Idx + idx++ + if (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 { + if idx < mapCtx.Len { + b = appendMapKeyIndent(ctx, code, b) + mapCtx.Idx = int(idx) + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + } else { + b = appendObjectEnd(ctx, code, b) + encoder.ReleaseMapContext(mapCtx) + code = code.End.Next + } + } else { + mapCtx.Slice.Items[mapCtx.Idx].Value = b[mapCtx.Start:len(b)] + if idx < mapCtx.Len { + mapCtx.Idx = int(idx) + mapCtx.Start = len(b) + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + } else { + code = code.End + } + } + case encoder.OpMapValue: + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + if (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 { + b = appendColon(ctx, b) + } else { + mapCtx.Slice.Items[mapCtx.Idx].Key = b[mapCtx.Start:len(b)] + mapCtx.Start = len(b) + } + value := mapitervalue(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(value)) + mapiternext(&mapCtx.Iter) + code = code.Next + case encoder.OpMapEnd: + // this operation only used by sorted map. + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + sort.Sort(mapCtx.Slice) + buf := mapCtx.Buf + for _, item := range mapCtx.Slice.Items { + buf = appendMapKeyValue(ctx, code, buf, item.Key, item.Value) + } + buf = appendMapEnd(ctx, code, buf) + b = b[:mapCtx.First] + b = append(b, buf...) + mapCtx.Buf = buf + encoder.ReleaseMapContext(mapCtx) + code = code.Next + case encoder.OpRecursivePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpRecursive: + ptr := load(ctxptr, code.Idx) + if ptr != 0 { + if recursiveLevel > encoder.StartDetectingCyclesAfter { + for _, seen := range ctx.SeenPtr { + if ptr == seen { + return nil, errUnsupportedValue(code, ptr) + } + } + } + } + ctx.SeenPtr = append(ctx.SeenPtr, ptr) + c := code.Jmp.Code + curlen := uintptr(len(ctx.Ptrs)) + offsetNum := ptrOffset / uintptrSize + oldOffset := ptrOffset + ptrOffset += code.Jmp.CurLen * uintptrSize + oldBaseIndent := ctx.BaseIndent + indentDiffFromTop := c.Indent - 1 + ctx.BaseIndent += code.Indent - indentDiffFromTop + + newLen := offsetNum + code.Jmp.CurLen + code.Jmp.NextLen + if curlen < newLen { + ctx.Ptrs = append(ctx.Ptrs, make([]uintptr, newLen-curlen)...) + } + ctxptr = ctx.Ptr() + ptrOffset // assign new ctxptr + + store(ctxptr, c.Idx, ptr) + store(ctxptr, c.End.Next.Idx, oldOffset) + store(ctxptr, c.End.Next.ElemIdx, uintptr(unsafe.Pointer(code.Next))) + storeIndent(ctxptr, c.End.Next, uintptr(oldBaseIndent)) + code = c + recursiveLevel++ + case encoder.OpRecursiveEnd: + recursiveLevel-- + + // restore ctxptr + restoreIndent(ctx, code, ctxptr) + offset := load(ctxptr, code.Idx) + ctx.SeenPtr = ctx.SeenPtr[:len(ctx.SeenPtr)-1] + + codePtr := load(ctxptr, code.ElemIdx) + code = (*encoder.Opcode)(ptrToUnsafePtr(codePtr)) + ctxptr = ctx.Ptr() + offset + ptrOffset = offset + case encoder.OpStructPtrHead: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHead: + p := load(ctxptr, code.Idx) + if p == 0 && ((code.Flags&encoder.IndirectFlags) != 0 || code.Next.Op == encoder.OpStructEnd) { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if len(code.Key) > 0 { + if (code.Flags&encoder.IsTaggedKeyFlags) != 0 || code.Flags&encoder.AnonymousKeyFlags == 0 { + b = appendStructKey(ctx, code, b) + } + } + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmpty: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmpty: + p := load(ctxptr, code.Idx) + if p == 0 && ((code.Flags&encoder.IndirectFlags) != 0 || code.Next.Op == encoder.OpStructEnd) { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if p == 0 || (ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0) { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadInt: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadInt: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyInt: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyInt: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadIntString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadIntString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyIntString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + u64 := ptrToUint64(p, code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadUint: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadUint: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUint: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyUint: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadUintString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadUintString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyUintString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat32: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat32: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat32(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat32String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat32String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat32(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat64: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat64: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat64String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat64String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNull(ctx, b) + b = appendComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToString(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadStringString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadStringString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p+uintptr(code.Offset))))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyStringString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToString(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBool: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBool: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBool: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBool: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } else { + code = code.NextField + } + case encoder.OpStructPtrHeadBoolString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBoolString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } else { + code = code.NextField + } + case encoder.OpStructPtrHeadBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBytes: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBytes: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBytes: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBytes: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadNumber: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadNumber: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumber: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyNumber: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToNumber(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + } + case encoder.OpStructPtrHeadNumberString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadNumberString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToNumber(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructPtrHeadNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadArray, encoder.OpStructPtrHeadSlice: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadArray, encoder.OpStructHeadSlice: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptyArray: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyArray: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptySlice: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptySlice: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + slice := ptrToSlice(p) + if slice.Len == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadArrayPtr, encoder.OpStructPtrHeadSlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadArrayPtr, encoder.OpStructHeadSlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + } else { + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadOmitEmptyArrayPtr, encoder.OpStructPtrHeadOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyArrayPtr, encoder.OpStructHeadOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMap: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMap: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if p != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p + uintptr(code.Offset)) + } + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptyMap: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMap: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p + uintptr(code.Offset)) + } + if maplen(ptrToUnsafePtr(p)) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + break + } + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + } else { + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + break + } + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 { + code = code.NextField + } else { + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadMarshalJSON { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadOmitEmptyMarshalJSON { + p = ptrToPtr(p) + } + } + iface := ptrToInterface(code, p) + if (code.Flags&encoder.NilCheckFlags) != 0 && encoder.IsNilForMarshaler(iface) { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, iface) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadMarshalText { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadOmitEmptyMarshalText { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructField: + if code.Flags&encoder.IsTaggedKeyFlags != 0 || code.Flags&encoder.AnonymousKeyFlags == 0 { + b = appendStructKey(ctx, code, b) + } + p := load(ctxptr, code.Idx) + uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmpty: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldInt: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyInt: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUint: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUint: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32String: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringString: + p := load(ctxptr, code.Idx) + s := ptrToString(p + uintptr(code.Offset)) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, s))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBool: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBool: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBytes: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBytes: + p := load(ctxptr, code.Idx) + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) > 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldNumber: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumber: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldNumberString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldMarshalJSON: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + break + } + iface := ptrToInterface(code, p) + if (code.Flags&encoder.NilCheckFlags) != 0 && encoder.IsNilForMarshaler(iface) { + code = code.NextField + break + } + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, iface) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldMarshalJSONPtr: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldMarshalText: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + break + } + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldMarshalTextPtr: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldArray: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyArray: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldArrayPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyArrayPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldSlice: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptySlice: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + slice := ptrToSlice(p) + if slice.Len == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldSlicePtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldMap: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyMap: + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 || maplen(ptrToUnsafePtr(p)) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldMapPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldStruct: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyStruct: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructEnd: + b = appendStructEndSkipLast(ctx, code, b) + code = code.Next + case encoder.OpStructEndInt: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyInt: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUint: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUint: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32String: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32Ptr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32PtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64Ptr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + b = appendStructEnd(ctx, code, b) + code = code.Next + break + } + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64PtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + s := ptrToString(p + uintptr(code.Offset)) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, s))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBool: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBool: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBytes: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBytes: + p := load(ctxptr, code.Idx) + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) > 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBytesPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumber: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + code = code.Next + case encoder.OpStructEndOmitEmptyNumber: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpEnd: + goto END + } + } +END: + return b, nil +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/debug_vm.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/debug_vm.go new file mode 100644 index 000000000..99395388c --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/debug_vm.go @@ -0,0 +1,35 @@ +package vm_indent + +import ( + "fmt" + + "github.com/goccy/go-json/internal/encoder" +) + +func DebugRun(ctx *encoder.RuntimeContext, b []byte, codeSet *encoder.OpcodeSet) ([]byte, error) { + var code *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + code = codeSet.EscapeKeyCode + } else { + code = codeSet.NoescapeKeyCode + } + + defer func() { + if err := recover(); err != nil { + w := ctx.Option.DebugOut + fmt.Fprintln(w, "=============[DEBUG]===============") + fmt.Fprintln(w, "* [TYPE]") + fmt.Fprintln(w, codeSet.Type) + fmt.Fprintf(w, "\n") + fmt.Fprintln(w, "* [ALL OPCODE]") + fmt.Fprintln(w, code.Dump()) + fmt.Fprintf(w, "\n") + fmt.Fprintln(w, "* [CONTEXT]") + fmt.Fprintf(w, "%+v\n", ctx) + fmt.Fprintln(w, "===================================") + panic(err) + } + }() + + return Run(ctx, b, codeSet) +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/hack.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/hack.go new file mode 100644 index 000000000..9e245bfe5 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/hack.go @@ -0,0 +1,9 @@ +package vm_indent + +import ( + // HACK: compile order + // `vm`, `vm_indent`, `vm_color`, `vm_color_indent` packages uses a lot of memory to compile, + // so forcibly make dependencies and avoid compiling in concurrent. + // dependency order: vm => vm_indent => vm_color => vm_color_indent + _ "github.com/goccy/go-json/internal/encoder/vm_color" +) diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/util.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/util.go new file mode 100644 index 000000000..6cb745e39 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/util.go @@ -0,0 +1,230 @@ +package vm_indent + +import ( + "encoding/json" + "fmt" + "unsafe" + + "github.com/goccy/go-json/internal/encoder" + "github.com/goccy/go-json/internal/runtime" +) + +const uintptrSize = 4 << (^uintptr(0) >> 63) + +var ( + appendInt = encoder.AppendInt + appendUint = encoder.AppendUint + appendFloat32 = encoder.AppendFloat32 + appendFloat64 = encoder.AppendFloat64 + appendString = encoder.AppendString + appendByteSlice = encoder.AppendByteSlice + appendNumber = encoder.AppendNumber + appendStructEnd = encoder.AppendStructEndIndent + appendIndent = encoder.AppendIndent + errUnsupportedValue = encoder.ErrUnsupportedValue + errUnsupportedFloat = encoder.ErrUnsupportedFloat + mapiterinit = encoder.MapIterInit + mapiterkey = encoder.MapIterKey + mapitervalue = encoder.MapIterValue + mapiternext = encoder.MapIterNext + maplen = encoder.MapLen +) + +type emptyInterface struct { + typ *runtime.Type + ptr unsafe.Pointer +} + +type nonEmptyInterface struct { + itab *struct { + ityp *runtime.Type // static interface type + typ *runtime.Type // dynamic concrete type + // unused fields... + } + ptr unsafe.Pointer +} + +func errUnimplementedOp(op encoder.OpType) error { + return fmt.Errorf("encoder (indent): opcode %s has not been implemented", op) +} + +func load(base uintptr, idx uint32) uintptr { + addr := base + uintptr(idx) + return **(**uintptr)(unsafe.Pointer(&addr)) +} + +func store(base uintptr, idx uint32, p uintptr) { + addr := base + uintptr(idx) + **(**uintptr)(unsafe.Pointer(&addr)) = p +} + +func loadNPtr(base uintptr, idx uint32, ptrNum uint8) uintptr { + addr := base + uintptr(idx) + p := **(**uintptr)(unsafe.Pointer(&addr)) + for i := uint8(0); i < ptrNum; i++ { + if p == 0 { + return 0 + } + p = ptrToPtr(p) + } + return p +} + +func ptrToUint64(p uintptr, bitSize uint8) uint64 { + switch bitSize { + case 8: + return (uint64)(**(**uint8)(unsafe.Pointer(&p))) + case 16: + return (uint64)(**(**uint16)(unsafe.Pointer(&p))) + case 32: + return (uint64)(**(**uint32)(unsafe.Pointer(&p))) + case 64: + return **(**uint64)(unsafe.Pointer(&p)) + } + return 0 +} +func ptrToFloat32(p uintptr) float32 { return **(**float32)(unsafe.Pointer(&p)) } +func ptrToFloat64(p uintptr) float64 { return **(**float64)(unsafe.Pointer(&p)) } +func ptrToBool(p uintptr) bool { return **(**bool)(unsafe.Pointer(&p)) } +func ptrToBytes(p uintptr) []byte { return **(**[]byte)(unsafe.Pointer(&p)) } +func ptrToNumber(p uintptr) json.Number { return **(**json.Number)(unsafe.Pointer(&p)) } +func ptrToString(p uintptr) string { return **(**string)(unsafe.Pointer(&p)) } +func ptrToSlice(p uintptr) *runtime.SliceHeader { return *(**runtime.SliceHeader)(unsafe.Pointer(&p)) } +func ptrToPtr(p uintptr) uintptr { + return uintptr(**(**unsafe.Pointer)(unsafe.Pointer(&p))) +} +func ptrToNPtr(p uintptr, ptrNum uint8) uintptr { + for i := uint8(0); i < ptrNum; i++ { + if p == 0 { + return 0 + } + p = ptrToPtr(p) + } + return p +} + +func ptrToUnsafePtr(p uintptr) unsafe.Pointer { + return *(*unsafe.Pointer)(unsafe.Pointer(&p)) +} +func ptrToInterface(code *encoder.Opcode, p uintptr) interface{} { + return *(*interface{})(unsafe.Pointer(&emptyInterface{ + typ: code.Type, + ptr: *(*unsafe.Pointer)(unsafe.Pointer(&p)), + })) +} + +func appendBool(_ *encoder.RuntimeContext, b []byte, v bool) []byte { + if v { + return append(b, "true"...) + } + return append(b, "false"...) +} + +func appendNull(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, "null"...) +} + +func appendComma(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, ',', '\n') +} + +func appendNullComma(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, "null,\n"...) +} + +func appendColon(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b[:len(b)-2], ':', ' ') +} + +func appendMapKeyValue(ctx *encoder.RuntimeContext, code *encoder.Opcode, b, key, value []byte) []byte { + b = appendIndent(ctx, b, code.Indent+1) + b = append(b, key...) + b[len(b)-2] = ':' + b[len(b)-1] = ' ' + return append(b, value...) +} + +func appendMapEnd(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + b = b[:len(b)-2] + b = append(b, '\n') + b = appendIndent(ctx, b, code.Indent) + return append(b, '}', ',', '\n') +} + +func appendArrayHead(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + b = append(b, '[', '\n') + return appendIndent(ctx, b, code.Indent+1) +} + +func appendArrayEnd(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + b = b[:len(b)-2] + b = append(b, '\n') + b = appendIndent(ctx, b, code.Indent) + return append(b, ']', ',', '\n') +} + +func appendEmptyArray(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '[', ']', ',', '\n') +} + +func appendEmptyObject(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '{', '}', ',', '\n') +} + +func appendObjectEnd(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + // replace comma to newline + b[last-1] = '\n' + b = appendIndent(ctx, b[:last], code.Indent) + return append(b, '}', ',', '\n') +} + +func appendMarshalJSON(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte, v interface{}) ([]byte, error) { + return encoder.AppendMarshalJSONIndent(ctx, code, b, v) +} + +func appendMarshalText(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte, v interface{}) ([]byte, error) { + return encoder.AppendMarshalTextIndent(ctx, code, b, v) +} + +func appendStructHead(_ *encoder.RuntimeContext, b []byte) []byte { + return append(b, '{', '\n') +} + +func appendStructKey(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + b = appendIndent(ctx, b, code.Indent) + b = append(b, code.Key...) + return append(b, ' ') +} + +func appendStructEndSkipLast(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + last := len(b) - 1 + if b[last-1] == '{' { + b[last] = '}' + } else { + if b[last] == '\n' { + // to remove ',' and '\n' characters + b = b[:len(b)-2] + } + b = append(b, '\n') + b = appendIndent(ctx, b, code.Indent-1) + b = append(b, '}') + } + return appendComma(ctx, b) +} + +func restoreIndent(ctx *encoder.RuntimeContext, code *encoder.Opcode, ctxptr uintptr) { + ctx.BaseIndent = uint32(load(ctxptr, code.Length)) +} + +func storeIndent(ctxptr uintptr, code *encoder.Opcode, indent uintptr) { + store(ctxptr, code.Length, indent) +} + +func appendArrayElemIndent(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + return appendIndent(ctx, b, code.Indent+1) +} + +func appendMapKeyIndent(ctx *encoder.RuntimeContext, code *encoder.Opcode, b []byte) []byte { + return appendIndent(ctx, b, code.Indent) +} diff --git a/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/vm.go b/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/vm.go new file mode 100644 index 000000000..836c5c8a8 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/encoder/vm_indent/vm.go @@ -0,0 +1,4859 @@ +// Code generated by internal/cmd/generator. DO NOT EDIT! +package vm_indent + +import ( + "math" + "reflect" + "sort" + "unsafe" + + "github.com/goccy/go-json/internal/encoder" + "github.com/goccy/go-json/internal/runtime" +) + +func Run(ctx *encoder.RuntimeContext, b []byte, codeSet *encoder.OpcodeSet) ([]byte, error) { + recursiveLevel := 0 + ptrOffset := uintptr(0) + ctxptr := ctx.Ptr() + var code *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + code = codeSet.EscapeKeyCode + } else { + code = codeSet.NoescapeKeyCode + } + + for { + switch code.Op { + default: + return nil, errUnimplementedOp(code.Op) + case encoder.OpPtr: + p := load(ctxptr, code.Idx) + code = code.Next + store(ctxptr, code.Idx, ptrToPtr(p)) + case encoder.OpIntPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpInt: + b = appendInt(ctx, b, load(ctxptr, code.Idx), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpUintPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpUint: + b = appendUint(ctx, b, load(ctxptr, code.Idx), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpIntString: + b = append(b, '"') + b = appendInt(ctx, b, load(ctxptr, code.Idx), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpUintString: + b = append(b, '"') + b = appendUint(ctx, b, load(ctxptr, code.Idx), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpFloat32Ptr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + b = appendComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpFloat32: + b = appendFloat32(ctx, b, ptrToFloat32(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpFloat64Ptr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpFloat64: + v := ptrToFloat64(load(ctxptr, code.Idx)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStringPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpString: + b = appendString(ctx, b, ptrToString(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpBoolPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpBool: + b = appendBool(ctx, b, ptrToBool(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpBytesPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpBytes: + b = appendByteSlice(ctx, b, ptrToBytes(load(ctxptr, code.Idx))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpNumberPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpNumber: + bb, err := appendNumber(ctx, b, ptrToNumber(load(ctxptr, code.Idx))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpInterfacePtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpInterface: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + if recursiveLevel > encoder.StartDetectingCyclesAfter { + for _, seen := range ctx.SeenPtr { + if p == seen { + return nil, errUnsupportedValue(code, p) + } + } + } + ctx.SeenPtr = append(ctx.SeenPtr, p) + var ( + typ *runtime.Type + ifacePtr unsafe.Pointer + ) + up := ptrToUnsafePtr(p) + if code.Flags&encoder.NonEmptyInterfaceFlags != 0 { + iface := (*nonEmptyInterface)(up) + ifacePtr = iface.ptr + if iface.itab != nil { + typ = iface.itab.typ + } + } else { + iface := (*emptyInterface)(up) + ifacePtr = iface.ptr + typ = iface.typ + } + if ifacePtr == nil { + isDirectedNil := typ != nil && typ.Kind() == reflect.Struct && !runtime.IfaceIndir(typ) + if !isDirectedNil { + b = appendNullComma(ctx, b) + code = code.Next + break + } + } + ctx.KeepRefs = append(ctx.KeepRefs, up) + ifaceCodeSet, err := encoder.CompileToGetCodeSet(ctx, uintptr(unsafe.Pointer(typ))) + if err != nil { + return nil, err + } + + totalLength := uintptr(code.Length) + 3 + nextTotalLength := uintptr(ifaceCodeSet.CodeLength) + 3 + + var c *encoder.Opcode + if (ctx.Option.Flag & encoder.HTMLEscapeOption) != 0 { + c = ifaceCodeSet.InterfaceEscapeKeyCode + } else { + c = ifaceCodeSet.InterfaceNoescapeKeyCode + } + curlen := uintptr(len(ctx.Ptrs)) + offsetNum := ptrOffset / uintptrSize + oldOffset := ptrOffset + ptrOffset += totalLength * uintptrSize + oldBaseIndent := ctx.BaseIndent + ctx.BaseIndent += code.Indent + + newLen := offsetNum + totalLength + nextTotalLength + if curlen < newLen { + ctx.Ptrs = append(ctx.Ptrs, make([]uintptr, newLen-curlen)...) + } + ctxptr = ctx.Ptr() + ptrOffset // assign new ctxptr + + end := ifaceCodeSet.EndCode + store(ctxptr, c.Idx, uintptr(ifacePtr)) + store(ctxptr, end.Idx, oldOffset) + store(ctxptr, end.ElemIdx, uintptr(unsafe.Pointer(code.Next))) + storeIndent(ctxptr, end, uintptr(oldBaseIndent)) + code = c + recursiveLevel++ + case encoder.OpInterfaceEnd: + recursiveLevel-- + + // restore ctxptr + offset := load(ctxptr, code.Idx) + restoreIndent(ctx, code, ctxptr) + ctx.SeenPtr = ctx.SeenPtr[:len(ctx.SeenPtr)-1] + + codePtr := load(ctxptr, code.ElemIdx) + code = (*encoder.Opcode)(ptrToUnsafePtr(codePtr)) + ctxptr = ctx.Ptr() + offset + ptrOffset = offset + case encoder.OpMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToPtr(p)) + fallthrough + case encoder.OpMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + if (code.Flags&encoder.IsNilableTypeFlags) != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p) + } + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToPtr(p)) + fallthrough + case encoder.OpMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + b = append(b, `""`...) + b = appendComma(ctx, b) + code = code.Next + break + } + if (code.Flags&encoder.IsNilableTypeFlags) != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p) + } + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpSlicePtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpSlice: + p := load(ctxptr, code.Idx) + slice := ptrToSlice(p) + if p == 0 || slice.Data == nil { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.ElemIdx, 0) + store(ctxptr, code.Length, uintptr(slice.Len)) + store(ctxptr, code.Idx, uintptr(slice.Data)) + if slice.Len > 0 { + b = appendArrayHead(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, uintptr(slice.Data)) + } else { + b = appendEmptyArray(ctx, b) + code = code.End.Next + } + case encoder.OpSliceElem: + idx := load(ctxptr, code.ElemIdx) + length := load(ctxptr, code.Length) + idx++ + if idx < length { + b = appendArrayElemIndent(ctx, code, b) + store(ctxptr, code.ElemIdx, idx) + data := load(ctxptr, code.Idx) + size := uintptr(code.Size) + code = code.Next + store(ctxptr, code.Idx, data+idx*size) + } else { + b = appendArrayEnd(ctx, code, b) + code = code.End.Next + } + case encoder.OpArrayPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpArray: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + if code.Length > 0 { + b = appendArrayHead(ctx, code, b) + store(ctxptr, code.ElemIdx, 0) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + b = appendEmptyArray(ctx, b) + code = code.End.Next + } + case encoder.OpArrayElem: + idx := load(ctxptr, code.ElemIdx) + idx++ + if idx < uintptr(code.Length) { + b = appendArrayElemIndent(ctx, code, b) + store(ctxptr, code.ElemIdx, idx) + p := load(ctxptr, code.Idx) + size := uintptr(code.Size) + code = code.Next + store(ctxptr, code.Idx, p+idx*size) + } else { + b = appendArrayEnd(ctx, code, b) + code = code.End.Next + } + case encoder.OpMapPtr: + p := loadNPtr(ctxptr, code.Idx, code.PtrNum) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + store(ctxptr, code.Idx, p) + fallthrough + case encoder.OpMap: + p := load(ctxptr, code.Idx) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.End.Next + break + } + uptr := ptrToUnsafePtr(p) + mlen := maplen(uptr) + if mlen <= 0 { + b = appendEmptyObject(ctx, b) + code = code.End.Next + break + } + b = appendStructHead(ctx, b) + unorderedMap := (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 + mapCtx := encoder.NewMapContext(mlen, unorderedMap) + mapiterinit(code.Type, uptr, &mapCtx.Iter) + store(ctxptr, code.Idx, uintptr(unsafe.Pointer(mapCtx))) + ctx.KeepRefs = append(ctx.KeepRefs, unsafe.Pointer(mapCtx)) + if unorderedMap { + b = appendMapKeyIndent(ctx, code.Next, b) + } else { + mapCtx.Start = len(b) + mapCtx.First = len(b) + } + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + case encoder.OpMapKey: + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + idx := mapCtx.Idx + idx++ + if (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 { + if idx < mapCtx.Len { + b = appendMapKeyIndent(ctx, code, b) + mapCtx.Idx = int(idx) + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + } else { + b = appendObjectEnd(ctx, code, b) + encoder.ReleaseMapContext(mapCtx) + code = code.End.Next + } + } else { + mapCtx.Slice.Items[mapCtx.Idx].Value = b[mapCtx.Start:len(b)] + if idx < mapCtx.Len { + mapCtx.Idx = int(idx) + mapCtx.Start = len(b) + key := mapiterkey(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(key)) + code = code.Next + } else { + code = code.End + } + } + case encoder.OpMapValue: + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + if (ctx.Option.Flag & encoder.UnorderedMapOption) != 0 { + b = appendColon(ctx, b) + } else { + mapCtx.Slice.Items[mapCtx.Idx].Key = b[mapCtx.Start:len(b)] + mapCtx.Start = len(b) + } + value := mapitervalue(&mapCtx.Iter) + store(ctxptr, code.Next.Idx, uintptr(value)) + mapiternext(&mapCtx.Iter) + code = code.Next + case encoder.OpMapEnd: + // this operation only used by sorted map. + mapCtx := (*encoder.MapContext)(ptrToUnsafePtr(load(ctxptr, code.Idx))) + sort.Sort(mapCtx.Slice) + buf := mapCtx.Buf + for _, item := range mapCtx.Slice.Items { + buf = appendMapKeyValue(ctx, code, buf, item.Key, item.Value) + } + buf = appendMapEnd(ctx, code, buf) + b = b[:mapCtx.First] + b = append(b, buf...) + mapCtx.Buf = buf + encoder.ReleaseMapContext(mapCtx) + code = code.Next + case encoder.OpRecursivePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + code = code.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpRecursive: + ptr := load(ctxptr, code.Idx) + if ptr != 0 { + if recursiveLevel > encoder.StartDetectingCyclesAfter { + for _, seen := range ctx.SeenPtr { + if ptr == seen { + return nil, errUnsupportedValue(code, ptr) + } + } + } + } + ctx.SeenPtr = append(ctx.SeenPtr, ptr) + c := code.Jmp.Code + curlen := uintptr(len(ctx.Ptrs)) + offsetNum := ptrOffset / uintptrSize + oldOffset := ptrOffset + ptrOffset += code.Jmp.CurLen * uintptrSize + oldBaseIndent := ctx.BaseIndent + indentDiffFromTop := c.Indent - 1 + ctx.BaseIndent += code.Indent - indentDiffFromTop + + newLen := offsetNum + code.Jmp.CurLen + code.Jmp.NextLen + if curlen < newLen { + ctx.Ptrs = append(ctx.Ptrs, make([]uintptr, newLen-curlen)...) + } + ctxptr = ctx.Ptr() + ptrOffset // assign new ctxptr + + store(ctxptr, c.Idx, ptr) + store(ctxptr, c.End.Next.Idx, oldOffset) + store(ctxptr, c.End.Next.ElemIdx, uintptr(unsafe.Pointer(code.Next))) + storeIndent(ctxptr, c.End.Next, uintptr(oldBaseIndent)) + code = c + recursiveLevel++ + case encoder.OpRecursiveEnd: + recursiveLevel-- + + // restore ctxptr + restoreIndent(ctx, code, ctxptr) + offset := load(ctxptr, code.Idx) + ctx.SeenPtr = ctx.SeenPtr[:len(ctx.SeenPtr)-1] + + codePtr := load(ctxptr, code.ElemIdx) + code = (*encoder.Opcode)(ptrToUnsafePtr(codePtr)) + ctxptr = ctx.Ptr() + offset + ptrOffset = offset + case encoder.OpStructPtrHead: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHead: + p := load(ctxptr, code.Idx) + if p == 0 && ((code.Flags&encoder.IndirectFlags) != 0 || code.Next.Op == encoder.OpStructEnd) { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if len(code.Key) > 0 { + if (code.Flags&encoder.IsTaggedKeyFlags) != 0 || code.Flags&encoder.AnonymousKeyFlags == 0 { + b = appendStructKey(ctx, code, b) + } + } + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmpty: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmpty: + p := load(ctxptr, code.Idx) + if p == 0 && ((code.Flags&encoder.IndirectFlags) != 0 || code.Next.Op == encoder.OpStructEnd) { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if p == 0 || (ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0) { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadInt: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadInt: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyInt: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyInt: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadIntString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadIntString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyIntString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + u64 := ptrToUint64(p, code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadUint: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadUint: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUint: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyUint: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadUintString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadUintString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyUintString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat32: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat32: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat32(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat32String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat32String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat32(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat64: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat64: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat64String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadFloat64String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64String: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToFloat64(p + uintptr(code.Offset)) + if v == 0 { + code = code.NextField + } else { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNull(ctx, b) + b = appendComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToString(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadStringString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadStringString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p+uintptr(code.Offset))))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyStringString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToString(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBool: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBool: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBool: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBool: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } else { + code = code.NextField + } + case encoder.OpStructPtrHeadBoolString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBoolString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + } else { + code = code.NextField + } + case encoder.OpStructPtrHeadBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadBytes: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadBytes: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBytes: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyBytes: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadNumber: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadNumber: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumber: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyNumber: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToNumber(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + } + case encoder.OpStructPtrHeadNumberString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadNumberString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberString: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + v := ptrToNumber(p + uintptr(code.Offset)) + if v == "" { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructPtrHeadNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructPtrHeadArray, encoder.OpStructPtrHeadSlice: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadArray, encoder.OpStructHeadSlice: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptyArray: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyArray: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptySlice: + if (code.Flags & encoder.IndirectFlags) != 0 { + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptySlice: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + slice := ptrToSlice(p) + if slice.Len == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadArrayPtr, encoder.OpStructPtrHeadSlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadArrayPtr, encoder.OpStructHeadSlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + } else { + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadOmitEmptyArrayPtr, encoder.OpStructPtrHeadOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyArrayPtr, encoder.OpStructHeadOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMap: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMap: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if p != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p + uintptr(code.Offset)) + } + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructPtrHeadOmitEmptyMap: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMap: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p != 0 && (code.Flags&encoder.IndirectFlags) != 0 { + p = ptrToPtr(p + uintptr(code.Offset)) + } + if maplen(ptrToUnsafePtr(p)) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + break + } + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.NextField + } else { + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + break + } + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 { + code = code.NextField + } else { + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructPtrHeadMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadMarshalJSON { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadOmitEmptyMarshalJSON { + p = ptrToPtr(p) + } + } + iface := ptrToInterface(code, p) + if (code.Flags&encoder.NilCheckFlags) != 0 && encoder.IsNilForMarshaler(iface) { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, iface) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadMarshalText { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + } + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + if (code.Flags&encoder.IndirectFlags) != 0 || code.Op == encoder.OpStructPtrHeadOmitEmptyMarshalText { + p = ptrToPtr(p) + } + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructPtrHeadMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + b = appendStructKey(ctx, code, b) + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructPtrHeadOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + store(ctxptr, code.Idx, ptrToNPtr(p, code.PtrNum)) + fallthrough + case encoder.OpStructHeadOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + if p == 0 && (code.Flags&encoder.IndirectFlags) != 0 { + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendNullComma(ctx, b) + } + code = code.End.Next + break + } + if (code.Flags & encoder.IndirectFlags) != 0 { + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + } + if code.Flags&encoder.AnonymousHeadFlags == 0 { + b = appendStructHead(ctx, b) + } + if p == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + b = appendComma(ctx, b) + code = code.Next + } + case encoder.OpStructField: + if code.Flags&encoder.IsTaggedKeyFlags != 0 || code.Flags&encoder.AnonymousKeyFlags == 0 { + b = appendStructKey(ctx, code, b) + } + p := load(ctxptr, code.Idx) + uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmpty: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldInt: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyInt: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUint: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUint: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32String: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNullComma(ctx, b) + code = code.Next + break + } + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringString: + p := load(ctxptr, code.Idx) + s := ptrToString(p + uintptr(code.Offset)) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, s))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBool: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBool: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBytes: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBytes: + p := load(ctxptr, code.Idx) + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) > 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldNumber: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumber: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldNumberString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + b = appendStructKey(ctx, code, b) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendComma(ctx, b) + } + code = code.Next + case encoder.OpStructFieldMarshalJSON: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalJSON: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + break + } + iface := ptrToInterface(code, p) + if (code.Flags&encoder.NilCheckFlags) != 0 && encoder.IsNilForMarshaler(iface) { + code = code.NextField + break + } + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, iface) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldMarshalJSONPtr: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalJSONPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalJSON(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldMarshalText: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalText: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if (code.Flags & encoder.IsNilableTypeFlags) != 0 { + p = ptrToPtr(p) + } + if p == 0 && (code.Flags&encoder.NilCheckFlags) != 0 { + code = code.NextField + break + } + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + code = code.Next + case encoder.OpStructFieldMarshalTextPtr: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendComma(ctx, b) + code = code.Next + case encoder.OpStructFieldOmitEmptyMarshalTextPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendMarshalText(ctx, code, b, ptrToInterface(code, p)) + if err != nil { + return nil, err + } + b = appendComma(ctx, bb) + } + code = code.Next + case encoder.OpStructFieldArray: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyArray: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldArrayPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyArrayPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldSlice: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptySlice: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + slice := ptrToSlice(p) + if slice.Len == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldSlicePtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptySlicePtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldMap: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyMap: + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p == 0 || maplen(ptrToUnsafePtr(p)) == 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructFieldMapPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyMapPtr: + p := load(ctxptr, code.Idx) + p = ptrToPtr(p + uintptr(code.Offset)) + if p != 0 { + p = ptrToNPtr(p, code.PtrNum) + } + if p != 0 { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } else { + code = code.NextField + } + case encoder.OpStructFieldStruct: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + code = code.Next + store(ctxptr, code.Idx, p) + case encoder.OpStructFieldOmitEmptyStruct: + p := load(ctxptr, code.Idx) + p += uintptr(code.Offset) + if ptrToPtr(p) == 0 && (code.Flags&encoder.IsNextOpPtrTypeFlags) != 0 { + code = code.NextField + } else { + b = appendStructKey(ctx, code, b) + code = code.Next + store(ctxptr, code.Idx, p) + } + case encoder.OpStructEnd: + b = appendStructEndSkipLast(ctx, code, b) + code = code.Next + case encoder.OpStructEndInt: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyInt: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendInt(ctx, b, p, code) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendInt(ctx, b, p, code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndIntPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyIntPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendInt(ctx, b, p, code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUint: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUint: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintString: + p := load(ctxptr, code.Idx) + u64 := ptrToUint64(p+uintptr(code.Offset), code.NumBitSize) + v := u64 & ((1 << code.NumBitSize) - 1) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p+uintptr(code.Offset), code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendUint(ctx, b, p, code) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendUint(ctx, b, p, code) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndUintPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyUintPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendUint(ctx, b, p, code) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32String: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32String: + p := load(ctxptr, code.Idx) + v := ptrToFloat32(p + uintptr(code.Offset)) + if v != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32Ptr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendFloat32(ctx, b, ptrToFloat32(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat32PtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat32PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat32(ctx, b, ptrToFloat32(p)) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64String: + p := load(ctxptr, code.Idx) + v := ptrToFloat64(p + uintptr(code.Offset)) + if v != 0 { + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64Ptr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + b = appendStructEnd(ctx, code, b) + code = code.Next + break + } + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64Ptr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndFloat64PtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = appendFloat64(ctx, b, v) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyFloat64PtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + v := ptrToFloat64(p) + if math.IsInf(v, 0) || math.IsNaN(v) { + return nil, errUnsupportedFloat(v) + } + b = append(b, '"') + b = appendFloat64(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + s := ptrToString(p + uintptr(code.Offset)) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, s))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringString: + p := load(ctxptr, code.Idx) + v := ptrToString(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, v))) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, ptrToString(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, ptrToString(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndStringPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyStringPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendString(ctx, b, string(appendString(ctx, []byte{}, ptrToString(p)))) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBool: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBool: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p+uintptr(code.Offset))) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolString: + p := load(ctxptr, code.Idx) + v := ptrToBool(p + uintptr(code.Offset)) + if v { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, v) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendBool(ctx, b, ptrToBool(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendBool(ctx, b, ptrToBool(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBoolPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBoolPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + b = appendBool(ctx, b, ptrToBool(p)) + b = append(b, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBytes: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p+uintptr(code.Offset))) + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBytes: + p := load(ctxptr, code.Idx) + v := ptrToBytes(p + uintptr(code.Offset)) + if len(v) > 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, v) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndBytesPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = appendByteSlice(ctx, b, ptrToBytes(p)) + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyBytesPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = appendByteSlice(ctx, b, ptrToBytes(p)) + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumber: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + code = code.Next + case encoder.OpStructEndOmitEmptyNumber: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberString: + p := load(ctxptr, code.Idx) + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p+uintptr(code.Offset))) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberString: + p := load(ctxptr, code.Idx) + v := ptrToNumber(p + uintptr(code.Offset)) + if v != "" { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, v) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberPtr: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = bb + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberPtr: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = appendStructEnd(ctx, code, bb) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpStructEndNumberPtrString: + b = appendStructKey(ctx, code, b) + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p == 0 { + b = appendNull(ctx, b) + } else { + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + } + b = appendStructEnd(ctx, code, b) + code = code.Next + case encoder.OpStructEndOmitEmptyNumberPtrString: + p := load(ctxptr, code.Idx) + p = ptrToNPtr(p+uintptr(code.Offset), code.PtrNum) + if p != 0 { + b = appendStructKey(ctx, code, b) + b = append(b, '"') + bb, err := appendNumber(ctx, b, ptrToNumber(p)) + if err != nil { + return nil, err + } + b = append(bb, '"') + b = appendStructEnd(ctx, code, b) + } else { + b = appendStructEndSkipLast(ctx, code, b) + } + code = code.Next + case encoder.OpEnd: + goto END + } + } +END: + return b, nil +} diff --git a/vendor/github.com/goccy/go-json/internal/errors/error.go b/vendor/github.com/goccy/go-json/internal/errors/error.go new file mode 100644 index 000000000..9207d0ff2 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/errors/error.go @@ -0,0 +1,183 @@ +package errors + +import ( + "fmt" + "reflect" + "strconv" +) + +type InvalidUTF8Error struct { + S string // the whole string value that caused the error +} + +func (e *InvalidUTF8Error) Error() string { + return fmt.Sprintf("json: invalid UTF-8 in string: %s", strconv.Quote(e.S)) +} + +type InvalidUnmarshalError struct { + Type reflect.Type +} + +func (e *InvalidUnmarshalError) Error() string { + if e.Type == nil { + return "json: Unmarshal(nil)" + } + + if e.Type.Kind() != reflect.Ptr { + return fmt.Sprintf("json: Unmarshal(non-pointer %s)", e.Type) + } + return fmt.Sprintf("json: Unmarshal(nil %s)", e.Type) +} + +// A MarshalerError represents an error from calling a MarshalJSON or MarshalText method. +type MarshalerError struct { + Type reflect.Type + Err error + sourceFunc string +} + +func (e *MarshalerError) Error() string { + srcFunc := e.sourceFunc + if srcFunc == "" { + srcFunc = "MarshalJSON" + } + return fmt.Sprintf("json: error calling %s for type %s: %s", srcFunc, e.Type, e.Err.Error()) +} + +// Unwrap returns the underlying error. +func (e *MarshalerError) Unwrap() error { return e.Err } + +// A SyntaxError is a description of a JSON syntax error. +type SyntaxError struct { + msg string // description of error + Offset int64 // error occurred after reading Offset bytes +} + +func (e *SyntaxError) Error() string { return e.msg } + +// An UnmarshalFieldError describes a JSON object key that +// led to an unexported (and therefore unwritable) struct field. +// +// Deprecated: No longer used; kept for compatibility. +type UnmarshalFieldError struct { + Key string + Type reflect.Type + Field reflect.StructField +} + +func (e *UnmarshalFieldError) Error() string { + return fmt.Sprintf("json: cannot unmarshal object key %s into unexported field %s of type %s", + strconv.Quote(e.Key), e.Field.Name, e.Type.String(), + ) +} + +// An UnmarshalTypeError describes a JSON value that was +// not appropriate for a value of a specific Go type. +type UnmarshalTypeError struct { + Value string // description of JSON value - "bool", "array", "number -5" + Type reflect.Type // type of Go value it could not be assigned to + Offset int64 // error occurred after reading Offset bytes + Struct string // name of the struct type containing the field + Field string // the full path from root node to the field +} + +func (e *UnmarshalTypeError) Error() string { + if e.Struct != "" || e.Field != "" { + return fmt.Sprintf("json: cannot unmarshal %s into Go struct field %s.%s of type %s", + e.Value, e.Struct, e.Field, e.Type, + ) + } + return fmt.Sprintf("json: cannot unmarshal %s into Go value of type %s", e.Value, e.Type) +} + +// An UnsupportedTypeError is returned by Marshal when attempting +// to encode an unsupported value type. +type UnsupportedTypeError struct { + Type reflect.Type +} + +func (e *UnsupportedTypeError) Error() string { + return fmt.Sprintf("json: unsupported type: %s", e.Type) +} + +type UnsupportedValueError struct { + Value reflect.Value + Str string +} + +func (e *UnsupportedValueError) Error() string { + return fmt.Sprintf("json: unsupported value: %s", e.Str) +} + +func ErrSyntax(msg string, offset int64) *SyntaxError { + return &SyntaxError{msg: msg, Offset: offset} +} + +func ErrMarshaler(typ reflect.Type, err error, msg string) *MarshalerError { + return &MarshalerError{ + Type: typ, + Err: err, + sourceFunc: msg, + } +} + +func ErrExceededMaxDepth(c byte, cursor int64) *SyntaxError { + return &SyntaxError{ + msg: fmt.Sprintf(`invalid character "%c" exceeded max depth`, c), + Offset: cursor, + } +} + +func ErrNotAtBeginningOfValue(cursor int64) *SyntaxError { + return &SyntaxError{msg: "not at beginning of value", Offset: cursor} +} + +func ErrUnexpectedEndOfJSON(msg string, cursor int64) *SyntaxError { + return &SyntaxError{ + msg: fmt.Sprintf("json: %s unexpected end of JSON input", msg), + Offset: cursor, + } +} + +func ErrExpected(msg string, cursor int64) *SyntaxError { + return &SyntaxError{msg: fmt.Sprintf("expected %s", msg), Offset: cursor} +} + +func ErrInvalidCharacter(c byte, context string, cursor int64) *SyntaxError { + if c == 0 { + return &SyntaxError{ + msg: fmt.Sprintf("json: invalid character as %s", context), + Offset: cursor, + } + } + return &SyntaxError{ + msg: fmt.Sprintf("json: invalid character %c as %s", c, context), + Offset: cursor, + } +} + +func ErrInvalidBeginningOfValue(c byte, cursor int64) *SyntaxError { + return &SyntaxError{ + msg: fmt.Sprintf("invalid character '%c' looking for beginning of value", c), + Offset: cursor, + } +} + +type PathError struct { + msg string +} + +func (e *PathError) Error() string { + return fmt.Sprintf("json: invalid path format: %s", e.msg) +} + +func ErrInvalidPath(msg string, args ...interface{}) *PathError { + if len(args) != 0 { + return &PathError{msg: fmt.Sprintf(msg, args...)} + } + return &PathError{msg: msg} +} + +func ErrEmptyPath() *PathError { + return &PathError{msg: "path is empty"} +} diff --git a/vendor/github.com/goccy/go-json/internal/runtime/rtype.go b/vendor/github.com/goccy/go-json/internal/runtime/rtype.go new file mode 100644 index 000000000..4db10debe --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/runtime/rtype.go @@ -0,0 +1,263 @@ +package runtime + +import ( + "reflect" + "unsafe" +) + +// Type representing reflect.rtype for noescape trick +type Type struct{} + +//go:linkname rtype_Align reflect.(*rtype).Align +//go:noescape +func rtype_Align(*Type) int + +func (t *Type) Align() int { + return rtype_Align(t) +} + +//go:linkname rtype_FieldAlign reflect.(*rtype).FieldAlign +//go:noescape +func rtype_FieldAlign(*Type) int + +func (t *Type) FieldAlign() int { + return rtype_FieldAlign(t) +} + +//go:linkname rtype_Method reflect.(*rtype).Method +//go:noescape +func rtype_Method(*Type, int) reflect.Method + +func (t *Type) Method(a0 int) reflect.Method { + return rtype_Method(t, a0) +} + +//go:linkname rtype_MethodByName reflect.(*rtype).MethodByName +//go:noescape +func rtype_MethodByName(*Type, string) (reflect.Method, bool) + +func (t *Type) MethodByName(a0 string) (reflect.Method, bool) { + return rtype_MethodByName(t, a0) +} + +//go:linkname rtype_NumMethod reflect.(*rtype).NumMethod +//go:noescape +func rtype_NumMethod(*Type) int + +func (t *Type) NumMethod() int { + return rtype_NumMethod(t) +} + +//go:linkname rtype_Name reflect.(*rtype).Name +//go:noescape +func rtype_Name(*Type) string + +func (t *Type) Name() string { + return rtype_Name(t) +} + +//go:linkname rtype_PkgPath reflect.(*rtype).PkgPath +//go:noescape +func rtype_PkgPath(*Type) string + +func (t *Type) PkgPath() string { + return rtype_PkgPath(t) +} + +//go:linkname rtype_Size reflect.(*rtype).Size +//go:noescape +func rtype_Size(*Type) uintptr + +func (t *Type) Size() uintptr { + return rtype_Size(t) +} + +//go:linkname rtype_String reflect.(*rtype).String +//go:noescape +func rtype_String(*Type) string + +func (t *Type) String() string { + return rtype_String(t) +} + +//go:linkname rtype_Kind reflect.(*rtype).Kind +//go:noescape +func rtype_Kind(*Type) reflect.Kind + +func (t *Type) Kind() reflect.Kind { + return rtype_Kind(t) +} + +//go:linkname rtype_Implements reflect.(*rtype).Implements +//go:noescape +func rtype_Implements(*Type, reflect.Type) bool + +func (t *Type) Implements(u reflect.Type) bool { + return rtype_Implements(t, u) +} + +//go:linkname rtype_AssignableTo reflect.(*rtype).AssignableTo +//go:noescape +func rtype_AssignableTo(*Type, reflect.Type) bool + +func (t *Type) AssignableTo(u reflect.Type) bool { + return rtype_AssignableTo(t, u) +} + +//go:linkname rtype_ConvertibleTo reflect.(*rtype).ConvertibleTo +//go:noescape +func rtype_ConvertibleTo(*Type, reflect.Type) bool + +func (t *Type) ConvertibleTo(u reflect.Type) bool { + return rtype_ConvertibleTo(t, u) +} + +//go:linkname rtype_Comparable reflect.(*rtype).Comparable +//go:noescape +func rtype_Comparable(*Type) bool + +func (t *Type) Comparable() bool { + return rtype_Comparable(t) +} + +//go:linkname rtype_Bits reflect.(*rtype).Bits +//go:noescape +func rtype_Bits(*Type) int + +func (t *Type) Bits() int { + return rtype_Bits(t) +} + +//go:linkname rtype_ChanDir reflect.(*rtype).ChanDir +//go:noescape +func rtype_ChanDir(*Type) reflect.ChanDir + +func (t *Type) ChanDir() reflect.ChanDir { + return rtype_ChanDir(t) +} + +//go:linkname rtype_IsVariadic reflect.(*rtype).IsVariadic +//go:noescape +func rtype_IsVariadic(*Type) bool + +func (t *Type) IsVariadic() bool { + return rtype_IsVariadic(t) +} + +//go:linkname rtype_Elem reflect.(*rtype).Elem +//go:noescape +func rtype_Elem(*Type) reflect.Type + +func (t *Type) Elem() *Type { + return Type2RType(rtype_Elem(t)) +} + +//go:linkname rtype_Field reflect.(*rtype).Field +//go:noescape +func rtype_Field(*Type, int) reflect.StructField + +func (t *Type) Field(i int) reflect.StructField { + return rtype_Field(t, i) +} + +//go:linkname rtype_FieldByIndex reflect.(*rtype).FieldByIndex +//go:noescape +func rtype_FieldByIndex(*Type, []int) reflect.StructField + +func (t *Type) FieldByIndex(index []int) reflect.StructField { + return rtype_FieldByIndex(t, index) +} + +//go:linkname rtype_FieldByName reflect.(*rtype).FieldByName +//go:noescape +func rtype_FieldByName(*Type, string) (reflect.StructField, bool) + +func (t *Type) FieldByName(name string) (reflect.StructField, bool) { + return rtype_FieldByName(t, name) +} + +//go:linkname rtype_FieldByNameFunc reflect.(*rtype).FieldByNameFunc +//go:noescape +func rtype_FieldByNameFunc(*Type, func(string) bool) (reflect.StructField, bool) + +func (t *Type) FieldByNameFunc(match func(string) bool) (reflect.StructField, bool) { + return rtype_FieldByNameFunc(t, match) +} + +//go:linkname rtype_In reflect.(*rtype).In +//go:noescape +func rtype_In(*Type, int) reflect.Type + +func (t *Type) In(i int) reflect.Type { + return rtype_In(t, i) +} + +//go:linkname rtype_Key reflect.(*rtype).Key +//go:noescape +func rtype_Key(*Type) reflect.Type + +func (t *Type) Key() *Type { + return Type2RType(rtype_Key(t)) +} + +//go:linkname rtype_Len reflect.(*rtype).Len +//go:noescape +func rtype_Len(*Type) int + +func (t *Type) Len() int { + return rtype_Len(t) +} + +//go:linkname rtype_NumField reflect.(*rtype).NumField +//go:noescape +func rtype_NumField(*Type) int + +func (t *Type) NumField() int { + return rtype_NumField(t) +} + +//go:linkname rtype_NumIn reflect.(*rtype).NumIn +//go:noescape +func rtype_NumIn(*Type) int + +func (t *Type) NumIn() int { + return rtype_NumIn(t) +} + +//go:linkname rtype_NumOut reflect.(*rtype).NumOut +//go:noescape +func rtype_NumOut(*Type) int + +func (t *Type) NumOut() int { + return rtype_NumOut(t) +} + +//go:linkname rtype_Out reflect.(*rtype).Out +//go:noescape +func rtype_Out(*Type, int) reflect.Type + +//go:linkname PtrTo reflect.(*rtype).ptrTo +//go:noescape +func PtrTo(*Type) *Type + +func (t *Type) Out(i int) reflect.Type { + return rtype_Out(t, i) +} + +//go:linkname IfaceIndir reflect.ifaceIndir +//go:noescape +func IfaceIndir(*Type) bool + +//go:linkname RType2Type reflect.toType +//go:noescape +func RType2Type(t *Type) reflect.Type + +//go:nolint structcheck +type emptyInterface struct { + _ *Type + ptr unsafe.Pointer +} + +func Type2RType(t reflect.Type) *Type { + return (*Type)(((*emptyInterface)(unsafe.Pointer(&t))).ptr) +} diff --git a/vendor/github.com/goccy/go-json/internal/runtime/struct_field.go b/vendor/github.com/goccy/go-json/internal/runtime/struct_field.go new file mode 100644 index 000000000..baab0c597 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/runtime/struct_field.go @@ -0,0 +1,91 @@ +package runtime + +import ( + "reflect" + "strings" + "unicode" +) + +func getTag(field reflect.StructField) string { + return field.Tag.Get("json") +} + +func IsIgnoredStructField(field reflect.StructField) bool { + if field.PkgPath != "" { + if field.Anonymous { + t := field.Type + if t.Kind() == reflect.Ptr { + t = t.Elem() + } + if t.Kind() != reflect.Struct { + return true + } + } else { + // private field + return true + } + } + tag := getTag(field) + return tag == "-" +} + +type StructTag struct { + Key string + IsTaggedKey bool + IsOmitEmpty bool + IsString bool + Field reflect.StructField +} + +type StructTags []*StructTag + +func (t StructTags) ExistsKey(key string) bool { + for _, tt := range t { + if tt.Key == key { + return true + } + } + return false +} + +func isValidTag(s string) bool { + if s == "" { + return false + } + for _, c := range s { + switch { + case strings.ContainsRune("!#$%&()*+-./:<=>?@[]^_{|}~ ", c): + // Backslash and quote chars are reserved, but + // otherwise any punctuation chars are allowed + // in a tag name. + case !unicode.IsLetter(c) && !unicode.IsDigit(c): + return false + } + } + return true +} + +func StructTagFromField(field reflect.StructField) *StructTag { + keyName := field.Name + tag := getTag(field) + st := &StructTag{Field: field} + opts := strings.Split(tag, ",") + if len(opts) > 0 { + if opts[0] != "" && isValidTag(opts[0]) { + keyName = opts[0] + st.IsTaggedKey = true + } + } + st.Key = keyName + if len(opts) > 1 { + for _, opt := range opts[1:] { + switch opt { + case "omitempty": + st.IsOmitEmpty = true + case "string": + st.IsString = true + } + } + } + return st +} diff --git a/vendor/github.com/goccy/go-json/internal/runtime/type.go b/vendor/github.com/goccy/go-json/internal/runtime/type.go new file mode 100644 index 000000000..0167cd2c0 --- /dev/null +++ b/vendor/github.com/goccy/go-json/internal/runtime/type.go @@ -0,0 +1,100 @@ +package runtime + +import ( + "reflect" + "unsafe" +) + +type SliceHeader struct { + Data unsafe.Pointer + Len int + Cap int +} + +const ( + maxAcceptableTypeAddrRange = 1024 * 1024 * 2 // 2 Mib +) + +type TypeAddr struct { + BaseTypeAddr uintptr + MaxTypeAddr uintptr + AddrRange uintptr + AddrShift uintptr +} + +var ( + typeAddr *TypeAddr + alreadyAnalyzed bool +) + +//go:linkname typelinks reflect.typelinks +func typelinks() ([]unsafe.Pointer, [][]int32) + +//go:linkname rtypeOff reflect.rtypeOff +func rtypeOff(unsafe.Pointer, int32) unsafe.Pointer + +func AnalyzeTypeAddr() *TypeAddr { + defer func() { + alreadyAnalyzed = true + }() + if alreadyAnalyzed { + return typeAddr + } + sections, offsets := typelinks() + if len(sections) != 1 { + return nil + } + if len(offsets) != 1 { + return nil + } + section := sections[0] + offset := offsets[0] + var ( + min uintptr = uintptr(^uint(0)) + max uintptr = 0 + isAligned64 = true + isAligned32 = true + ) + for i := 0; i < len(offset); i++ { + typ := (*Type)(rtypeOff(section, offset[i])) + addr := uintptr(unsafe.Pointer(typ)) + if min > addr { + min = addr + } + if max < addr { + max = addr + } + if typ.Kind() == reflect.Ptr { + addr = uintptr(unsafe.Pointer(typ.Elem())) + if min > addr { + min = addr + } + if max < addr { + max = addr + } + } + isAligned64 = isAligned64 && (addr-min)&63 == 0 + isAligned32 = isAligned32 && (addr-min)&31 == 0 + } + addrRange := max - min + if addrRange == 0 { + return nil + } + var addrShift uintptr + if isAligned64 { + addrShift = 6 + } else if isAligned32 { + addrShift = 5 + } + cacheSize := addrRange >> addrShift + if cacheSize > maxAcceptableTypeAddrRange { + return nil + } + typeAddr = &TypeAddr{ + BaseTypeAddr: min, + MaxTypeAddr: max, + AddrRange: addrRange, + AddrShift: addrShift, + } + return typeAddr +} diff --git a/vendor/github.com/goccy/go-json/json.go b/vendor/github.com/goccy/go-json/json.go new file mode 100644 index 000000000..413cb20bf --- /dev/null +++ b/vendor/github.com/goccy/go-json/json.go @@ -0,0 +1,371 @@ +package json + +import ( + "bytes" + "context" + "encoding/json" + + "github.com/goccy/go-json/internal/encoder" +) + +// Marshaler is the interface implemented by types that +// can marshal themselves into valid JSON. +type Marshaler interface { + MarshalJSON() ([]byte, error) +} + +// MarshalerContext is the interface implemented by types that +// can marshal themselves into valid JSON with context.Context. +type MarshalerContext interface { + MarshalJSON(context.Context) ([]byte, error) +} + +// Unmarshaler is the interface implemented by types +// that can unmarshal a JSON description of themselves. +// The input can be assumed to be a valid encoding of +// a JSON value. UnmarshalJSON must copy the JSON data +// if it wishes to retain the data after returning. +// +// By convention, to approximate the behavior of Unmarshal itself, +// Unmarshalers implement UnmarshalJSON([]byte("null")) as a no-op. +type Unmarshaler interface { + UnmarshalJSON([]byte) error +} + +// UnmarshalerContext is the interface implemented by types +// that can unmarshal with context.Context a JSON description of themselves. +type UnmarshalerContext interface { + UnmarshalJSON(context.Context, []byte) error +} + +// Marshal returns the JSON encoding of v. +// +// Marshal traverses the value v recursively. +// If an encountered value implements the Marshaler interface +// and is not a nil pointer, Marshal calls its MarshalJSON method +// to produce JSON. If no MarshalJSON method is present but the +// value implements encoding.TextMarshaler instead, Marshal calls +// its MarshalText method and encodes the result as a JSON string. +// The nil pointer exception is not strictly necessary +// but mimics a similar, necessary exception in the behavior of +// UnmarshalJSON. +// +// Otherwise, Marshal uses the following type-dependent default encodings: +// +// Boolean values encode as JSON booleans. +// +// Floating point, integer, and Number values encode as JSON numbers. +// +// String values encode as JSON strings coerced to valid UTF-8, +// replacing invalid bytes with the Unicode replacement rune. +// The angle brackets "<" and ">" are escaped to "\u003c" and "\u003e" +// to keep some browsers from misinterpreting JSON output as HTML. +// Ampersand "&" is also escaped to "\u0026" for the same reason. +// This escaping can be disabled using an Encoder that had SetEscapeHTML(false) +// called on it. +// +// Array and slice values encode as JSON arrays, except that +// []byte encodes as a base64-encoded string, and a nil slice +// encodes as the null JSON value. +// +// Struct values encode as JSON objects. +// Each exported struct field becomes a member of the object, using the +// field name as the object key, unless the field is omitted for one of the +// reasons given below. +// +// The encoding of each struct field can be customized by the format string +// stored under the "json" key in the struct field's tag. +// The format string gives the name of the field, possibly followed by a +// comma-separated list of options. The name may be empty in order to +// specify options without overriding the default field name. +// +// The "omitempty" option specifies that the field should be omitted +// from the encoding if the field has an empty value, defined as +// false, 0, a nil pointer, a nil interface value, and any empty array, +// slice, map, or string. +// +// As a special case, if the field tag is "-", the field is always omitted. +// Note that a field with name "-" can still be generated using the tag "-,". +// +// Examples of struct field tags and their meanings: +// +// // Field appears in JSON as key "myName". +// Field int `json:"myName"` +// +// // Field appears in JSON as key "myName" and +// // the field is omitted from the object if its value is empty, +// // as defined above. +// Field int `json:"myName,omitempty"` +// +// // Field appears in JSON as key "Field" (the default), but +// // the field is skipped if empty. +// // Note the leading comma. +// Field int `json:",omitempty"` +// +// // Field is ignored by this package. +// Field int `json:"-"` +// +// // Field appears in JSON as key "-". +// Field int `json:"-,"` +// +// The "string" option signals that a field is stored as JSON inside a +// JSON-encoded string. It applies only to fields of string, floating point, +// integer, or boolean types. This extra level of encoding is sometimes used +// when communicating with JavaScript programs: +// +// Int64String int64 `json:",string"` +// +// The key name will be used if it's a non-empty string consisting of +// only Unicode letters, digits, and ASCII punctuation except quotation +// marks, backslash, and comma. +// +// Anonymous struct fields are usually marshaled as if their inner exported fields +// were fields in the outer struct, subject to the usual Go visibility rules amended +// as described in the next paragraph. +// An anonymous struct field with a name given in its JSON tag is treated as +// having that name, rather than being anonymous. +// An anonymous struct field of interface type is treated the same as having +// that type as its name, rather than being anonymous. +// +// The Go visibility rules for struct fields are amended for JSON when +// deciding which field to marshal or unmarshal. If there are +// multiple fields at the same level, and that level is the least +// nested (and would therefore be the nesting level selected by the +// usual Go rules), the following extra rules apply: +// +// 1) Of those fields, if any are JSON-tagged, only tagged fields are considered, +// even if there are multiple untagged fields that would otherwise conflict. +// +// 2) If there is exactly one field (tagged or not according to the first rule), that is selected. +// +// 3) Otherwise there are multiple fields, and all are ignored; no error occurs. +// +// Handling of anonymous struct fields is new in Go 1.1. +// Prior to Go 1.1, anonymous struct fields were ignored. To force ignoring of +// an anonymous struct field in both current and earlier versions, give the field +// a JSON tag of "-". +// +// Map values encode as JSON objects. The map's key type must either be a +// string, an integer type, or implement encoding.TextMarshaler. The map keys +// are sorted and used as JSON object keys by applying the following rules, +// subject to the UTF-8 coercion described for string values above: +// - string keys are used directly +// - encoding.TextMarshalers are marshaled +// - integer keys are converted to strings +// +// Pointer values encode as the value pointed to. +// A nil pointer encodes as the null JSON value. +// +// Interface values encode as the value contained in the interface. +// A nil interface value encodes as the null JSON value. +// +// Channel, complex, and function values cannot be encoded in JSON. +// Attempting to encode such a value causes Marshal to return +// an UnsupportedTypeError. +// +// JSON cannot represent cyclic data structures and Marshal does not +// handle them. Passing cyclic structures to Marshal will result in +// an infinite recursion. +// +func Marshal(v interface{}) ([]byte, error) { + return MarshalWithOption(v) +} + +// MarshalNoEscape returns the JSON encoding of v and doesn't escape v. +func MarshalNoEscape(v interface{}) ([]byte, error) { + return marshalNoEscape(v) +} + +// MarshalContext returns the JSON encoding of v with context.Context and EncodeOption. +func MarshalContext(ctx context.Context, v interface{}, optFuncs ...EncodeOptionFunc) ([]byte, error) { + return marshalContext(ctx, v, optFuncs...) +} + +// MarshalWithOption returns the JSON encoding of v with EncodeOption. +func MarshalWithOption(v interface{}, optFuncs ...EncodeOptionFunc) ([]byte, error) { + return marshal(v, optFuncs...) +} + +// MarshalIndent is like Marshal but applies Indent to format the output. +// Each JSON element in the output will begin on a new line beginning with prefix +// followed by one or more copies of indent according to the indentation nesting. +func MarshalIndent(v interface{}, prefix, indent string) ([]byte, error) { + return MarshalIndentWithOption(v, prefix, indent) +} + +// MarshalIndentWithOption is like Marshal but applies Indent to format the output with EncodeOption. +func MarshalIndentWithOption(v interface{}, prefix, indent string, optFuncs ...EncodeOptionFunc) ([]byte, error) { + return marshalIndent(v, prefix, indent, optFuncs...) +} + +// Unmarshal parses the JSON-encoded data and stores the result +// in the value pointed to by v. If v is nil or not a pointer, +// Unmarshal returns an InvalidUnmarshalError. +// +// Unmarshal uses the inverse of the encodings that +// Marshal uses, allocating maps, slices, and pointers as necessary, +// with the following additional rules: +// +// To unmarshal JSON into a pointer, Unmarshal first handles the case of +// the JSON being the JSON literal null. In that case, Unmarshal sets +// the pointer to nil. Otherwise, Unmarshal unmarshals the JSON into +// the value pointed at by the pointer. If the pointer is nil, Unmarshal +// allocates a new value for it to point to. +// +// To unmarshal JSON into a value implementing the Unmarshaler interface, +// Unmarshal calls that value's UnmarshalJSON method, including +// when the input is a JSON null. +// Otherwise, if the value implements encoding.TextUnmarshaler +// and the input is a JSON quoted string, Unmarshal calls that value's +// UnmarshalText method with the unquoted form of the string. +// +// To unmarshal JSON into a struct, Unmarshal matches incoming object +// keys to the keys used by Marshal (either the struct field name or its tag), +// preferring an exact match but also accepting a case-insensitive match. By +// default, object keys which don't have a corresponding struct field are +// ignored (see Decoder.DisallowUnknownFields for an alternative). +// +// To unmarshal JSON into an interface value, +// Unmarshal stores one of these in the interface value: +// +// bool, for JSON booleans +// float64, for JSON numbers +// string, for JSON strings +// []interface{}, for JSON arrays +// map[string]interface{}, for JSON objects +// nil for JSON null +// +// To unmarshal a JSON array into a slice, Unmarshal resets the slice length +// to zero and then appends each element to the slice. +// As a special case, to unmarshal an empty JSON array into a slice, +// Unmarshal replaces the slice with a new empty slice. +// +// To unmarshal a JSON array into a Go array, Unmarshal decodes +// JSON array elements into corresponding Go array elements. +// If the Go array is smaller than the JSON array, +// the additional JSON array elements are discarded. +// If the JSON array is smaller than the Go array, +// the additional Go array elements are set to zero values. +// +// To unmarshal a JSON object into a map, Unmarshal first establishes a map to +// use. If the map is nil, Unmarshal allocates a new map. Otherwise Unmarshal +// reuses the existing map, keeping existing entries. Unmarshal then stores +// key-value pairs from the JSON object into the map. The map's key type must +// either be any string type, an integer, implement json.Unmarshaler, or +// implement encoding.TextUnmarshaler. +// +// If a JSON value is not appropriate for a given target type, +// or if a JSON number overflows the target type, Unmarshal +// skips that field and completes the unmarshaling as best it can. +// If no more serious errors are encountered, Unmarshal returns +// an UnmarshalTypeError describing the earliest such error. In any +// case, it's not guaranteed that all the remaining fields following +// the problematic one will be unmarshaled into the target object. +// +// The JSON null value unmarshals into an interface, map, pointer, or slice +// by setting that Go value to nil. Because null is often used in JSON to mean +// ``not present,'' unmarshaling a JSON null into any other Go type has no effect +// on the value and produces no error. +// +// When unmarshaling quoted strings, invalid UTF-8 or +// invalid UTF-16 surrogate pairs are not treated as an error. +// Instead, they are replaced by the Unicode replacement +// character U+FFFD. +// +func Unmarshal(data []byte, v interface{}) error { + return unmarshal(data, v) +} + +// UnmarshalContext parses the JSON-encoded data and stores the result +// in the value pointed to by v. If you implement the UnmarshalerContext interface, +// call it with ctx as an argument. +func UnmarshalContext(ctx context.Context, data []byte, v interface{}, optFuncs ...DecodeOptionFunc) error { + return unmarshalContext(ctx, data, v) +} + +func UnmarshalWithOption(data []byte, v interface{}, optFuncs ...DecodeOptionFunc) error { + return unmarshal(data, v, optFuncs...) +} + +func UnmarshalNoEscape(data []byte, v interface{}, optFuncs ...DecodeOptionFunc) error { + return unmarshalNoEscape(data, v, optFuncs...) +} + +// A Token holds a value of one of these types: +// +// Delim, for the four JSON delimiters [ ] { } +// bool, for JSON booleans +// float64, for JSON numbers +// Number, for JSON numbers +// string, for JSON string literals +// nil, for JSON null +// +type Token = json.Token + +// A Number represents a JSON number literal. +type Number = json.Number + +// RawMessage is a raw encoded JSON value. +// It implements Marshaler and Unmarshaler and can +// be used to delay JSON decoding or precompute a JSON encoding. +type RawMessage = json.RawMessage + +// A Delim is a JSON array or object delimiter, one of [ ] { or }. +type Delim = json.Delim + +// Compact appends to dst the JSON-encoded src with +// insignificant space characters elided. +func Compact(dst *bytes.Buffer, src []byte) error { + return encoder.Compact(dst, src, false) +} + +// Indent appends to dst an indented form of the JSON-encoded src. +// Each element in a JSON object or array begins on a new, +// indented line beginning with prefix followed by one or more +// copies of indent according to the indentation nesting. +// The data appended to dst does not begin with the prefix nor +// any indentation, to make it easier to embed inside other formatted JSON data. +// Although leading space characters (space, tab, carriage return, newline) +// at the beginning of src are dropped, trailing space characters +// at the end of src are preserved and copied to dst. +// For example, if src has no trailing spaces, neither will dst; +// if src ends in a trailing newline, so will dst. +func Indent(dst *bytes.Buffer, src []byte, prefix, indent string) error { + return encoder.Indent(dst, src, prefix, indent) +} + +// HTMLEscape appends to dst the JSON-encoded src with <, >, &, U+2028 and U+2029 +// characters inside string literals changed to \u003c, \u003e, \u0026, \u2028, \u2029 +// so that the JSON will be safe to embed inside HTML